Upgrade dependencies (#1007)

- Upgrade Gradle to 8.13
- Upgrade SLF4J to 2.0.17
- Upgrade Mockito to 5.16.1
- Upgrade AssertJ to 3.27.3
- Upgrade Logback to 1.5.18
- Upgrade Testcontainers to 1.20.6

Signed-off-by: Dmitry Sulman <dmitry.sulman@gmail.com>

.gitattributes

@@ -1 +1,2 @@
 *.bat text eol=crlf
+src/itest/docker-image/** eol=lf

.github/workflows/gradle.yml

@@ -6,48 +6,37 @@ name: Build SSHJ
 
 on:
   push:
-    branches: [ master ]
   pull_request:
     branches: [ master ]
 
 jobs:
   java12:
-    name: Build with Java 12
+    name: Build with Java 11
     runs-on: ubuntu-latest
     steps:
-    - uses: actions/checkout@v2
-    - name: Set up JDK 12
-      uses: actions/setup-java@v1
+    - uses: actions/checkout@v4
+    - name: Set up Java 11
+      uses: actions/setup-java@v4
       with:
-        java-version: 12
+        distribution: 'temurin'
+        java-version: 11
     - name: Grant execute permission for gradlew
       run: chmod +x gradlew
     - name: Build with Gradle
       run: ./gradlew check
-  # java10:
-  #   name: Build with Java 10
-  #   runs-on: ubuntu-latest
-  #   steps:
-  #   - uses: actions/checkout@v2
-  #   - name: Set up JDK 10
-  #     uses: actions/setup-java@v1
-  #     with:
-  #       java-version: 10
-  #   - name: Grant execute permission for gradlew
-  #     run: chmod +x gradlew
-  #   - name: Build with Gradle
-  #     run: ./gradlew check -xanimalsnifferMain -xanimalsnifferTest
+    - name: Codecov
+      uses: codecov/codecov-action@v2
 
   integration:
     name: Integration test
-    needs: [java12]
-    runs-on: [ubuntu-latest]
+    runs-on: ubuntu-latest
     steps:
-      - uses: actions/checkout@v2
+      - uses: actions/checkout@v4
       - run: git fetch --depth=1 origin +refs/tags/*:refs/tags/*
-      - uses: actions/setup-java@v1
+      - uses: actions/setup-java@v4
         with:
-          java-version: 12
+          distribution: 'temurin'
+          java-version: 11
       - name: Grant execute permission for gradlew
         run: chmod +x gradlew
       - name: Build with Gradle

.github/workflows/release.yml

@@ -0,0 +1,49 @@
+name: SSHJ Release
+
+on:
+  push:
+    tags:
+      - '*'
+
+permissions:
+  contents: write
+
+jobs:
+  java12:
+    name: Build with Java 12
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+      - name: Set up JDK 12
+        uses: actions/setup-java@v4
+        with:
+          distribution: 'zulu'
+          java-version: 12
+      - name: Grant execute permission for gradlew
+        run: chmod +x gradlew
+      - name: Build with Gradle
+        run: ./gradlew check
+  release:
+    name: Release
+    needs: [java12]
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          fetch-depth: 0
+      - uses: actions/setup-java@v4
+        with:
+          distribution: 'zulu'
+          java-version: 12
+      - name: Grant execute permission for gradlew
+        run: chmod +x gradlew
+      - name: Release
+        run: ./gradlew clean publishToSonatype closeAndReleaseSonatypeStagingRepository
+        env:
+          ORG_GRADLE_PROJECT_signingKey: ${{ secrets.SIGNINGKEY }}
+          ORG_GRADLE_PROJECT_signingKeyId: ${{ secrets.SIGNINGKEYID }}
+          ORG_GRADLE_PROJECT_signingPassword: ${{ secrets.SIGNINGPASSWORD }}
+          ORG_GRADLE_PROJECT_sonatypeUsername: ${{ secrets.OSSRH_USERNAME }}
+          ORG_GRADLE_PROJECT_sonatypePassword: ${{ secrets.OSSRH_PASSWORD }}

.vscode/settings.json

@@ -2,5 +2,6 @@
     "java.checkstyle.configuration": "${workspaceFolder}/gradle/config/checkstyle/checkstyle.xml",
     "files.watcherExclude": {
         "**/target": true
-    }
+    },
+    "java.configuration.updateBuildConfiguration": "automatic"
 }

README.adoc

@@ -1,16 +1,17 @@
 = sshj - SSHv2 library for Java
 Jeroen van Erp
 :sshj_groupid: com.hierynomus
-:sshj_version: 0.31.0
+:sshj_version: 0.38.0
 :source-highlighter: pygments
 
-image:https://api.bintray.com/packages/hierynomus/maven/sshj/images/download.svg[link="https://bintray.com/hierynomus/maven/sshj/_latestVersion"]
-image:https://travis-ci.org/hierynomus/sshj.svg?branch=master[link="https://travis-ci.org/hierynomus/sshj"]
-image:https://api.codacy.com/project/badge/Grade/14a0a316bb9149739b5ea26dbfa8da8a["Codacy code quality", link="https://www.codacy.com/app/jeroen_2/sshj?utm_source=github.com&utm_medium=referral&utm_content=hierynomus/sshj&utm_campaign=Badge_Grade"]
+image:https://github.com/hierynomus/sshj/actions/workflows/gradle.yml/badge.svg[link="https://github.com/hierynomus/sshj/actions/workflows/gradle.yml"]
+image:https://app.codacy.com/project/badge/Grade/2c8a5a67c6a54ed89c9a699fd6b27305["Codacy Grade", link="https://app.codacy.com/gh/hierynomus/sshj"]
 image:https://codecov.io/gh/hierynomus/sshj/branch/master/graph/badge.svg["codecov", link="https://codecov.io/gh/hierynomus/sshj"]
 image:http://www.javadoc.io/badge/com.hierynomus/sshj.svg?color=blue["JavaDocs", link="http://www.javadoc.io/doc/com.hierynomus/sshj"]
 image:https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj/badge.svg["Maven Central",link="https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj"]
 
+WARNING: SSHJ versions up to and including 0.37.0 are vulnerable to https://nvd.nist.gov/vuln/detail/CVE-2023-48795[CVE-2023-48795 - Terrapin]. Please upgrade to 0.38.0 or higher.
+
 To get started, have a look at one of the examples. Hopefully you will find the API pleasant to work with :)
 
 == Getting SSHJ
@@ -47,7 +48,7 @@ If your project is built using another build tool that uses the Maven Central re
 In the `examples` directory, there is a separate Maven project that shows how the library can be used in some sample cases. If you want to run them, follow these guidelines:
 
 . Install http://maven.apache.org/[Maven 2.2.1] or up.
-. Clone the Overthere repository.
+. Clone the SSHJ repository.
 . Go into the `examples` directory and run the command `mvn eclipse:eclipse`.
 . Import the `examples` project into Eclipse.
 . Change the login details in the example classes (address, username and password) and run them!
@@ -64,7 +65,7 @@ In the `examples` directory, there is a separate Maven project that shows how th
 Implementations / adapters for the following algorithms are included:
 
 ciphers::
-  `aes{128,192,256}-{cbc,ctr}`, `aes{128,256}-gcm@openssh.com`, `blowfish-{cbc,ctr}`, `3des-{cbc,ctr}`, `twofish{128,192,256}-{cbc,ctr}`, `twofish-cbc`, `serpent{128,192,256}-{cbc,ctr}`, `idea-{cbc,ctr}`, `cast128-{cbc,ctr}`, `arcfour`, `arcfour{128,256}`
+  `aes{128,192,256}-{cbc,ctr}`, `aes{128,256}-gcm@openssh.com`, `blowfish-{cbc,ctr}`, `chacha20-poly1305@openssh.com`, `3des-{cbc,ctr}`, `twofish{128,192,256}-{cbc,ctr}`, `twofish-cbc`, `serpent{128,192,256}-{cbc,ctr}`, `idea-{cbc,ctr}`, `cast128-{cbc,ctr}`, `arcfour`, `arcfour{128,256}`
   SSHJ also supports the following extended (non official) ciphers: `camellia{128,192,256}-{cbc,ctr}`, `camellia{128,192,256}-{cbc,ctr}@openssh.org`
 
 key exchange::
@@ -96,7 +97,11 @@ If you need something that is not included, it shouldn't be too hard to add (do
 http://ssh-comparison.quendi.de/comparison.html[SSH Implementation Comparison]
 
 == Dependencies
-Java 6+. http://www.slf4j.org/download.html[slf4j] is required. http://www.bouncycastle.org/java.html[bouncycastle] is highly recommended and required for using some of the crypto algorithms. http://www.jcraft.com/jzlib/[jzlib] is required for using zlib compression.
+
+- Java 8 or higher
+- https://www.slf4j.org/[SLF4J 2.0.0]
+- https://www.bouncycastle.org[Bouncy Castle]
+
 
 == Reporting bugs
 Issue tracker: https://github.com/hierynomus/sshj/issues
@@ -105,6 +110,73 @@ Issue tracker: https://github.com/hierynomus/sshj/issues
 Fork away!
 
 == Release history
+SSHJ 0.38.0 (2024-01-02)::
+* Mitigated CVE-2023-48795 - Terrapin
+  * Merged https://github.com/hierynomus/sshj/pull/917[#917]: Implement OpenSSH strict key exchange extension
+* Merged https://github.com/hierynomus/sshj/pull/903[#903]: Fix for writing known hosts key string
+* Merged https://github.com/hierynomus/sshj/pull/913[#913]: Prevent remote port forwarding buffers to grow without bounds
+* Moved tests to JUnit5
+* Merged https://github.com/hierynomus/sshj/pull/827[#827]: Fallback to posix-rename@openssh.com extension if available
+* Merged https://github.com/hierynomus/sshj/pull/904[#904]: Add ChaCha20-Poly1305 support for OpenSSH keys
+SSHJ 0.37.0 (2023-10-11)::
+* Merged https://github.com/hierynomus/sshj/pull/899[#899]: Add support for AES-GCM OpenSSH private keys
+* Merged https://github.com/hierynomus/sshj/pull/901[#901]: Fix ZLib compression bug
+* Merged https://github.com/hierynomus/sshj/pull/898[#898]: Improved malformed file handling for OpenSSH private keys
+SSHJ 0.36.0 (2023-09-04)::
+* Rewrote Integration tests to JUnit5
+* Merged https://github.com/hierynomus/sshj/pull/851[#851]: Fix race condition in key exchange causing intermittent SSH_MSG_UNIMPLEMENTED
+* Merged https://github.com/hierynomus/sshj/pull/861[#861]: Add DefaultSecurityProviderConfig with has BouncyCastle disabled
+* Merged https://github.com/hierynomus/sshj/pull/881[#881]: Rewrote test classes to JUnit Jupiter engine
+* Merged https://github.com/hierynomus/sshj/pull/880[#880]: Removed Java 7 backport Socket utilities
+* Merged https://github.com/hierynomus/sshj/pull/879[#879]: Replaced custom Base64 with java.util.Base64
+* Merged https://github.com/hierynomus/sshj/pull/852[#852]: Removed unused bcrypt password hashing methods
+* Merged https://github.com/hierynomus/sshj/pull/874[#874]: Java 8 minimum version + dependency upgrades
+* Merged https://github.com/hierynomus/sshj/pull/876[#876]: Change `newStatefulSFTPClient` to return `StatefulSFTPClient`
+* Merged https://github.com/hierynomus/sshj/pull/860[#860]: Upgrade to Gradle 7.6.1
+* Merged https://github.com/hierynomus/sshj/pull/838[#838]: Replaced Curve25519 class with X25519 Key agreement
+* Merged https://github.com/hierynomus/sshj/pull/772[#772]: Remove dependency on jzlib
+SSHJ 0.35.0 (2023-01-30)::
+* Merged https://github.com/hierynomus/sshj/pull/835[#835]: TimeoutException message improved
+* Merged https://github.com/hierynomus/sshj/pull/815[#815]: Support authPassword on FreeBSD
+* Merged https://github.com/hierynomus/sshj/pull/813[#813]: Prevent `CHANNEL_CLOSE` between isOpen and write call.
+* Merged https://github.com/hierynomus/sshj/pull/811[#811]: Add `Transport.isKeyExchangeREquired` to prevent unnecessary KEXINIT
+SSHJ 0.34.0 (2022-08-10)::
+* Merged https://github.com/hierynomus/sshj/pull/743[#743]: Use default client credentials for AuthGssApiWithMic
+* Merged https://github.com/hierynomus/sshj/pull/801[#801]: Restore thread interrupt status after catching InterruptedException
+* Merged https://github.com/hierynomus/sshj/pull/793[#793]: Merge PKCS5 and PKCS8 classes
+* Upgraded dependencies SLF4J (1.7.36) and Logback (1.2.11)
+* Merged https://github.com/hierynomus/sshj/pull/791[#791]: Update KeepAlive examples
+* Merged https://github.com/hierynomus/sshj/pull/775[#775]: Add SFTP resume support
+SSHJ 0.33.0 (2022-04-22)::
+* Upgraded dependencies BouncyCastle (1.70)
+* Merged https://github.com/hierynomus/sshj/pull/687[#687]: Correctly close connection when remote closes connection.
+* Merged https://github.com/hierynomus/sshj/pull/741[#741]: Add support for testcontainers in test setup to test more scenarios
+* Merged https://github.com/hierynomus/sshj/pull/733[#733]: Send correct key proposal if client knows CA key
+* Merged https://github.com/hierynomus/sshj/pull/746[#746]: Fix bug in reading Putty private key file with passphrase
+* Merged https://github.com/hierynomus/sshj/pull/742[#742]: Use Config.keyAlgorithms to determine rsa-sha2 support
+* Merged https://github.com/hierynomus/sshj/pull/754[#754]: Use SFTP protocol version to set FXP rename flags conditionally
+* Merged https://github.com/hierynomus/sshj/pull/752[#752]: Correctly start and terminate KeepAlive thread
+* Merged https://github.com/hierynomus/sshj/pull/753[#753]: Provide better thread names
+* Merged https://github.com/hierynomus/sshj/pull/724[#724]: Add parameter to limit read ahead length
+* Merged https://github.com/hierynomus/sshj/pull/763[#763]: Try all public key algorithms for a specific key type
+* Merged https://github.com/hierynomus/sshj/pull/756[#756]: Remove deprecated proxy connect methods
+* Merged https://github.com/hierynomus/sshj/pull/770[#770]: Add support for `ed25519` `aes-128-cbc` keys
+* Merged https://github.com/hierynomus/sshj/pull/773[#773]: Fix NPE when reading empty OpenSSHKeyV1KeyFile
+* Merged https://github.com/hierynomus/sshj/pull/777[#777]: Don't request too many read-ahead packets
+
+SSHJ 0.32.0 (2021-10-12)::
+* Send EOF on channel close (Fixes https://github.com/hierynomus/sshj/issues/143[#143], https://github.com/hierynomus/sshj/issues/496[#496], https://github.com/hierynomus/sshj/issues/553[#553], https://github.com/hierynomus/sshj/issues/554[#554])
+* Merged https://github.com/hierynomus/sshj/pull/726[#726]: Parse OpenSSH v1 keys with full CRT information present
+* Merged https://github.com/hierynomus/sshj/pull/721[#721]: Prefer known host key algorithm for host key verification
+* Merged https://github.com/hierynomus/sshj/pull/716[#716], https://github.com/hierynomus/sshj/pull/729[#729] and https://github.com/hierynomus/sshj/pull/730[#730]: Add full support for PuTTY v3 key files.
+* Merged https://github.com/hierynomus/sshj/pull/708[#708] and https://github.com/hierynomus/sshj/pull/713[#71]: Add support for PKCS#8 private keys
+* Merged https://github.com/hierynomus/sshj/pull/703[#703]: Support host certificate keys
+* Upgraded dependencies BouncyCastle (1.69), SLF4j (1.7.32), Logback (1.2.6), asn-one (0.6.0)
+* Merged https://github.com/hierynomus/sshj/pull/702[#702]: Support Public key authentication using certificates
+* Merged https://github.com/hierynomus/sshj/pull/691[#691]: Fix for writing negative unsigned integers to Buffer
+* Merged https://github.com/hierynomus/sshj/pull/682[#682]: Support for chacha20-poly1305@openssh.com cipher
+* Merged https://github.com/hierynomus/sshj/pull/680[#680]: Configurable preserve mtimes for SCP transfers
+
 SSHJ 0.31.0 (2021-02-08)::
 * Bump dependencies (asn-one 0.5.0, BouncyCastle 1.68, slf4j-api 1.7.30)
 * Merged https://github.com/hierynomus/sshj/pull/660[#660]: Support ED25519 and ECDSA keys in PuTTY format

build-publishing.gradle

@@ -23,7 +23,6 @@ dependencies {
   compile "org.slf4j:slf4j-api:1.7.7"
   compile "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
   compile "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
-  compile "com.jcraft:jzlib:1.1.3"
 
   testCompile "junit:junit:4.11"
   testCompile "org.mockito:mockito-core:1.9.5"

build.gradle

@@ -1,23 +1,31 @@
-import java.text.SimpleDateFormat
-import com.bmuschko.gradle.docker.tasks.container.*
-import com.bmuschko.gradle.docker.tasks.image.*
-
 plugins {
   id "java"
+  id "jvm-test-suite"
   id "groovy"
   id "jacoco"
-  id "com.github.blindpirate.osgi" version '0.0.3'
+  id "com.github.blindpirate.osgi" version '0.0.6'
   id "maven-publish"
-  id 'pl.allegro.tech.build.axion-release' version '1.11.0'
-  id "com.bmuschko.docker-remote-api" version "6.4.0"
-  id "com.github.hierynomus.license" version "0.12.1"
-  id "com.jfrog.bintray" version "1.8.5"
-  id 'ru.vyarus.java-lib' version '1.0.5'
-  // id 'ru.vyarus.pom' version '1.0.3'
-  id 'ru.vyarus.github-info' version '1.1.0'
+  id "signing"
+  id 'pl.allegro.tech.build.axion-release' version '1.15.3'
+  id "com.github.hierynomus.license" version "0.16.1"
+  id "com.bmuschko.docker-remote-api" version "9.2.1"
+  id 'ru.vyarus.github-info' version '2.0.0'
+  id "io.github.gradle-nexus.publish-plugin" version "1.3.0"
 }
 
 group = "com.hierynomus"
+ext.moduleName = "${project.group}.${project.name}"
+
+defaultTasks "build"
+
+repositories {
+  mavenCentral()
+}
+
+github {
+    user 'hierynomus'
+    license 'Apache'
+}
 
 scmVersion {
   tag {
@@ -32,36 +40,20 @@ scmVersion {
 
 project.version = scmVersion.version
 
-defaultTasks "build"
-
-repositories {
-  mavenCentral()
+compileJava {
+  options.release = 8
 }
 
-configurations.compile.transitive = false
+configurations.implementation.transitive = false
 
-def bouncycastleVersion = "1.68"
-def sshdVersion = "2.1.0"
+def bouncycastleVersion = "1.80"
+def sshdVersion = "2.14.0"
 
 dependencies {
-  implementation "org.slf4j:slf4j-api:1.7.30"
-  implementation "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
-  implementation "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
-  implementation "com.jcraft:jzlib:1.1.3"
-  implementation "com.hierynomus:asn-one:0.5.0"
-
-  implementation "net.i2p.crypto:eddsa:0.3.0"
-
-  testImplementation "junit:junit:4.12"
-  testImplementation 'org.spockframework:spock-core:1.3-groovy-2.4'
-  testImplementation "org.mockito:mockito-core:2.28.2"
-  testImplementation "org.apache.sshd:sshd-core:$sshdVersion"
-  testImplementation "org.apache.sshd:sshd-sftp:$sshdVersion"
-  testImplementation "org.apache.sshd:sshd-scp:$sshdVersion"
-  testRuntimeOnly "ch.qos.logback:logback-classic:1.2.3"
-  testImplementation 'org.glassfish.grizzly:grizzly-http-server:2.4.4'
-  testImplementation 'org.apache.httpcomponents:httpclient:4.5.9'
-
+  implementation "org.slf4j:slf4j-api:2.0.17"
+  implementation "org.bouncycastle:bcprov-jdk18on:$bouncycastleVersion"
+  implementation "org.bouncycastle:bcpkix-jdk18on:$bouncycastleVersion"
+  implementation "com.hierynomus:asn-one:0.6.0"
 }
 
 license {
@@ -70,7 +62,15 @@ license {
   mapping {
     java = 'SLASHSTAR_STYLE'
   }
-  excludes(['**/djb/Curve25519.java', '**/sshj/common/Base64.java', '**/org/mindrot/jbcrypt/*.java'])
+  excludes([
+    '**/com/hierynomus/sshj/userauth/keyprovider/bcrypt/*.java',
+    '**/files/test_file_*.txt',
+  ])
+}
+
+java {
+	withJavadocJar()
+	withSourcesJar()
 }
 
 if (!JavaVersion.current().isJava9Compatible()) {
@@ -84,11 +84,82 @@ if (JavaVersion.current().isJava8Compatible()) {
   }
 }
 
-
-compileJava {
-  options.compilerArgs.addAll(['--release', '7'])
+testing {
+  suites {
+    configureEach {
+      useJUnitJupiter()
+      dependencies {
+        implementation "org.slf4j:slf4j-api:2.0.16"
+        implementation 'org.spockframework:spock-core:2.3-groovy-3.0'
+        implementation "org.mockito:mockito-core:5.16.1"
+        implementation "org.assertj:assertj-core:3.27.3"
+        implementation "ru.vyarus:spock-junit5:1.2.0"
+        implementation "org.apache.sshd:sshd-core:$sshdVersion"
+        implementation "org.apache.sshd:sshd-sftp:$sshdVersion"
+        implementation "org.apache.sshd:sshd-scp:$sshdVersion"
+        implementation "ch.qos.logback:logback-classic:1.5.18"
+        implementation 'org.glassfish.grizzly:grizzly-http-server:3.0.1'
       }
 
+      targets {
+        all {
+          testTask.configure {
+            testLogging {
+              showStandardStreams = false
+              exceptionFormat = 'full'
+            }
+            include "**/*Test.*"
+            include "**/*Spec.*"
+            afterSuite { descriptor, result ->
+              def indicator = "\u001B[32m✓\u001b[0m"
+              if (result.failedTestCount > 0) {
+                indicator = "\u001B[31m✘\u001b[0m"
+              }
+              logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
+            }
+          }
+        }
+      }
+    }
+
+    test {
+      sources {
+        groovy {
+          srcDirs = ['src/test/groovy']
+        }
+      }
+    }
+
+    integrationTest(JvmTestSuite) {
+      dependencies {
+        implementation project()
+        implementation platform('org.testcontainers:testcontainers-bom:1.20.6')
+        implementation 'org.testcontainers:junit-jupiter'
+      }
+
+      sources {
+        java {
+          srcDirs = ['src/itest/java']
+        }
+
+        resources {
+          srcDirs = ['src/itest/resources']
+        }
+      }
+
+      targets {
+        all {
+          testTask.configure {
+            shouldRunAfter(test)
+          }
+        }
+      }
+    }
+  }
+}
+
+project.tasks.compileGroovy.onlyIf { false }
+
 task writeSshjVersionProperties {
   doLast {
     project.file("${project.buildDir}/resources/main").mkdirs()
@@ -100,15 +171,16 @@ task writeSshjVersionProperties {
 
 jar.dependsOn writeSshjVersionProperties
 jar {
+  inputs.property("moduleName", moduleName)
   manifest {
+    attributes 'Automatic-Module-Name': moduleName
+
     // please see http://bnd.bndtools.org/chapters/390-wrapping.html
     instruction "Bundle-Description", "SSHv2 library for Java"
     instruction "Bundle-License", "http://www.apache.org/licenses/LICENSE-2.0.txt"
     instruction "Import-Package", "!net.schmizz.*"
     instruction "Import-Package", "!com.hierynomus.sshj.*"
     instruction "Import-Package", "javax.crypto*"
-    instruction "Import-Package", "!net.i2p.crypto.eddsa.math"
-    instruction "Import-Package", "net.i2p*"
     instruction "Import-Package", "com.jcraft.jzlib*;version=\"[1.1,2)\";resolution:=optional"
     instruction "Import-Package", "org.slf4j*;version=\"[1.7,5)\""
     instruction "Import-Package", "org.bouncycastle*;resolution:=optional"
@@ -132,163 +204,91 @@ sourcesJar {
   }
 }
 
