mirror of
https://github.com/hierynomus/sshj.git
synced 2025-12-08 08:10:55 +03:00
Compare commits
61 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
dc6b20772b | ||
|
|
81e87a4d35 | ||
|
|
a262f51900 | ||
|
|
50c753dc58 | ||
|
|
1c547886c8 | ||
|
|
b7dc869a13 | ||
|
|
4774721b49 | ||
|
|
542bb35bda | ||
|
|
3b67d2b476 | ||
|
|
9b9b208434 | ||
|
|
a3cce0d2f9 | ||
|
|
5d040dd4bb | ||
|
|
461c0e46d4 | ||
|
|
f4d34d899d | ||
|
|
2bef99c875 | ||
|
|
a186dbf0bc | ||
|
|
a5fdb29fad | ||
|
|
3069138482 | ||
|
|
a3c9c61a09 | ||
|
|
31d156b19f | ||
|
|
ec69d109e8 | ||
|
|
f35c2bd4ce | ||
|
|
07837098eb | ||
|
|
39a7be9221 | ||
|
|
e7614db94a | ||
|
|
233c0dcaa6 | ||
|
|
0d16fbe146 | ||
|
|
154a202384 | ||
|
|
830a39dc24 | ||
|
|
dcfa1833d7 | ||
|
|
6e7fb96d07 | ||
|
|
d5d6096d5d | ||
|
|
2551f8e559 | ||
|
|
430cbfcf13 | ||
|
|
ec467a3875 | ||
|
|
1b258f0677 | ||
|
|
559384ac91 | ||
|
|
5674072666 | ||
|
|
f33bfecbf5 | ||
|
|
c0f6000ff5 | ||
|
|
3de0302c84 | ||
|
|
d7e402c557 | ||
|
|
8ef996b406 | ||
|
|
e9cb90901c | ||
|
|
69812e9a81 | ||
|
|
9a939d029b | ||
|
|
50efeb6519 | ||
|
|
aabb1be52e | ||
|
|
32329e547e | ||
|
|
8cf63a96a9 | ||
|
|
cab7731928 | ||
|
|
50073db6c1 | ||
|
|
90099bbf5e | ||
|
|
ce0a7d5193 | ||
|
|
ced27fc898 | ||
|
|
624747c527 | ||
|
|
d8697c2228 | ||
|
|
7c14098f7d | ||
|
|
d5805a6c64 | ||
|
|
8a66dc5336 | ||
|
|
a5c10ab50f |
1
.gitattributes
vendored
1
.gitattributes
vendored
@@ -1 +1,2 @@
|
||||
*.bat text eol=crlf
|
||||
src/itest/docker-image/** eol=lf
|
||||
|
||||
20
.github/workflows/gradle.yml
vendored
20
.github/workflows/gradle.yml
vendored
@@ -6,35 +6,37 @@ name: Build SSHJ
|
||||
|
||||
on:
|
||||
push:
|
||||
branches: [ master ]
|
||||
pull_request:
|
||||
branches: [ master ]
|
||||
|
||||
jobs:
|
||||
java12:
|
||||
name: Build with Java 12
|
||||
name: Build with Java 11
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK 12
|
||||
uses: actions/setup-java@v1
|
||||
- name: Set up Java 11
|
||||
uses: actions/setup-java@v3
|
||||
with:
|
||||
java-version: 12
|
||||
distribution: 'temurin'
|
||||
java-version: 11
|
||||
- name: Grant execute permission for gradlew
|
||||
run: chmod +x gradlew
|
||||
- name: Build with Gradle
|
||||
run: ./gradlew check
|
||||
- name: Codecov
|
||||
uses: codecov/codecov-action@v2
|
||||
|
||||
integration:
|
||||
name: Integration test
|
||||
needs: [java12]
|
||||
runs-on: [ubuntu-latest]
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- run: git fetch --depth=1 origin +refs/tags/*:refs/tags/*
|
||||
- uses: actions/setup-java@v1
|
||||
- uses: actions/setup-java@v3
|
||||
with:
|
||||
java-version: 12
|
||||
distribution: 'temurin'
|
||||
java-version: 11
|
||||
- name: Grant execute permission for gradlew
|
||||
run: chmod +x gradlew
|
||||
- name: Build with Gradle
|
||||
|
||||
14
.github/workflows/release.yml
vendored
14
.github/workflows/release.yml
vendored
@@ -13,12 +13,13 @@ jobs:
|
||||
name: Build with Java 12
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- uses: actions/checkout@v3
|
||||
with:
|
||||
fetch-depth: 0
|
||||
- name: Set up JDK 12
|
||||
uses: actions/setup-java@v1
|
||||
uses: actions/setup-java@v2
|
||||
with:
|
||||
distribution: 'zulu'
|
||||
java-version: 12
|
||||
- name: Grant execute permission for gradlew
|
||||
run: chmod +x gradlew
|
||||
@@ -29,21 +30,20 @@ jobs:
|
||||
needs: [java12]
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- uses: actions/checkout@v3
|
||||
with:
|
||||
fetch-depth: 0
|
||||
- uses: actions/setup-java@v1
|
||||
- uses: actions/setup-java@v2
|
||||
with:
|
||||
distribution: 'zulu'
|
||||
java-version: 12
|
||||
- name: Grant execute permission for gradlew
|
||||
run: chmod +x gradlew
|
||||
- name: Release
|
||||
run: ./gradlew release -Prelease.disableChecks -Prelease.pushTagsOnly -Prelease.customUsername=${{ github.actor }} -Prelease.customPassword=${{ github.token }}
|
||||
run: ./gradlew clean publishToSonatype closeAndReleaseSonatypeStagingRepository
|
||||
env:
|
||||
ORG_GRADLE_PROJECT_signingKey: ${{ secrets.SIGNINGKEY }}
|
||||
ORG_GRADLE_PROJECT_signingKeyId: ${{ secrets.SIGNINGKEYID }}
|
||||
ORG_GRADLE_PROJECT_signingPassword: ${{ secrets.SIGNINGPASSWORD }}
|
||||
ORG_GRADLE_PROJECT_sonatypeUsername: ${{ secrets.OSSRH_USERNAME }}
|
||||
ORG_GRADLE_PROJECT_sonatypePassword: ${{ secrets.OSSRH_PASSWORD }}
|
||||
|
||||
|
||||
|
||||
68
README.adoc
68
README.adoc
@@ -1,7 +1,7 @@
|
||||
= sshj - SSHv2 library for Java
|
||||
Jeroen van Erp
|
||||
:sshj_groupid: com.hierynomus
|
||||
:sshj_version: 0.31.0
|
||||
:sshj_version: 0.38.0
|
||||
:source-highlighter: pygments
|
||||
|
||||
image:https://github.com/hierynomus/sshj/actions/workflows/gradle.yml/badge.svg[link="https://github.com/hierynomus/sshj/actions/workflows/gradle.yml"]
|
||||
@@ -10,6 +10,8 @@ image:https://codecov.io/gh/hierynomus/sshj/branch/master/graph/badge.svg["codec
|
||||
image:http://www.javadoc.io/badge/com.hierynomus/sshj.svg?color=blue["JavaDocs", link="http://www.javadoc.io/doc/com.hierynomus/sshj"]
|
||||
image:https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj/badge.svg["Maven Central",link="https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj"]
|
||||
|
||||
WARNING: SSHJ versions up to and including 0.37.0 are vulnerable to https://nvd.nist.gov/vuln/detail/CVE-2023-48795[CVE-2023-48795 - Terrapin]. Please upgrade to 0.38.0 or higher.
|
||||
|
||||
To get started, have a look at one of the examples. Hopefully you will find the API pleasant to work with :)
|
||||
|
||||
== Getting SSHJ
|
||||
@@ -46,7 +48,7 @@ If your project is built using another build tool that uses the Maven Central re
|
||||
In the `examples` directory, there is a separate Maven project that shows how the library can be used in some sample cases. If you want to run them, follow these guidelines:
|
||||
|
||||
. Install http://maven.apache.org/[Maven 2.2.1] or up.
|
||||
. Clone the Overthere repository.
|
||||
. Clone the SSHJ repository.
|
||||
. Go into the `examples` directory and run the command `mvn eclipse:eclipse`.
|
||||
. Import the `examples` project into Eclipse.
|
||||
. Change the login details in the example classes (address, username and password) and run them!
|
||||
@@ -95,7 +97,11 @@ If you need something that is not included, it shouldn't be too hard to add (do
|
||||
http://ssh-comparison.quendi.de/comparison.html[SSH Implementation Comparison]
|
||||
|
||||
== Dependencies
|
||||
Java 6+. http://www.slf4j.org/download.html[slf4j] is required. http://www.bouncycastle.org/java.html[bouncycastle] is highly recommended and required for using some of the crypto algorithms. http://www.jcraft.com/jzlib/[jzlib] is required for using zlib compression.
|
||||
|
||||
- Java 8 or higher
|
||||
- https://www.slf4j.org/[SLF4J 2.0.0]
|
||||
- https://www.bouncycastle.org[Bouncy Castle]
|
||||
|
||||
|
||||
== Reporting bugs
|
||||
Issue tracker: https://github.com/hierynomus/sshj/issues
|
||||
@@ -104,8 +110,62 @@ Issue tracker: https://github.com/hierynomus/sshj/issues
|
||||
Fork away!