-configurations {
-  integrationTestImplementation.extendsFrom testImplementation
-  integrationTestRuntimeOnly.extendsFrom testRuntimeOnly
-}
-
-sourceSets {
-  integrationTest {
-    groovy {
-      compileClasspath += sourceSets.main.output + sourceSets.test.output
-      runtimeClasspath += sourceSets.main.output + sourceSets.test.output
-      srcDir file('src/itest/groovy')
-    }
-    resources.srcDir file('src/itest/resources')
-  }
-}
-
-task integrationTest(type: Test) {
-  testClassesDirs = sourceSets.integrationTest.output.classesDirs
-  classpath = sourceSets.integrationTest.runtimeClasspath
-}
-
-tasks.withType(Test) {
-  testLogging {
-    exceptionFormat = 'full'
-  }
-  include "**/*Test.*"
-  include "**/*Spec.*"
-  if (!project.hasProperty("allTests")) {
-    useJUnit {
-      excludeCategories 'com.hierynomus.sshj.test.SlowTests'
-      excludeCategories 'com.hierynomus.sshj.test.KnownFailingTests'
-    }
-  }
-
-  afterSuite { descriptor, result ->
-    if (descriptor.className != null) {
-      def indicator = "\u001B[32m✓\u001b[0m"
-      if (result.failedTestCount > 0) {
-        indicator = "\u001B[31m✘\u001b[0m"
-      }
-      logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
+publishing {
+	publications {
+		maven(MavenPublication) {
+			from(components.java)
 		}
 	}
 }
 
-project.tasks.compileGroovy.onlyIf { false }
+project.signing {
+  required { project.gradle.taskGraph.hasTask("release") }
+	sign publishing.publications.maven
 
-github {
-  user 'hierynomus'
-  license 'Apache'
+  if (project.hasProperty("signingKeyId") || project.hasProperty("signingKey")) {
+		def signingKeyId = project.findProperty("signingKeyId")
+		def signingKey = project.findProperty("signingKey")
+		def signingPassword = project.findProperty("signingPassword")
+		if (signingKeyId) {
+			useInMemoryPgpKeys(signingKeyId, signingKey, signingPassword)
+		} else if (signingKey) {
+			useInMemoryPgpKeys(signingKey, signingPassword)
+		}
+	}
 }
 
-pom {
-  description "SSHv2 library for Java"
-  url "https://github.com/hierynomus/sshj"
-  inceptionYear "2009"
+project.plugins.withType(MavenPublishPlugin).all {
+	PublishingExtension publishing = project.extensions.getByType(PublishingExtension)
+	publishing.publications.withType(MavenPublication).all { mavenPublication ->
+		mavenPublication.pom {
+			name = "${project.name}"
+      description = 'SSHv2 library for Java'
+      inceptionYear = '2009'
+      url = "https://github.com/hierynomus/${project.name}"
+			licenses {
+				license {
+					name = "The Apache License, Version 2.0"
+					url = "https://www.apache.org/licenses/LICENSE-2.0"
+				}
+			}
 			developers {
 				developer {
-      id "hierynomus"
-      name "Jeroen van Erp"
-      email "jeroen@javadude.nl"
-      roles {
-        role "Lead developer"
-      }
+					id = "hierynomus"
+					name = "Jeroen van Erp"
+					email = "jeroen@hierynomus.com"
 				}
 				developer {
-      id "shikhar"
-      name "Shikhar Bhushan"
-      email "shikhar@schmizz.net"
-      url "http://schmizz.net"
-      roles {
-        role "Previous lead developer"
-      }
+					id = "shikhar"
+					name = "Shikhar Bhushan"
+					email = "shikhar@schmizz.net"
+          url = "http://schmizz.net"
+          roles = ["Previous Lead developer"]
 				}
         developer {
-      id "iterate"
-      name "David Kocher"
-      email "dkocher@iterate.ch"
-      organization "iterage GmbH"
-      organizationUrl "https://iterate.ch"
-      roles {
-        role "Developer"
+          id = "iterate"
+          name = "David Kocher"
+          email = "dkocher@iterate.ch"
+          organization = "iterate GmbH"
+          organizationUrl = "https://iterate.ch"
+          roles = ["Developer"]
+        }
+			}
+      scm {
+        url = "https://github.com/hierynomus/${project.name}"
+        connection = "scm:git@github.com:hierynomus/${project.name}.git"
+        developerConnection = "scm:git@github.com:hierynomus/${project.name}.git"
       }
 		}
 	}
 }
 
-if (project.hasProperty("bintrayUsername") && project.hasProperty("bintrayApiKey")) {
-  bintray {
-    user = project.property("bintrayUsername")
-    key = project.property("bintrayApiKey")
-    publish = true
-    publications = ["maven"]
-    pkg {
-      repo = "maven"
-      name = "${project.name}"
-      licenses = ["Apache-2.0"]
-      vcsUrl = "https://github.com/hierynomus/sshj.git"
-      labels = ["ssh", "sftp", "secure-shell", "network", "file-transfer"]
-      githubRepo = "hierynomus/sshj"
-      version {
-        name = "${project.version}"
-        vcsTag = "v${project.version}"
-        released = new SimpleDateFormat('yyyy-MM-dd\'T\'HH:mm:ss.SSSZZ').format(new Date())
-        gpg {
-          sign = true
-          passphrase = project.property("signing.password")
-        }
-        mavenCentralSync {
-          sync = true
-          user = project.property("sonatypeUsername")
-          password = project.property("sonatypePassword")
-          close = 1
-        }
-      }
-    }
+nexusPublishing {
+	repositories {
+		sonatype()    //sonatypeUsername and sonatypePassword properties are used automatically
 	}
+
+	connectTimeout = Duration.ofMinutes(3)
+	clientTimeout = Duration.ofMinutes(3)
 }
 
 jacocoTestReport {
     reports {
-        xml.enabled true
-        html.enabled true
+        xml.required = true
+        html.required = true
     }
 }
 
-
-task buildItestImage(type: DockerBuildImage) {
-    inputDir = file('src/itest/docker-image')
-    images.add('sshj/sshd-itest:latest')
-}
-
-task createItestContainer(type: DockerCreateContainer) {
-    dependsOn buildItestImage
-    targetImageId buildItestImage.getImageId()
-    hostConfig.portBindings = ['2222:22']
-    hostConfig.autoRemove = true
-}
-
-task startItestContainer(type: DockerStartContainer) {
-    dependsOn createItestContainer
-    targetContainerId createItestContainer.getContainerId()
-}
-
-task stopItestContainer(type: DockerStopContainer) {
-    targetContainerId createItestContainer.getContainerId()
-}
-
-task forkedUploadRelease(type: GradleBuild) {
-  buildFile = project.buildFile
-  tasks = ["bintrayUpload"]
-}
-
-project.tasks.integrationTest.dependsOn(startItestContainer)
-project.tasks.integrationTest.finalizedBy(stopItestContainer)
-
 project.tasks.release.dependsOn([project.tasks.integrationTest, project.tasks.build])
-project.tasks.release.finalizedBy(project.tasks.forkedUploadRelease)
 project.tasks.jacocoTestReport.dependsOn(project.tasks.test)
 project.tasks.check.dependsOn(project.tasks.jacocoTestReport)

examples/pom.xml

@@ -24,7 +24,7 @@
     <groupId>com.hierynomus</groupId>
     <artifactId>sshj-examples</artifactId>
     <packaging>jar</packaging>
-    <version>0.19.1</version>
+    <version>0.37.0</version>
 
     <name>sshj-examples</name>
     <description>Examples for SSHv2 library for Java</description>
@@ -55,7 +55,7 @@
         <dependency>
             <groupId>com.hierynomus</groupId>
             <artifactId>sshj</artifactId>
-            <version>0.24.0</version>
+            <version>0.33.0</version>
         </dependency>
     </dependencies>
 

examples/src/main/java/net/schmizz/sshj/examples/InMemoryKnownHosts.java

@@ -18,7 +18,7 @@ public class InMemoryKnownHosts {
     public static void main(String[] args) throws IOException {
         InputStream entry = new ByteArrayInputStream("localhost ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIPmhSBtMctNa4hsZt8QGlsYSE5/gMkjeand69Vj4ir13".getBytes(Charset.defaultCharset()));
         SSHClient ssh = new SSHClient();
-        ssh.addHostKeyVerifier(new InMemoryHostKeyVerifier(entry, Charset.defaultCharset()));
+        ssh.addHostKeyVerifier(new OpenSSHKnownHosts(new InputStreamReader(entry, Charset.defaultCharset())));
         ssh.connect("localhost");
         try {
             ssh.authPublickey(System.getProperty("user.name"));
@@ -28,44 +28,4 @@ public class InMemoryKnownHosts {
         }
     }
 
-    public static class InMemoryHostKeyVerifier implements HostKeyVerifier {
-
-        private final List<OpenSSHKnownHosts.KnownHostEntry> entries = new ArrayList<OpenSSHKnownHosts.KnownHostEntry>();
-
-        public InMemoryHostKeyVerifier(InputStream inputStream, Charset charset) throws IOException {
-            final OpenSSHKnownHosts.EntryFactory entryFactory = new OpenSSHKnownHosts.EntryFactory();
-            BufferedReader reader = new BufferedReader(new InputStreamReader(inputStream, charset));
-            while(reader.ready()) {
-                String line = reader.readLine();
-                try {
-                    OpenSSHKnownHosts.KnownHostEntry entry = entryFactory.parseEntry(line);
-                    if (entry != null) {
-                        entries.add(entry);
-                    }
-                } catch (Exception e) {
-                    //log error
-                }
-            }
-        }
-
-        @Override
-        public boolean verify(String hostname, int port, PublicKey key) {
-            final KeyType type = KeyType.fromKey(key);
-            if (type == KeyType.UNKNOWN) {
-                return false;
-            }
-
-            for (OpenSSHKnownHosts.KnownHostEntry e : entries) {
-                try {
-                    if (e.appliesTo(type, hostname) && e.verify(key)) {
-                        return true;
-                    }
-                } catch (IOException ioe) {
-                    //log error
-                }
-            }
-            return false;
-        }
-    }
-
 }

examples/src/main/java/net/schmizz/sshj/examples/KeepAlive.java

@@ -19,8 +19,9 @@ public class KeepAlive {
         final SSHClient ssh = new SSHClient(defaultConfig);
         try {
             ssh.addHostKeyVerifier(new PromiscuousVerifier());
+            // Set interval to enable keep-alive before connecting
+            ssh.getConnection().getKeepAlive().setKeepAliveInterval(5);
             ssh.connect(args[0]);
-            ssh.getConnection().getKeepAlive().setKeepAliveInterval(5); //every 60sec
             ssh.authPassword(args[1], args[2]);
             Session session = ssh.startSession();
             session.allocateDefaultPTY();

examples/src/main/java/net/schmizz/sshj/examples/LocalPF.java

@@ -2,6 +2,7 @@ package net.schmizz.sshj.examples;
 
 import net.schmizz.sshj.SSHClient;
 import net.schmizz.sshj.connection.channel.direct.LocalPortForwarder;
+import net.schmizz.sshj.connection.channel.direct.Parameters;
 
 import java.io.IOException;
 import java.net.InetSocketAddress;
@@ -28,8 +29,8 @@ public class LocalPF {
             * _We_ listen on localhost:8080 and forward all connections on to server, which then forwards it to
             * google.com:80
             */
-            final LocalPortForwarder.Parameters params
-                    = new LocalPortForwarder.Parameters("0.0.0.0", 8080, "google.com", 80);
+            final Parameters params
+                    = new Parameters("0.0.0.0", 8080, "google.com", 80);
             final ServerSocket ss = new ServerSocket();
             ss.setReuseAddress(true);
             ss.bind(new InetSocketAddress(params.getLocalHost(), params.getLocalPort()));

examples/src/main/java/net/schmizz/sshj/examples/RemotePF.java

@@ -19,6 +19,7 @@ public class RemotePF {
         client.loadKnownHosts();
 
         client.connect("localhost");
+        client.getConnection().getKeepAlive().setKeepAliveInterval(5);
         try {
 
             client.authPublickey(System.getProperty("user.name"));
@@ -33,8 +34,6 @@ public class RemotePF {
                     // what we do with incoming connections that are forwarded to us
                     new SocketForwardingConnectListener(new InetSocketAddress("google.com", 80)));
 
-            client.getTransport().setHeartbeatInterval(30);
-
             // Something to hang on to so that the forwarding stays
             client.getTransport().join();
 

gradle/wrapper/gradle-wrapper.properties

@@ -1,5 +1,7 @@
 distributionBase=GRADLE_USER_HOME
 distributionPath=wrapper/dists
-distributionUrl=https\://services.gradle.org/distributions/gradle-6.4-bin.zip
+distributionUrl=https\://services.gradle.org/distributions/gradle-8.13-bin.zip
+networkTimeout=10000
+validateDistributionUrl=true
 zipStoreBase=GRADLE_USER_HOME
 zipStorePath=wrapper/dists

gradlew

@@ -1,7 +1,7 @@
-#!/usr/bin/env sh
+#!/bin/sh
 
 #
-# Copyright 2015 the original author or authors.
+# Copyright © 2015-2021 the original authors.
 #
 # Licensed under the Apache License, Version 2.0 (the "License");
 # you may not use this file except in compliance with the License.
@@ -15,80 +15,115 @@
 # See the License for the specific language governing permissions and
 # limitations under the License.
 #
+# SPDX-License-Identifier: Apache-2.0
+#
 
 ##############################################################################
-##
-##  Gradle start up script for UN*X
-##
+#
+#   Gradle start up script for POSIX generated by Gradle.
+#
+#   Important for running:
+#
+#   (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
+#       noncompliant, but you have some other compliant shell such as ksh or
+#       bash, then to run this script, type that shell name before the whole
+#       command line, like:
+#
+#           ksh Gradle
+#
+#       Busybox and similar reduced shells will NOT work, because this script
+#       requires all of these POSIX shell features:
+#         * functions;
+#         * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
+#           «${var#prefix}», «${var%suffix}», and «$( cmd )»;
+#         * compound commands having a testable exit status, especially «case»;
+#         * various built-in commands including «command», «set», and «ulimit».
+#
+#   Important for patching:
+#
+#   (2) This script targets any POSIX shell, so it avoids extensions provided
+#       by Bash, Ksh, etc; in particular arrays are avoided.
+#
+#       The "traditional" practice of packing multiple parameters into a
+#       space-separated string is a well documented source of bugs and security
+#       problems, so this is (mostly) avoided, by progressively accumulating
+#       options in "$@", and eventually passing that to Java.
+#
+#       Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
+#       and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
+#       see the in-line comments for details.
+#
+#       There are tweaks for specific operating systems such as AIX, CygWin,
+#       Darwin, MinGW, and NonStop.
+#
+#   (3) This script is generated from the Groovy template
+#       https://github.com/gradle/gradle/blob/HEAD/platforms/jvm/plugins-application/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
+#       within the Gradle project.
+#
+#       You can find Gradle at https://github.com/gradle/gradle/.
+#
 ##############################################################################
 
 # Attempt to set APP_HOME
+
 # Resolve links: $0 may be a link
-PRG="$0"
-# Need this for relative symlinks.
-while [ -h "$PRG" ] ; do
-    ls=`ls -ld "$PRG"`
-    link=`expr "$ls" : '.*-> \(.*\)$'`
-    if expr "$link" : '/.*' > /dev/null; then
-        PRG="$link"
-    else
-        PRG=`dirname "$PRG"`"/$link"
-    fi
+app_path=$0
+
+# Need this for daisy-chained symlinks.
+while
+    APP_HOME=${app_path%"${app_path##*/}"}  # leaves a trailing /; empty if no leading path
+    [ -h "$app_path" ]
+do
+    ls=$( ls -ld "$app_path" )
+    link=${ls#*' -> '}
+    case $link in             #(
+      /*)   app_path=$link ;; #(
+      *)    app_path=$APP_HOME$link ;;
+    esac
 done
-SAVED="`pwd`"
-cd "`dirname \"$PRG\"`/" >/dev/null
-APP_HOME="`pwd -P`"
-cd "$SAVED" >/dev/null
 
-APP_NAME="Gradle"
-APP_BASE_NAME=`basename "$0"`
-
-# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
-DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
+# This is normally unused
+# shellcheck disable=SC2034
+APP_BASE_NAME=${0##*/}
+# Discard cd standard output in case $CDPATH is set (https://github.com/gradle/gradle/issues/25036)
+APP_HOME=$( cd -P "${APP_HOME:-./}" > /dev/null && printf '%s\n' "$PWD" ) || exit
 
 # Use the maximum available, or set MAX_FD != -1 to use that value.
-MAX_FD="maximum"
+MAX_FD=maximum
 
 warn () {
     echo "$*"
-}
+} >&2
 
 die () {
     echo
     echo "$*"
     echo
     exit 1
-}
+} >&2
 
 # OS specific support (must be 'true' or 'false').
 cygwin=false
 msys=false
 darwin=false
 nonstop=false
-case "`uname`" in
-  CYGWIN* )
-    cygwin=true
-    ;;
-  Darwin* )
-    darwin=true
-    ;;
-  MINGW* )
-    msys=true
-    ;;
-  NONSTOP* )
-    nonstop=true
-    ;;
+case "$( uname )" in                #(
+  CYGWIN* )         cygwin=true  ;; #(
+  Darwin* )         darwin=true  ;; #(
+  MSYS* | MINGW* )  msys=true    ;; #(
+  NONSTOP* )        nonstop=true ;;
 esac
 
 CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
 
+
 # Determine the Java command to use to start the JVM.
 if [ -n "$JAVA_HOME" ] ; then
     if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
         # IBM's JDK on AIX uses strange locations for the executables
-        JAVACMD="$JAVA_HOME/jre/sh/java"
+        JAVACMD=$JAVA_HOME/jre/sh/java
     else
-        JAVACMD="$JAVA_HOME/bin/java"
+        JAVACMD=$JAVA_HOME/bin/java
     fi
     if [ ! -x "$JAVACMD" ] ; then
         die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
@@ -97,87 +132,120 @@ Please set the JAVA_HOME variable in your environment to match the
 location of your Java installation."
     fi
 else
-    JAVACMD="java"
-    which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
+    JAVACMD=java
+    if ! command -v java >/dev/null 2>&1
+    then
+        die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
 
 Please set the JAVA_HOME variable in your environment to match the
 location of your Java installation."
     fi
+fi
 
 # Increase the maximum file descriptors if we can.
-if [ "$cygwin" = "false" -a "$darwin" = "false" -a "$nonstop" = "false" ] ; then
-    MAX_FD_LIMIT=`ulimit -H -n`
-    if [ $? -eq 0 ] ; then
-        if [ "$MAX_FD" = "maximum" -o "$MAX_FD" = "max" ] ; then
-            MAX_FD="$MAX_FD_LIMIT"
-        fi
-        ulimit -n $MAX_FD
-        if [ $? -ne 0 ] ; then
-            warn "Could not set maximum file descriptor limit: $MAX_FD"
-        fi
-    else
-        warn "Could not query maximum file descriptor limit: $MAX_FD_LIMIT"
-    fi
-fi
-
-# For Darwin, add options to specify how the application appears in the dock
-if $darwin; then
-    GRADLE_OPTS="$GRADLE_OPTS \"-Xdock:name=$APP_NAME\" \"-Xdock:icon=$APP_HOME/media/gradle.icns\""
-fi
-
-# For Cygwin or MSYS, switch paths to Windows format before running java
-if [ "$cygwin" = "true" -o "$msys" = "true" ] ; then
-    APP_HOME=`cygpath --path --mixed "$APP_HOME"`
-    CLASSPATH=`cygpath --path --mixed "$CLASSPATH"`
-    JAVACMD=`cygpath --unix "$JAVACMD"`
-
-    # We build the pattern for arguments to be converted via cygpath
-    ROOTDIRSRAW=`find -L / -maxdepth 1 -mindepth 1 -type d 2>/dev/null`
-    SEP=""
-    for dir in $ROOTDIRSRAW ; do
-        ROOTDIRS="$ROOTDIRS$SEP$dir"
-        SEP="|"
-    done
-    OURCYGPATTERN="(^($ROOTDIRS))"
-    # Add a user-defined pattern to the cygpath arguments
-    if [ "$GRADLE_CYGPATTERN" != "" ] ; then
-        OURCYGPATTERN="$OURCYGPATTERN|($GRADLE_CYGPATTERN)"
-    fi
-    # Now convert the arguments - kludge to limit ourselves to /bin/sh
-    i=0
-    for arg in "$@" ; do
-        CHECK=`echo "$arg"|egrep -c "$OURCYGPATTERN" -`
-        CHECK2=`echo "$arg"|egrep -c "^-"`                                 ### Determine if an option
-
-        if [ $CHECK -ne 0 ] && [ $CHECK2 -eq 0 ] ; then                    ### Added a condition
-            eval `echo args$i`=`cygpath --path --ignore --mixed "$arg"`
-        else
-            eval `echo args$i`="\"$arg\""
-        fi
-        i=`expr $i + 1`
-    done
-    case $i in
-        0) set -- ;;
-        1) set -- "$args0" ;;
-        2) set -- "$args0" "$args1" ;;
-        3) set -- "$args0" "$args1" "$args2" ;;
-        4) set -- "$args0" "$args1" "$args2" "$args3" ;;
-        5) set -- "$args0" "$args1" "$args2" "$args3" "$args4" ;;
-        6) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" ;;
-        7) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" ;;
-        8) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" ;;
-        9) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" "$args8" ;;
+if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
+    case $MAX_FD in #(
+      max*)
+        # In POSIX sh, ulimit -H is undefined. That's why the result is checked to see if it worked.
+        # shellcheck disable=SC2039,SC3045
+        MAX_FD=$( ulimit -H -n ) ||
+            warn "Could not query maximum file descriptor limit"
+    esac
+    case $MAX_FD in  #(
+      '' | soft) :;; #(
+      *)
+        # In POSIX sh, ulimit -n is undefined. That's why the result is checked to see if it worked.
+        # shellcheck disable=SC2039,SC3045
+        ulimit -n "$MAX_FD" ||
+            warn "Could not set maximum file descriptor limit to $MAX_FD"
     esac
 fi
 
-# Escape application args
-save () {
-    for i do printf %s\\n "$i" | sed "s/'/'\\\\''/g;1s/^/'/;\$s/\$/' \\\\/" ; done
-    echo " "
-}
-APP_ARGS=`save "$@"`
+# Collect all arguments for the java command, stacking in reverse order:
+#   * args from the command line
+#   * the main class name
+#   * -classpath
+#   * -D...appname settings
+#   * --module-path (only if needed)
+#   * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
 