|
||||
|
||||
== Release history
|
||||
SSHJ 0.38.0 (2024-01-02)::
|
||||
* Mitigated CVE-2023-48795 - Terrapin
|
||||
* Merged https://github.com/hierynomus/sshj/pull/917[#917]: Implement OpenSSH strict key exchange extension
|
||||
* Merged https://github.com/hierynomus/sshj/pull/903[#903]: Fix for writing known hosts key string
|
||||
* Merged https://github.com/hierynomus/sshj/pull/913[#913]: Prevent remote port forwarding buffers to grow without bounds
|
||||
* Moved tess to JUnit5
|
||||
* Merged https://github.com/hierynomus/sshj/pull/827[#827]: Fallback to posix-rename@openssh.com extension if available
|
||||
* Merged https://github.com/hierynomus/sshj/pull/904[#904]: Add ChaCha20-Poly1305 support for OpenSSH keys
|
||||
SSHJ 0.37.0 (2023-10-11)::
|
||||
* Merged https://github.com/hierynomus/sshj/pull/899[#899]: Add support for AES-GCM OpenSSH private keys
|
||||
* Merged https://github.com/hierynomus/sshj/pull/901[#901]: Fix ZLib compression bug
|
||||
* Merged https://github.com/hierynomus/sshj/pull/898[#898]: Improved malformed file handling for OpenSSH private keys
|
||||
SSHJ 0.36.0 (2023-09-04)::
|
||||
* Rewrote Integration tests to JUnit5
|
||||
* Merged https://github.com/hierynomus/sshj/pull/851[#851]: Fix race condition in key exchange causing intermittent SSH_MSG_UNIMPLEMENTED
|
||||
* Merged https://github.com/hierynomus/sshj/pull/861[#861]: Add DefaultSecurityProviderConfig with has BouncyCastle disabled
|
||||
* Merged https://github.com/hierynomus/sshj/pull/881[#881]: Rewrote test classes to JUnit Jupiter engine
|
||||
* Merged https://github.com/hierynomus/sshj/pull/880[#880]: Removed Java 7 backport Socket utilities
|
||||
* Merged https://github.com/hierynomus/sshj/pull/879[#879]: Replaced custom Base64 with java.util.Base64
|
||||
* Merged https://github.com/hierynomus/sshj/pull/852[#852]: Removed unused bcrypt password hashing methods
|
||||
* Merged https://github.com/hierynomus/sshj/pull/874[#874]: Java 8 minimum version + dependency upgrades
|
||||
* Merged https://github.com/hierynomus/sshj/pull/876[#876]: Change `newStatefulSFTPClient` to return `StatefulSFTPClient`
|
||||
* Merged https://github.com/hierynomus/sshj/pull/860[#860]: Upgrade to Gradle 7.6.1
|
||||
* Merged https://github.com/hierynomus/sshj/pull/838[#838]: Replaced Curve25519 class with X25519 Key agreement
|
||||
* Merged https://github.com/hierynomus/sshj/pull/772[#772]: Remove dependency on jzlib
|
||||
SSHJ 0.35.0 (2023-01-30)::
|
||||
* Merged https://github.com/hierynomus/sshj/pull/835[#835]: TimeoutException message improved
|
||||
* Merged https://github.com/hierynomus/sshj/pull/815[#815]: Support authPassword on FreeBSD
|
||||
* Merged https://github.com/hierynomus/sshj/pull/813[#813]: Prevent `CHANNEL_CLOSE` between isOpen and write call.
|
||||
* Merged https://github.com/hierynomus/sshj/pull/811[#811]: Add `Transport.isKeyExchangeREquired` to prevent unnecessary KEXINIT
|
||||
SSHJ 0.34.0 (2022-08-10)::
|
||||
* Merged https://github.com/hierynomus/sshj/pull/743[#743]: Use default client credentials for AuthGssApiWithMic
|
||||
* Merged https://github.com/hierynomus/sshj/pull/801[#801]: Restore thread interrupt status after catching InterruptedException
|
||||
* Merged https://github.com/hierynomus/sshj/pull/793[#793]: Merge PKCS5 and PKCS8 classes
|
||||
* Upgraded dependencies SLF4J (1.7.36) and Logback (1.2.11)
|
||||
* Merged https://github.com/hierynomus/sshj/pull/791[#791]: Update KeepAlive examples
|
||||
* Merged https://github.com/hierynomus/sshj/pull/775[#775]: Add SFTP resume support
|
||||
SSHJ 0.33.0 (2022-04-22)::
|
||||
* Upgraded dependencies BouncyCastle (1.70)
|
||||
* Merged https://github.com/hierynomus/sshj/pull/687[#687]: Correctly close connection when remote closes connection.
|
||||
* Merged https://github.com/hierynomus/sshj/pull/741[#741]: Add support for testcontainers in test setup to test more scenarios
|
||||
* Merged https://github.com/hierynomus/sshj/pull/733[#733]: Send correct key proposal if client knows CA key
|
||||
* Merged https://github.com/hierynomus/sshj/pull/746[#746]: Fix bug in reading Putty private key file with passphrase
|
||||
* Merged https://github.com/hierynomus/sshj/pull/742[#742]: Use Config.keyAlgorithms to determine rsa-sha2 support
|
||||
* Merged https://github.com/hierynomus/sshj/pull/754[#754]: Use SFTP protocol version to set FXP rename flags conditionally
|
||||
* Merged https://github.com/hierynomus/sshj/pull/752[#752]: Correctly start and terminate KeepAlive thread
|
||||
* Merged https://github.com/hierynomus/sshj/pull/753[#753]: Provide better thread names
|
||||
* Merged https://github.com/hierynomus/sshj/pull/724[#724]: Add parameter to limit read ahead length
|
||||
* Merged https://github.com/hierynomus/sshj/pull/763[#763]: Try all public key algorithms for a specific key type
|
||||
* Merged https://github.com/hierynomus/sshj/pull/756[#756]: Remove deprecated proxy connect methods
|
||||
* Merged https://github.com/hierynomus/sshj/pull/770[#770]: Add support for `ed25519` `aes-128-cbc` keys
|
||||
* Merged https://github.com/hierynomus/sshj/pull/773[#773]: Fix NPE when reading empty OpenSSHKeyV1KeyFile
|
||||
* Merged https://github.com/hierynomus/sshj/pull/777[#777]: Don't request too many read-ahead packets
|
||||
|
||||
SSHJ 0.32.0 (2021-10-12)::
|
||||
* Send EOF on channel close (Fixes https://github.com/hierynomus/sshj/issue/143[#143], https://github.com/hierynomus/sshj/issue/496[#496], https://github.com/hierynomus/sshj/issue/553[#553], https://github.com/hierynomus/sshj/issue/554[#554])
|
||||
* Send EOF on channel close (Fixes https://github.com/hierynomus/sshj/issues/143[#143], https://github.com/hierynomus/sshj/issues/496[#496], https://github.com/hierynomus/sshj/issues/553[#553], https://github.com/hierynomus/sshj/issues/554[#554])
|
||||
* Merged https://github.com/hierynomus/sshj/pull/726[#726]: Parse OpenSSH v1 keys with full CRT information present
|
||||
* Merged https://github.com/hierynomus/sshj/pull/721[#721]: Prefer known host key algorithm for host key verification
|
||||
* Merged https://github.com/hierynomus/sshj/pull/716[#716], https://github.com/hierynomus/sshj/pull/729[#729] and https://github.com/hierynomus/sshj/pull/730[#730]: Add full support for PuTTY v3 key files.
|
||||
|
||||
@@ -23,7 +23,6 @@ dependencies {
|
||||
compile "org.slf4j:slf4j-api:1.7.7"
|
||||
compile "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
|
||||
compile "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
|
||||
compile "com.jcraft:jzlib:1.1.3"
|
||||
|
||||
testCompile "junit:junit:4.11"
|
||||
testCompile "org.mockito:mockito-core:1.9.5"
|
||||
|
||||
236
build.gradle
236
build.gradle
@@ -1,29 +1,27 @@
|
||||
import java.text.SimpleDateFormat
|
||||
import com.bmuschko.gradle.docker.tasks.container.*
|
||||
import com.bmuschko.gradle.docker.tasks.image.*
|
||||
|
||||
plugins {
|
||||
id "java"
|
||||
id "jvm-test-suite"
|
||||
id "groovy"
|
||||
id "jacoco"
|
||||
id "com.github.blindpirate.osgi" version '0.0.6'
|
||||
id "maven-publish"
|
||||
id "signing"
|
||||
id 'pl.allegro.tech.build.axion-release' version '1.13.3'
|
||||
id "com.bmuschko.docker-remote-api" version "7.1.0"
|
||||
id 'pl.allegro.tech.build.axion-release' version '1.15.3'
|
||||
id "com.github.hierynomus.license" version "0.16.1"
|
||||
id 'ru.vyarus.github-info' version '1.2.0'
|
||||
id "io.github.gradle-nexus.publish-plugin" version "1.0.0"
|
||||
id "com.bmuschko.docker-remote-api" version "9.2.1"
|
||||
id 'ru.vyarus.github-info' version '1.5.0'
|
||||
id "io.github.gradle-nexus.publish-plugin" version "1.3.0"
|
||||
}
|
||||
|
||||
group = "com.hierynomus"
|
||||
ext.moduleName = "${project.group}.${project.name}"
|
||||
|
||||
defaultTasks "build"
|
||||
|
||||
repositories {
|
||||
mavenCentral()
|
||||
}
|
||||
|
||||
group = "com.hierynomus"
|
||||
defaultTasks ["build"]
|
||||
ext.moduleName = "${project.group}.${project.name}"
|
||||
|
||||
scmVersion {
|
||||
tag {
|
||||
prefix = 'v'
|
||||
@@ -37,30 +35,21 @@ scmVersion {
|
||||
|
||||
project.version = scmVersion.version
|
||||
|
||||
compileJava {
|
||||
options.release = 8
|
||||
}
|
||||
|
||||
configurations.implementation.transitive = false
|
||||
|
||||
def bouncycastleVersion = "1.69"
|
||||
def sshdVersion = "2.1.0"
|
||||
def bouncycastleVersion = "1.75"
|
||||
def sshdVersion = "2.10.0"
|
||||
|
||||
dependencies {
|
||||
implementation "org.slf4j:slf4j-api:1.7.32"
|
||||
implementation "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
|
||||
implementation "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
|
||||
implementation "com.jcraft:jzlib:1.1.3"
|
||||
implementation "org.slf4j:slf4j-api:2.0.7"
|
||||
implementation "org.bouncycastle:bcprov-jdk18on:$bouncycastleVersion"
|
||||
implementation "org.bouncycastle:bcpkix-jdk18on:$bouncycastleVersion"
|
||||
implementation "com.hierynomus:asn-one:0.6.0"
|
||||
|
||||
implementation "net.i2p.crypto:eddsa:0.3.0"
|
||||
|
||||
testImplementation "junit:junit:4.12"