-# Collect all arguments for the java command, following the shell quoting and substitution rules
-eval set -- $DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS "\"-Dorg.gradle.appname=$APP_BASE_NAME\"" -classpath "\"$CLASSPATH\"" org.gradle.wrapper.GradleWrapperMain "$APP_ARGS"
+# For Cygwin or MSYS, switch paths to Windows format before running java
+if "$cygwin" || "$msys" ; then
+    APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
+    CLASSPATH=$( cygpath --path --mixed "$CLASSPATH" )
+
+    JAVACMD=$( cygpath --unix "$JAVACMD" )
+
+    # Now convert the arguments - kludge to limit ourselves to /bin/sh
+    for arg do
+        if
+            case $arg in                                #(
+              -*)   false ;;                            # don't mess with options #(
+              /?*)  t=${arg#/} t=/${t%%/*}              # looks like a POSIX filepath
+                    [ -e "$t" ] ;;                      #(
+              *)    false ;;
+            esac
+        then
+            arg=$( cygpath --path --ignore --mixed "$arg" )
+        fi
+        # Roll the args list around exactly as many times as the number of
+        # args, so each arg winds up back in the position where it started, but
+        # possibly modified.
+        #
+        # NB: a `for` loop captures its iteration list before it begins, so
+        # changing the positional parameters here affects neither the number of
+        # iterations, nor the values presented in `arg`.
+        shift                   # remove old arg
+        set -- "$@" "$arg"      # push replacement arg
+    done
+fi
+
+
+# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
+DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
+
+# Collect all arguments for the java command:
+#   * DEFAULT_JVM_OPTS, JAVA_OPTS, JAVA_OPTS, and optsEnvironmentVar are not allowed to contain shell fragments,
+#     and any embedded shellness will be escaped.
+#   * For example: A user cannot expect ${Hostname} to be expanded, as it is an environment variable and will be
+#     treated as '${Hostname}' itself on the command line.
+
+set -- \
+        "-Dorg.gradle.appname=$APP_BASE_NAME" \
+        -classpath "$CLASSPATH" \
+        org.gradle.wrapper.GradleWrapperMain \
+        "$@"
+
+# Stop when "xargs" is not available.
+if ! command -v xargs >/dev/null 2>&1
+then
+    die "xargs is not available"
+fi
+
+# Use "xargs" to parse quoted args.
+#
+# With -n1 it outputs one arg per line, with the quotes and backslashes removed.
+#
+# In Bash we could simply go:
+#
+#   readarray ARGS < <( xargs -n1 <<<"$var" ) &&
+#   set -- "${ARGS[@]}" "$@"
+#
+# but POSIX shell has neither arrays nor command substitution, so instead we
+# post-process each arg (as a line of input to sed) to backslash-escape any
+# character that might be a shell metacharacter, then use eval to reverse
+# that process (while maintaining the separation between arguments), and wrap
+# the whole thing up as a single "set" statement.
+#
+# This will of course break if any of these variables contains a newline or
+# an unmatched quote.
+#
+
+eval "set -- $(
+        printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
+        xargs -n1 |
+        sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
+        tr '\n' ' '
+    )" '"$@"'
 
 exec "$JAVACMD" "$@"

gradlew.bat

@@ -13,6 +13,8 @@
 @rem See the License for the specific language governing permissions and
 @rem limitations under the License.
 @rem
+@rem SPDX-License-Identifier: Apache-2.0
+@rem
 
 @if "%DEBUG%"=="" @echo off
 @rem ##########################################################################
@@ -26,6 +28,7 @@ if "%OS%"=="Windows_NT" setlocal
 
 set DIRNAME=%~dp0
 if "%DIRNAME%"=="" set DIRNAME=.
+@rem This is normally unused
 set APP_BASE_NAME=%~n0
 set APP_HOME=%DIRNAME%
 
@@ -40,13 +43,13 @@ if defined JAVA_HOME goto findJavaFromJavaHome
 
 set JAVA_EXE=java.exe
 %JAVA_EXE% -version >NUL 2>&1
-if "%ERRORLEVEL%" == "0" goto init
+if %ERRORLEVEL% equ 0 goto execute
 
-echo.
-echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
-echo.
-echo Please set the JAVA_HOME variable in your environment to match the
-echo location of your Java installation.
+echo. 1>&2
+echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. 1>&2
+echo. 1>&2
+echo Please set the JAVA_HOME variable in your environment to match the 1>&2
+echo location of your Java installation. 1>&2
 
 goto fail
 
@@ -54,48 +57,36 @@ goto fail
 set JAVA_HOME=%JAVA_HOME:"=%
 set JAVA_EXE=%JAVA_HOME%/bin/java.exe
 
-if exist "%JAVA_EXE%" goto init
+if exist "%JAVA_EXE%" goto execute
 
-echo.
-echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
-echo.
-echo Please set the JAVA_HOME variable in your environment to match the
-echo location of your Java installation.
+echo. 1>&2
+echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME% 1>&2
+echo. 1>&2
+echo Please set the JAVA_HOME variable in your environment to match the 1>&2
+echo location of your Java installation. 1>&2
 
 goto fail
 
-:init
-@rem Get command-line arguments, handling Windows variants
-
-if not "%OS%" == "Windows_NT" goto win9xME_args
-
-:win9xME_args
-@rem Slurp the command line arguments.
-set CMD_LINE_ARGS=
-set _SKIP=2
-
-:win9xME_args_slurp
-if "x%~1" == "x" goto execute
-
-set CMD_LINE_ARGS=%*
-
 :execute
 @rem Setup the command line
 
 set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
 
+
 @rem Execute Gradle
-"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %CMD_LINE_ARGS%
+"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %*
 
 :end
 @rem End local scope for the variables with windows NT shell
-if "%ERRORLEVEL%"=="0" goto mainEnd
+if %ERRORLEVEL% equ 0 goto mainEnd
 
 :fail
 rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of
 rem the _cmd.exe /c_ return code!
-if  not "" == "%GRADLE_EXIT_CONSOLE%" exit 1
-exit /b 1
+set EXIT_CODE=%ERRORLEVEL%
+if %EXIT_CODE% equ 0 set EXIT_CODE=1
+if not ""=="%GRADLE_EXIT_CONSOLE%" exit %EXIT_CODE%
+exit /b %EXIT_CODE%
 
 :mainEnd
 if "%OS%"=="Windows_NT" endlocal

src/itest/docker-image/Dockerfile

@@ -1,24 +0,0 @@
-FROM sickp/alpine-sshd:7.5-r2
-
-ADD authorized_keys /home/sshj/.ssh/authorized_keys
-
-ADD test-container/ssh_host_ecdsa_key     /etc/ssh/ssh_host_ecdsa_key
-ADD test-container/ssh_host_ecdsa_key.pub /etc/ssh/ssh_host_ecdsa_key.pub
-ADD test-container/ssh_host_ed25519_key   /etc/ssh/ssh_host_ed25519_key
-ADD test-container/ssh_host_ed25519_key.pub   /etc/ssh/ssh_host_ed25519_key.pub
-ADD test-container/sshd_config /etc/ssh/sshd_config
-ADD test-container/users_rsa_ca.pub /etc/ssh/users_rsa_ca.pub
-
-RUN apk add --no-cache tini
-RUN \
-  echo "root:smile" | chpasswd && \
-  adduser -D -s /bin/ash sshj && \
-  passwd -u sshj && \
-  chmod 600 /home/sshj/.ssh/authorized_keys && \
-  chmod 600 /etc/ssh/ssh_host_ecdsa_key && \
-  chmod 644 /etc/ssh/ssh_host_ecdsa_key.pub && \
-  chmod 600 /etc/ssh/ssh_host_ed25519_key && \
-  chmod 644 /etc/ssh/ssh_host_ed25519_key.pub && \
-  chown -R sshj:sshj /home/sshj
-
-ENTRYPOINT ["/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2"]

src/itest/docker-image/authorized_keys

@@ -3,6 +3,7 @@ ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHQiZm0w
 ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDAdJiRkkBM8yC8seTEoAn2PfwbLKrkcahZ0xxPoWICJ root@sshj
 ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIJ8ww4hJG/gHJYdkjTTBDF1GNz+228nuWprPV+NbQauA ajvanerp@Heimdall.local
 ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIOaWrwt3drIOjeBq2LSHRavxAT7ja2f+5soOUJl/zKSI ajvanerp@Heimdall.xebialabs.com
+ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAICYfPGSYFOHuSzTJ67H0ynvKJDfgDmwPOj7iJaLGbIBi sshjtest@TranceLove
 ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAoZ9l6Tkm2aL1tSBy2yw4xU5s8BE9MfqS/4J7DzvsYJxF6oQmTIjmStuhH/CT7UjuDtKXdXZUsIhKtafiizxGO8kHSzKDeitpth2RSr8ddMzZKyD6RNs7MfsgjA3UTtrrSrCXEY6O43S2cnuJrWzkPxtwxaQ3zOvDbS2tiulzyq0VzYmuhA/a4CyuQtJBuu+P2oqmu6pU/VB6IzONpvBvYbNPsH1WDmP7zko5wHPihXPCliztspKxS4DRtOZ7BGXyvg44UmIy0Kf4jOkaBV/eCCA4qH7ZHz71/5ceMOpszPcNOEmLGGYhwI+P3OuGMpkrSAv1f8IY6R8spZNncP6UaQ== no-passphrase
 ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQDKRyZAtOJJfAhPU6xE6ZXY564vwErAI3n3Yn4lTHL9bxev9Ily6eCqPLcV0WbSV04pztngFn9MjT7yb8mcXheHpIaWEH569sMpmpOtyfn4p68SceuXBGyyPGMIcfOTknkASd1JYSD4EPkd9rZmCzcx3vEnLu8ChnA/G221xSVQ5VC/jD/c/CgNUayhQ+xbn57qHKKtZwfTa21QmwIabGYJNwlVjlKTCdddeVnZfKqKrG7cxHQApsxd21rhM9IT/C/f4Y/Tx3WUUVeam0iZ265oiPHoPALqJIWSQIUheRYAxYAQqJwSQ0Or9MM8XXun2Iy3RUSGk6eIvrCsFbNURsHNs7Pu0UnpYv6FZ3vCkFep/1pAT6fQvY7pDOOWDHKXArD4watc9gIWaQBH73wDW/KgBcnMRSoGWgQjsYqIamP4oV1+HqUI3lRAsXZaX+eiBGt3+3A5KebP27UJ1YUwhwlzs7wzTKaCu0OaL+hOsP1F2AxAa995bgFksMd23645ux3YCJKXG4sGpJ1Z/Hs49K72gv+QjLZVxXqY623c8+3OUhlixqoEFd4iG7UMc5a552ch/VA+jaspmLZoFhPz99aBRVb1oCSPxSwLw+Q/wxv6pZmT+14rqTzY2farjU53hM+CsUPh7dnWXhGG7RuA5wCdeOXOYjuksfzAoHIZhPqTgQ== ajvanerp@Heimdall.local
 ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBMvfRYSe44VQGwxexOMibcM3+fWeUP1jrBofOxFDRRrzRF8dK/vll2svqTPXMRnITnT1UoemEcB5OHtvH4hzfh/HFeDxJ5S7UncYxoClTSa8MeMFG2Zj9CoUZs1SHbwSGg== root@sshj

src/itest/docker-image/entrypoint.sh

@@ -0,0 +1,7 @@
+#!/bin/ash
+
+# generate host keys if not present
+ssh-keygen -A
+
+# do not detach (-D), log to stderr (-e), passthrough other arguments
+exec /usr/sbin/sshd -D -e "$@"

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_256_key

@@ -0,0 +1,9 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAaAAAABNlY2RzYS
+1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQR1fMdT7FYIpIo+4hhd5oOgHk6uW79B
+HVscKp83yPhFylnG4NtpF7anAWTcpl5aB9eJVWTCP5KVvlVLVkxUSRDwAAAAwITPM06Ezz
+NOAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7i
+GF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEP
+AAAAAhAP21AnkkpifUJgiBSYk7YhOfcwC4VfMB3n+BBln73VnmAAAAImlkX2VjZHNhXzI1
+Nl9yZmM0NzE2X3NpZ25lZF9ieV9yc2EBAgMEBQ==
+-----END OPENSSH PRIVATE KEY-----

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_256_key-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgQgbM6lYD+Yx1aendIKHYuKthkIN0WhvPdMA0DbC/QmEAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7iGF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEPAAAAAAAAAAAAAAAAIAAAAiaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAAZcAAAAHc3NoLXJzYQAAAAMBAAEAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGCdqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWILhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2ryUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYqDvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzpjI2xwC8ecQF9jeFGBcooa86OO65oPQAAAZQAAAAMcnNhLXNoYTItNTEyAAABgAOa69XTj4yOPjKtN5Few84Y2qj4p/4RK9yiAjWWxbMQv+dlLzEH/wtj6p1SeDJozFssVfyH2ODFGY9Dct3K4SbLA1b8LfM6vaf1bUxdQz7njsQ40KpcJu662hMOkj9AKTQgpVUVgJJOQuLrIbyfjKClaqt2W6ziH2eLn7wPsZ6HGhQMALQVmebzgFepnwCve9wgX1HNOfuAYYVQwFXddi/xQ4BIVmsH6E3DcUUzjtZZaG063CddPYOW2Ea1efWqHu20FRWqsMnwbL6Hr9JkjKv/Iub8mgLMP1bhbMEblb+tQ+y9RRvPwjT89tKljc7hXvBxpHA4c4ZlnTidsjqPHVeARCt5LV4lES7HWEZ+kFIkGndNLYXOUnxgk6iSLLHVVZUCZPbUiZbSJdoj7r7LGiz4KA7mnqQQGU2jWxSI2drD5T6SW0TFspzjX4dPnJyzFpe02Fl+NvblUUHsnPTHdsRexHRNfqkQhKIO4i8AM8U02nU/uBmXFPb9ANbLcq+Npw== id_ecdsa_256_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_256_key.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7iGF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEPA= id_ecdsa_256_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_384_key

@@ -0,0 +1,11 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAiAAAABNlY2RzYS
+1zaGEyLW5pc3RwMzg0AAAACG5pc3RwMzg0AAAAYQQ00XynBzgyJLB+1SDf2elIDYt7Lz6g
+Y3dzdqKmYe5L6jzUShmV1UjiE9gCl7i47aRWHSZ3VwiZ0jsT2ekL+ctScSn+NGgw/6BgFr
+c3zIkJoYWYzpg2D3mKUkNDMnJWgisAAADw6GCqcuhgqnIAAAATZWNkc2Etc2hhMi1uaXN0
+cDM4NAAAAAhuaXN0cDM4NAAAAGEENNF8pwc4MiSwftUg39npSA2Ley8+oGN3c3aipmHuS+
+o81EoZldVI4hPYApe4uO2kVh0md1cImdI7E9npC/nLUnEp/jRoMP+gYBa3N8yJCaGFmM6Y
+Ng95ilJDQzJyVoIrAAAAMQDwyD4C4DbK9DVDOovHqCt/f2TKaho1F4wouIIa4ZTph+9cSp
+PUhlSNXKDRD7pOUdIAAAAiaWRfZWNkc2FfMzg0X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQEC
+AwQF
+-----END OPENSSH PRIVATE KEY-----

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_384_key-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAg2byoaIudWiOZaNJMfyOHNw5tOy8lWAADbp/rNkJ7krwAAAAIbmlzdHAzODQAAABhBDTRfKcHODIksH7VIN/Z6UgNi3svPqBjd3N2oqZh7kvqPNRKGZXVSOIT2AKXuLjtpFYdJndXCJnSOxPZ6Qv5y1JxKf40aDD/oGAWtzfMiQmhhZjOmDYPeYpSQ0MyclaCKwAAAAAAAAAAAAAAAgAAACJpZF9lY2RzYV8zODRfcmZjNDcxNl9zaWduZWRfYnlfcnNhAAAADQAAAAkxMjcuMC4wLjEAAAAAAAAAAP//////////AAAAAAAAAAAAAAAAAAABlwAAAAdzc2gtcnNhAAAAAwEAAQAAAYEAylFXh7HVmrZPMpI/uDVesACwaypsa8p7oGNeolrU5rI+BxMlZksNUKI1qmoygYJ2oCfMEoipXCPGF3LU4/tzkG89kb2WO6OUCIGFDm302s36Na/qkTfDebkwUNWHud4a+v3ArwgaEh61+kbr/AnfI4AXWxCQLCAN/sF+RsyrUh/6rJMMXsjd/PJqphf/rUFHaLK2k3FpVXDWDXkQp1EeRRzvrQvSRUXBaSbIAWkr5k85qX2lEcpr2aL/dNFdxDbRmcEHPPGXhuydecRYguEFLGy2gQX3iEcot66gqX2Q/H82oq/CMgSq1T+YTuL5oAT1Z/qdHQI62UE+yPFm1/YBzavJQJ38Rx0CoMY7BnLibWzQbkRAxNTW5YKAYHLPoM9YIIMJp1CrQZoAKNw7IFzLm2tSobFioO+ZkKCrogO/VsYUOUXHV7E7EgAq6u6JV082f5z6HscSZ4z444mrWuOJsPuRTAwrRxyFXOmMjbHALx5xAX2N4UYFyihrzo47rmg9AAABlAAAAAxyc2Etc2hhMi01MTIAAAGAV3uUrbSScu722FmIUG1FEtd7X+y58XlZyBZMDkI2G8RL0bZtALg8kfAUqRs17XS8MEIsG2STDGvDoKpPlGrupTGAwjnpTrDsgr/WaXUn/21Tyv6h4npcPxX5h5OU24UdZRXUGMRqwRXn4d6c44I6lAXkFGEHV20da+2sKR02QOIEfYik7kYgUzkVE5QPr0YN2hWCNxPNahgPow2RvPDHKL0PBS2CASeIo9pZ6OECdsCX92+BXN+e8oPO+BTp2mwzaepFPiSO6pIdTOnhFHwiY7mG7Y+Xw3nCYJl9cILzeuuUeEw3elRMYtnIoUye/IZaZw6GNBObb59seFOaf8Hm7NV6F7L/RNUG7aESB2n6KKggbPci8xuCulfgi/XBxjsXd/affASOUcn3X6IIUwJDqwMBkhmagvYVoLX1gMoHBW0aLZDQEXigV0WW8v1oMsEp6Sl9Y0kRs9vPBr/8LX9vDaPKmNxOBV8uOnicDb9HZicyLkVQyPFobHOvYt/gfEUM id_ecdsa_384_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_384_key.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBDTRfKcHODIksH7VIN/Z6UgNi3svPqBjd3N2oqZh7kvqPNRKGZXVSOIT2AKXuLjtpFYdJndXCJnSOxPZ6Qv5y1JxKf40aDD/oGAWtzfMiQmhhZjOmDYPeYpSQ0MyclaCKw== id_ecdsa_384_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_521_key

@@ -0,0 +1,12 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAArAAAABNlY2RzYS
+1zaGEyLW5pc3RwNTIxAAAACG5pc3RwNTIxAAAAhQQBkA3IU8ml4HuqnsOYb2H89fRKo0Wx
+nFnke8J5olJ0eyaoAv/0fSZDiOeF5j/K6VGeCa45edqJZCNCwda0vzQaZH8AYUnwojVGH1
+pchzLm1U9C3WlF0wP/c141GiNVmkKAQDN7J4KKxchhByMKVPLUzHv181OvItrLR3ECuhGT
+a8xpJRYAAAEgetmfwXrZn8EAAAATZWNkc2Etc2hhMi1uaXN0cDUyMQAAAAhuaXN0cDUyMQ
+AAAIUEAZANyFPJpeB7qp7DmG9h/PX0SqNFsZxZ5HvCeaJSdHsmqAL/9H0mQ4jnheY/yulR
+ngmuOXnaiWQjQsHWtL80GmR/AGFJ8KI1Rh9aXIcy5tVPQt1pRdMD/3NeNRojVZpCgEAzey
+eCisXIYQcjClTy1Mx79fNTryLay0dxAroRk2vMaSUWAAAAQWe6t//lZtwKOHz9KOFcSfpO
+DPQTu+PyzryWrwG99r6IoEqXahhK6FjTJ7U0/Ep9zVeeiLpRVlKe15pcN6U3dp9uAAAAIm
+lkX2VjZHNhXzUyMV9yZmM0NzE2X3NpZ25lZF9ieV9yc2EB
+-----END OPENSSH PRIVATE KEY-----

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_521_key-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp521-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHA1MjEtY2VydC12MDFAb3BlbnNzaC5jb20AAAAghRVKHO1c4TGUTQt6NcV1mXd4HCBJLlkJZtPmVp0EQjUAAAAIbmlzdHA1MjEAAACFBAGQDchTyaXge6qew5hvYfz19EqjRbGcWeR7wnmiUnR7JqgC//R9JkOI54XmP8rpUZ4Jrjl52olkI0LB1rS/NBpkfwBhSfCiNUYfWlyHMubVT0LdaUXTA/9zXjUaI1WaQoBAM3sngorFyGEHIwpU8tTMe/XzU68i2stHcQK6EZNrzGklFgAAAAAAAAAAAAAAAgAAACJpZF9lY2RzYV81MjFfcmZjNDcxNl9zaWduZWRfYnlfcnNhAAAADQAAAAkxMjcuMC4wLjEAAAAAAAAAAP//////////AAAAAAAAAAAAAAAAAAABlwAAAAdzc2gtcnNhAAAAAwEAAQAAAYEAylFXh7HVmrZPMpI/uDVesACwaypsa8p7oGNeolrU5rI+BxMlZksNUKI1qmoygYJ2oCfMEoipXCPGF3LU4/tzkG89kb2WO6OUCIGFDm302s36Na/qkTfDebkwUNWHud4a+v3ArwgaEh61+kbr/AnfI4AXWxCQLCAN/sF+RsyrUh/6rJMMXsjd/PJqphf/rUFHaLK2k3FpVXDWDXkQp1EeRRzvrQvSRUXBaSbIAWkr5k85qX2lEcpr2aL/dNFdxDbRmcEHPPGXhuydecRYguEFLGy2gQX3iEcot66gqX2Q/H82oq/CMgSq1T+YTuL5oAT1Z/qdHQI62UE+yPFm1/YBzavJQJ38Rx0CoMY7BnLibWzQbkRAxNTW5YKAYHLPoM9YIIMJp1CrQZoAKNw7IFzLm2tSobFioO+ZkKCrogO/VsYUOUXHV7E7EgAq6u6JV082f5z6HscSZ4z444mrWuOJsPuRTAwrRxyFXOmMjbHALx5xAX2N4UYFyihrzo47rmg9AAABlAAAAAxyc2Etc2hhMi01MTIAAAGAmpwzeo95ahCTQuLfdsHSlWhNlBVUsEze9ogzqhnh1unL0uDztGbEwZ3+2vAQI9wRlIBJhg+FFIOc6KW6Hi9zHZaU/ipmrtDwoMfaRrL6ZgP+COvCxPMiTuJPt8Er2OsRnarc7iM1RnhFz3jVTGhkTG8W9yvN6Pr7SeJ9DokrRMfuDBosLE7i22pLWWBeDmSHz0dh6VGUhTnEK/9RzRnPQmByRQJ+Xfv4He7QE1IWIufG6zYKi42XiCpC2DKCxI0yapKvqVWkR1snc/0ykMUESsAgyzZoYqzxUCSmTzfT/DCb1WRswFVlLb+uccpo6ioi62CCNvC88WDsXhSO4VYsUno33KL9MopvbO1Gg5IncJP+a2wbP3fFQpefx0D828DovGKNSDxGmzXE2HoEQSsW9EsrBOEBZffHRIgLx+yuR9Er67RrIzUZclUlGZaLf/PWf2JSNwuIhxCShwPu1d3I2VYx5Lcn5MXk/IpHP8xLXH/g8/Mm+NhO4blVFAOwYaox id_ecdsa_521_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ecdsa_521_key.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp521 AAAAE2VjZHNhLXNoYTItbmlzdHA1MjEAAAAIbmlzdHA1MjEAAACFBAGQDchTyaXge6qew5hvYfz19EqjRbGcWeR7wnmiUnR7JqgC//R9JkOI54XmP8rpUZ4Jrjl52olkI0LB1rS/NBpkfwBhSfCiNUYfWlyHMubVT0LdaUXTA/9zXjUaI1WaQoBAM3sngorFyGEHIwpU8tTMe/XzU68i2stHcQK6EZNrzGklFg== id_ecdsa_521_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ed25519_384_key

@@ -0,0 +1,8 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAMwAAAAtzc2gtZW
+QyNTUxOQAAACAz/M/Awfg01fL5pK7PsOmk8sdM98WFXv/7ycMEsMu8EgAAAKilREz2pURM
+9gAAAAtzc2gtZWQyNTUxOQAAACAz/M/Awfg01fL5pK7PsOmk8sdM98WFXv/7ycMEsMu8Eg
+AAAEB9mj+1Z9CnxalesmwJiPa7051sjjnXKR00aQ59jCX0GTP8z8DB+DTV8vmkrs+w6aTy
+x0z3xYVe//vJwwSwy7wSAAAAJGlkX2VkMjU1MTlfMzg0X3JmYzQ3MTZfc2lnbmVkX2J5X3
+JzYQE=
+-----END OPENSSH PRIVATE KEY-----

src/itest/docker-image/test-container/host_keys/ssh_host_ed25519_384_key-cert.pub