|
||||
testImplementation 'org.spockframework:spock-core:1.3-groovy-2.4'
|
||||
testImplementation "org.mockito:mockito-core:2.28.2"
|
||||
testImplementation "org.apache.sshd:sshd-core:$sshdVersion"
|
||||
testImplementation "org.apache.sshd:sshd-sftp:$sshdVersion"
|
||||
testImplementation "org.apache.sshd:sshd-scp:$sshdVersion"
|
||||
testRuntimeOnly "ch.qos.logback:logback-classic:1.2.6"
|
||||
testImplementation 'org.glassfish.grizzly:grizzly-http-server:2.4.4'
|
||||
testImplementation 'org.apache.httpcomponents:httpclient:4.5.9'
|
||||
|
||||
}
|
||||
|
||||
license {
|
||||
@@ -69,7 +58,16 @@ license {
|
||||
mapping {
|
||||
java = 'SLASHSTAR_STYLE'
|
||||
}
|
||||
excludes(['**/djb/Curve25519.java', '**/sshj/common/Base64.java', '**/com/hierynomus/sshj/userauth/keyprovider/bcrypt/*.java'])
|
||||
excludes([
|
||||
'**/sshj/common/Base64.java',
|
||||
'**/com/hierynomus/sshj/userauth/keyprovider/bcrypt/*.java',
|
||||
'**/files/test_file_*.txt',
|
||||
])
|
||||
}
|
||||
|
||||
java {
|
||||
withJavadocJar()
|
||||
withSourcesJar()
|
||||
}
|
||||
|
||||
if (!JavaVersion.current().isJava9Compatible()) {
|
||||
@@ -83,10 +81,82 @@ if (JavaVersion.current().isJava8Compatible()) {
|
||||
}
|
||||
}
|
||||
|
||||
compileJava {
|
||||
options.compilerArgs.addAll(['--release', '7'])
|
||||
testing {
|
||||
suites {
|
||||
configureEach {
|
||||
useJUnitJupiter()
|
||||
dependencies {
|
||||
implementation "org.slf4j:slf4j-api:2.0.7"
|
||||
implementation 'org.spockframework:spock-core:2.3-groovy-3.0'
|
||||
implementation "org.mockito:mockito-core:4.11.0"
|
||||
implementation "org.assertj:assertj-core:3.24.2"
|
||||
implementation "ru.vyarus:spock-junit5:1.2.0"
|
||||
implementation "org.apache.sshd:sshd-core:$sshdVersion"
|
||||
implementation "org.apache.sshd:sshd-sftp:$sshdVersion"
|
||||
implementation "org.apache.sshd:sshd-scp:$sshdVersion"
|
||||
implementation "ch.qos.logback:logback-classic:1.3.8"
|
||||
implementation 'org.glassfish.grizzly:grizzly-http-server:3.0.1'
|
||||
}
|
||||
|
||||
targets {
|
||||
all {
|
||||
testTask.configure {
|
||||
testLogging {
|
||||
showStandardStreams = false
|
||||
exceptionFormat = 'full'
|
||||
}
|
||||
include "**/*Test.*"
|
||||
include "**/*Spec.*"
|
||||
afterSuite { descriptor, result ->
|
||||
def indicator = "\u001B[32m✓\u001b[0m"
|
||||
if (result.failedTestCount > 0) {
|
||||
indicator = "\u001B[31m✘\u001b[0m"
|
||||
}
|
||||
logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
test {
|
||||
sources {
|
||||
groovy {
|
||||
srcDirs = ['src/test/groovy']
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
integrationTest(JvmTestSuite) {
|
||||
dependencies {
|
||||
implementation project()
|
||||
implementation 'org.testcontainers:testcontainers:1.18.3'
|
||||
implementation 'org.testcontainers:junit-jupiter:1.18.3'
|
||||
}
|
||||
|
||||
sources {
|
||||
java {
|
||||
srcDirs = ['src/itest/java']
|
||||
}
|
||||
|
||||
resources {
|
||||
srcDirs = ['src/itest/resources']
|
||||
}
|
||||
}
|
||||
|
||||
targets {
|
||||
all {
|
||||
testTask.configure {
|
||||
shouldRunAfter(test)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
project.tasks.compileGroovy.onlyIf { false }
|
||||
|
||||
task writeSshjVersionProperties {
|
||||
doLast {
|
||||
project.file("${project.buildDir}/resources/main").mkdirs()
|
||||
@@ -120,12 +190,6 @@ jar {
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
java {
|
||||
withJavadocJar()
|
||||
withSourcesJar()
|
||||
}
|
||||
|
||||
sourcesJar {
|
||||
manifest {
|
||||
attributes(
|
||||
@@ -139,53 +203,6 @@ sourcesJar {
|
||||
}
|
||||
}
|
||||
|
||||
configurations {
|
||||
integrationTestImplementation.extendsFrom testImplementation
|
||||
integrationTestRuntimeOnly.extendsFrom testRuntimeOnly
|
||||
}
|
||||
|
||||
sourceSets {
|
||||
integrationTest {
|
||||
groovy {
|
||||
compileClasspath += sourceSets.main.output + sourceSets.test.output
|
||||
runtimeClasspath += sourceSets.main.output + sourceSets.test.output
|
||||
srcDir file('src/itest/groovy')
|
||||
}
|
||||
resources.srcDir file('src/itest/resources')
|
||||
}
|
||||
}
|
||||
|
||||
task integrationTest(type: Test) {
|
||||
testClassesDirs = sourceSets.integrationTest.output.classesDirs
|
||||
classpath = sourceSets.integrationTest.runtimeClasspath
|
||||
}
|
||||
|
||||
tasks.withType(Test) {
|
||||
testLogging {
|
||||
exceptionFormat = 'full'
|
||||
}
|
||||
include "**/*Test.*"
|
||||
include "**/*Spec.*"
|
||||
if (!project.hasProperty("allTests")) {
|
||||
useJUnit {
|
||||
excludeCategories 'com.hierynomus.sshj.test.SlowTests'
|
||||
excludeCategories 'com.hierynomus.sshj.test.KnownFailingTests'
|
||||
}
|
||||
}
|
||||
|
||||
afterSuite { descriptor, result ->
|
||||
if (descriptor.className != null) {
|
||||
def indicator = "\u001B[32m✓\u001b[0m"
|
||||
if (result.failedTestCount > 0) {
|
||||
indicator = "\u001B[31m✘\u001b[0m"
|
||||
}
|
||||
logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
project.tasks.compileGroovy.onlyIf { false }
|
||||
|
||||
github {
|
||||
user 'hierynomus'
|
||||
license 'Apache'
|
||||
@@ -271,54 +288,11 @@ nexusPublishing {
|
||||
|
||||
jacocoTestReport {
|
||||
reports {
|
||||
xml.enabled true
|
||||
html.enabled true
|
||||
xml.required = true
|
||||
html.required = true
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
task buildItestImage(type: DockerBuildImage) {
|
||||
inputDir = file('src/itest/docker-image')
|
||||
images.add('sshj/sshd-itest:latest')
|
||||
}
|
||||
|
||||
task createItestContainer(type: DockerCreateContainer) {
|
||||
dependsOn buildItestImage
|
||||
targetImageId buildItestImage.getImageId()
|
||||
hostConfig.portBindings = ['2222:22']
|
||||
hostConfig.autoRemove = true
|
||||
}
|
||||
|
||||
task startItestContainer(type: DockerStartContainer) {
|
||||
dependsOn createItestContainer
|
||||
targetContainerId createItestContainer.getContainerId()
|
||||
}
|
||||
|
||||
task logItestContainer(type: DockerLogsContainer) {
|
||||
dependsOn createItestContainer
|
||||
targetContainerId createItestContainer.getContainerId()
|
||||
showTimestamps = true
|
||||
stdErr = true
|
||||
stdOut = true
|
||||
tailAll = true
|
||||
}
|
||||
|
||||
task stopItestContainer(type: DockerStopContainer) {
|
||||
targetContainerId createItestContainer.getContainerId()
|
||||
}
|
||||
|
||||
task forkedUploadRelease(type: GradleBuild) {
|
||||
buildFile = project.buildFile
|
||||
tasks = ["clean", "publishToSonatype", "closeAndReleaseSonatypeStagingRepository"]
|
||||
}
|
||||
|
||||
project.tasks.integrationTest.dependsOn(startItestContainer)
|
||||
project.tasks.integrationTest.finalizedBy(stopItestContainer)
|
||||
|
||||
// Being enabled, it pollutes logs on CI. Uncomment when debugging some test to get sshd logs.
|
||||
// project.tasks.stopItestContainer.dependsOn(logItestContainer)
|
||||
|
||||
project.tasks.release.dependsOn([project.tasks.integrationTest, project.tasks.build])
|
||||
project.tasks.release.finalizedBy(project.tasks.forkedUploadRelease)
|
||||
project.tasks.jacocoTestReport.dependsOn(project.tasks.test)
|
||||
project.tasks.check.dependsOn(project.tasks.jacocoTestReport)
|
||||
|
||||
@@ -24,7 +24,7 @@
|
||||
<groupId>com.hierynomus</groupId>
|
||||
<artifactId>sshj-examples</artifactId>
|
||||
<packaging>jar</packaging>
|
||||
<version>0.19.1</version>
|
||||
<version>0.37.0</version>
|
||||
|
||||
<name>sshj-examples</name>
|
||||
<description>Examples for SSHv2 library for Java</description>
|
||||
@@ -55,7 +55,7 @@
|
||||
<dependency>
|
||||
<groupId>com.hierynomus</groupId>
|
||||
<artifactId>sshj</artifactId>
|
||||
<version>0.31.0</version>
|
||||
<version>0.33.0</version>
|
||||
</dependency>
|
||||
</dependencies>
|
||||
|
||||
|
||||
@@ -19,8 +19,9 @@ public class KeepAlive {
|
||||
final SSHClient ssh = new SSHClient(defaultConfig);
|
||||
try {
|
||||
ssh.addHostKeyVerifier(new PromiscuousVerifier());
|
||||
// Set interval to enable keep-alive before connecting
|
||||
ssh.getConnection().getKeepAlive().setKeepAliveInterval(5);
|
||||
ssh.connect(args[0]);
|
||||
ssh.getConnection().getKeepAlive().setKeepAliveInterval(5); //every 60sec
|
||||
ssh.authPassword(args[1], args[2]);
|
||||
Session session = ssh.startSession();
|
||||
session.allocateDefaultPTY();
|
||||
|
||||
@@ -19,6 +19,7 @@ public class RemotePF {
|
||||
client.loadKnownHosts();
|
||||
|
||||
client.connect("localhost");
|
||||
client.getConnection().getKeepAlive().setKeepAliveInterval(5);
|
||||
try {
|
||||
|
||||
client.authPublickey(System.getProperty("user.name"));
|
||||
@@ -33,8 +34,6 @@ public class RemotePF {
|
||||
// what we do with incoming connections that are forwarded to us
|
||||
new SocketForwardingConnectListener(new InetSocketAddress("google.com", 80)));
|
||||
|
||||
client.getTransport().setHeartbeatInterval(30);
|
||||
|
||||
// Something to hang on to so that the forwarding stays
|
||||
client.getTransport().join();
|
||||
|
||||
|
||||
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
Binary file not shown.