@@ -0,0 +1 @@
+ssh-ed25519-cert-v01@openssh.com AAAAIHNzaC1lZDI1NTE5LWNlcnQtdjAxQG9wZW5zc2guY29tAAAAIJPdoRzLgA3gyn+/e94rnl7IvN7PxvEeV0JTITLah2ipAAAAIDP8z8DB+DTV8vmkrs+w6aTyx0z3xYVe//vJwwSwy7wSAAAAAAAAAAAAAAACAAAAJGlkX2VkMjU1MTlfMzg0X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAAZcAAAAHc3NoLXJzYQAAAAMBAAEAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGCdqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWILhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2ryUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYqDvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzpjI2xwC8ecQF9jeFGBcooa86OO65oPQAAAZQAAAAMcnNhLXNoYTItNTEyAAABgJob5TylOxmfFX5qH3iE53+zgXp3JbuxcRG9aYx/5GFiWx2yCku1/2lN/KgW2AOb31iS22LXlhCUtZBmbHiYI9aftZAyBcHGYcHvMCDHH66q+bVLlmRlNW+JjWLM46ythgRT+1dKGWAarZSwAC8hYxlV07pvt7EXFmzy4Kv0C/FL8d78P3nrRsmDTYBwrhQy1s5gwOeZlLyomPtSL7kfdxBXum8v4lG+ddtcL82iGdp2gNyonrjyaDZcdXD1FoBDlqM+lvWGO1n4ikts7JG3jcgK3QRdYOVmPnsCzEHaiTm9APuhf72+B5RXybbQcyHTA49+TptavkoxVaMqzdvIunfEYVf1S5zCHgysOkqGLOEVyMSxZk3pORajr2kdyc02Q4Plrb8B6G0rbixJRCJouS6I8J4W/Orypa2ge/un3U1JYaBeA18va7hwHoG/0zsdswETyIB+nrj59YM6Zm4zzC7Sm0SBNXFN0m2f6SDj6CDTnmj13aejQLUzED4e2Bm6Qw== id_ed25519_384_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_ed25519_384_key.pub

@@ -0,0 +1 @@
+ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDP8z8DB+DTV8vmkrs+w6aTyx0z3xYVe//vJwwSwy7wS id_ed25519_384_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_rsa_2048_key

@@ -0,0 +1,27 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAABFwAAAAdzc2gtcn
+NhAAAAAwEAAQAAAQEA1iHGJi0EhM4vSCe40N3670OWx6tsA28P7Rpqgl9VdYtorneByT6U
+3o7nSIK7MCGXD9XFCPDbQPnCpjIOQaq9f7wzaj7vEzN3iPEsUohfGIhBnZUZqtHdPSMhqE
+JwxuIqRAlSjy8XnBNK6EjgpZGyXL5NijjR9dp/jYgOCMMmJB585BWhYQt7P5qceFjz6AqH
+WKnBbajorFjiJQR9LVhi9nBCC1I02e8aWqS05JR51J8J1+lECJEiKBbzD0dhAd0CPsGlux
+BtwVGZF13+xzc9/NZLUUb4wJxWM0R8flmIochK+yqPgCmr7rjA3yyEPXtQrvTQ46Jjt/u6
+uKyLbdiZ2QAAA9i320dZt9tHWQAAAAdzc2gtcnNhAAABAQDWIcYmLQSEzi9IJ7jQ3frvQ5
+bHq2wDbw/tGmqCX1V1i2iud4HJPpTejudIgrswIZcP1cUI8NtA+cKmMg5Bqr1/vDNqPu8T
+M3eI8SxSiF8YiEGdlRmq0d09IyGoQnDG4ipECVKPLxecE0roSOClkbJcvk2KONH12n+NiA
+4IwyYkHnzkFaFhC3s/mpx4WPPoCodYqcFtqOisWOIlBH0tWGL2cEILUjTZ7xpapLTklHnU
+nwnX6UQIkSIoFvMPR2EB3QI+waW7EG3BUZkXXf7HNz381ktRRvjAnFYzRHx+WYihyEr7Ko
++AKavuuMDfLIQ9e1Cu9NDjomO3+7q4rItt2JnZAAAAAwEAAQAAAQEAkd0x4GF8GYdmV+2P
+DOCZhhDxjhQsoO4v2CDNev+79DVB2s7XnyG9QRnxXMiJAJFxGL1S2fNQN6OrP5ELexn2ui
+OWloJGUzsU6zj2K0ZwGQMAR3sAoAcTgQkEbVzM+/2mMvByx8yZdZ0CwtaaCM8Fw/1yTnzE
+MYhkqSGMBdYBjknjZ8pPMYNVucncmdYibPU5VRRhWSSXlee6oZRgWrcW8VGlFtQU/RHt1a
+LUPrSk/3e1Iqk75AWaFVVwnTnz8pPBpQXboiN22gZ8fvPYO9wphPmuXPapGFUt5NHBgMOv
+Yr2+uzeSYg79VKhRv6YEM3aeW8kkjdZ7r4uP8EFnimUDAQAAAIEAsIsTx8nO65tEJbCEmM
+/bFXHRmMSnVyQWQgyPXTvbWyI1Uk0YyaFOnsFCuXwfM/3fupvFyKTC4rdeJYl9HiVbZAm3
+puI+GIRPOdKMWdh+e802KdeGXPsc+LU0tw5zwaRKH46QtmKEu1UICmUEsDFQxYfSlL8zhc
+/OrNwPUZTRtrYAAACBAOsPC4PtdyItaHVYbSlgp++foTm4adby3lYQOh4VDanY4H95ct/P
+4Qa9BklZmkN5HoaPBnOCV66+RzW42qSbincRSdsYXP6t5fnnQwp9+tqCQaPuHVIGuW9MI9
+qO1hwOl1HnvYFvOEvdvA+Os3as5DyZO5AP5Eta6cwjMwKDTB/hAAAAgQDpNXQL3vJvsUgP
+yZjhxodGGoT7HvLVClrICEuVrJj/10t5AabWjh5G3FILZyTU+zNTGLn+emocuKf+sbrlAe
+6sImXPfKKx/kgSR7knPlUi0TEOow4XbIif0cfGxqkamANe1Sv7xReR2rIqkWqEZsDNhtZR
+oQQY9bNehpqAweCY+QAAACFpZF9yc2FfMjA0OF9yZmM0NzE2X3NpZ25lZF9ieV9yc2E=
+-----END OPENSSH PRIVATE KEY-----

src/itest/docker-image/test-container/host_keys/ssh_host_rsa_2048_key-cert.pub

@@ -0,0 +1 @@
+ssh-rsa-cert-v01@openssh.com AAAAHHNzaC1yc2EtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgKsWt/s6Kl/ti8EuWBhg0TdS/kEUWRzsogWz5M1CVjtoAAAADAQABAAABAQDWIcYmLQSEzi9IJ7jQ3frvQ5bHq2wDbw/tGmqCX1V1i2iud4HJPpTejudIgrswIZcP1cUI8NtA+cKmMg5Bqr1/vDNqPu8TM3eI8SxSiF8YiEGdlRmq0d09IyGoQnDG4ipECVKPLxecE0roSOClkbJcvk2KONH12n+NiA4IwyYkHnzkFaFhC3s/mpx4WPPoCodYqcFtqOisWOIlBH0tWGL2cEILUjTZ7xpapLTklHnUnwnX6UQIkSIoFvMPR2EB3QI+waW7EG3BUZkXXf7HNz381ktRRvjAnFYzRHx+WYihyEr7Ko+AKavuuMDfLIQ9e1Cu9NDjomO3+7q4rItt2JnZAAAAAAAAAAAAAAACAAAAIWlkX3JzYV8yMDQ4X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAAZcAAAAHc3NoLXJzYQAAAAMBAAEAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGCdqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWILhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2ryUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYqDvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzpjI2xwC8ecQF9jeFGBcooa86OO65oPQAAAZQAAAAMcnNhLXNoYTItNTEyAAABgJSHsEN9ccb4C/wrw0Lq22tZ/tLdjXxHKa1xBZZf81z7POZy8njEDN9bXHQalpLzgR12HDnkbBhk0tBrH8JDEmddOiMZrjD5GUzsK5Y3X6H/MTZrPYSqeO7ikmffxRI4A0BjYBmGk5ClntKzs3VhbhnlwBzTbvl+lwGVnP2EJmmP6/xjB0V3udYOQMbRd9Q2ORIZWF0VSexhjVVSdEwDlDdHWubFJwpHGDXKWeijGxSYXbZGwCGhqU04DYIx7HEIm0sulIX9GxjAm16y8QvrSjKCmfOkvg6T/TVVStYGkU2BGGhXyCfCA3gecdxI8mijuLsuBnkr0rVlDg00FLOAduLzsQq7gSC0/xit4OlJO7MoNUSnC9NjNSLjPy7DzW0bwfkmvfuTpKhDmO0lNbr+6if3+Q8pXZV+q1bRFMO9AsSO52gXA/IXGZC3u5JCL56hqb03sQPn/K9ZWmiRzwJYWTpgIgycGwR1ZIYFvtqKJqtVoGaZfCIQD/I4i01qqHxVAg== id_rsa_2048_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/host_keys/ssh_host_rsa_2048_key.pub

@@ -0,0 +1 @@
+ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDWIcYmLQSEzi9IJ7jQ3frvQ5bHq2wDbw/tGmqCX1V1i2iud4HJPpTejudIgrswIZcP1cUI8NtA+cKmMg5Bqr1/vDNqPu8TM3eI8SxSiF8YiEGdlRmq0d09IyGoQnDG4ipECVKPLxecE0roSOClkbJcvk2KONH12n+NiA4IwyYkHnzkFaFhC3s/mpx4WPPoCodYqcFtqOisWOIlBH0tWGL2cEILUjTZ7xpapLTklHnUnwnX6UQIkSIoFvMPR2EB3QI+waW7EG3BUZkXXf7HNz381ktRRvjAnFYzRHx+WYihyEr7Ko+AKavuuMDfLIQ9e1Cu9NDjomO3+7q4rItt2JnZ id_rsa_2048_rfc4716_signed_by_rsa

src/itest/docker-image/test-container/sshd_config

@@ -1,136 +0,0 @@
-#	$OpenBSD: sshd_config,v 1.101 2017/03/14 07:19:07 djm Exp $
-
-# This is the sshd server system-wide configuration file.  See
-# sshd_config(5) for more information.
-
-# This sshd was compiled with PATH=/bin:/usr/bin:/sbin:/usr/sbin
-
-# The strategy used for options in the default sshd_config shipped with
-# OpenSSH is to specify options with their default value where
-# possible, but leave them commented.  Uncommented options override the
-# default value.
-
-#Port 22
-#AddressFamily any
-#ListenAddress 0.0.0.0
-#ListenAddress ::
-
-#HostKey /etc/ssh/ssh_host_rsa_key
-#HostKey /etc/ssh/ssh_host_dsa_key
-#HostKey /etc/ssh/ssh_host_ecdsa_key
-#HostKey /etc/ssh/ssh_host_ed25519_key
-
-# Ciphers and keying
-#RekeyLimit default none
-
-# Logging
-#SyslogFacility AUTH
-#LogLevel INFO
-
-# Authentication:
-
-#LoginGraceTime 2m
-PermitRootLogin yes
-#StrictModes yes
-#MaxAuthTries 6
-#MaxSessions 10
-
-#PubkeyAuthentication yes
-
-# The default is to check both .ssh/authorized_keys and .ssh/authorized_keys2
-# but this is overridden so installations will only check .ssh/authorized_keys
-AuthorizedKeysFile	.ssh/authorized_keys
-
-#AuthorizedPrincipalsFile none
-
-#AuthorizedKeysCommand none
-#AuthorizedKeysCommandUser nobody
-
-# For this to work you will also need host keys in /etc/ssh/ssh_known_hosts
-#HostbasedAuthentication no
-# Change to yes if you don't trust ~/.ssh/known_hosts for
-# HostbasedAuthentication
-#IgnoreUserKnownHosts no
-# Don't read the user's ~/.rhosts and ~/.shosts files
-#IgnoreRhosts yes
-
-# To disable tunneled clear text passwords, change to no here!
-#PasswordAuthentication yes
-#PermitEmptyPasswords no
-
-# Change to no to disable s/key passwords
-#ChallengeResponseAuthentication yes
-
-# Kerberos options
-#KerberosAuthentication no
-#KerberosOrLocalPasswd yes
-#KerberosTicketCleanup yes
-#KerberosGetAFSToken no
-
-# GSSAPI options
-#GSSAPIAuthentication no
-#GSSAPICleanupCredentials yes
-
-# Set this to 'yes' to enable PAM authentication, account processing,
-# and session processing. If this is enabled, PAM authentication will
-# be allowed through the ChallengeResponseAuthentication and
-# PasswordAuthentication.  Depending on your PAM configuration,
-# PAM authentication via ChallengeResponseAuthentication may bypass
-# the setting of "PermitRootLogin without-password".
-# If you just want the PAM account and session checks to run without
-# PAM authentication, then enable this but set PasswordAuthentication
-# and ChallengeResponseAuthentication to 'no'.
-#UsePAM no
-
-#AllowAgentForwarding yes
-#AllowTcpForwarding yes
-#GatewayPorts no
-#X11Forwarding no
-#X11DisplayOffset 10
-#X11UseLocalhost yes
-#PermitTTY yes
-#PrintMotd yes
-#PrintLastLog yes
-#TCPKeepAlive yes
-#UseLogin no
-#PermitUserEnvironment no
-#Compression delayed
-#ClientAliveInterval 0
-#ClientAliveCountMax 3
-#UseDNS no
-#PidFile /run/sshd.pid
-#MaxStartups 10:30:100
-#PermitTunnel no
-#ChrootDirectory none
-#VersionAddendum none
-
-# no default banner path
-#Banner none
-
-# override default of no subsystems
-Subsystem	sftp	/usr/lib/ssh/sftp-server
-
-# the following are HPN related configuration options
-# tcp receive buffer polling. disable in non autotuning kernels
-#TcpRcvBufPoll yes
-
-# disable hpn performance boosts
-#HPNDisabled no
-
-# buffer size for hpn to non-hpn connections
-#HPNBufferSize 2048
-
-
-# Example of overriding settings on a per-user basis
-#Match User anoncvs
-#	X11Forwarding no
-#	AllowTcpForwarding no
-#	PermitTTY no
-#	ForceCommand cvs server
-
-KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1
-macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,hmac-ripemd160-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512,hmac-ripemd160,hmac-ripemd160@openssh.com
-
-TrustedUserCAKeys /etc/ssh/users_rsa_ca.pub
-
-Ciphers 3des-cbc,blowfish-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com

src/itest/docker-image/test-container/trusted_ca_keys

@@ -0,0 +1,4 @@
+ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABgQDN70b/cYHZQMD1YW0mlncXqC2l++sEWrVYlIUCzNxNhRYjI4UmEVEq3ru1h6K3ZVAJi1DcZuf5ne1ZXtwJ1Uw1JA4wGdKw+9TwAb5Gubn+VEowgt62kLAPeChiPucTXD0FDDhIUOBv3KxytdrJIYAtzZT27STsBiDF1+7Ld3wk/1Dg9NAaI6q40PmuicTEACQRHn5snI1t9+LgZTd3/PPE5pjJM0ow9+r6mlUUM5oHCk5sZ8DBuRR1Ram4sxp/LFQM+9feMmW3ZM2C5AN0JG4A7NXnlwiTKmNVrGI0iFucBBKhjxN1qdgBF11/42cCrerC9UW1auTTi9mqwEIqBGL30VOPy+dCPQQViP+C09CBgyr3wpZciPKP1mvmcOkC5FDzKg9e3v1JBq0fqZgwt+PPG8cGnxRCGEQ+ZMLDuAixkQUEwDWeMskHLkbjUEiVZydViCPSzFczGtKatQiQVZA5Zx0Gn2sUaQjykhWzqKNL8oIbolEdkH9ubOZWNi0brzU= root@sshj
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBNz89k9T3el9LpypMH6Rs8Ovn/xC6subq9XBoTK8G9x3Q4IifsN+bCy7h9juYdE8it5GvgnpM2HSdPBFMpJnEFI= CA_ecdsa.pem
+ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABgQDKUVeHsdWatk8ykj+4NV6wALBrKmxrynugY16iWtTmsj4HEyVmSw1QojWqajKBgnagJ8wSiKlcI8YXctTj+3OQbz2RvZY7o5QIgYUObfTazfo1r+qRN8N5uTBQ1Ye53hr6/cCvCBoSHrX6Ruv8Cd8jgBdbEJAsIA3+wX5GzKtSH/qskwxeyN388mqmF/+tQUdosraTcWlVcNYNeRCnUR5FHO+tC9JFRcFpJsgBaSvmTzmpfaURymvZov900V3ENtGZwQc88ZeG7J15xFiC4QUsbLaBBfeIRyi3rqCpfZD8fzair8IyBKrVP5hO4vmgBPVn+p0dAjrZQT7I8WbX9gHNq8lAnfxHHQKgxjsGcuJtbNBuREDE1NblgoBgcs+gz1gggwmnUKtBmgAo3DsgXMuba1KhsWKg75mQoKuiA79WxhQ5RcdXsTsSACrq7olXTzZ/nPoexxJnjPjjiata44mw+5FMDCtHHIVc6YyNscAvHnEBfY3hRgXKKGvOjjuuaD0= CA_rsa.pem
+ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDphrlRZfHI2xJ7IIqmoLji2Bh2j7ZP0jynCL0TnjTuH CA_ed25519.pem

src/itest/generate.sh

@@ -1,6 +1,102 @@
-#!/bin/sh
-# Don't call it frequently. It's rather a documentation how everything is generated.
-ssh-keygen -f resources/users_rsa_ca -t rsa -N ''
+#!/usr/bin/env bash
+# This script is intended for generating SSH keys required for unit and integration tests. If you intend to add a new
+# key to the tests, please write its generation command there.
+#
+# All generation commands should generate only files that does not exist. If some key is already generated, the script
+# should not overwrite the key.
+
+set -e -o pipefail
+cd "${BASH_SOURCES[0]}"
+
+function generate() {
+  local destination="$1"
+  if [[ ! -f "$destination" ]]; then
+    echo "Generating $destination" 1>&2
+    shift
+    mkdir -p "$(dirname "$destination")"
+    ssh-keygen -q -f "$destination" "${@}"
+  fi
+}
+
+function generate_cert() {
+  local private_key
+  local suffix
+  local cert
+  private_key="$1"
+  suffix="$2"
+  shift 2
+  cert="$private_key$suffix-cert.pub"
+  if [[ ! -f "$cert" ]]; then
+    cp "$private_key" "$private_key$suffix"
+    cp "$private_key.pub" "$private_key$suffix.pub"
+    generate "$cert" "$@" "$private_key$suffix.pub"
+    rm -f "$private_key$suffix" "$private_key$suffix.pub"
+  fi
+}
+
+generate resources/users_rsa_ca -t rsa -N ''
+if [[ -f resources/users_rsa_ca.pub ]]; then
   mv resources/users_rsa_ca.pub docker-image/test-container
-ssh-keygen -f resources/keyfiles/id_rsa2 -t rsa -m pem -N ''
-ssh-keygen -s resources/users_rsa_ca -I my_key_id -n sshj resources/keyfiles/id_rsa2.pub
+fi
+generate resources/keyfiles/id_rsa2 -t rsa -m pem -N ''
+generate resources/keyfiles/id_rsa2-cert.pub -s resources/users_rsa_ca -I my_key_id -n sshj resources/keyfiles/id_rsa2.pub
+
+cat docker-image/test-container/users_rsa_ca.pub >docker-image/test-container/trusted_ca_keys
+
+key_algo_pairs=(ecdsa_256 ecdsa_384 ecdsa_521 rsa_2048 ed25519_384)
+
+for ca_algo in ecdsa rsa ed25519; do
+  generate "resources/keyfiles/certificates/CA_${ca_algo}.pem" -N "" -t "$ca_algo" -C "CA_${ca_algo}.pem"
+  cat "resources/keyfiles/certificates/CA_${ca_algo}.pem.pub" >>docker-image/test-container/trusted_ca_keys
+
+  for key_algo_pair in "${key_algo_pairs[@]}"; do
+    key_algo="${key_algo_pair/_*/}"
+    bits="${key_algo_pair/*_/}"
+
+    for format in pem rfc4716; do
+      if [[ "$key_algo" == 'pem' && "$format" == 'ed25519' ]]; then
+        # Ed25519 keys are always generated in RFC4716 format.
+        continue
+      fi
+
+      user_key="resources/keyfiles/certificates/id_${key_algo_pair}_${format}_signed_by_${ca_algo}"
+      generate "$user_key" -N '' -t "$key_algo" -b "$bits" -m "$format" -C "$(basename "$user_key")"
+      generate "${user_key}-cert.pub" -s "resources/keyfiles/certificates/CA_${ca_algo}.pem" -I "$(basename "$user_key")" -n sshj "${user_key}.pub"
+
+      # These certificates are to be used as host certificates of sshd.
+      generate_cert "$user_key" _host \
+        -s "resources/keyfiles/certificates/CA_${ca_algo}.pem" -I "$(basename "$user_key")" -h -n 127.0.0.1
+    done
+  done
+done
+
+mkdir -p docker-image/test-container/host_keys
+
+for key_algo_pair in "${key_algo_pairs[@]}"; do
+  key_algo="${key_algo_pair/_*/}"
+  bits="${key_algo_pair/*_/}"
+
+  user_key="resources/keyfiles/certificates/id_${key_algo_pair}_${format}_signed_by_rsa"
+  host_key="docker-image/test-container/host_keys/ssh_host_${key_algo_pair}_key"
+  if [[ ! -f "$host_key" ]]; then
+    cp -p "$user_key" "$host_key"
+    cp -p "${user_key}.pub" "${host_key}.pub"
+    cp -p "${user_key}_host-cert.pub" "${host_key}-cert.pub"
+  fi
+done
+
+(
+  cd resources/keyfiles/certificates
+
+  generate_cert id_ed25519_384_rfc4716_signed_by_rsa _host_valid_before_past \
+    -s "CA_rsa.pem" -I valid_before_past -h -n 127.0.0.1 -V 'always:20210101000000'
+
+  generate_cert id_ed25519_384_rfc4716_signed_by_rsa _host_valid_after_future \
+    -s "CA_rsa.pem" -I valid_after_future -h -n 127.0.0.1 -V '20990101000000:forever'
+
+  generate_cert id_ed25519_384_rfc4716_signed_by_rsa _host_no_principal \
+    -s "CA_rsa.pem" -I no_principal -h
+
+  generate_cert id_ed25519_384_rfc4716_signed_by_rsa _host_principal_wildcard_example_com \
+    -s "CA_rsa.pem" -I principal_wildcard_example_com -h -n '*.example.com'
+)

src/itest/groovy/com/hierynomus/sshj/IntegrationBaseSpec.groovy

@@ -1,42 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj
-
-import net.schmizz.sshj.Config
-import net.schmizz.sshj.DefaultConfig
-import net.schmizz.sshj.SSHClient
-import net.schmizz.sshj.transport.verification.PromiscuousVerifier
-import spock.lang.Specification
-
-class IntegrationBaseSpec extends Specification {
-    protected static final int DOCKER_PORT = 2222
-    protected static final String USERNAME = "sshj"
-    protected static final String KEYFILE = "src/itest/resources/keyfiles/id_rsa"
-    protected final static String SERVER_IP = System.getProperty("serverIP", "127.0.0.1")
-
-    protected static SSHClient getConnectedClient(Config config) {
-        SSHClient sshClient = new SSHClient(config)
-        sshClient.addHostKeyVerifier(new PromiscuousVerifier())
-        sshClient.connect(SERVER_IP, DOCKER_PORT)
-
-        return sshClient
-    }
-
-    protected static SSHClient getConnectedClient() throws IOException {
-        return getConnectedClient(new DefaultConfig())
-    }
-
-}