2
gradle/wrapper/gradle-wrapper.properties
vendored
2
gradle/wrapper/gradle-wrapper.properties
vendored
@@ -1,5 +1,5 @@
|
||||
distributionBase=GRADLE_USER_HOME
|
||||
distributionPath=wrapper/dists
|
||||
distributionUrl=https\://services.gradle.org/distributions/gradle-7.0-bin.zip
|
||||
distributionUrl=https\://services.gradle.org/distributions/gradle-8.2-bin.zip
|
||||
zipStoreBase=GRADLE_USER_HOME
|
||||
zipStorePath=wrapper/dists
|
||||
|
||||
269
gradlew
vendored
269
gradlew
vendored
@@ -1,7 +1,7 @@
|
||||
#!/usr/bin/env sh
|
||||
#!/bin/sh
|
||||
|
||||
#
|
||||
# Copyright 2015 the original author or authors.
|
||||
# Copyright © 2015-2021 the original authors.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
@@ -17,78 +17,113 @@
|
||||
#
|
||||
|
||||
##############################################################################
|
||||
##
|
||||
## Gradle start up script for UN*X
|
||||
##
|
||||
#
|
||||
# Gradle start up script for POSIX generated by Gradle.
|
||||
#
|
||||
# Important for running:
|
||||
#
|
||||
# (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
|
||||
# noncompliant, but you have some other compliant shell such as ksh or
|
||||
# bash, then to run this script, type that shell name before the whole
|
||||
# command line, like:
|
||||
#
|
||||
# ksh Gradle
|
||||
#
|
||||
# Busybox and similar reduced shells will NOT work, because this script
|
||||
# requires all of these POSIX shell features:
|
||||
# * functions;
|
||||
# * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
|
||||
# «${var#prefix}», «${var%suffix}», and «$( cmd )»;
|
||||
# * compound commands having a testable exit status, especially «case»;
|
||||
# * various built-in commands including «command», «set», and «ulimit».
|
||||
#
|
||||
# Important for patching:
|
||||
#
|
||||
# (2) This script targets any POSIX shell, so it avoids extensions provided
|
||||
# by Bash, Ksh, etc; in particular arrays are avoided.
|
||||
#
|
||||
# The "traditional" practice of packing multiple parameters into a
|
||||
# space-separated string is a well documented source of bugs and security
|
||||
# problems, so this is (mostly) avoided, by progressively accumulating
|
||||
# options in "$@", and eventually passing that to Java.
|
||||
#
|
||||
# Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
|
||||
# and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
|
||||
# see the in-line comments for details.
|
||||
#
|
||||
# There are tweaks for specific operating systems such as AIX, CygWin,
|
||||
# Darwin, MinGW, and NonStop.
|
||||
#
|
||||
# (3) This script is generated from the Groovy template
|
||||
# https://github.com/gradle/gradle/blob/master/subprojects/plugins/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
|
||||
# within the Gradle project.
|
||||
#
|
||||
# You can find Gradle at https://github.com/gradle/gradle/.
|
||||
#
|
||||
##############################################################################
|
||||
|
||||
# Attempt to set APP_HOME
|
||||
|
||||
# Resolve links: $0 may be a link
|
||||
PRG="$0"
|
||||
# Need this for relative symlinks.
|
||||
while [ -h "$PRG" ] ; do
|
||||
ls=`ls -ld "$PRG"`
|
||||
link=`expr "$ls" : '.*-> \(.*\)$'`
|
||||
if expr "$link" : '/.*' > /dev/null; then
|
||||
PRG="$link"
|
||||
else
|
||||
PRG=`dirname "$PRG"`"/$link"
|
||||
fi
|
||||
app_path=$0
|
||||
|
||||
# Need this for daisy-chained symlinks.
|
||||
while
|
||||
APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path
|
||||
[ -h "$app_path" ]
|
||||
do
|
||||
ls=$( ls -ld "$app_path" )
|
||||
link=${ls#*' -> '}
|
||||
case $link in #(
|
||||
/*) app_path=$link ;; #(
|
||||
*) app_path=$APP_HOME$link ;;
|
||||
esac
|
||||
done
|
||||
SAVED="`pwd`"
|
||||
cd "`dirname \"$PRG\"`/" >/dev/null
|
||||
APP_HOME="`pwd -P`"
|
||||
cd "$SAVED" >/dev/null
|
||||
|
||||
APP_HOME=$( cd "${APP_HOME:-./}" && pwd -P ) || exit
|
||||
|
||||
APP_NAME="Gradle"
|
||||
APP_BASE_NAME=`basename "$0"`
|
||||
APP_BASE_NAME=${0##*/}
|
||||
|
||||
# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
|
||||
DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
|
||||
|
||||
# Use the maximum available, or set MAX_FD != -1 to use that value.
|
||||
MAX_FD="maximum"
|
||||
MAX_FD=maximum
|
||||
|
||||
warn () {
|
||||
echo "$*"
|
||||
}
|
||||
} >&2
|
||||
|
||||
die () {
|
||||
echo
|
||||
echo "$*"
|
||||
echo
|
||||
exit 1
|
||||
}
|
||||
} >&2
|
||||
|
||||
# OS specific support (must be 'true' or 'false').
|
||||
cygwin=false
|
||||
msys=false
|
||||
darwin=false
|
||||
nonstop=false
|
||||
case "`uname`" in
|
||||
CYGWIN* )
|
||||
cygwin=true
|
||||
;;
|
||||
Darwin* )
|
||||
darwin=true
|
||||
;;
|
||||
MINGW* )
|
||||
msys=true
|
||||
;;
|
||||
NONSTOP* )
|
||||
nonstop=true
|
||||
;;
|
||||
case "$( uname )" in #(
|
||||
CYGWIN* ) cygwin=true ;; #(
|
||||
Darwin* ) darwin=true ;; #(
|
||||
MSYS* | MINGW* ) msys=true ;; #(
|
||||
NONSTOP* ) nonstop=true ;;
|
||||
esac
|
||||
|
||||
CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
|
||||
|
||||
|
||||
# Determine the Java command to use to start the JVM.
|
||||
if [ -n "$JAVA_HOME" ] ; then
|
||||
if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
|
||||
# IBM's JDK on AIX uses strange locations for the executables
|
||||
JAVACMD="$JAVA_HOME/jre/sh/java"
|
||||
JAVACMD=$JAVA_HOME/jre/sh/java
|
||||
else
|
||||
JAVACMD="$JAVA_HOME/bin/java"
|
||||
JAVACMD=$JAVA_HOME/bin/java
|
||||
fi
|
||||
if [ ! -x "$JAVACMD" ] ; then
|
||||
die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
|
||||
@@ -97,7 +132,7 @@ Please set the JAVA_HOME variable in your environment to match the
|
||||
location of your Java installation."
|
||||
fi
|
||||
else
|
||||
JAVACMD="java"
|
||||
JAVACMD=java
|
||||
which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
||||
|
||||
Please set the JAVA_HOME variable in your environment to match the
|
||||
@@ -105,79 +140,95 @@ location of your Java installation."