src/itest/groovy/com/hierynomus/sshj/IntegrationSpec.groovy

@@ -1,95 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj
-
-import com.hierynomus.sshj.key.KeyAlgorithms
-import net.schmizz.sshj.DefaultConfig
-import net.schmizz.sshj.SSHClient
-import net.schmizz.sshj.transport.TransportException
-import net.schmizz.sshj.userauth.UserAuthException
-import spock.lang.Unroll
-
-class IntegrationSpec extends IntegrationBaseSpec {
-
-    @Unroll
-    def "should accept correct key for #signatureName"() {
-        given:
-        def config = new DefaultConfig()
-        config.setKeyAlgorithms(Collections.singletonList(signatureFactory))
-        SSHClient sshClient = new SSHClient(config)
-        sshClient.addHostKeyVerifier(fingerprint) // test-containers/ssh_host_ecdsa_key's fingerprint
-
-        when:
-        sshClient.connect(SERVER_IP, DOCKER_PORT)
-
-        then:
-        sshClient.isConnected()
-
-        where:
-        signatureFactory << [KeyAlgorithms.ECDSASHANistp256(), KeyAlgorithms.EdDSA25519()]
-        fingerprint << ["d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3", "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"]
-        signatureName = signatureFactory.getName()
-    }
-
-    def "should decline wrong key"() throws IOException {
-        given:
-        SSHClient sshClient = new SSHClient(new DefaultConfig())
-        sshClient.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3")
-
-        when:
-        sshClient.connect(SERVER_IP, DOCKER_PORT)
-
-        then:
-        thrown(TransportException.class)
-    }
-
-    @Unroll
-    def "should authenticate with key #key"() {
-        given:
-        SSHClient client = getConnectedClient()
-
-        when:
-        def keyProvider = passphrase != null ? client.loadKeys("src/itest/resources/keyfiles/$key", passphrase) : client.loadKeys("src/itest/resources/keyfiles/$key")
-        client.authPublickey(USERNAME, keyProvider)
-
-        then:
-        client.isAuthenticated()
-
-        where:
-        key | passphrase
-//        "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
-        "id_ecdsa_opensshv1" | null
-        "id_ed25519_opensshv1" | null
-        "id_ed25519_opensshv1_aes256cbc.pem" | "foobar"
-        "id_ed25519_opensshv1_protected" | "sshjtest"
-        "id_rsa" | null
-        "id_rsa_opensshv1" | null
-        "id_ecdsa_nistp384_opensshv1" | null
-        "id_ecdsa_nistp521_opensshv1" | null
-    }
-
-   def "should not authenticate with wrong key"() {
-        given:
-        SSHClient client = getConnectedClient()
-
-        when:
-        client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key")
-
-        then:
-        thrown(UserAuthException.class)
-        !client.isAuthenticated()
-    }
-}

src/itest/groovy/com/hierynomus/sshj/sftp/FileWriteSpec.groovy

@@ -1,68 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj.sftp
-
-import com.hierynomus.sshj.IntegrationBaseSpec
-import net.schmizz.sshj.SSHClient
-import net.schmizz.sshj.sftp.OpenMode
-import net.schmizz.sshj.sftp.RemoteFile
-import net.schmizz.sshj.sftp.SFTPClient
-
-import java.nio.charset.StandardCharsets
-
-import static org.codehaus.groovy.runtime.IOGroovyMethods.withCloseable
-
-class FileWriteSpec extends IntegrationBaseSpec {
-
-    def "should append to file (GH issue #390)"() {
-        given:
-        SSHClient client = getConnectedClient()
-        client.authPublickey("sshj", "src/test/resources/id_rsa")
-        SFTPClient sftp = client.newSFTPClient()
-        def file = "/home/sshj/test.txt"
-        def initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16)
-        def appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16)
-
-        when:
-        withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) { RemoteFile initial ->
-            initial.write(0, initialText, 0, initialText.length)
-        }
-
-        then:
-        withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
-            def bytes = new byte[initialText.length]
-            read.read(0, bytes, 0, bytes.length)
-            bytes == initialText
-        }
-
-        when:
-        withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) { RemoteFile append ->
-            append.write(0, appendText, 0, appendText.length)
-        }
-
-        then:
-        withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
-            def bytes = new byte[initialText.length + appendText.length]
-            read.read(0, bytes, 0, bytes.length)
-            Arrays.copyOfRange(bytes, 0, initialText.length) == initialText
-            Arrays.copyOfRange(bytes, initialText.length, initialText.length + appendText.length) == appendText
-        }
-
-        cleanup:
-        sftp.close()
-        client.close()
-    }
-}

src/itest/groovy/com/hierynomus/sshj/signature/SignatureSpec.groovy

@@ -1,42 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj.signature
-
-import com.hierynomus.sshj.IntegrationBaseSpec
-import com.hierynomus.sshj.key.KeyAlgorithms
-import net.schmizz.sshj.DefaultConfig
-import spock.lang.Unroll
-
-class SignatureSpec extends IntegrationBaseSpec {
-
-    @Unroll
-    def "should correctly connect with #sig Signature"() {
-        given:
-        def cfg = new DefaultConfig()
-        cfg.setKeyAlgorithms(Collections.singletonList(sigFactory))
-        def client = getConnectedClient(cfg)
-
-        when:
-        client.authPublickey(USERNAME, KEYFILE)
-
-        then:
-        client.authenticated
-
-        where:
-        sigFactory << [KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512()]
-        sig = sigFactory.name
-    }
-}

src/itest/groovy/com/hierynomus/sshj/transport/cipher/CipherSpec.groovy

@@ -1,54 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj.transport.cipher
-
-import com.hierynomus.sshj.IntegrationBaseSpec
-import net.schmizz.sshj.DefaultConfig
-import spock.lang.Unroll
-
-class CipherSpec extends IntegrationBaseSpec {
-
-    @Unroll
-    def "should correctly connect with #cipher Cipher"() {
-        given:
-        def cfg = new DefaultConfig()
-        cfg.setCipherFactories(cipherFactory)
-        def client = getConnectedClient(cfg)
-
-        when:
-        client.authPublickey(USERNAME, KEYFILE)
-
-        then:
-        client.authenticated
-
-        cleanup:
-        client.disconnect()
-
-        where:
-        cipherFactory << [BlockCiphers.TripleDESCBC(),
-                          BlockCiphers.BlowfishCBC(),
-                          BlockCiphers.AES128CBC(),
-                          BlockCiphers.AES128CTR(),
-                          BlockCiphers.AES192CBC(),
-                          BlockCiphers.AES192CTR(),
-                          BlockCiphers.AES256CBC(),
-                          BlockCiphers.AES256CTR(),
-                          GcmCiphers.AES128GCM(),
-                          GcmCiphers.AES256GCM()]
-        cipher = cipherFactory.name
-    }
-
-}

src/itest/groovy/com/hierynomus/sshj/transport/kex/KexSpec.groovy

@@ -1,61 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj.transport.kex
-
-import com.hierynomus.sshj.IntegrationBaseSpec
-import com.hierynomus.sshj.transport.mac.Macs
-import net.schmizz.sshj.DefaultConfig
-import net.schmizz.sshj.transport.kex.Curve25519DH
-import net.schmizz.sshj.transport.kex.Curve25519SHA256
-import net.schmizz.sshj.transport.kex.DH
-import net.schmizz.sshj.transport.kex.DHGexSHA1
-import net.schmizz.sshj.transport.kex.DHGexSHA256
-import net.schmizz.sshj.transport.kex.ECDH
-import net.schmizz.sshj.transport.kex.ECDHNistP
-import spock.lang.Unroll
-
-class KexSpec extends IntegrationBaseSpec {
-
-    @Unroll
-    def "should correctly connect with #kex Key Exchange"() {
-        given:
-        def cfg = new DefaultConfig()
-        cfg.setKeyExchangeFactories(kexFactory)
-        def client = getConnectedClient(cfg)
-
-        when:
-        client.authPublickey(USERNAME, KEYFILE)
-
-        then:
-        client.authenticated
-
-        where:
-        kexFactory << [DHGroups.Group1SHA1(),
-                       DHGroups.Group14SHA1(),
-                       DHGroups.Group14SHA256(),
-                       DHGroups.Group16SHA512(),
-                       DHGroups.Group18SHA512(),
-                       new DHGexSHA1.Factory(),
-                       new DHGexSHA256.Factory(),
-                       new Curve25519SHA256.Factory(),
-                       new Curve25519SHA256.FactoryLibSsh(),
-                       new ECDHNistP.Factory256(),
-                       new ECDHNistP.Factory384(),
-                       new ECDHNistP.Factory521()]
-        kex = kexFactory.name
-    }
-
-}

src/itest/groovy/com/hierynomus/sshj/transport/mac/MacSpec.groovy

@@ -1,65 +0,0 @@
-/*
- * Copyright (C)2009 - SSHJ Contributors
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package com.hierynomus.sshj.transport.mac
-
-import com.hierynomus.sshj.IntegrationBaseSpec
-import net.schmizz.sshj.DefaultConfig
-import spock.lang.Unroll
-
-class MacSpec extends IntegrationBaseSpec {
-
-    @Unroll
-    def "should correctly connect with #mac MAC"() {
-        given:
-        def cfg = new DefaultConfig()
-        cfg.setMACFactories(macFactory)
-        def client = getConnectedClient(cfg)
-
-        when:
-        client.authPublickey(USERNAME, KEYFILE)
-
-        then:
-        client.authenticated
-
-        cleanup:
-        client.disconnect()
-
-        where:
-        macFactory << [Macs.HMACRIPEMD160(), Macs.HMACRIPEMD160OpenSsh(), Macs.HMACSHA2256(), Macs.HMACSHA2512()]
-        mac = macFactory.name
-    }
-
-    @Unroll
-    def "should correctly connect with Encrypt-Then-Mac #mac MAC"() {
-        given:
-        def cfg = new DefaultConfig()
-        cfg.setMACFactories(macFactory)
-        def client = getConnectedClient(cfg)
-
-        when:
-        client.authPublickey(USERNAME, KEYFILE)
-
-        then:
-        client.authenticated
-
-        cleanup:
-        client.disconnect()
-
-        where:
-        macFactory << [Macs.HMACRIPEMD160Etm(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm()]
-        mac = macFactory.name
-    }
-}

src/itest/java/com/hierynomus/sshj/HostKeyVerifierTest.java

@@ -0,0 +1,72 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import static org.junit.Assert.assertThrows;
+import static org.junit.Assert.assertTrue;
+
+import java.util.List;
+import java.util.stream.Stream;
+
+import org.junit.jupiter.api.Test;
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.Arguments;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.key.KeyAlgorithms;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.transport.TransportException;
+
+@Testcontainers
+public class HostKeyVerifierTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    public static Stream<Arguments> signatureAlgos() {
+        return Stream.of(
+            Arguments.of(KeyAlgorithms.ECDSASHANistp256(), "d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3"),
+            Arguments.of(KeyAlgorithms.EdDSA25519(), "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"));
+    }
+
+    @ParameterizedTest(name = "Should connect with signature verified for Key Algorithm {0}")
+    @MethodSource("signatureAlgos")
+    public void shouldConnectWithSignatureVerified(KeyAlgorithms.Factory alg, String fingerprint) throws Throwable {
+        Config config = new DefaultConfig();
+        config.setKeyAlgorithms(List.of(alg));
+
+        try (SSHClient client = new SSHClient(config)) {
+            client.addHostKeyVerifier(fingerprint);
+            client.connect(sshd.getHost(), sshd.getFirstMappedPort());
+
+            assertTrue(client.isConnected());
+        }
+    }
+
+    @Test
+    public void shouldDeclineWrongKey() throws Throwable {
+        try (SSHClient client = new SSHClient()) {
+            assertThrows(TransportException.class, () -> {
+                client.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3");
+                client.connect(sshd.getHost(), sshd.getFirstMappedPort());
+            });
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/ManyChannelsTest.java

@@ -0,0 +1,74 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import java.util.ArrayList;
+import java.util.List;
+import java.util.concurrent.ExecutorService;
+import java.util.concurrent.Executors;
+import java.util.concurrent.Future;
+import java.util.concurrent.TimeUnit;
+
+import org.junit.jupiter.api.Test;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.common.IOUtils;
+import net.schmizz.sshj.connection.channel.direct.Session;
+
+import static org.assertj.core.api.Assertions.*;
+
+@Testcontainers
+public class ManyChannelsTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder()
+            .withSshdConfig(SshdConfigBuilder.defaultBuilder().with("MaxSessions", "200")).withAllKeys());
+
+    @Test
+    public void shouldWorkWithManyChannelsWithoutNoExistentChannelError_GH805() throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            client.authPublickey("sshj", "src/test/resources/id_rsa");
+
+            List<Future<Exception>> futures = new ArrayList<>();
+            ExecutorService executorService = Executors.newCachedThreadPool();
+
+            for (int i = 0; i < 20; i++) {
+                futures.add(executorService.submit(() -> {
+                    try {
+                        for (int j = 0; j < 10; j++) {
+                            try (Session sshSession = client.startSession()) {
+                                try (Session.Command sshCommand = sshSession.exec("ls -la")) {
+                                    IOUtils.readFully(sshCommand.getInputStream()).toString();
+                                }
+                            }
+                        }
+                    } catch (Exception e) {
+                        return e;
+                    }
+                    return null;
+                }));
+            }
+
+            executorService.shutdown();
+            executorService.awaitTermination(1, TimeUnit.DAYS);
+
+            assertThat(futures).allSatisfy(future -> assertThat(future.get()).isNull());
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/PublicKeyAuthTest.java

@@ -0,0 +1,86 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertThrows;
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+import java.util.stream.Stream;
+
+import org.junit.jupiter.api.Test;
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.Arguments;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.userauth.UserAuthException;
+import net.schmizz.sshj.userauth.keyprovider.KeyProvider;
+
+@Testcontainers
+public class PublicKeyAuthTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(
+            SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com"))
+            .withAllKeys());
+
+    public static Stream<Arguments> keys() {
+        return Stream.of(
+                Arguments.of("id_rsa2", null),
+                // "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
+                Arguments.of("id_ecdsa_opensshv1", null),
+                Arguments.of("id_ed25519_opensshv1", null),
+                Arguments.of("id_ed25519_opensshv1_aes256cbc.pem", "foobar"),
+                Arguments.of("id_ed25519_opensshv1_aes128cbc.pem", "sshjtest"),
+                Arguments.of("id_ed25519_opensshv1_protected", "sshjtest"),
+                Arguments.of("id_rsa", null),
+                Arguments.of("id_rsa_opensshv1", null),
+                Arguments.of("id_ecdsa_nistp384_opensshv1", null),
+                Arguments.of("id_ecdsa_nistp521_opensshv1", null));
+    }
+
+    @ParameterizedTest(name = "should authenticate with signed public key {0}")
+    @MethodSource("keys")
+    public void shouldAuthenticateWithSignedRsaKey(String key, String passphrase) throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            KeyProvider p = null;
+            if (passphrase != null) {
+                p = client.loadKeys("src/itest/resources/keyfiles/" + key, passphrase);
+            } else {
+                p = client.loadKeys("src/itest/resources/keyfiles/" + key);
+            }
+            client.authPublickey("sshj", p);
+
+            assertTrue(client.isAuthenticated());
+        }
+    }
+
+    @Test
+    public void shouldNotAuthenticateWithUnknownKey() throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            assertThrows(UserAuthException.class, () -> {
+                client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key");
+            });
+
+            assertFalse(client.isAuthenticated());
+        }
+    }
+
+}

src/itest/java/com/hierynomus/sshj/RsaShaKeySignatureTest.java

@@ -0,0 +1,100 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.Arguments;
+import org.junit.jupiter.params.provider.MethodSource;
+
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+import com.hierynomus.sshj.key.KeyAlgorithms;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+
+import java.util.List;
+
+import static org.junit.jupiter.api.Assertions.assertTrue;
+import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
+
+public class RsaShaKeySignatureTest {
+
+    public static Stream<Arguments> hostKeysAndAlgorithms() {
+        return Stream.of(
+                Arguments.of("ssh_host_ecdsa_256_key", KeyAlgorithms.ECDSASHANistp256()),
+                Arguments.of("ssh_host_ecdsa_384_key", KeyAlgorithms.ECDSASHANistp384()),
+                Arguments.of("ssh_host_ecdsa_521_key", KeyAlgorithms.ECDSASHANistp521()),
+                Arguments.of("ssh_host_ed25519_384_key", KeyAlgorithms.EdDSA25519()),
+                Arguments.of("ssh_host_rsa_2048_key", KeyAlgorithms.RSASHA512()));
+    }
+
+    @ParameterizedTest(name = "Should connect to server that does not support ssh-rsa with host key {1}")
+    @MethodSource("hostKeysAndAlgorithms")
+    public void shouldConnectToServerThatDoesNotSupportSshRsaWithHostKey(String key, KeyAlgorithms.Factory algorithm)
+            throws Throwable {
+        SshdConfigBuilder configBuilder = SshdConfigBuilder
+                .defaultBuilder()
+                .with("PubkeyAcceptedAlgorithms", "rsa-sha2-512,rsa-sha2-256,ssh-ed25519");
+        withSshdContainer(SshdContainer.Builder.defaultBuilder()
+                .withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
+                    Config c = new DefaultConfig();
+                    c.setKeyAlgorithms(List.of(KeyAlgorithms.RSASHA512(), KeyAlgorithms.RSASHA256(), algorithm));
+
+                    SSHClient client = sshd.getConnectedClient(c);
+                    client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+                    assertTrue(client.isAuthenticated());
+
+                    client.disconnect();
+                });
+    }
+
+    @ParameterizedTest(name = "Should connect to a default server with host key {1} with a default config")
+    @MethodSource("hostKeysAndAlgorithms")
+    public void shouldConnectToDefaultServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
+        withSshdContainer(SshdContainer.Builder.defaultBuilder().addHostKey("test-container/host_keys/" + key),
+                sshd -> {
+                    SSHClient client = sshd.getConnectedClient();
+                    client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+                    assertTrue(client.isAuthenticated());
+
+                    client.disconnect();
+                });
+    }
+
+    @ParameterizedTest(name = "Should connect to a server that only supports ssh-rsa with host key {1}")
+    @MethodSource("hostKeysAndAlgorithms")
+    public void shouldConnectToSshRsaOnlyServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
+        SshdConfigBuilder configBuilder = SshdConfigBuilder
+                .defaultBuilder()
+                .with("PubkeyAcceptedAlgorithms", "ssh-rsa,ssh-ed25519");
+
+        withSshdContainer(SshdContainer.Builder.defaultBuilder()
+                .withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
+                    Config c = new DefaultConfig();
+                    c.setKeyAlgorithms(List.of(KeyAlgorithms.SSHRSA(), algorithm));
+                    SSHClient client = sshd.getConnectedClient(c);
+                    client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+                    assertTrue(client.isAuthenticated());
+                    client.disconnect();
+                });
+    }
+}

src/itest/java/com/hierynomus/sshj/SshServerWaitStrategy.java

@@ -0,0 +1,77 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import org.testcontainers.containers.wait.strategy.WaitStrategy;
+import org.testcontainers.containers.wait.strategy.WaitStrategyTarget;
+
+import java.io.IOException;
+import java.net.InetSocketAddress;
+import java.net.Socket;
+import java.nio.charset.StandardCharsets;
+import java.time.Duration;
+import java.util.Arrays;
+
+/**
+ * A wait strategy designed for {@link SshdContainer} to wait until the SSH server is ready, to avoid races when a test
+ * tries to connect to a server before the server has started.
+ */
+public class SshServerWaitStrategy implements WaitStrategy {
+    private Duration startupTimeout = Duration.ofMinutes(1);
+
+    @Override
+    public void waitUntilReady(WaitStrategyTarget waitStrategyTarget) {
+        long expectedEnd = System.nanoTime() + startupTimeout.toNanos();
+        while (waitStrategyTarget.isRunning()) {
+            long attemptStart = System.nanoTime();
+            IOException error = null;
+            byte[] buffer = new byte[7];
+            try (Socket socket = new Socket()) {
+                socket.setSoTimeout(500);
+                socket.connect(new InetSocketAddress(
+                        waitStrategyTarget.getHost(), waitStrategyTarget.getFirstMappedPort()));
+                // Haven't seen any SSH server that sends the version in two or more packets.
+                //noinspection ResultOfMethodCallIgnored
+                socket.getInputStream().read(buffer);
+                if (!Arrays.equals(buffer, "SSH-2.0".getBytes(StandardCharsets.UTF_8))) {
+                    error = new IOException("The version message doesn't look like an SSH server version");
+                }
+            } catch (IOException err) {
+                error = err;
+            }
+
+            if (error == null) {
+                break;
+            } else if (System.nanoTime() >= expectedEnd) {
+                throw new RuntimeException(error);
+            }
+
+            try {
+                //noinspection BusyWait
+                Thread.sleep(Math.max(0L, 500L - (System.nanoTime() - attemptStart) / 1_000_000));
+            } catch (InterruptedException e) {
+                Thread.currentThread().interrupt();
+                break;
+            }
+        }
+    }
+
+    @Override
+    public WaitStrategy withStartupTimeout(Duration startupTimeout) {
+        this.startupTimeout = startupTimeout;
+        return this;
+    }
+}

src/itest/java/com/hierynomus/sshj/SshdContainer.java

@@ -0,0 +1,246 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj;
+
+import ch.qos.logback.classic.Level;
+import ch.qos.logback.classic.Logger;
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.transport.verification.PromiscuousVerifier;
+
+import org.jetbrains.annotations.NotNull;
+import org.junit.jupiter.api.function.ThrowingConsumer;
+import org.slf4j.LoggerFactory;
+import org.testcontainers.containers.GenericContainer;
+import org.testcontainers.images.builder.ImageFromDockerfile;
+import org.testcontainers.images.builder.dockerfile.DockerfileBuilder;
+import org.testcontainers.utility.DockerLoggerFactory;
+
+import java.util.function.Consumer;
+
+import java.io.IOException;
+import java.nio.file.Paths;
+import java.util.ArrayList;
+import java.util.List;
+import java.util.concurrent.Future;
+
+/**
+ * A JUnit4 rule for launching a generic SSH server container.
+ */
+public class SshdContainer extends GenericContainer<SshdContainer> {
+
+    /**
+     * A workaround for strange logger names of testcontainers. They contain no
+     * dots, but contain slashes,
+     * square brackets, and even emoji. It's uneasy to set the logging level via the
+     * XML file of logback, the
+     * result would be less readable than the code below.
+     */
+    public static class DebugLoggingImageFromDockerfile extends ImageFromDockerfile {
+        public DebugLoggingImageFromDockerfile() {
+            super();
+            Logger logger = (Logger) LoggerFactory.getILoggerFactory()
+                    .getLogger(DockerLoggerFactory.getLogger(getDockerImageName()).getName());
+            logger.setLevel(Level.DEBUG);
+        }
+    }
+
+    public static class SshdConfigBuilder {
+        public static final String DEFAULT_SSHD_CONFIG = "" +
+                "PermitRootLogin yes\n" +
+                "AuthorizedKeysFile .ssh/authorized_keys\n" +
+                "Subsystem sftp /usr/lib/ssh/sftp-server\n" +
+                "KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1\n"
+                +
+                "macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512\n"
+                +
+                "TrustedUserCAKeys /etc/ssh/trusted_ca_keys\n" +
+                "Ciphers 3des-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com,chacha20-poly1305@openssh.com\n"
+                +
+                "LogLevel DEBUG2\n";
+        private String sshdConfig;
+
+        public SshdConfigBuilder(@NotNull String sshdConfig) {
+            this.sshdConfig = sshdConfig;
+        }
+
+        public static SshdConfigBuilder defaultBuilder() {
+            return new SshdConfigBuilder(DEFAULT_SSHD_CONFIG);
+        }
+
+        public @NotNull SshdConfigBuilder withHostKey(@NotNull String hostKey) {
+            sshdConfig += "HostKey /etc/ssh/" + Paths.get(hostKey).getFileName() + "\n";
+            return this;
+        }
+
+        public @NotNull SshdConfigBuilder withHostKeyCertificate(@NotNull String hostKeyCertificate) {
+            sshdConfig += "HostCertificate /etc/ssh/" + Paths.get(hostKeyCertificate).getFileName() + "\n";
+            return this;
+        }
+
+        public @NotNull SshdConfigBuilder with(String key, String value) {
+            sshdConfig += key + " " + value + "\n";
+            return this;
+        }
+
+        public @NotNull String build() {
+            return sshdConfig;
+        }
+    }
+
+    public static class Builder implements Consumer<DockerfileBuilder> {
+        private List<String> hostKeys = new ArrayList<>();
+        private List<String> certificates = new ArrayList<>();
+        private @NotNull SshdConfigBuilder sshdConfig = SshdConfigBuilder.defaultBuilder();
+
+        public static Builder defaultBuilder() {
+            Builder b = new Builder();
+
+            return b;
+        }
+
+
+        public @NotNull Builder withSshdConfig(@NotNull SshdConfigBuilder sshdConfig) {
+            this.sshdConfig = sshdConfig;
+            return this;
+        }
+
+        public @NotNull Builder withAllKeys() {
+            this.addHostKey("test-container/ssh_host_ecdsa_key");
+            this.addHostKey("test-container/ssh_host_ed25519_key");
+            this.addHostKey("test-container/host_keys/ssh_host_ecdsa_256_key");
+            this.addHostKey("test-container/host_keys/ssh_host_ecdsa_384_key");
+            this.addHostKey("test-container/host_keys/ssh_host_ecdsa_521_key");
+            this.addHostKey("test-container/host_keys/ssh_host_ed25519_384_key");
+            this.addHostKey("test-container/host_keys/ssh_host_rsa_2048_key");
+            this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_256_key-cert.pub");
+            this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_384_key-cert.pub");
+            this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_521_key-cert.pub");
+            this.addHostKeyCertificate("test-container/host_keys/ssh_host_ed25519_384_key-cert.pub");
+            this.addHostKeyCertificate("test-container/host_keys/ssh_host_rsa_2048_key-cert.pub");
+            return this;
+        }
+
+        public @NotNull SshdContainer build() {
+            return new SshdContainer(buildInner());
+        }
+
+        @NotNull Future<String> buildInner() {
+            return new DebugLoggingImageFromDockerfile()
+                    .withDockerfileFromBuilder(this)
+                    .withFileFromPath(".", Paths.get("src/itest/docker-image"))
+                    .withFileFromString("sshd_config", sshdConfig.build());
+        }
+
+        @Override
+        public void accept(@NotNull DockerfileBuilder builder) {
+            builder.from("alpine:3.19.0");
+            builder.run("apk add --no-cache openssh");
+            builder.expose(22);
+            builder.copy("entrypoint.sh", "/entrypoint.sh");
+
+            builder.add("authorized_keys", "/home/sshj/.ssh/authorized_keys");
+            builder.copy("test-container/trusted_ca_keys", "/etc/ssh/trusted_ca_keys");
+
+            for (String hostKey : hostKeys) {
+                builder.copy(hostKey, "/etc/ssh/" + Paths.get(hostKey).getFileName());
+                builder.copy(hostKey + ".pub", "/etc/ssh/" + Paths.get(hostKey).getFileName() + ".pub");
+            }
+
+            for (String certificate : certificates) {
+                builder.copy(certificate, "/etc/ssh/" + Paths.get(certificate).getFileName());
+            }
+
+
+            builder.run("apk add --no-cache tini"
+                    + " && echo \"root:smile\" | chpasswd"
+                    + " && adduser -D -s /bin/ash sshj"
+                    + " && passwd -u sshj"
+                    + " && echo \"sshj:ultrapassword\" | chpasswd"
+                    + " && chmod 600 /home/sshj/.ssh/authorized_keys"
+                    + " && chmod 600 /etc/ssh/ssh_host_*_key"
+                    + " && chmod 644 /etc/ssh/*.pub"
+                    + " && chmod 755 /entrypoint.sh"
+                    + " && chown -R sshj:sshj /home/sshj");
+            builder.entryPoint("/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2");
+
+            builder.add("sshd_config", "/etc/ssh/sshd_config");
+        }
+
+        public @NotNull Builder addHostKey(@NotNull String hostKey) {
+            hostKeys.add(hostKey);
+            sshdConfig.withHostKey(hostKey);
+            return this;
+        }
+
+        public @NotNull Builder addHostKeyCertificate(@NotNull String hostKeyCertificate) {
+            certificates.add(hostKeyCertificate);
+            sshdConfig.withHostKeyCertificate(hostKeyCertificate);
+            return this;
+        }
+    }
+
+    @SuppressWarnings("unused") // Used dynamically by Spock
+    public SshdContainer() {
+        this(new SshdContainer.Builder().withAllKeys().buildInner());
+    }
+
+    public SshdContainer(SshdContainer.Builder builder) {
+        this(builder.buildInner());
+    }
+
+    public SshdContainer(@NotNull Future<String> future) {
+        super(future);
+        withExposedPorts(22);
+        setWaitStrategy(new SshServerWaitStrategy());
+        withLogConsumer(outputFrame -> {
+            switch (outputFrame.getType()) {
+                case STDOUT:
+                    logger().info("sshd stdout: {}", outputFrame.getUtf8String().stripTrailing());
+                    break;
+                case STDERR:
+                    logger().info("sshd stderr: {}", outputFrame.getUtf8String().stripTrailing());
+                    break;
+                case END:
+                    break;
+
+            }
+        });
+    }
+
+    public SSHClient getConnectedClient(Config config) throws IOException {
+        SSHClient sshClient = new SSHClient(config);
+        sshClient.addHostKeyVerifier(new PromiscuousVerifier());
+        sshClient.connect("127.0.0.1", getFirstMappedPort());
+
+        return sshClient;
+    }
+
+    public SSHClient getConnectedClient() throws IOException {
+        return getConnectedClient(new DefaultConfig());
+    }
+
+    public static void withSshdContainer(SshdContainer.Builder builder, @NotNull ThrowingConsumer<SshdContainer> consumer) throws Throwable {
+        SshdContainer sshdContainer = new SshdContainer(builder.buildInner());
+        sshdContainer.start();
+        try {
+            consumer.accept(sshdContainer);
+        } finally {
+            sshdContainer.stop();
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/sftp/FileWriteTest.java

@@ -0,0 +1,79 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.sftp;
+
+import java.nio.charset.StandardCharsets;
+import java.util.EnumSet;
+
+import org.junit.jupiter.api.Test;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.sftp.OpenMode;
+import net.schmizz.sshj.sftp.RemoteFile;
+import net.schmizz.sshj.sftp.SFTPClient;
+
+import static org.assertj.core.api.Assertions.assertThat;
+import static org.junit.jupiter.api.Assertions.assertArrayEquals;
+
+@Testcontainers
+public class FileWriteTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    @Test
+    public void shouldAppendToFile_GH390() throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            client.authPublickey("sshj", "src/test/resources/id_rsa");
+            try (SFTPClient sftp = client.newSFTPClient()) {
+                String file = "/home/sshj/test.txt";
+                byte[] initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16);
+                byte[] appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16);
+
+                try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) {
+                    initial.write(0, initialText, 0, initialText.length);
+                }
+
+                try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
+                    byte[] readBytes = new byte[initialText.length];
+                    read.read(0, readBytes, 0, readBytes.length);
+                    assertThat(readBytes).isEqualTo(initialText);
+                }
+
+                try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) {
+                    initial.write(0, appendText, 0, appendText.length);
+                }
+
+                try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
+                    byte[] readBytes = new byte[initialText.length + appendText.length];
+                    read.read(0, readBytes, 0, readBytes.length);
+
+                    final byte[] expectedInitialText = new byte[initialText.length];
+                    System.arraycopy(readBytes, 0, expectedInitialText, 0, expectedInitialText.length);
+                    assertArrayEquals(expectedInitialText, initialText);
+
+                    final byte[] expectedAppendText = new byte[appendText.length];
+                    System.arraycopy(readBytes, initialText.length, expectedAppendText, 0, expectedAppendText.length);
+                    assertArrayEquals(expectedAppendText, appendText);
+                }
+            }
+
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/sftp/PutFileCompressedTest.java

@@ -0,0 +1,81 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.sftp;
+
+import com.hierynomus.sshj.SshdContainer;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.sftp.SFTPClient;
+import net.schmizz.sshj.xfer.InMemorySourceFile;
+import org.junit.jupiter.api.Test;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import java.io.ByteArrayInputStream;
+import java.io.IOException;
+import java.io.InputStream;
+import java.util.Random;
+
+@Testcontainers
+public class PutFileCompressedTest {
+
+    private static class TestInMemorySourceFile extends InMemorySourceFile {
+
+        private final String name;
+        private final byte[] data;
+
+        public TestInMemorySourceFile(String name, byte[] data) {
+            this.name = name;
+            this.data = data;
+        }
+
+        @Override
+        public String getName() {
+            return name;
+        }
+
+        @Override
+        public long getLength() {
+            return data.length;
+        }
+
+        @Override
+        public InputStream getInputStream() throws IOException {
+            return new ByteArrayInputStream(data);
+        }
+
+    }
+
+    @Container
+    private static SshdContainer sshd = new SshdContainer();
+
+    @Test
+    public void shouldPutCompressedFile_GH893() throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            client.authPublickey("sshj", "src/test/resources/id_rsa");
+            client.useCompression();
+            try (SFTPClient sftp = client.newSFTPClient()) {
+                String filename = "test.txt";
+                // needs to be a larger file for bug taking effect
+                byte[] content = new byte[5000];
+                Random r = new Random(1);
+                r.nextBytes(content);
+
+                sftp.put(new TestInMemorySourceFile(filename,content), "/home/sshj/");
+            }
+
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/sftp/SftpIntegrationTest.java

@@ -0,0 +1,47 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.sftp;
+
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNull;
+
+import org.junit.jupiter.api.Test;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.sftp.FileAttributes;
+import net.schmizz.sshj.sftp.SFTPClient;
+
+@Testcontainers
+public class SftpIntegrationTest {
+    @Container
+    private static SshdContainer sshd = new SshdContainer();
+
+    @Test
+    public void shouldCheckFileExistsForNonExistingFile_GH894() throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient()) {
+            client.authPublickey("sshj", "src/test/resources/id_rsa");
+            try (SFTPClient sftp = client.newSFTPClient()) {
+                String file = "/home/sshj/i_do_not_exist.txt";
+                FileAttributes exists = sftp.statExistence(file);
+                assertNull(exists);
+            }
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/signature/HostKeyWithCertificateTest.java

@@ -0,0 +1,65 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.signature;
+
+import java.io.File;
+import java.io.StringReader;
+import java.nio.file.Files;
+import java.util.List;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.ValueSource;
+
+import com.hierynomus.sshj.SshdContainer;
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.transport.verification.OpenSSHKnownHosts;
+
+import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+public class HostKeyWithCertificateTest {
+
+    @ParameterizedTest(name = "Should connect to server that has a signed host public key {0}")
+    @ValueSource(strings = { "ssh_host_ecdsa_256_key", "ssh_host_ecdsa_384_key", "ssh_host_ecdsa_521_key",
+            "ssh_host_ed25519_384_key" })
+    // TODO "ssh_host_rsa_2048_key" fails with "HOST_KEY_NOT_VERIFIABLE" after upgrade to new OpenSSH version
+    public void shouldConnectToServerWithSignedHostKey(String hostkey) throws Throwable {
+        File caPubKey = new File("src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub");
+        String caPubKeyContents = Files.readString(caPubKey.toPath());
+        String address = "127.0.0.1";
+
+        SshdConfigBuilder b = SshdConfigBuilder.defaultBuilder().with("PasswordAuthentication", "yes");
+
+        withSshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(b).addHostKey("test-container/host_keys/" + hostkey).addHostKeyCertificate("test-container/host_keys/" + hostkey + "-cert.pub"), sshd -> {
+            String knownHosts = List.of("@cert-authority " + address + " " + caPubKeyContents,
+                    "@cert-authority [" + address + "]:" + sshd.getFirstMappedPort() + " " + caPubKeyContents).stream()
+                    .reduce("", (a, b1) -> a + "\n" + b1);
+            DefaultConfig cfg = new DefaultConfig();
+            try (SSHClient c = new SSHClient(cfg)) {
+                c.addHostKeyVerifier(new OpenSSHKnownHosts(new StringReader(knownHosts)));
+                c.connect(address, sshd.getFirstMappedPort());
+
+                c.authPassword("sshj", "ultrapassword");
+
+                assertTrue(c.isAuthenticated());
+            }
+        });
+
+    }
+}

src/itest/java/com/hierynomus/sshj/signature/PublicKeyAuthWithCertificateTest.java

@@ -0,0 +1,83 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.signature;
+
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+
+@Testcontainers
+public class PublicKeyAuthWithCertificateTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com")).withAllKeys());
+
+    public static Stream<String> keys() {
+        return Stream.of(
+        "id_ecdsa_256_pem_signed_by_ecdsa",
+        "id_ecdsa_256_rfc4716_signed_by_ecdsa",
+        "id_ecdsa_256_pem_signed_by_ed25519",
+        "id_ecdsa_256_rfc4716_signed_by_ed25519",
+        "id_ecdsa_256_pem_signed_by_rsa",
+        "id_ecdsa_256_rfc4716_signed_by_rsa",
+        "id_ecdsa_384_pem_signed_by_ecdsa",
+        "id_ecdsa_384_rfc4716_signed_by_ecdsa",
+        "id_ecdsa_384_pem_signed_by_ed25519",
+        "id_ecdsa_384_rfc4716_signed_by_ed25519",
+        "id_ecdsa_384_pem_signed_by_rsa",
+        "id_ecdsa_384_rfc4716_signed_by_rsa",
+        "id_ecdsa_521_pem_signed_by_ecdsa",
+        "id_ecdsa_521_rfc4716_signed_by_ecdsa",
+        "id_ecdsa_521_pem_signed_by_ed25519",
+        "id_ecdsa_521_rfc4716_signed_by_ed25519",
+        "id_ecdsa_521_pem_signed_by_rsa",
+        "id_ecdsa_521_rfc4716_signed_by_rsa",
+        "id_rsa_2048_pem_signed_by_ecdsa",
+        "id_rsa_2048_rfc4716_signed_by_ecdsa",
+        "id_rsa_2048_pem_signed_by_ed25519",
+        "id_rsa_2048_rfc4716_signed_by_ed25519",
+        "id_rsa_2048_pem_signed_by_rsa",
+        "id_rsa_2048_rfc4716_signed_by_rsa",
+        "id_ed25519_384_rfc4716_signed_by_ecdsa",
+        "id_ed25519_384_rfc4716_signed_by_ed25519",
+        "id_ed25519_384_rfc4716_signed_by_rsa");
+    }
+
+    @ParameterizedTest(name = "should authenticate with signed public key {0}")
+    @MethodSource("keys")
+    public void shouldAuthenticateWithSignedPublicKey(String key) throws Throwable {
+        Config c = new DefaultConfig();
+        SSHClient client = sshd.getConnectedClient(c);
+
+        client.authPublickey("sshj", "src/itest/resources/keyfiles/certificates/" + key);
+
+        assertTrue(client.isAuthenticated());
+
+        client.disconnect();
+    }
+
+}

src/itest/java/com/hierynomus/sshj/signature/SignatureTest.java

@@ -0,0 +1,57 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.signature;
+
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+import java.util.List;
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
+import com.hierynomus.sshj.key.KeyAlgorithms;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+
+@Testcontainers
+public class SignatureTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("HostKeyAlgorithms", "+ssh-rsa").with("PubkeyAcceptedAlgorithms", "+ssh-rsa")).withAllKeys());
+
+    public static Stream<KeyAlgorithms.Factory> algs() {
+        return Stream.of(KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512());
+    }
+
+    @ParameterizedTest(name = "should correctly connect with Signature {0}")
+    @MethodSource("algs")
+    public void shouldCorrectlyConnectWithMac(KeyAlgorithms.Factory alg) throws Throwable {
+        Config c = new DefaultConfig();
+        c.setKeyAlgorithms(List.of(alg));
+        try (SSHClient client = sshd.getConnectedClient(c)) {
+            client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa");
+
+            assertTrue(client.isAuthenticated());
+        }
+    }
+
+}

src/itest/java/com/hierynomus/sshj/transport/cipher/CipherTest.java

@@ -0,0 +1,65 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.transport.cipher;
+
+import static org.junit.Assert.assertTrue;
+
+import java.util.List;
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.common.Factory;
+import net.schmizz.sshj.transport.cipher.Cipher;
+
+@Testcontainers
+public class CipherTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    public static Stream<Factory.Named<Cipher>> ciphers() {
+        return Stream.of(BlockCiphers.TripleDESCBC(),
+                          BlockCiphers.AES128CBC(),
+                          BlockCiphers.AES128CTR(),
+                          BlockCiphers.AES192CBC(),
+                          BlockCiphers.AES192CTR(),
+                          BlockCiphers.AES256CBC(),
+                          BlockCiphers.AES256CTR(),
+                          GcmCiphers.AES128GCM(),
+                          GcmCiphers.AES256GCM(),
+                          ChachaPolyCiphers.CHACHA_POLY_OPENSSH());
+    }
+
+    @ParameterizedTest(name = "should correctly connect with Cipher {0}")
+    @MethodSource("ciphers")
+    public void shouldCorrectlyConnectWithCipher(Factory.Named<Cipher> cipher) throws Throwable {
+        Config c = new DefaultConfig();
+        c.setCipherFactories(List.of(cipher));
+        try (SSHClient client = sshd.getConnectedClient(c)) {
+            client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+            assertTrue(client.isAuthenticated());
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/transport/kex/KexTest.java

@@ -0,0 +1,72 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.transport.kex;
+
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+import java.util.List;
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.common.Factory;
+import net.schmizz.sshj.transport.kex.Curve25519SHA256;
+import net.schmizz.sshj.transport.kex.DHGexSHA1;
+import net.schmizz.sshj.transport.kex.DHGexSHA256;
+import net.schmizz.sshj.transport.kex.ECDHNistP;
+import net.schmizz.sshj.transport.kex.KeyExchange;
+
+@Testcontainers
+public class KexTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    public static Stream<Factory.Named<KeyExchange>> kex() {
+        return Stream.of(
+                DHGroups.Group1SHA1(),
+                DHGroups.Group14SHA1(),
+                DHGroups.Group14SHA256(),
+                DHGroups.Group16SHA512(),
+                DHGroups.Group18SHA512(),
+                new DHGexSHA1.Factory(),
+                new DHGexSHA256.Factory(),
+                new Curve25519SHA256.Factory(),
+                new Curve25519SHA256.FactoryLibSsh(),
+                new ECDHNistP.Factory256(),
+                new ECDHNistP.Factory384(),
+                new ECDHNistP.Factory521());
+    }
+
+    @ParameterizedTest(name = "should correctly connect with Key Exchange {0}")
+    @MethodSource("kex")
+    public void shouldCorrectlyConnectWithMac(Factory.Named<KeyExchange> kex) throws Throwable {
+        Config c = new DefaultConfig();
+        c.setKeyExchangeFactories(List.of(kex));
+        try (SSHClient client = sshd.getConnectedClient(c)) {
+            client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+            assertTrue(client.isAuthenticated());
+        }
+    }
+}

src/itest/java/com/hierynomus/sshj/transport/kex/StrictKeyExchangeTest.java

@@ -0,0 +1,153 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.transport.kex;
+
+import java.util.ArrayList;
+import java.util.List;
+import java.util.stream.Collectors;
+import java.util.stream.Stream;
+
+import ch.qos.logback.classic.Logger;
+import ch.qos.logback.classic.spi.ILoggingEvent;
+import ch.qos.logback.core.read.ListAppender;
+import com.hierynomus.sshj.SshdContainer;
+import net.schmizz.keepalive.KeepAlive;
+import net.schmizz.keepalive.KeepAliveProvider;
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+import net.schmizz.sshj.common.Message;
+import net.schmizz.sshj.common.SSHPacket;
+import net.schmizz.sshj.connection.ConnectionImpl;
+import net.schmizz.sshj.transport.TransportException;
+import org.junit.jupiter.api.AfterEach;
+import org.junit.jupiter.api.BeforeEach;
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.Arguments;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.slf4j.LoggerFactory;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import static org.assertj.core.api.Assertions.assertThat;
+import static org.junit.jupiter.api.Assertions.assertTrue;
+
+@Testcontainers
+class StrictKeyExchangeTest {
+
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    private final List<Logger> watchedLoggers = new ArrayList<>();
+    private final ListAppender<ILoggingEvent> logWatcher = new ListAppender<>();
+
+    @BeforeEach
+    void setUpLogWatcher() {
+        logWatcher.start();
+        setUpLogger("net.schmizz.sshj.transport.Decoder");
+        setUpLogger("net.schmizz.sshj.transport.Encoder");
+        setUpLogger("net.schmizz.sshj.transport.KeyExchanger");
+    }
+
+    @AfterEach
+    void tearDown() {
+        watchedLoggers.forEach(Logger::detachAndStopAllAppenders);
+    }
+
+    private void setUpLogger(String className) {
+        Logger logger = ((Logger) LoggerFactory.getLogger(className));
+        logger.addAppender(logWatcher);
+        watchedLoggers.add(logger);
+    }
+
+    private static Stream<Arguments> strictKeyExchange() {
+        Config defaultConfig = new DefaultConfig();
+        Config heartbeaterConfig = new DefaultConfig();
+        heartbeaterConfig.setKeepAliveProvider(new KeepAliveProvider() {
+            @Override
+            public KeepAlive provide(ConnectionImpl connection) {
+                return new HotLoopHeartbeater(connection);
+            }
+        });
+        return Stream.of(defaultConfig, heartbeaterConfig).map(Arguments::of);
+    }
+
+    @MethodSource
+    @ParameterizedTest
+    void strictKeyExchange(Config config) throws Throwable {
+        try (SSHClient client = sshd.getConnectedClient(config)) {
+            client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+            assertTrue(client.isAuthenticated());
+        }
+        List<String> keyExchangerLogs = getLogs("KeyExchanger");
+        assertThat(keyExchangerLogs).contains(
+            "Initiating key exchange",
+            "Sending SSH_MSG_KEXINIT",
+            "Received SSH_MSG_KEXINIT",
+            "Enabling strict key exchange extension"
+        );
+        List<String> decoderLogs = getLogs("Decoder").stream()
+            .map(log -> log.split(":")[0])
+            .collect(Collectors.toList());
+        assertThat(decoderLogs).startsWith(
+            "Received packet #0",
+            "Received packet #1",
+            "Received packet #2",
+            "Received packet #0",
+            "Received packet #1",
+            "Received packet #2",
+            "Received packet #3"
+        );
+        List<String> encoderLogs = getLogs("Encoder").stream()
+            .map(log -> log.split(":")[0])
+            .collect(Collectors.toList());
+        assertThat(encoderLogs).startsWith(
+            "Encoding packet #0",
+            "Encoding packet #1",
+            "Encoding packet #2",
+            "Encoding packet #0",
+            "Encoding packet #1",
+            "Encoding packet #2",
+            "Encoding packet #3"
+        );
+    }
+
+    private List<String> getLogs(String className) {
+        return logWatcher.list.stream()
+            .filter(event -> event.getLoggerName().endsWith(className))
+            .map(ILoggingEvent::getFormattedMessage)
+            .collect(Collectors.toList());
+    }
+
+    private static class HotLoopHeartbeater extends KeepAlive {
+
+        HotLoopHeartbeater(ConnectionImpl conn) {
+            super(conn, "sshj-Heartbeater");
+        }
+
+        @Override
+        public boolean isEnabled() {
+            return true;
+        }
+
+        @Override
+        protected void doKeepAlive() throws TransportException {
+            conn.getTransport().write(new SSHPacket(Message.IGNORE).putString(""));
+        }
+
+    }
+
+}

src/itest/java/com/hierynomus/sshj/transport/mac/MacTest.java

@@ -0,0 +1,54 @@
+/*
+ * Copyright (C)2009 - SSHJ Contributors
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.hierynomus.sshj.transport.mac;
+
+import static org.junit.Assert.assertTrue;
+
+import java.util.List;
+import java.util.stream.Stream;
+
+import org.junit.jupiter.params.ParameterizedTest;
+import org.junit.jupiter.params.provider.MethodSource;
+import org.testcontainers.junit.jupiter.Container;
+import org.testcontainers.junit.jupiter.Testcontainers;
+
+import com.hierynomus.sshj.SshdContainer;
+
+import net.schmizz.sshj.Config;
+import net.schmizz.sshj.DefaultConfig;
+import net.schmizz.sshj.SSHClient;
+
+@Testcontainers
+public class MacTest {
+    @Container
+    private static final SshdContainer sshd = new SshdContainer();
+
+    public static Stream<Macs.Factory> macs() {
+        return Stream.of(Macs.HMACSHA2256(), Macs.HMACSHA2512(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm());
+    }
+
+    @ParameterizedTest(name = "should correctly connect with MAC {0}")
+    @MethodSource("macs")
+    public void shouldCorrectlyConnectWithMac(Macs.Factory mac) throws Throwable {
+        Config c = new DefaultConfig();
+        c.setMACFactories(List.of(mac));
+        try (SSHClient client = sshd.getConnectedClient(c)) {
+            client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
+
+            assertTrue(client.isAuthenticated());
+        }
+    }
+}

src/itest/resources/keyfiles/certificates/CA_ecdsa.pem

@@ -0,0 +1,9 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAaAAAABNlY2RzYS
+1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQTc/PZPU93pfS6cqTB+kbPDr5/8QurL
+m6vVwaEyvBvcd0OCIn7Dfmwsu4fY7mHRPIreRr4J6TNh0nTwRTKSZxBSAAAAqP36PXj9+j
+14AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBNz89k9T3el9Lpyp
+MH6Rs8Ovn/xC6subq9XBoTK8G9x3Q4IifsN+bCy7h9juYdE8it5GvgnpM2HSdPBFMpJnEF
+IAAAAhAJoGc1L5zMmeORPDxMFTzo47oot8ao0BziAm3NU5ExxOAAAADENBX2VjZHNhLnBl
+bQECAw==
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/CA_ecdsa.pem.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBNz89k9T3el9LpypMH6Rs8Ovn/xC6subq9XBoTK8G9x3Q4IifsN+bCy7h9juYdE8it5GvgnpM2HSdPBFMpJnEFI= CA_ecdsa.pem

src/itest/resources/keyfiles/certificates/CA_ed25519.pem

@@ -0,0 +1,7 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAMwAAAAtzc2gtZW
+QyNTUxOQAAACA6Ya5UWXxyNsSeyCKpqC44tgYdo+2T9I8pwi9E5407hwAAAJhnCXFqZwlx
+agAAAAtzc2gtZWQyNTUxOQAAACA6Ya5UWXxyNsSeyCKpqC44tgYdo+2T9I8pwi9E5407hw
+AAAEBHofpGRYy15jvyiJrPuijusTXmM6bQs6fgegqljUzqwjphrlRZfHI2xJ7IIqmoLji2
+Bh2j7ZP0jynCL0TnjTuHAAAADkNBX2VkMjU1MTkucGVtAQIDBAUGBw==
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/CA_ed25519.pem.pub