|
||||
fi
|
||||
|
||||
# Increase the maximum file descriptors if we can.
|
||||
if [ "$cygwin" = "false" -a "$darwin" = "false" -a "$nonstop" = "false" ] ; then
|
||||
MAX_FD_LIMIT=`ulimit -H -n`
|
||||
if [ $? -eq 0 ] ; then
|
||||
if [ "$MAX_FD" = "maximum" -o "$MAX_FD" = "max" ] ; then
|
||||
MAX_FD="$MAX_FD_LIMIT"
|
||||
fi
|
||||
ulimit -n $MAX_FD
|
||||
if [ $? -ne 0 ] ; then
|
||||
warn "Could not set maximum file descriptor limit: $MAX_FD"
|
||||
fi
|
||||
else
|
||||
warn "Could not query maximum file descriptor limit: $MAX_FD_LIMIT"
|
||||
fi
|
||||
fi
|
||||
|
||||
# For Darwin, add options to specify how the application appears in the dock
|
||||
if $darwin; then
|
||||
GRADLE_OPTS="$GRADLE_OPTS \"-Xdock:name=$APP_NAME\" \"-Xdock:icon=$APP_HOME/media/gradle.icns\""
|
||||
fi
|
||||
|
||||
# For Cygwin or MSYS, switch paths to Windows format before running java
|
||||
if [ "$cygwin" = "true" -o "$msys" = "true" ] ; then
|
||||
APP_HOME=`cygpath --path --mixed "$APP_HOME"`
|
||||
CLASSPATH=`cygpath --path --mixed "$CLASSPATH"`
|
||||
JAVACMD=`cygpath --unix "$JAVACMD"`
|
||||
|
||||
# We build the pattern for arguments to be converted via cygpath
|
||||
ROOTDIRSRAW=`find -L / -maxdepth 1 -mindepth 1 -type d 2>/dev/null`
|
||||
SEP=""
|
||||
for dir in $ROOTDIRSRAW ; do
|
||||
ROOTDIRS="$ROOTDIRS$SEP$dir"
|
||||
SEP="|"
|
||||
done
|
||||
OURCYGPATTERN="(^($ROOTDIRS))"
|
||||
# Add a user-defined pattern to the cygpath arguments
|
||||
if [ "$GRADLE_CYGPATTERN" != "" ] ; then
|
||||
OURCYGPATTERN="$OURCYGPATTERN|($GRADLE_CYGPATTERN)"
|
||||
fi
|
||||
# Now convert the arguments - kludge to limit ourselves to /bin/sh
|
||||
i=0
|
||||
for arg in "$@" ; do
|
||||
CHECK=`echo "$arg"|egrep -c "$OURCYGPATTERN" -`
|
||||
CHECK2=`echo "$arg"|egrep -c "^-"` ### Determine if an option
|
||||
|
||||
if [ $CHECK -ne 0 ] && [ $CHECK2 -eq 0 ] ; then ### Added a condition
|
||||
eval `echo args$i`=`cygpath --path --ignore --mixed "$arg"`
|
||||
else
|
||||
eval `echo args$i`="\"$arg\""
|
||||
fi
|
||||
i=`expr $i + 1`
|
||||
done
|
||||
case $i in
|
||||
0) set -- ;;
|
||||
1) set -- "$args0" ;;
|
||||
2) set -- "$args0" "$args1" ;;
|
||||
3) set -- "$args0" "$args1" "$args2" ;;
|
||||
4) set -- "$args0" "$args1" "$args2" "$args3" ;;
|
||||
5) set -- "$args0" "$args1" "$args2" "$args3" "$args4" ;;
|
||||
6) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" ;;
|
||||
7) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" ;;
|
||||
8) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" ;;
|
||||
9) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" "$args8" ;;
|
||||
if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
|
||||
case $MAX_FD in #(
|
||||
max*)
|
||||
MAX_FD=$( ulimit -H -n ) ||
|
||||
warn "Could not query maximum file descriptor limit"
|
||||
esac
|
||||
case $MAX_FD in #(
|
||||
'' | soft) :;; #(
|
||||
*)
|
||||
ulimit -n "$MAX_FD" ||
|
||||
warn "Could not set maximum file descriptor limit to $MAX_FD"
|
||||
esac
|
||||
fi
|
||||
|
||||
# Escape application args
|
||||
save () {
|
||||
for i do printf %s\\n "$i" | sed "s/'/'\\\\''/g;1s/^/'/;\$s/\$/' \\\\/" ; done
|
||||
echo " "
|
||||
}
|
||||
APP_ARGS=`save "$@"`
|
||||
# Collect all arguments for the java command, stacking in reverse order:
|
||||
# * args from the command line
|
||||
# * the main class name
|
||||
# * -classpath
|
||||
# * -D...appname settings
|
||||
# * --module-path (only if needed)
|
||||
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
|
||||
|
||||
# Collect all arguments for the java command, following the shell quoting and substitution rules
|
||||
eval set -- $DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS "\"-Dorg.gradle.appname=$APP_BASE_NAME\"" -classpath "\"$CLASSPATH\"" org.gradle.wrapper.GradleWrapperMain "$APP_ARGS"
|
||||
# For Cygwin or MSYS, switch paths to Windows format before running java
|
||||
if "$cygwin" || "$msys" ; then
|
||||
APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
|
||||
CLASSPATH=$( cygpath --path --mixed "$CLASSPATH" )
|
||||
|
||||
JAVACMD=$( cygpath --unix "$JAVACMD" )
|
||||
|
||||
# Now convert the arguments - kludge to limit ourselves to /bin/sh
|
||||
for arg do
|
||||
if
|
||||
case $arg in #(
|
||||
-*) false ;; # don't mess with options #(
|
||||
/?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath
|
||||
[ -e "$t" ] ;; #(
|
||||
*) false ;;
|
||||
esac
|
||||
then
|
||||
arg=$( cygpath --path --ignore --mixed "$arg" )
|
||||
fi
|
||||
# Roll the args list around exactly as many times as the number of
|
||||
# args, so each arg winds up back in the position where it started, but
|
||||
# possibly modified.
|
||||
#
|
||||
# NB: a `for` loop captures its iteration list before it begins, so
|
||||
# changing the positional parameters here affects neither the number of
|
||||
# iterations, nor the values presented in `arg`.
|
||||
shift # remove old arg
|
||||
set -- "$@" "$arg" # push replacement arg
|
||||
done
|
||||
fi
|
||||
|
||||
# Collect all arguments for the java command;
|
||||
# * $DEFAULT_JVM_OPTS, $JAVA_OPTS, and $GRADLE_OPTS can contain fragments of
|
||||
# shell script including quotes and variable substitutions, so put them in
|
||||
# double quotes to make sure that they get re-expanded; and
|
||||
# * put everything else in single quotes, so that it's not re-expanded.
|
||||
|
||||
set -- \
|
||||
"-Dorg.gradle.appname=$APP_BASE_NAME" \
|
||||
-classpath "$CLASSPATH" \
|
||||
org.gradle.wrapper.GradleWrapperMain \
|
||||
"$@"
|
||||
|
||||
# Use "xargs" to parse quoted args.
|
||||
#
|
||||
# With -n1 it outputs one arg per line, with the quotes and backslashes removed.
|
||||
#
|
||||
# In Bash we could simply go:
|
||||
#
|
||||
# readarray ARGS < <( xargs -n1 <<<"$var" ) &&
|
||||
# set -- "${ARGS[@]}" "$@"
|
||||
#
|
||||
# but POSIX shell has neither arrays nor command substitution, so instead we
|
||||
# post-process each arg (as a line of input to sed) to backslash-escape any
|
||||
# character that might be a shell metacharacter, then use eval to reverse
|
||||
# that process (while maintaining the separation between arguments), and wrap
|
||||
# the whole thing up as a single "set" statement.
|
||||
#
|
||||
# This will of course break if any of these variables contains a newline or
|
||||
# an unmatched quote.
|
||||
#
|
||||
|
||||
eval "set -- $(
|
||||
printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
|
||||
xargs -n1 |
|
||||
sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
|
||||
tr '\n' ' '
|
||||
)" '"$@"'
|
||||
|
||||
exec "$JAVACMD" "$@"
|
||||
|
||||
22
gradlew.bat
vendored
22
gradlew.bat
vendored
@@ -40,7 +40,7 @@ if defined JAVA_HOME goto findJavaFromJavaHome
|
||||
|
||||
set JAVA_EXE=java.exe
|
||||
%JAVA_EXE% -version >NUL 2>&1
|
||||
if "%ERRORLEVEL%" == "0" goto init
|
||||
if "%ERRORLEVEL%" == "0" goto execute
|
||||
|
||||
echo.
|
||||
echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
||||
@@ -54,7 +54,7 @@ goto fail
|
||||
set JAVA_HOME=%JAVA_HOME:"=%
|
||||
set JAVA_EXE=%JAVA_HOME%/bin/java.exe
|
||||
|
||||
if exist "%JAVA_EXE%" goto init
|
||||
if exist "%JAVA_EXE%" goto execute
|
||||
|
||||
echo.
|
||||
echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
|
||||
@@ -64,28 +64,14 @@ echo location of your Java installation.
|
||||
|
||||
goto fail
|
||||
|
||||
:init
|
||||
@rem Get command-line arguments, handling Windows variants
|
||||
|
||||
if not "%OS%" == "Windows_NT" goto win9xME_args
|
||||
|
||||
:win9xME_args
|
||||
@rem Slurp the command line arguments.
|
||||
set CMD_LINE_ARGS=
|
||||
set _SKIP=2
|
||||
|
||||
:win9xME_args_slurp
|
||||
if "x%~1" == "x" goto execute
|
||||
|
||||
set CMD_LINE_ARGS=%*
|
||||
|
||||
:execute
|
||||
@rem Setup the command line
|
||||
|
||||
set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
|
||||
|
||||
|
||||
@rem Execute Gradle
|
||||
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %CMD_LINE_ARGS%
|
||||
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %*
|
||||
|
||||
:end
|
||||
@rem End local scope for the variables with windows NT shell
|
||||
|
||||
@@ -1,24 +0,0 @@
|
||||
FROM sickp/alpine-sshd:7.5-r2
|
||||
|
||||
ADD authorized_keys /home/sshj/.ssh/authorized_keys
|
||||
|
||||
ADD test-container/ssh_host_ecdsa_key /etc/ssh/ssh_host_ecdsa_key
|
||||
ADD test-container/ssh_host_ecdsa_key.pub /etc/ssh/ssh_host_ecdsa_key.pub
|
||||
ADD test-container/ssh_host_ed25519_key /etc/ssh/ssh_host_ed25519_key
|
||||
ADD test-container/ssh_host_ed25519_key.pub /etc/ssh/ssh_host_ed25519_key.pub
|
||||
ADD test-container/sshd_config /etc/ssh/sshd_config
|
||||
COPY test-container/trusted_ca_keys /etc/ssh/trusted_ca_keys
|
||||
COPY test-container/host_keys/* /etc/ssh/
|
||||
|
||||
RUN apk add --no-cache tini
|
||||
RUN \
|
||||
echo "root:smile" | chpasswd && \
|
||||
adduser -D -s /bin/ash sshj && \
|
||||
passwd -u sshj && \
|
||||
echo "sshj:ultrapassword" | chpasswd && \
|
||||
chmod 600 /home/sshj/.ssh/authorized_keys && \
|
||||
chmod 600 /etc/ssh/ssh_host_*_key && \
|
||||
chmod 644 /etc/ssh/*.pub && \
|
||||
chown -R sshj:sshj /home/sshj
|
||||
|
||||
ENTRYPOINT ["/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2"]
|
||||
@@ -3,6 +3,7 @@ ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHQiZm0w
|
||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDAdJiRkkBM8yC8seTEoAn2PfwbLKrkcahZ0xxPoWICJ root@sshj
|
||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIJ8ww4hJG/gHJYdkjTTBDF1GNz+228nuWprPV+NbQauA ajvanerp@Heimdall.local
|
||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIOaWrwt3drIOjeBq2LSHRavxAT7ja2f+5soOUJl/zKSI ajvanerp@Heimdall.xebialabs.com
|
||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAICYfPGSYFOHuSzTJ67H0ynvKJDfgDmwPOj7iJaLGbIBi sshjtest@TranceLove
|
||||
ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAoZ9l6Tkm2aL1tSBy2yw4xU5s8BE9MfqS/4J7DzvsYJxF6oQmTIjmStuhH/CT7UjuDtKXdXZUsIhKtafiizxGO8kHSzKDeitpth2RSr8ddMzZKyD6RNs7MfsgjA3UTtrrSrCXEY6O43S2cnuJrWzkPxtwxaQ3zOvDbS2tiulzyq0VzYmuhA/a4CyuQtJBuu+P2oqmu6pU/VB6IzONpvBvYbNPsH1WDmP7zko5wHPihXPCliztspKxS4DRtOZ7BGXyvg44UmIy0Kf4jOkaBV/eCCA4qH7ZHz71/5ceMOpszPcNOEmLGGYhwI+P3OuGMpkrSAv1f8IY6R8spZNncP6UaQ== no-passphrase
|
||||
ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQDKRyZAtOJJfAhPU6xE6ZXY564vwErAI3n3Yn4lTHL9bxev9Ily6eCqPLcV0WbSV04pztngFn9MjT7yb8mcXheHpIaWEH569sMpmpOtyfn4p68SceuXBGyyPGMIcfOTknkASd1JYSD4EPkd9rZmCzcx3vEnLu8ChnA/G221xSVQ5VC/jD/c/CgNUayhQ+xbn57qHKKtZwfTa21QmwIabGYJNwlVjlKTCdddeVnZfKqKrG7cxHQApsxd21rhM9IT/C/f4Y/Tx3WUUVeam0iZ265oiPHoPALqJIWSQIUheRYAxYAQqJwSQ0Or9MM8XXun2Iy3RUSGk6eIvrCsFbNURsHNs7Pu0UnpYv6FZ3vCkFep/1pAT6fQvY7pDOOWDHKXArD4watc9gIWaQBH73wDW/KgBcnMRSoGWgQjsYqIamP4oV1+HqUI3lRAsXZaX+eiBGt3+3A5KebP27UJ1YUwhwlzs7wzTKaCu0OaL+hOsP1F2AxAa995bgFksMd23645ux3YCJKXG4sGpJ1Z/Hs49K72gv+QjLZVxXqY623c8+3OUhlixqoEFd4iG7UMc5a552ch/VA+jaspmLZoFhPz99aBRVb1oCSPxSwLw+Q/wxv6pZmT+14rqTzY2farjU53hM+CsUPh7dnWXhGG7RuA5wCdeOXOYjuksfzAoHIZhPqTgQ== ajvanerp@Heimdall.local
|
||||
ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBMvfRYSe44VQGwxexOMibcM3+fWeUP1jrBofOxFDRRrzRF8dK/vll2svqTPXMRnITnT1UoemEcB5OHtvH4hzfh/HFeDxJ5S7UncYxoClTSa8MeMFG2Zj9CoUZs1SHbwSGg== root@sshj
|
||||
|
||||
7
src/itest/docker-image/entrypoint.sh
Normal file
7
src/itest/docker-image/entrypoint.sh
Normal file
@@ -0,0 +1,7 @@
|
||||
#!/bin/ash
|
||||
|
||||
# generate host keys if not present
|
||||
ssh-keygen -A
|
||||
|
||||
# do not detach (-D), log to stderr (-e), passthrough other arguments
|
||||
exec /usr/sbin/sshd -D -e "$@"
|
||||
@@ -1,158 +0,0 @@
|
||||
# $OpenBSD: sshd_config,v 1.101 2017/03/14 07:19:07 djm Exp $
|
||||
|
||||
# This is the sshd server system-wide configuration file. See
|
||||
# sshd_config(5) for more information.
|
||||
|
||||
# This sshd was compiled with PATH=/bin:/usr/bin:/sbin:/usr/sbin
|
||||
|
||||
# The strategy used for options in the default sshd_config shipped with
|
||||
# OpenSSH is to specify options with their default value where
|
||||
# possible, but leave them commented. Uncommented options override the
|
||||
# default value.
|
||||
|
||||
#Port 22
|
||||
#AddressFamily any
|
||||
#ListenAddress 0.0.0.0
|
||||
#ListenAddress ::
|
||||
|
||||
#HostKey /etc/ssh/ssh_host_rsa_key
|
||||
#HostKey /etc/ssh/ssh_host_dsa_key
|
||||
#HostKey /etc/ssh/ssh_host_ecdsa_key
|
||||
#HostKey /etc/ssh/ssh_host_ed25519_key
|
||||
|
||||
# Ciphers and keying
|
||||
#RekeyLimit default none
|
||||
|
||||
# Logging
|
||||
#SyslogFacility AUTH
|
||||
#LogLevel INFO
|
||||
|
||||
# Authentication:
|
||||
|
||||
#LoginGraceTime 2m
|
||||
PermitRootLogin yes
|
||||
#StrictModes yes
|
||||
#MaxAuthTries 6
|
||||
#MaxSessions 10
|
||||
|
||||
#PubkeyAuthentication yes
|
||||
|
||||
# The default is to check both .ssh/authorized_keys and .ssh/authorized_keys2
|
||||
# but this is overridden so installations will only check .ssh/authorized_keys
|
||||
AuthorizedKeysFile .ssh/authorized_keys
|
||||
|
||||
#AuthorizedPrincipalsFile none
|
||||
|
||||
#AuthorizedKeysCommand none
|
||||
#AuthorizedKeysCommandUser nobody
|
||||
|
||||
# For this to work you will also need host keys in /etc/ssh/ssh_known_hosts
|
||||
#HostbasedAuthentication no
|
||||
# Change to yes if you don't trust ~/.ssh/known_hosts for
|
||||
# HostbasedAuthentication
|
||||
#IgnoreUserKnownHosts no
|
||||
# Don't read the user's ~/.rhosts and ~/.shosts files
|
||||
#IgnoreRhosts yes
|
||||
|
||||
# To disable tunneled clear text passwords, change to no here!
|
||||
#PasswordAuthentication yes
|
||||
#PermitEmptyPasswords no
|
||||
|
||||
# Change to no to disable s/key passwords
|
||||
#ChallengeResponseAuthentication yes
|
||||
|
||||
# Kerberos options
|
||||
#KerberosAuthentication no
|
||||
#KerberosOrLocalPasswd yes
|
||||
#KerberosTicketCleanup yes
|
||||
#KerberosGetAFSToken no
|
||||
|
||||
# GSSAPI options
|
||||
#GSSAPIAuthentication no
|
||||
#GSSAPICleanupCredentials yes
|
||||
|
||||
# Set this to 'yes' to enable PAM authentication, account processing,
|
||||
# and session processing. If this is enabled, PAM authentication will
|
||||
# be allowed through the ChallengeResponseAuthentication and
|
||||
# PasswordAuthentication. Depending on your PAM configuration,
|
||||
# PAM authentication via ChallengeResponseAuthentication may bypass
|
||||
# the setting of "PermitRootLogin without-password".
|
||||
# If you just want the PAM account and session checks to run without
|
||||
# PAM authentication, then enable this but set PasswordAuthentication
|
||||
# and ChallengeResponseAuthentication to 'no'.
|
||||
#UsePAM no
|
||||
|
||||
#AllowAgentForwarding yes
|
||||
#AllowTcpForwarding yes
|
||||
#GatewayPorts no
|
||||
#X11Forwarding no
|
||||
#X11DisplayOffset 10
|
||||
#X11UseLocalhost yes
|
||||
#PermitTTY yes
|
||||
#PrintMotd yes
|
||||
#PrintLastLog yes
|
||||
#TCPKeepAlive yes
|
||||
#UseLogin no
|
||||
#PermitUserEnvironment no
|
||||
#Compression delayed
|
||||
#ClientAliveInterval 0
|
||||
#ClientAliveCountMax 3
|
||||
#UseDNS no
|
||||
#PidFile /run/sshd.pid
|
||||
#MaxStartups 10:30:100
|
||||
#PermitTunnel no
|
||||
#ChrootDirectory none
|
||||
#VersionAddendum none
|
||||
|
||||
# no default banner path
|
||||
#Banner none
|
||||
|
||||
# override default of no subsystems
|
||||
Subsystem sftp /usr/lib/ssh/sftp-server
|
||||
|
||||
# the following are HPN related configuration options
|
||||
# tcp receive buffer polling. disable in non autotuning kernels
|
||||
#TcpRcvBufPoll yes
|
||||
|
||||
# disable hpn performance boosts
|
||||
#HPNDisabled no
|
||||
|
||||
# buffer size for hpn to non-hpn connections
|
||||
#HPNBufferSize 2048
|
||||
|
||||
|
||||
# Example of overriding settings on a per-user basis
|
||||
#Match User anoncvs
|
||||
# X11Forwarding no
|
||||
# AllowTcpForwarding no
|
||||
# PermitTTY no
|
||||
# ForceCommand cvs server
|
||||
|
||||
KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1
|
||||
macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,hmac-ripemd160-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512,hmac-ripemd160,hmac-ripemd160@openssh.com
|
||||
|
||||
TrustedUserCAKeys /etc/ssh/trusted_ca_keys
|
||||
|
||||
Ciphers 3des-cbc,blowfish-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com,chacha20-poly1305@openssh.com
|
||||
|
||||
HostKey /etc/ssh/ssh_host_rsa_key
|
||||
HostKey /etc/ssh/ssh_host_dsa_key
|
||||
HostKey /etc/ssh/ssh_host_ecdsa_key
|
||||
HostKey /etc/ssh/ssh_host_ed25519_key
|
||||
|
||||
HostKey /etc/ssh/ssh_host_ecdsa_256_key
|
||||
HostCertificate /etc/ssh/ssh_host_ecdsa_256_key-cert.pub
|
||||
|
||||
HostKey /etc/ssh/ssh_host_ecdsa_384_key
|
||||
HostCertificate /etc/ssh/ssh_host_ecdsa_384_key-cert.pub
|
||||
|
||||
HostKey /etc/ssh/ssh_host_ecdsa_521_key
|
||||
HostCertificate /etc/ssh/ssh_host_ecdsa_521_key-cert.pub
|
||||
|
||||
HostKey /etc/ssh/ssh_host_ed25519_384_key
|
||||
HostCertificate /etc/ssh/ssh_host_ed25519_384_key-cert.pub
|
||||
|
||||
HostKey /etc/ssh/ssh_host_rsa_2048_key
|
||||
HostCertificate /etc/ssh/ssh_host_rsa_2048_key-cert.pub
|
||||
|
||||
LogLevel DEBUG2
|
||||
@@ -1,42 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj
|
||||
|
||||
import net.schmizz.sshj.Config
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import net.schmizz.sshj.SSHClient
|
||||
import net.schmizz.sshj.transport.verification.PromiscuousVerifier
|
||||
import spock.lang.Specification
|
||||
|
||||
class IntegrationBaseSpec extends Specification {
|
||||
protected static final int DOCKER_PORT = 2222
|
||||
protected static final String USERNAME = "sshj"
|
||||
protected static final String KEYFILE = "src/itest/resources/keyfiles/id_rsa"
|
||||
protected final static String SERVER_IP = System.getProperty("serverIP", "127.0.0.1")
|
||||
|
||||
protected static SSHClient getConnectedClient(Config config) {
|
||||
SSHClient sshClient = new SSHClient(config)
|
||||
sshClient.addHostKeyVerifier(new PromiscuousVerifier())
|
||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
||||
|
||||
return sshClient
|
||||
}
|
||||
|
||||
protected static SSHClient getConnectedClient() throws IOException {
|
||||
return getConnectedClient(new DefaultConfig())
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,95 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj
|
||||
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import net.schmizz.sshj.SSHClient
|
||||
import net.schmizz.sshj.transport.TransportException
|
||||
import net.schmizz.sshj.userauth.UserAuthException
|
||||
import spock.lang.Unroll
|
||||
|
||||
class IntegrationSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "should accept correct key for #signatureName"() {
|
||||
given:
|
||||
def config = new DefaultConfig()
|
||||
config.setKeyAlgorithms(Collections.singletonList(signatureFactory))
|
||||
SSHClient sshClient = new SSHClient(config)
|
||||
sshClient.addHostKeyVerifier(fingerprint) // test-containers/ssh_host_ecdsa_key's fingerprint
|
||||
|
||||
when:
|
||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
||||
|
||||
then:
|
||||
sshClient.isConnected()
|
||||
|
||||
where:
|
||||
signatureFactory << [KeyAlgorithms.ECDSASHANistp256(), KeyAlgorithms.EdDSA25519()]
|
||||
fingerprint << ["d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3", "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"]
|
||||
signatureName = signatureFactory.getName()
|
||||
}
|
||||
|
||||
def "should decline wrong key"() throws IOException {
|
||||
given:
|
||||
SSHClient sshClient = new SSHClient(new DefaultConfig())
|
||||
sshClient.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3")
|
||||
|
||||
when:
|
||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
||||
|
||||
then:
|
||||
thrown(TransportException.class)
|
||||
}
|
||||
|
||||
@Unroll
|
||||
def "should authenticate with key #key"() {
|
||||
given:
|
||||
SSHClient client = getConnectedClient()
|
||||
|
||||
when:
|
||||
def keyProvider = passphrase != null ? client.loadKeys("src/itest/resources/keyfiles/$key", passphrase) : client.loadKeys("src/itest/resources/keyfiles/$key")
|
||||
client.authPublickey(USERNAME, keyProvider)
|
||||
|
||||
then:
|
||||
client.isAuthenticated()
|
||||
|
||||
where:
|
||||
key | passphrase
|
||||
// "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
|
||||
"id_ecdsa_opensshv1" | null
|
||||
"id_ed25519_opensshv1" | null
|
||||
"id_ed25519_opensshv1_aes256cbc.pem" | "foobar"
|
||||