@@ -0,0 +1 @@
+ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDphrlRZfHI2xJ7IIqmoLji2Bh2j7ZP0jynCL0TnjTuH CA_ed25519.pem

src/itest/resources/keyfiles/certificates/CA_rsa.pem

@@ -0,0 +1,38 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAABlwAAAAdzc2gtcn
+NhAAAAAwEAAQAAAYEAylFXh7HVmrZPMpI/uDVesACwaypsa8p7oGNeolrU5rI+BxMlZksN
+UKI1qmoygYJ2oCfMEoipXCPGF3LU4/tzkG89kb2WO6OUCIGFDm302s36Na/qkTfDebkwUN
+WHud4a+v3ArwgaEh61+kbr/AnfI4AXWxCQLCAN/sF+RsyrUh/6rJMMXsjd/PJqphf/rUFH
+aLK2k3FpVXDWDXkQp1EeRRzvrQvSRUXBaSbIAWkr5k85qX2lEcpr2aL/dNFdxDbRmcEHPP
+GXhuydecRYguEFLGy2gQX3iEcot66gqX2Q/H82oq/CMgSq1T+YTuL5oAT1Z/qdHQI62UE+
+yPFm1/YBzavJQJ38Rx0CoMY7BnLibWzQbkRAxNTW5YKAYHLPoM9YIIMJp1CrQZoAKNw7IF
+zLm2tSobFioO+ZkKCrogO/VsYUOUXHV7E7EgAq6u6JV082f5z6HscSZ4z444mrWuOJsPuR
+TAwrRxyFXOmMjbHALx5xAX2N4UYFyihrzo47rmg9AAAFgHGJKn5xiSp+AAAAB3NzaC1yc2
+EAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGC
+dqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK
+8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw
+1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWI
+LhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2r
+yUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYq
+DvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzp
+jI2xwC8ecQF9jeFGBcooa86OO65oPQAAAAMBAAEAAAGAc0imd8v9y4rW1ho/9Nd0fRXncS
+lbXpCioWH+KsVXS52FesKOLRvXGntT2SdqYCHXNqt2vZjh6H76AaKNbNt7nnHEw6ckVBeB
+4tbq2q4NOCDm0nDLWLRNzq6XuXfzPxYwiZTOlu4m7OxTBaokDhoR7EixBlMJ1Brv3pqjOf
+SmKsXOMUgZZGlRFTGNU9eY+UCZUC+Fmb6mJumFD2hM9QpkFT3H1PNHffGhpClVDni/axz5
+3nqZ9OlDS2B18DrdE1GoWhxvnX2nOpKZ+dSKAflyczQI9qOx0FczRuTmnjPz9jYLzTKPfi
+Pw9vkUxNiyJSkYgPMWODDwXCz0frv0n5ZUQvFrtQVjls+fHdoj3qnRYFAvgPgT8LLWE+SD
+SEvWXob6tldI9tTL4Ymx/9FsI5mvcGDhMQtK0YX1mwFBIUq3CRQD6CMd6oDcK1rpn7cQ2z
+AdI+MUdoTjDTr+sIr7ijcLvz1l/PHrFpmb5OCKr0HkVhfQHu8z1Est1ZL4ioQ1Y1ABAAAA
+wF07au4kjHZueAR+MSmD0uBzdZneq/2l5IXEtl4eC5gs2pNpkd4zoa1NhvimFqk2xgAN96
+k6sUXW/sJT+D/AC6heOC/DRUuemHcSyOpSosmGVf56WzC5eDXzrqNbyb6UEA/XshSW3lR5
+VZBO/gVMv0I5qWdTcvDbgAa6mi/gzRkZ6MqJ+zzaXyfz/W6wVD7v2PJAZB9GhNDTpA2UOC
+T3Z1Lk8i4hLX6r18AwYnh7f26LI5ZAMNv2kT98J5qZIV0ntwAAAMEA79Md+2SofgHcurgn
+O3xfH5EgLemF6X/KQTRojuVzlUiId2koMVk1iCv/a5wDqPwvU0kWJtd9RIzm+DeOzTlBwL
+49U3PSr0A4XFwU4Z6/9TlNFpqDbGIiPfFmnhwgi4iOtIHSUm/OdmX4ys0meDERDMCq1g0C
+rTLy9MtpUTv6oiAYLCk6N3lz7059R9394BQR2VoMoyvVmpbwReVqzx7HHb4i/YgdqiaSae
+NUyGv1/G5g0Lko+hFb+rZnCtTREHsdAAAAwQDX9p5+cXsLJygzppmK7yXalBmm0nWmnTnX
+faLp7qPOBxBsOCVno3Ud2BGNodcMkJPG9V8t1jnfFoEyAvq7eJxXCN3s1ACZDAXXp8dtWE
+1lUzZyX6uERljp2jXACpK2v3wBDNjoTr8GuQzJTi0U77YZ2iMs9HjDJFytAZjyl1dTZL5v
+jwTOZx17YQb0qfzAtkKQwxb8o54TK+p7yv8/vZb86WC+qtNsOrQAbhcyNhSeNBQz18oBwX
+tMsqKBf4Eo96EAAAAKQ0FfcnNhLnBlbQE=
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub

@@ -0,0 +1 @@
+ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABgQDKUVeHsdWatk8ykj+4NV6wALBrKmxrynugY16iWtTmsj4HEyVmSw1QojWqajKBgnagJ8wSiKlcI8YXctTj+3OQbz2RvZY7o5QIgYUObfTazfo1r+qRN8N5uTBQ1Ye53hr6/cCvCBoSHrX6Ruv8Cd8jgBdbEJAsIA3+wX5GzKtSH/qskwxeyN388mqmF/+tQUdosraTcWlVcNYNeRCnUR5FHO+tC9JFRcFpJsgBaSvmTzmpfaURymvZov900V3ENtGZwQc88ZeG7J15xFiC4QUsbLaBBfeIRyi3rqCpfZD8fzair8IyBKrVP5hO4vmgBPVn+p0dAjrZQT7I8WbX9gHNq8lAnfxHHQKgxjsGcuJtbNBuREDE1NblgoBgcs+gz1gggwmnUKtBmgAo3DsgXMuba1KhsWKg75mQoKuiA79WxhQ5RcdXsTsSACrq7olXTzZ/nPoexxJnjPjjiata44mw+5FMDCtHHIVc6YyNscAvHnEBfY3hRgXKKGvOjjuuaD0= CA_rsa.pem

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ecdsa

@@ -0,0 +1,5 @@
+-----BEGIN EC PRIVATE KEY-----
+MHcCAQEEIIfJPrGJGZ7jWfxLWoA4DLK4UX8xeKPZBhpRW8Lf6+C3oAoGCCqGSM49
+AwEHoUQDQgAE5Hdnjy/w72a9P3sSQd57DJayX9m75p1N/W1mh3IDIrI6xIOVeu6g
+w0KbBSExvjsS6TrtJPgGo9XTFp2LcQBDkw==
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ecdsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgpQb0g0drrzK2coGjm7xOG0FeIl5pqEoNhbY9VbmEJzsAAAAIbmlzdHAyNTYAAABBBOR3Z48v8O9mvT97EkHeewyWsl/Zu+adTf1tZodyAyKyOsSDlXruoMNCmwUhMb47Euk67ST4BqPV0xadi3EAQ5MAAAAAAAAAAAAAAAEAAAAgaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfZWNkc2EAAAAIAAAABHNzaGoAAAAAAAAAAP//////////AAAAAAAAAIIAAAAVcGVybWl0LVgxMS1mb3J3YXJkaW5nAAAAAAAAABdwZXJtaXQtYWdlbnQtZm9yd2FyZGluZwAAAAAAAAAWcGVybWl0LXBvcnQtZm9yd2FyZGluZwAAAAAAAAAKcGVybWl0LXB0eQAAAAAAAAAOcGVybWl0LXVzZXItcmMAAAAAAAAAAAAAAGgAAAATZWNkc2Etc2hhMi1uaXN0cDI1NgAAAAhuaXN0cDI1NgAAAEEE3Pz2T1Pd6X0unKkwfpGzw6+f/ELqy5ur1cGhMrwb3HdDgiJ+w35sLLuH2O5h0TyK3ka+CekzYdJ08EUykmcQUgAAAGQAAAATZWNkc2Etc2hhMi1uaXN0cDI1NgAAAEkAAAAhAPdi7qLZdHYtpNiaQlzT+p//KduiWy3B4o3g+8qmTrywAAAAIGrPimSBL8JTI0YuRzS54Vg90r52aTkRmtOKBXkd7mbx id_ecdsa_256_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ecdsa.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBOR3Z48v8O9mvT97EkHeewyWsl/Zu+adTf1tZodyAyKyOsSDlXruoMNCmwUhMb47Euk67ST4BqPV0xadi3EAQ5M= id_ecdsa_256_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ecdsa_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgl67ZVJD8No6A02obFMo6hs8Ldt14DeO6b58RWpAiPycAAAAIbmlzdHAyNTYAAABBBOR3Z48v8O9mvT97EkHeewyWsl/Zu+adTf1tZodyAyKyOsSDlXruoMNCmwUhMb47Euk67ST4BqPV0xadi3EAQ5MAAAAAAAAAAAAAAAIAAAAgaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfZWNkc2EAAAANAAAACTEyNy4wLjAuMQAAAAAAAAAA//////////8AAAAAAAAAAAAAAAAAAABoAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBNz89k9T3el9LpypMH6Rs8Ovn/xC6subq9XBoTK8G9x3Q4IifsN+bCy7h9juYdE8it5GvgnpM2HSdPBFMpJnEFIAAABkAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAABJAAAAIFO6PcSIVKhcnYZRRLes2qPZMpq7P+UDW20vYQn9aQltAAAAIQC877vpE4EbsJuyymmw/T7NsjmVcQnH/U6WjwZCODxI1g== id_ecdsa_256_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ed25519

@@ -0,0 +1,5 @@
+-----BEGIN EC PRIVATE KEY-----
+MHcCAQEEIFEVp4a/QxSG2pwM8l2yK17tTC3f98FOd4NAUECN0jZcoAoGCCqGSM49
+AwEHoUQDQgAEfz2MGBoHybmWH1pCMKn0u7sLeyDiH5HedZGmQFniDZSUHJErbpaA
+pRhnoR12OHyNpblTd3UhpOJl76tp/2Ht+A==
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ed25519-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgjgBeNTL1MzUsswy1BYjpiftZ9C9PEGvM6vngt6hJL/EAAAAIbmlzdHAyNTYAAABBBH89jBgaB8m5lh9aQjCp9Lu7C3sg4h+R3nWRpkBZ4g2UlByRK26WgKUYZ6Eddjh8jaW5U3d1IaTiZe+raf9h7fgAAAAAAAAAAAAAAAEAAAAiaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfZWQyNTUxOQAAAAgAAAAEc3NoagAAAAAAAAAA//////////8AAAAAAAAAggAAABVwZXJtaXQtWDExLWZvcndhcmRpbmcAAAAAAAAAF3Blcm1pdC1hZ2VudC1mb3J3YXJkaW5nAAAAAAAAABZwZXJtaXQtcG9ydC1mb3J3YXJkaW5nAAAAAAAAAApwZXJtaXQtcHR5AAAAAAAAAA5wZXJtaXQtdXNlci1yYwAAAAAAAAAAAAAAMwAAAAtzc2gtZWQyNTUxOQAAACA6Ya5UWXxyNsSeyCKpqC44tgYdo+2T9I8pwi9E5407hwAAAFMAAAALc3NoLWVkMjU1MTkAAABAfg65fi6me4HL37NLoLi+9NeAZFHPfS5PfNLbx5ZAvA/wOrV//NlFMiiJ6lAuTLQtQU8WMESDZbf7diSDQI34BQ== id_ecdsa_256_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ed25519.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBH89jBgaB8m5lh9aQjCp9Lu7C3sg4h+R3nWRpkBZ4g2UlByRK26WgKUYZ6Eddjh8jaW5U3d1IaTiZe+raf9h7fg= id_ecdsa_256_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_ed25519_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgAfBLm5SO2/sG021RdO4S+q1AVpdahAz3jx3XIBMX/DcAAAAIbmlzdHAyNTYAAABBBH89jBgaB8m5lh9aQjCp9Lu7C3sg4h+R3nWRpkBZ4g2UlByRK26WgKUYZ6Eddjh8jaW5U3d1IaTiZe+raf9h7fgAAAAAAAAAAAAAAAIAAAAiaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfZWQyNTUxOQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAADMAAAALc3NoLWVkMjU1MTkAAAAgOmGuVFl8cjbEnsgiqaguOLYGHaPtk/SPKcIvROeNO4cAAABTAAAAC3NzaC1lZDI1NTE5AAAAQD/r1H8JDNXac/XsQr5pxLKAa2EkBtitlyjQlAWX3UlBdm00r9NfcNa0qOhYEAITA2ipM0Kox43KzkSIB9N8yw4= id_ecdsa_256_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_rsa

@@ -0,0 +1,5 @@
+-----BEGIN EC PRIVATE KEY-----
+MHcCAQEEIOzGWqHfgD0W/1E3lozWoK0EGi/fh07uw1YR9K3y/EA/oAoGCCqGSM49
+AwEHoUQDQgAECRvqxweOpIpe/gX/0htrI+ZH0gqPT9YYxrIrGJKGJ4X3g24tqyI/
+VAJGyJ3e/bAE1Mnlm4EAN08cokWUOF+wOg==
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_rsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgb79Hsx9T9VAh4/hyezWkS4le/m0+YLq9sUXAme7QiRQAAAAIbmlzdHAyNTYAAABBBAkb6scHjqSKXv4F/9IbayPmR9IKj0/WGMayKxiShieF94NuLasiP1QCRsid3v2wBNTJ5ZuBADdPHKJFlDhfsDoAAAAAAAAAAAAAAAEAAAAeaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfcnNhAAAACAAAAARzc2hqAAAAAAAAAAD//////////wAAAAAAAACCAAAAFXBlcm1pdC1YMTEtZm9yd2FyZGluZwAAAAAAAAAXcGVybWl0LWFnZW50LWZvcndhcmRpbmcAAAAAAAAAFnBlcm1pdC1wb3J0LWZvcndhcmRpbmcAAAAAAAAACnBlcm1pdC1wdHkAAAAAAAAADnBlcm1pdC11c2VyLXJjAAAAAAAAAAAAAAGXAAAAB3NzaC1yc2EAAAADAQABAAABgQDKUVeHsdWatk8ykj+4NV6wALBrKmxrynugY16iWtTmsj4HEyVmSw1QojWqajKBgnagJ8wSiKlcI8YXctTj+3OQbz2RvZY7o5QIgYUObfTazfo1r+qRN8N5uTBQ1Ye53hr6/cCvCBoSHrX6Ruv8Cd8jgBdbEJAsIA3+wX5GzKtSH/qskwxeyN388mqmF/+tQUdosraTcWlVcNYNeRCnUR5FHO+tC9JFRcFpJsgBaSvmTzmpfaURymvZov900V3ENtGZwQc88ZeG7J15xFiC4QUsbLaBBfeIRyi3rqCpfZD8fzair8IyBKrVP5hO4vmgBPVn+p0dAjrZQT7I8WbX9gHNq8lAnfxHHQKgxjsGcuJtbNBuREDE1NblgoBgcs+gz1gggwmnUKtBmgAo3DsgXMuba1KhsWKg75mQoKuiA79WxhQ5RcdXsTsSACrq7olXTzZ/nPoexxJnjPjjiata44mw+5FMDCtHHIVc6YyNscAvHnEBfY3hRgXKKGvOjjuuaD0AAAGUAAAADHJzYS1zaGEyLTUxMgAAAYCLm55D5nwIJNNCPidXas09UpeBc7FO5SBNq2rzOWeFkLcqfEq6uYJvX5/Va/zq9TCW+m1lQrVsqZVa3Ks4lKz44IBzyqBBpWcfgqNcXOc7wltSW8tfIsmQvSMODMn+bKSQzMWPSt3gjgHFylL4iNbCVSpHmPL3UjhUJurJrtIhTyYtZD6AVZvRS7J07eOTWIl0dx2txJ2xn2fRSx9jkpPDPsuHVB/scE5lm2cqFT5UMe3TVo4jSy6yMqnp+iIThMydsTsq8dFzg8PMFQdCD6MK+zjOPTnKW9wYCuQkjN8/9Ln6imWcpkYNGQsBJiPb1qMUxPzrUnUYMXvjUpzjBiiFaugshmuLFSKxEDSWkjHw6TGAagylOH7vItcptULNmcBrq2gDbI/Pl71aFVFjooOnjeWSmLoAcEIT+2K2e8YMOcC1eBCltVo9hhnfzRLrnV0ss1NI0cP9m0uBri7O77+NPA+TrMMTybe4x3gMzHobEKDrZlyNwJfHUA+vdzCJNQ4= id_ecdsa_256_pem_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_rsa.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBAkb6scHjqSKXv4F/9IbayPmR9IKj0/WGMayKxiShieF94NuLasiP1QCRsid3v2wBNTJ5ZuBADdPHKJFlDhfsDo= id_ecdsa_256_pem_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_pem_signed_by_rsa_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAg39MCdE+TdsgibyL9pdV+Oip06sFgPj7Lldoa8Mdrr6EAAAAIbmlzdHAyNTYAAABBBAkb6scHjqSKXv4F/9IbayPmR9IKj0/WGMayKxiShieF94NuLasiP1QCRsid3v2wBNTJ5ZuBADdPHKJFlDhfsDoAAAAAAAAAAAAAAAIAAAAeaWRfZWNkc2FfMjU2X3BlbV9zaWduZWRfYnlfcnNhAAAADQAAAAkxMjcuMC4wLjEAAAAAAAAAAP//////////AAAAAAAAAAAAAAAAAAABlwAAAAdzc2gtcnNhAAAAAwEAAQAAAYEAylFXh7HVmrZPMpI/uDVesACwaypsa8p7oGNeolrU5rI+BxMlZksNUKI1qmoygYJ2oCfMEoipXCPGF3LU4/tzkG89kb2WO6OUCIGFDm302s36Na/qkTfDebkwUNWHud4a+v3ArwgaEh61+kbr/AnfI4AXWxCQLCAN/sF+RsyrUh/6rJMMXsjd/PJqphf/rUFHaLK2k3FpVXDWDXkQp1EeRRzvrQvSRUXBaSbIAWkr5k85qX2lEcpr2aL/dNFdxDbRmcEHPPGXhuydecRYguEFLGy2gQX3iEcot66gqX2Q/H82oq/CMgSq1T+YTuL5oAT1Z/qdHQI62UE+yPFm1/YBzavJQJ38Rx0CoMY7BnLibWzQbkRAxNTW5YKAYHLPoM9YIIMJp1CrQZoAKNw7IFzLm2tSobFioO+ZkKCrogO/VsYUOUXHV7E7EgAq6u6JV082f5z6HscSZ4z444mrWuOJsPuRTAwrRxyFXOmMjbHALx5xAX2N4UYFyihrzo47rmg9AAABlAAAAAxyc2Etc2hhMi01MTIAAAGAu9U1TrUpxb5Iq1/3i5gvgiUk+Pr8ckCJ1X2v2g0wJF1iDRgt1ynL5o842Va0dND8r/tlYuXiXDY+nVK3P5e+Qdyq7ORbbibqDfJXpXN3WRCY4IjXzAWBUh2h8ywDTBgpbvBdcv0ITOF8V9w8LwCzFMqAEAf9ZvxqNA33qJjUXpP/XFwrkK81VJo4XNPXFf5NXRrUn7nDDU2QMyzfLYJwErNVV8iw/U/cef9ens1M15IX8yrMJxCQb7JQkvKeUPrs6ALa4lgvMISl1/jDEQ4nCw0YrXC9rWOTr71HS7SZrw3KLJQYyQNGBjqc4n4BqhPUYf9ac+w1trKBMtw0tFKjVEzsjg6dpYMr5cIon6Gm1N9GWV6pRcghkDoC3qbSUDbvqFWUOt9HAuiFUpye4BxP/W52PM63xVJhkOQ0DpQbCM2W7KWj6E/KjHlFeoTPzy3GmG3KBUrl1nQK5HSriuINyLZAq6Q8AUhekG8Td52rucU9WYfz1W6J7XrdEy73jsVT id_ecdsa_256_pem_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ecdsa

@@ -0,0 +1,9 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAaAAAABNlY2RzYS
+1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQSg88EiIHWvzomLE8ahdjrqE0iZnrCZ
+5bBy1uZj/QiOvJcyWeV8G7nTmyGhDSzE2BVZNmK7tjK1h7QKCcn7gLZqAAAAwEc6tF1HOr
+RdAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBKDzwSIgda/OiYsT
+xqF2OuoTSJmesJnlsHLW5mP9CI68lzJZ5XwbudObIaENLMTYFVk2Yru2MrWHtAoJyfuAtm
+oAAAAhAN2usDXl6owiRjz99e5lTmsGwFY1qtPlDBP+G4d4pBbhAAAAJGlkX2VjZHNhXzI1
+Nl9yZmM0NzE2X3NpZ25lZF9ieV9lY2RzYQECAw==
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ecdsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgpwwYrqrCZSI5imMxVTHnzFZSDW3NvYfLaFMiKCvegaAAAAAIbmlzdHAyNTYAAABBBKDzwSIgda/OiYsTxqF2OuoTSJmesJnlsHLW5mP9CI68lzJZ5XwbudObIaENLMTYFVk2Yru2MrWHtAoJyfuAtmoAAAAAAAAAAAAAAAEAAAAkaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X2VjZHNhAAAACAAAAARzc2hqAAAAAAAAAAD//////////wAAAAAAAACCAAAAFXBlcm1pdC1YMTEtZm9yd2FyZGluZwAAAAAAAAAXcGVybWl0LWFnZW50LWZvcndhcmRpbmcAAAAAAAAAFnBlcm1pdC1wb3J0LWZvcndhcmRpbmcAAAAAAAAACnBlcm1pdC1wdHkAAAAAAAAADnBlcm1pdC11c2VyLXJjAAAAAAAAAAAAAABoAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBNz89k9T3el9LpypMH6Rs8Ovn/xC6subq9XBoTK8G9x3Q4IifsN+bCy7h9juYdE8it5GvgnpM2HSdPBFMpJnEFIAAABkAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAABJAAAAIQD7GTHsM19ZtnntVYvFz3dJZZh5ZyJz2OeNPbUTEtBTiQAAACA1Zanogf6uUgFnjNS1KwOhSUqzKwtQ+Db7c6DV2HFN8g== id_ecdsa_256_rfc4716_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ecdsa.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBKDzwSIgda/OiYsTxqF2OuoTSJmesJnlsHLW5mP9CI68lzJZ5XwbudObIaENLMTYFVk2Yru2MrWHtAoJyfuAtmo= id_ecdsa_256_rfc4716_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ecdsa_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAg0cIXSpmbkGXAqBI2MfH9tpCITWA28bvcPogKDHk2+aUAAAAIbmlzdHAyNTYAAABBBKDzwSIgda/OiYsTxqF2OuoTSJmesJnlsHLW5mP9CI68lzJZ5XwbudObIaENLMTYFVk2Yru2MrWHtAoJyfuAtmoAAAAAAAAAAAAAAAIAAAAkaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X2VjZHNhAAAADQAAAAkxMjcuMC4wLjEAAAAAAAAAAP//////////AAAAAAAAAAAAAAAAAAAAaAAAABNlY2RzYS1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQTc/PZPU93pfS6cqTB+kbPDr5/8QurLm6vVwaEyvBvcd0OCIn7Dfmwsu4fY7mHRPIreRr4J6TNh0nTwRTKSZxBSAAAAZQAAABNlY2RzYS1zaGEyLW5pc3RwMjU2AAAASgAAACEAm95yiB9YDmtQJR1Eqeg9Di5GAu0BmbIIVQXKqAmbNgkAAAAhAOCYC23uX7C1wSo4uHcDnIkN1fwjTkrmzryLbGQvI10R id_ecdsa_256_rfc4716_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ed25519