"id_ed25519_opensshv1_protected" | "sshjtest"
|
||||
"id_rsa" | null
|
||||
"id_rsa_opensshv1" | null
|
||||
"id_ecdsa_nistp384_opensshv1" | null
|
||||
"id_ecdsa_nistp521_opensshv1" | null
|
||||
}
|
||||
|
||||
def "should not authenticate with wrong key"() {
|
||||
given:
|
||||
SSHClient client = getConnectedClient()
|
||||
|
||||
when:
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key")
|
||||
|
||||
then:
|
||||
thrown(UserAuthException.class)
|
||||
!client.isAuthenticated()
|
||||
}
|
||||
}
|
||||
@@ -1,68 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.sftp
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import net.schmizz.sshj.SSHClient
|
||||
import net.schmizz.sshj.sftp.OpenMode
|
||||
import net.schmizz.sshj.sftp.RemoteFile
|
||||
import net.schmizz.sshj.sftp.SFTPClient
|
||||
|
||||
import java.nio.charset.StandardCharsets
|
||||
|
||||
import static org.codehaus.groovy.runtime.IOGroovyMethods.withCloseable
|
||||
|
||||
class FileWriteSpec extends IntegrationBaseSpec {
|
||||
|
||||
def "should append to file (GH issue #390)"() {
|
||||
given:
|
||||
SSHClient client = getConnectedClient()
|
||||
client.authPublickey("sshj", "src/test/resources/id_rsa")
|
||||
SFTPClient sftp = client.newSFTPClient()
|
||||
def file = "/home/sshj/test.txt"
|
||||
def initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16)
|
||||
def appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16)
|
||||
|
||||
when:
|
||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) { RemoteFile initial ->
|
||||
initial.write(0, initialText, 0, initialText.length)
|
||||
}
|
||||
|
||||
then:
|
||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
|
||||
def bytes = new byte[initialText.length]
|
||||
read.read(0, bytes, 0, bytes.length)
|
||||
bytes == initialText
|
||||
}
|
||||
|
||||
when:
|
||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) { RemoteFile append ->
|
||||
append.write(0, appendText, 0, appendText.length)
|
||||
}
|
||||
|
||||
then:
|
||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
|
||||
def bytes = new byte[initialText.length + appendText.length]
|
||||
read.read(0, bytes, 0, bytes.length)
|
||||
Arrays.copyOfRange(bytes, 0, initialText.length) == initialText
|
||||
Arrays.copyOfRange(bytes, initialText.length, initialText.length + appendText.length) == appendText
|
||||
}
|
||||
|
||||
cleanup:
|
||||
sftp.close()
|
||||
client.close()
|
||||
}
|
||||
}
|
||||
@@ -1,115 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import net.schmizz.sshj.SSHClient
|
||||
import net.schmizz.sshj.transport.verification.OpenSSHKnownHosts
|
||||
import spock.lang.Unroll
|
||||
|
||||
import java.nio.file.Files
|
||||
import java.util.stream.Collectors
|
||||
|
||||
/**
|
||||
* This is a brief test for verifying connection to a server using keys with certificates.
|
||||
*
|
||||
* Also, take a look at the unit test {@link net.schmizz.sshj.transport.verification.KeyWithCertificateUnitSpec}.
|
||||
*/
|
||||
class KeyWithCertificateSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "authorising with a signed public key #keyName"() {
|
||||
given:
|
||||
def client = getConnectedClient()
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, "src/itest/resources/keyfiles/certificates/$keyName")
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
where:
|
||||
keyName << [
|
||||
"id_ecdsa_256_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_256_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_256_pem_signed_by_ed25519",
|
||||
"id_ecdsa_256_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_256_pem_signed_by_rsa",
|
||||
"id_ecdsa_256_rfc4716_signed_by_rsa",
|
||||
"id_ecdsa_384_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_384_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_384_pem_signed_by_ed25519",
|
||||
"id_ecdsa_384_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_384_pem_signed_by_rsa",
|
||||
"id_ecdsa_384_rfc4716_signed_by_rsa",
|
||||
"id_ecdsa_521_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_521_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_521_pem_signed_by_ed25519",
|
||||
"id_ecdsa_521_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_521_pem_signed_by_rsa",
|
||||
"id_ecdsa_521_rfc4716_signed_by_rsa",
|
||||
"id_rsa_2048_pem_signed_by_ecdsa",
|
||||
"id_rsa_2048_rfc4716_signed_by_ecdsa",
|
||||
"id_rsa_2048_pem_signed_by_ed25519",
|
||||
"id_rsa_2048_rfc4716_signed_by_ed25519",
|
||||
"id_rsa_2048_pem_signed_by_rsa",
|
||||
"id_rsa_2048_rfc4716_signed_by_rsa",
|
||||
"id_ed25519_384_rfc4716_signed_by_ecdsa",
|
||||
"id_ed25519_384_rfc4716_signed_by_ed25519",
|
||||
"id_ed25519_384_rfc4716_signed_by_rsa",
|
||||
]
|
||||
}
|
||||
|
||||
@Unroll
|
||||
def "accepting a signed host public key with type #hostKeyAlgo"() {
|
||||
given:
|
||||
File knownHosts = Files.createTempFile("known_hosts", "").toFile()
|
||||
knownHosts.deleteOnExit()
|
||||
|
||||
and:
|
||||
File caPubKey = new File("src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub")
|
||||
String knownHostsFileContents = "" +
|
||||
"@cert-authority $SERVER_IP ${caPubKey.text}" +
|
||||
"\n@cert-authority [$SERVER_IP]:$DOCKER_PORT ${caPubKey.text}"
|
||||
knownHosts.write(knownHostsFileContents)
|
||||
|
||||
and:
|
||||
def config = new DefaultConfig()
|
||||
config.keyAlgorithms = config.keyAlgorithms.stream()
|
||||
.filter { it.name == hostKeyAlgo }
|
||||
.collect(Collectors.toList())
|
||||
SSHClient sshClient = new SSHClient(config)
|
||||
sshClient.addHostKeyVerifier(new OpenSSHKnownHosts(knownHosts))
|
||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
||||
|
||||
when:
|
||||
sshClient.authPassword("sshj", "ultrapassword")
|
||||
|
||||
then:
|
||||
sshClient.authenticated
|
||||
|
||||
and:
|
||||
knownHosts.getText() == knownHostsFileContents
|
||||
|
||||
where:
|
||||
hostKeyAlgo << [
|
||||
"ecdsa-sha2-nistp256-cert-v01@openssh.com",
|
||||
"ssh-ed25519-cert-v01@openssh.com",
|
||||
"ssh-rsa-cert-v01@openssh.com",
|
||||
]
|
||||
}
|
||||
}
|
||||
@@ -1,42 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import spock.lang.Unroll
|
||||
|
||||
class SignatureSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "should correctly connect with #sig Signature"() {
|
||||
given:
|
||||
def cfg = new DefaultConfig()
|
||||
cfg.setKeyAlgorithms(Collections.singletonList(sigFactory))
|
||||
def client = getConnectedClient(cfg)
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, KEYFILE)
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
where:
|
||||
sigFactory << [KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512()]
|
||||
sig = sigFactory.name
|
||||
}
|
||||
}
|
||||
@@ -1,55 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.cipher
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import spock.lang.Unroll
|
||||
|
||||
class CipherSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "should correctly connect with #cipher Cipher"() {
|
||||
given:
|
||||
def cfg = new DefaultConfig()
|
||||
cfg.setCipherFactories(cipherFactory)
|
||||
def client = getConnectedClient(cfg)
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, KEYFILE)
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
cleanup:
|
||||
client.disconnect()
|
||||
|
||||
where:
|
||||
cipherFactory << [BlockCiphers.TripleDESCBC(),
|
||||
BlockCiphers.BlowfishCBC(),
|
||||
BlockCiphers.AES128CBC(),
|
||||
BlockCiphers.AES128CTR(),
|
||||
BlockCiphers.AES192CBC(),
|
||||
BlockCiphers.AES192CTR(),
|
||||
BlockCiphers.AES256CBC(),
|
||||
BlockCiphers.AES256CTR(),
|
||||
GcmCiphers.AES128GCM(),
|
||||
GcmCiphers.AES256GCM(),
|
||||
ChachaPolyCiphers.CHACHA_POLY_OPENSSH()]
|
||||
cipher = cipherFactory.name
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,61 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.kex
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import com.hierynomus.sshj.transport.mac.Macs
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import net.schmizz.sshj.transport.kex.Curve25519DH
|
||||
import net.schmizz.sshj.transport.kex.Curve25519SHA256
|
||||
import net.schmizz.sshj.transport.kex.DH
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA1
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA256
|
||||
import net.schmizz.sshj.transport.kex.ECDH
|
||||
import net.schmizz.sshj.transport.kex.ECDHNistP
|
||||
import spock.lang.Unroll
|
||||
|
||||
class KexSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "should correctly connect with #kex Key Exchange"() {
|
||||
given:
|
||||
def cfg = new DefaultConfig()
|
||||
cfg.setKeyExchangeFactories(kexFactory)
|
||||
def client = getConnectedClient(cfg)
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, KEYFILE)
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
where:
|
||||
kexFactory << [DHGroups.Group1SHA1(),
|
||||
DHGroups.Group14SHA1(),