@@ -0,0 +1,9 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAaAAAABNlY2RzYS
+1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQSSlaBbx7IhGpFNz0AJjNS9ltz3Pt+7
+qI5PPwRJKq5qIdJiejYjE4G4/kHSacJXYj9AsmSIkWq8blhW099x+MmiAAAAwNnay43Z2s
+uNAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBJKVoFvHsiEakU3P
+QAmM1L2W3Pc+37uojk8/BEkqrmoh0mJ6NiMTgbj+QdJpwldiP0CyZIiRarxuWFbT33H4ya
+IAAAAhAIAiz2os7YuPnqIHiRnHhQjcnm2y/D8WJ35paiWs1RVGAAAAJmlkX2VjZHNhXzI1
+Nl9yZmM0NzE2X3NpZ25lZF9ieV9lZDI1NTE5AQ==
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ed25519-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAg8EviOh4kJ/RDObpq9OJjY1v55378bby2aNotrPon6XsAAAAIbmlzdHAyNTYAAABBBJKVoFvHsiEakU3PQAmM1L2W3Pc+37uojk8/BEkqrmoh0mJ6NiMTgbj+QdJpwldiP0CyZIiRarxuWFbT33H4yaIAAAAAAAAAAAAAAAEAAAAmaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X2VkMjU1MTkAAAAIAAAABHNzaGoAAAAAAAAAAP//////////AAAAAAAAAIIAAAAVcGVybWl0LVgxMS1mb3J3YXJkaW5nAAAAAAAAABdwZXJtaXQtYWdlbnQtZm9yd2FyZGluZwAAAAAAAAAWcGVybWl0LXBvcnQtZm9yd2FyZGluZwAAAAAAAAAKcGVybWl0LXB0eQAAAAAAAAAOcGVybWl0LXVzZXItcmMAAAAAAAAAAAAAADMAAAALc3NoLWVkMjU1MTkAAAAgOmGuVFl8cjbEnsgiqaguOLYGHaPtk/SPKcIvROeNO4cAAABTAAAAC3NzaC1lZDI1NTE5AAAAQOlUU8WMaF/szvw9K79abfnTNCLr1k6QZyQnbZR8d1hW5+TlhI6020enha0TApG6zwLPuQ28LZstnpSpKehoYwo= id_ecdsa_256_rfc4716_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ed25519.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBJKVoFvHsiEakU3PQAmM1L2W3Pc+37uojk8/BEkqrmoh0mJ6NiMTgbj+QdJpwldiP0CyZIiRarxuWFbT33H4yaI= id_ecdsa_256_rfc4716_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_ed25519_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgrJTOkSNe36/l/T13/eKF59eow8nik6PMBXKDJc52ODwAAAAIbmlzdHAyNTYAAABBBJKVoFvHsiEakU3PQAmM1L2W3Pc+37uojk8/BEkqrmoh0mJ6NiMTgbj+QdJpwldiP0CyZIiRarxuWFbT33H4yaIAAAAAAAAAAAAAAAIAAAAmaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X2VkMjU1MTkAAAANAAAACTEyNy4wLjAuMQAAAAAAAAAA//////////8AAAAAAAAAAAAAAAAAAAAzAAAAC3NzaC1lZDI1NTE5AAAAIDphrlRZfHI2xJ7IIqmoLji2Bh2j7ZP0jynCL0TnjTuHAAAAUwAAAAtzc2gtZWQyNTUxOQAAAECrlWp1E6MWq80NGW5i4gpWH/hKwEJlsoKMokLUi1GilQuMaS0FPrFl4XJR44fCZKKuugaoouL8zxUgficeVOYM id_ecdsa_256_rfc4716_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_rsa

@@ -0,0 +1,9 @@
+-----BEGIN OPENSSH PRIVATE KEY-----
+b3BlbnNzaC1rZXktdjEAAAAABG5vbmUAAAAEbm9uZQAAAAAAAAABAAAAaAAAABNlY2RzYS
+1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQR1fMdT7FYIpIo+4hhd5oOgHk6uW79B
+HVscKp83yPhFylnG4NtpF7anAWTcpl5aB9eJVWTCP5KVvlVLVkxUSRDwAAAAwITPM06Ezz
+NOAAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7i
+GF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEP
+AAAAAhAP21AnkkpifUJgiBSYk7YhOfcwC4VfMB3n+BBln73VnmAAAAImlkX2VjZHNhXzI1
+Nl9yZmM0NzE2X3NpZ25lZF9ieV9yc2EBAgMEBQ==
+-----END OPENSSH PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_rsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAg1VzZYeBstzrnExtKXoHjWcKOPy0he5FfNQfyJop5fWoAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7iGF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEPAAAAAAAAAAAAAAAAEAAAAiaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQAAAAgAAAAEc3NoagAAAAAAAAAA//////////8AAAAAAAAAggAAABVwZXJtaXQtWDExLWZvcndhcmRpbmcAAAAAAAAAF3Blcm1pdC1hZ2VudC1mb3J3YXJkaW5nAAAAAAAAABZwZXJtaXQtcG9ydC1mb3J3YXJkaW5nAAAAAAAAAApwZXJtaXQtcHR5AAAAAAAAAA5wZXJtaXQtdXNlci1yYwAAAAAAAAAAAAABlwAAAAdzc2gtcnNhAAAAAwEAAQAAAYEAylFXh7HVmrZPMpI/uDVesACwaypsa8p7oGNeolrU5rI+BxMlZksNUKI1qmoygYJ2oCfMEoipXCPGF3LU4/tzkG89kb2WO6OUCIGFDm302s36Na/qkTfDebkwUNWHud4a+v3ArwgaEh61+kbr/AnfI4AXWxCQLCAN/sF+RsyrUh/6rJMMXsjd/PJqphf/rUFHaLK2k3FpVXDWDXkQp1EeRRzvrQvSRUXBaSbIAWkr5k85qX2lEcpr2aL/dNFdxDbRmcEHPPGXhuydecRYguEFLGy2gQX3iEcot66gqX2Q/H82oq/CMgSq1T+YTuL5oAT1Z/qdHQI62UE+yPFm1/YBzavJQJ38Rx0CoMY7BnLibWzQbkRAxNTW5YKAYHLPoM9YIIMJp1CrQZoAKNw7IFzLm2tSobFioO+ZkKCrogO/VsYUOUXHV7E7EgAq6u6JV082f5z6HscSZ4z444mrWuOJsPuRTAwrRxyFXOmMjbHALx5xAX2N4UYFyihrzo47rmg9AAABlAAAAAxyc2Etc2hhMi01MTIAAAGABeiDaBt62xlJ7H5/ek8KPwqfhhyKV1+w9PLSchd8Y5KyK25iTtYO/SNAeuiJuSCZGk4NgJ+FzEHmvbpYtF57kvHUddQ3+0jJIvjQev1RDwLDkuCiDtzYCgtSGW2K7KXPpap4PrShDfmlt/VUN5Dt2ELi2f0hekSS638et3NnaF8SGpLhdU5IiV5jXbYH/7sdUDT4hxIwb7FnZzL8Zt1TtMRz8NtSlIhTDVA6BRNiVunkHYkvqIpA1Rd4/zD2udWV8CZTyW+TL3ULJU94pk8Bm19X9JGNbSA/7VvVOQiBqk+eIgc4kXl7Gyp6IbtNODkJ8yN3CrwiO5k0nCTVC0STHKcPexVulqWWlwQgLD8GppNHzyW0mvdjx5oLdpMH9octCUIXfdF/lW1wH1FgEIa9NUQXX3C+FkhFD46IgOK+mmk6YR9np1a0QqXnGcQnjjjxeVtEiG91ywz9i09MvYRAsslkpB8+ce8xylq+dkie8ppkkeGqChu5jF4mYDq1iGzS id_ecdsa_256_rfc4716_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_rsa.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7iGF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEPA= id_ecdsa_256_rfc4716_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_256_rfc4716_signed_by_rsa_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp256-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAyNTYtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgQgbM6lYD+Yx1aendIKHYuKthkIN0WhvPdMA0DbC/QmEAAAAIbmlzdHAyNTYAAABBBHV8x1PsVgikij7iGF3mg6AeTq5bv0EdWxwqnzfI+EXKWcbg22kXtqcBZNymXloH14lVZMI/kpW+VUtWTFRJEPAAAAAAAAAAAAAAAAIAAAAiaWRfZWNkc2FfMjU2X3JmYzQ3MTZfc2lnbmVkX2J5X3JzYQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAAZcAAAAHc3NoLXJzYQAAAAMBAAEAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGCdqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWILhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2ryUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYqDvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzpjI2xwC8ecQF9jeFGBcooa86OO65oPQAAAZQAAAAMcnNhLXNoYTItNTEyAAABgAOa69XTj4yOPjKtN5Few84Y2qj4p/4RK9yiAjWWxbMQv+dlLzEH/wtj6p1SeDJozFssVfyH2ODFGY9Dct3K4SbLA1b8LfM6vaf1bUxdQz7njsQ40KpcJu662hMOkj9AKTQgpVUVgJJOQuLrIbyfjKClaqt2W6ziH2eLn7wPsZ6HGhQMALQVmebzgFepnwCve9wgX1HNOfuAYYVQwFXddi/xQ4BIVmsH6E3DcUUzjtZZaG063CddPYOW2Ea1efWqHu20FRWqsMnwbL6Hr9JkjKv/Iub8mgLMP1bhbMEblb+tQ+y9RRvPwjT89tKljc7hXvBxpHA4c4ZlnTidsjqPHVeARCt5LV4lES7HWEZ+kFIkGndNLYXOUnxgk6iSLLHVVZUCZPbUiZbSJdoj7r7LGiz4KA7mnqQQGU2jWxSI2drD5T6SW0TFspzjX4dPnJyzFpe02Fl+NvblUUHsnPTHdsRexHRNfqkQhKIO4i8AM8U02nU/uBmXFPb9ANbLcq+Npw== id_ecdsa_256_rfc4716_signed_by_rsa

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ecdsa

@@ -0,0 +1,6 @@
+-----BEGIN EC PRIVATE KEY-----
+MIGkAgEBBDDnWxfGM8iNcn6VgKlVmVdrMm6KbhlGYnH0G2XNpwJhQsvnDsoL4N8M
+ojKTfWH1U7ugBwYFK4EEACKhZANiAASrxIDF2kzXSeiwRWVA9sEJf8/SB05JFK+g
+e6KBOr/tvv6EISb8wVMmkAGUb5oLL6EgaZ9d1q6w3pThW2dC4bQyP7B1W4TaKZCR
+wF8EH+zvOP6QROzxFbXzCAiCjcvbcB0=
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ecdsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgr2RJOHA5xgXoG2b1eRDnXKgzD+BsxXrqiWI8GxlHMGMAAAAIbmlzdHAzODQAAABhBKvEgMXaTNdJ6LBFZUD2wQl/z9IHTkkUr6B7ooE6v+2+/oQhJvzBUyaQAZRvmgsvoSBpn13WrrDelOFbZ0LhtDI/sHVbhNopkJHAXwQf7O84/pBE7PEVtfMICIKNy9twHQAAAAAAAAAAAAAAAQAAACBpZF9lY2RzYV8zODRfcGVtX3NpZ25lZF9ieV9lY2RzYQAAAAgAAAAEc3NoagAAAAAAAAAA//////////8AAAAAAAAAggAAABVwZXJtaXQtWDExLWZvcndhcmRpbmcAAAAAAAAAF3Blcm1pdC1hZ2VudC1mb3J3YXJkaW5nAAAAAAAAABZwZXJtaXQtcG9ydC1mb3J3YXJkaW5nAAAAAAAAAApwZXJtaXQtcHR5AAAAAAAAAA5wZXJtaXQtdXNlci1yYwAAAAAAAAAAAAAAaAAAABNlY2RzYS1zaGEyLW5pc3RwMjU2AAAACG5pc3RwMjU2AAAAQQTc/PZPU93pfS6cqTB+kbPDr5/8QurLm6vVwaEyvBvcd0OCIn7Dfmwsu4fY7mHRPIreRr4J6TNh0nTwRTKSZxBSAAAAZAAAABNlY2RzYS1zaGEyLW5pc3RwMjU2AAAASQAAACEAvkclDQy9KSmNbS/jteikatmEbSfmO7/FaXcS5+in8wIAAAAgdcjFIdh7/xAVIN52V77vzWrgKNwVEa2Vbtjnkg1KUr8= id_ecdsa_384_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ecdsa.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBKvEgMXaTNdJ6LBFZUD2wQl/z9IHTkkUr6B7ooE6v+2+/oQhJvzBUyaQAZRvmgsvoSBpn13WrrDelOFbZ0LhtDI/sHVbhNopkJHAXwQf7O84/pBE7PEVtfMICIKNy9twHQ== id_ecdsa_384_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ecdsa_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgY2OzNmZOc/vZIZBQFWEORqvMf/oHPrX+yxHKqhAZ28cAAAAIbmlzdHAzODQAAABhBKvEgMXaTNdJ6LBFZUD2wQl/z9IHTkkUr6B7ooE6v+2+/oQhJvzBUyaQAZRvmgsvoSBpn13WrrDelOFbZ0LhtDI/sHVbhNopkJHAXwQf7O84/pBE7PEVtfMICIKNy9twHQAAAAAAAAAAAAAAAgAAACBpZF9lY2RzYV8zODRfcGVtX3NpZ25lZF9ieV9lY2RzYQAAAA0AAAAJMTI3LjAuMC4xAAAAAAAAAAD//////////wAAAAAAAAAAAAAAAAAAAGgAAAATZWNkc2Etc2hhMi1uaXN0cDI1NgAAAAhuaXN0cDI1NgAAAEEE3Pz2T1Pd6X0unKkwfpGzw6+f/ELqy5ur1cGhMrwb3HdDgiJ+w35sLLuH2O5h0TyK3ka+CekzYdJ08EUykmcQUgAAAGQAAAATZWNkc2Etc2hhMi1uaXN0cDI1NgAAAEkAAAAgMqxtjTDkl14nj/EpXUdqoheSYN6nNsH6J4ZedLti6AcAAAAhAIkJoGGFMb0sTPfmWEa7Dd0GIZYz6jhV+P34XT5krXcB id_ecdsa_384_pem_signed_by_ecdsa

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ed25519

@@ -0,0 +1,6 @@
+-----BEGIN EC PRIVATE KEY-----
+MIGkAgEBBDDZCyYToDyuqStWrDnO7bb4vaydvcGaMM69jQGMhpH38ygRQW9fE9E4
+/dlQ0u3IizGgBwYFK4EEACKhZANiAATiQceFLd2USzUJ4HB1NmleM2hJQBJ3lnur
+w+LrGKHR2xwl8wZePhtvVpCVndf0GLmbeTTciDSA2oAaIL63AzwgnGWuSCmQdTyV
+IzYbfw6eCPi4hGc8cKS8ZHQS2OK8avE=
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ed25519-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgb8WjV0yI6r7nIUsMSdoXVEd6NTlrRo+EFYMY4Wc8YyYAAAAIbmlzdHAzODQAAABhBOJBx4Ut3ZRLNQngcHU2aV4zaElAEneWe6vD4usYodHbHCXzBl4+G29WkJWd1/QYuZt5NNyINIDagBogvrcDPCCcZa5IKZB1PJUjNht/Dp4I+LiEZzxwpLxkdBLY4rxq8QAAAAAAAAAAAAAAAQAAACJpZF9lY2RzYV8zODRfcGVtX3NpZ25lZF9ieV9lZDI1NTE5AAAACAAAAARzc2hqAAAAAAAAAAD//////////wAAAAAAAACCAAAAFXBlcm1pdC1YMTEtZm9yd2FyZGluZwAAAAAAAAAXcGVybWl0LWFnZW50LWZvcndhcmRpbmcAAAAAAAAAFnBlcm1pdC1wb3J0LWZvcndhcmRpbmcAAAAAAAAACnBlcm1pdC1wdHkAAAAAAAAADnBlcm1pdC11c2VyLXJjAAAAAAAAAAAAAAAzAAAAC3NzaC1lZDI1NTE5AAAAIDphrlRZfHI2xJ7IIqmoLji2Bh2j7ZP0jynCL0TnjTuHAAAAUwAAAAtzc2gtZWQyNTUxOQAAAEC87hSbGcEMRKetxHJrJ71A9U1CHBh6TyizBbnJWzVm3va+R0ohO4TW5tZn83Cw+B2qL+GTGJ6j8tm1U3Cu0MMK id_ecdsa_384_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ed25519.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBOJBx4Ut3ZRLNQngcHU2aV4zaElAEneWe6vD4usYodHbHCXzBl4+G29WkJWd1/QYuZt5NNyINIDagBogvrcDPCCcZa5IKZB1PJUjNht/Dp4I+LiEZzxwpLxkdBLY4rxq8Q== id_ecdsa_384_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_ed25519_host-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAgGZiVJml5jUGLWIzSqiJPuIHQlllgL0ACSFDfHcI/KyQAAAAIbmlzdHAzODQAAABhBOJBx4Ut3ZRLNQngcHU2aV4zaElAEneWe6vD4usYodHbHCXzBl4+G29WkJWd1/QYuZt5NNyINIDagBogvrcDPCCcZa5IKZB1PJUjNht/Dp4I+LiEZzxwpLxkdBLY4rxq8QAAAAAAAAAAAAAAAgAAACJpZF9lY2RzYV8zODRfcGVtX3NpZ25lZF9ieV9lZDI1NTE5AAAADQAAAAkxMjcuMC4wLjEAAAAAAAAAAP//////////AAAAAAAAAAAAAAAAAAAAMwAAAAtzc2gtZWQyNTUxOQAAACA6Ya5UWXxyNsSeyCKpqC44tgYdo+2T9I8pwi9E5407hwAAAFMAAAALc3NoLWVkMjU1MTkAAABAHyGchTk5zw6vfu+SdHdSz7p2Nb0gTnp2/DJ8I9oN1l4PQT2xnPOvPo0EiopxTFhu9gLmaBFBtb0Ld1KjseKADA== id_ecdsa_384_pem_signed_by_ed25519

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_rsa

@@ -0,0 +1,6 @@
+-----BEGIN EC PRIVATE KEY-----
+MIGkAgEBBDAdedfKcsWfF/5F1gzur96bZm46418quWRbxqxL1C9V0xNfwsHgy1C/
+IqAul+nXkKugBwYFK4EEACKhZANiAAQ9VkGx/6Q2kYz3OECqYLThHFvy7ErXl1Pc
+yIxCFZAqXf1mj3656pdc7vxtDXMeWC9mHyhA7c18YbJGnPDgEeQq+8DIOgmIdTbj
+garD0mxCwrX9Rdki2xhFhuHex6JmzdQ=
+-----END EC PRIVATE KEY-----

src/itest/resources/keyfiles/certificates/id_ecdsa_384_pem_signed_by_rsa-cert.pub

@@ -0,0 +1 @@
+ecdsa-sha2-nistp384-cert-v01@openssh.com AAAAKGVjZHNhLXNoYTItbmlzdHAzODQtY2VydC12MDFAb3BlbnNzaC5jb20AAAAghcwzqH5DN9fwc2z3PUGDVRBWNz8R/m07fxTWMCdVoKsAAAAIbmlzdHAzODQAAABhBD1WQbH/pDaRjPc4QKpgtOEcW/LsSteXU9zIjEIVkCpd/WaPfrnql1zu/G0Ncx5YL2YfKEDtzXxhskac8OAR5Cr7wMg6CYh1NuOBqsPSbELCtf1F2SLbGEWG4d7HombN1AAAAAAAAAAAAAAAAQAAAB5pZF9lY2RzYV8zODRfcGVtX3NpZ25lZF9ieV9yc2EAAAAIAAAABHNzaGoAAAAAAAAAAP//////////AAAAAAAAAIIAAAAVcGVybWl0LVgxMS1mb3J3YXJkaW5nAAAAAAAAABdwZXJtaXQtYWdlbnQtZm9yd2FyZGluZwAAAAAAAAAWcGVybWl0LXBvcnQtZm9yd2FyZGluZwAAAAAAAAAKcGVybWl0LXB0eQAAAAAAAAAOcGVybWl0LXVzZXItcmMAAAAAAAAAAAAAAZcAAAAHc3NoLXJzYQAAAAMBAAEAAAGBAMpRV4ex1Zq2TzKSP7g1XrAAsGsqbGvKe6BjXqJa1OayPgcTJWZLDVCiNapqMoGCdqAnzBKIqVwjxhdy1OP7c5BvPZG9ljujlAiBhQ5t9NrN+jWv6pE3w3m5MFDVh7neGvr9wK8IGhIetfpG6/wJ3yOAF1sQkCwgDf7BfkbMq1If+qyTDF7I3fzyaqYX/61BR2iytpNxaVVw1g15EKdRHkUc760L0kVFwWkmyAFpK+ZPOal9pRHKa9mi/3TRXcQ20ZnBBzzxl4bsnXnEWILhBSxstoEF94hHKLeuoKl9kPx/NqKvwjIEqtU/mE7i+aAE9Wf6nR0COtlBPsjxZtf2Ac2ryUCd/EcdAqDGOwZy4m1s0G5EQMTU1uWCgGByz6DPWCCDCadQq0GaACjcOyBcy5trUqGxYqDvmZCgq6IDv1bGFDlFx1exOxIAKuruiVdPNn+c+h7HEmeM+OOJq1rjibD7kUwMK0cchVzpjI2xwC8ecQF9jeFGBcooa86OO65oPQAAAZQAAAAMcnNhLXNoYTItNTEyAAABgIMLYvfexE8s6eMYNOgqKOceG0uAKDUWT7aHXVA2q4jkTvMCQLck7k+hc1np8Gwwfaehn7zesLjOx9GzeN8MlFt1l07wRhqqDdpJNpcc4L7JAajJeaXn71dHkTqPuEeclyPE1LUZyanX0Y2fg8WnNt7+giZr3T9n3PahVA7dannqPwhKg/bFBMjF16WixLXOXuJFGkiKeha/9JS9t6ihVritTOOui09xJKIBCB8apx7TgAKlCGynVxwxZi02/dPRoZruBZ4wpw66UQvX/HYtz/cI7kU6lMpRAJdBFnHhgEgGGS6Y91JBXxde3VGuHKxe8+TwAWhD++WWukQPSfGp9YYuyFNqqQXNmpgpnuCxiBjSBpGYo76N7+HRKG7R4xS4fnD4ZDspY/JapHVTng0hYS7fa2Nw3hnz+mbFHDfkw8L2S+8VWxbXh2LqJo1+KmQN4O9SFUzwbLqxJ3DOnYAZe8I43WAjyxcafBeUGWI5Q2FdMVPm/2/L3B+M6cDL2RBiow== id_ecdsa_384_pem_signed_by_rsa