|
||||
DHGroups.Group14SHA256(),
|
||||
DHGroups.Group16SHA512(),
|
||||
DHGroups.Group18SHA512(),
|
||||
new DHGexSHA1.Factory(),
|
||||
new DHGexSHA256.Factory(),
|
||||
new Curve25519SHA256.Factory(),
|
||||
new Curve25519SHA256.FactoryLibSsh(),
|
||||
new ECDHNistP.Factory256(),
|
||||
new ECDHNistP.Factory384(),
|
||||
new ECDHNistP.Factory521()]
|
||||
kex = kexFactory.name
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,65 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.mac
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import spock.lang.Unroll
|
||||
|
||||
class MacSpec extends IntegrationBaseSpec {
|
||||
|
||||
@Unroll
|
||||
def "should correctly connect with #mac MAC"() {
|
||||
given:
|
||||
def cfg = new DefaultConfig()
|
||||
cfg.setMACFactories(macFactory)
|
||||
def client = getConnectedClient(cfg)
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, KEYFILE)
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
cleanup:
|
||||
client.disconnect()
|
||||
|
||||
where:
|
||||
macFactory << [Macs.HMACRIPEMD160(), Macs.HMACRIPEMD160OpenSsh(), Macs.HMACSHA2256(), Macs.HMACSHA2512()]
|
||||
mac = macFactory.name
|
||||
}
|
||||
|
||||
@Unroll
|
||||
def "should correctly connect with Encrypt-Then-Mac #mac MAC"() {
|
||||
given:
|
||||
def cfg = new DefaultConfig()
|
||||
cfg.setMACFactories(macFactory)
|
||||
def client = getConnectedClient(cfg)
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, KEYFILE)
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
|
||||
cleanup:
|
||||
client.disconnect()
|
||||
|
||||
where:
|
||||
macFactory << [Macs.HMACRIPEMD160Etm(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm()]
|
||||
mac = macFactory.name
|
||||
}
|
||||
}
|
||||
72
src/itest/java/com/hierynomus/sshj/HostKeyVerifierTest.java
Normal file
72
src/itest/java/com/hierynomus/sshj/HostKeyVerifierTest.java
Normal file
@@ -0,0 +1,72 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import static org.junit.Assert.assertThrows;
|
||||
import static org.junit.Assert.assertTrue;
|
||||
|
||||
import java.util.List;
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.Arguments;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.transport.TransportException;
|
||||
|
||||
@Testcontainers
|
||||
public class HostKeyVerifierTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer();
|
||||
|
||||
public static Stream<Arguments> signatureAlgos() {
|
||||
return Stream.of(
|
||||
Arguments.of(KeyAlgorithms.ECDSASHANistp256(), "d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3"),
|
||||
Arguments.of(KeyAlgorithms.EdDSA25519(), "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"));
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "Should connect with signature verified for Key Algorithm {0}")
|
||||
@MethodSource("signatureAlgos")
|
||||
public void shouldConnectWithSignatureVerified(KeyAlgorithms.Factory alg, String fingerprint) throws Throwable {
|
||||
Config config = new DefaultConfig();
|
||||
config.setKeyAlgorithms(List.of(alg));
|
||||
|
||||
try (SSHClient client = new SSHClient(config)) {
|
||||
client.addHostKeyVerifier(fingerprint);
|
||||
client.connect(sshd.getHost(), sshd.getFirstMappedPort());
|
||||
|
||||
assertTrue(client.isConnected());
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
public void shouldDeclineWrongKey() throws Throwable {
|
||||
try (SSHClient client = new SSHClient()) {
|
||||
assertThrows(TransportException.class, () -> {
|
||||
client.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3");
|
||||
client.connect(sshd.getHost(), sshd.getFirstMappedPort());
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
74
src/itest/java/com/hierynomus/sshj/ManyChannelsTest.java
Normal file
74
src/itest/java/com/hierynomus/sshj/ManyChannelsTest.java
Normal file
@@ -0,0 +1,74 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import java.util.concurrent.ExecutorService;
|
||||
import java.util.concurrent.Executors;
|
||||
import java.util.concurrent.Future;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.connection.channel.direct.Session;
|
||||
|
||||
import static org.assertj.core.api.Assertions.*;
|
||||
|
||||
@Testcontainers
|
||||
public class ManyChannelsTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||
.withSshdConfig(SshdConfigBuilder.defaultBuilder().with("MaxSessions", "200")).withAllKeys());
|
||||
|
||||
@Test
|
||||
public void shouldWorkWithManyChannelsWithoutNoExistentChannelError_GH805() throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||
|
||||
List<Future<Exception>> futures = new ArrayList<>();
|
||||
ExecutorService executorService = Executors.newCachedThreadPool();
|
||||
|
||||
for (int i = 0; i < 20; i++) {
|
||||
futures.add(executorService.submit(() -> {
|
||||
try {
|
||||
for (int j = 0; j < 10; j++) {
|
||||
try (Session sshSession = client.startSession()) {
|
||||
try (Session.Command sshCommand = sshSession.exec("ls -la")) {
|
||||
IOUtils.readFully(sshCommand.getInputStream()).toString();
|
||||
}
|
||||
}
|
||||
}
|
||||
} catch (Exception e) {
|
||||
return e;
|
||||
}
|
||||
return null;
|
||||
}));
|
||||
}
|
||||
|
||||
executorService.shutdown();
|
||||
executorService.awaitTermination(1, TimeUnit.DAYS);
|
||||
|
||||
assertThat(futures).allSatisfy(future -> assertThat(future.get()).isNull());
|
||||
}
|
||||
}
|
||||
}
|
||||
86
src/itest/java/com/hierynomus/sshj/PublicKeyAuthTest.java
Normal file
86
src/itest/java/com/hierynomus/sshj/PublicKeyAuthTest.java
Normal file
@@ -0,0 +1,86 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import static org.junit.Assert.assertFalse;
|
||||
import static org.junit.Assert.assertThrows;
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.Arguments;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.userauth.UserAuthException;
|
||||
import net.schmizz.sshj.userauth.keyprovider.KeyProvider;
|
||||
|
||||
@Testcontainers
|
||||
public class PublicKeyAuthTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(
|
||||
SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com"))
|
||||
.withAllKeys());
|
||||
|
||||
public static Stream<Arguments> keys() {
|
||||
return Stream.of(
|
||||
Arguments.of("id_rsa2", null),
|
||||
// "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
|
||||
Arguments.of("id_ecdsa_opensshv1", null),
|
||||
Arguments.of("id_ed25519_opensshv1", null),
|
||||
Arguments.of("id_ed25519_opensshv1_aes256cbc.pem", "foobar"),
|
||||
Arguments.of("id_ed25519_opensshv1_aes128cbc.pem", "sshjtest"),
|
||||
Arguments.of("id_ed25519_opensshv1_protected", "sshjtest"),
|
||||
Arguments.of("id_rsa", null),
|
||||
Arguments.of("id_rsa_opensshv1", null),
|
||||
Arguments.of("id_ecdsa_nistp384_opensshv1", null),
|
||||
Arguments.of("id_ecdsa_nistp521_opensshv1", null));
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should authenticate with signed public key {0}")
|
||||
@MethodSource("keys")
|
||||
public void shouldAuthenticateWithSignedRsaKey(String key, String passphrase) throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
KeyProvider p = null;
|
||||
if (passphrase != null) {
|
||||
p = client.loadKeys("src/itest/resources/keyfiles/" + key, passphrase);
|
||||
} else {
|
||||
p = client.loadKeys("src/itest/resources/keyfiles/" + key);
|
||||
}
|
||||
client.authPublickey("sshj", p);
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
public void shouldNotAuthenticateWithUnknownKey() throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
assertThrows(UserAuthException.class, () -> {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key");
|
||||
});
|
||||
|
||||
assertFalse(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
100
src/itest/java/com/hierynomus/sshj/RsaShaKeySignatureTest.java
Normal file
100
src/itest/java/com/hierynomus/sshj/RsaShaKeySignatureTest.java
Normal file
@@ -0,0 +1,100 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.Arguments;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
|
||||
import java.util.List;
|
||||
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
|
||||
|
||||
public class RsaShaKeySignatureTest {
|
||||
|
||||
public static Stream<Arguments> hostKeysAndAlgorithms() {
|
||||
return Stream.of(
|
||||
Arguments.of("ssh_host_ecdsa_256_key", KeyAlgorithms.ECDSASHANistp256()),
|
||||
Arguments.of("ssh_host_ecdsa_384_key", KeyAlgorithms.ECDSASHANistp384()),
|
||||
Arguments.of("ssh_host_ecdsa_521_key", KeyAlgorithms.ECDSASHANistp521()),
|
||||
Arguments.of("ssh_host_ed25519_384_key", KeyAlgorithms.EdDSA25519()),
|
||||
Arguments.of("ssh_host_rsa_2048_key", KeyAlgorithms.RSASHA512()));
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "Should connect to server that does not support ssh-rsa with host key {1}")
|
||||
@MethodSource("hostKeysAndAlgorithms")
|
||||
public void shouldConnectToServerThatDoesNotSupportSshRsaWithHostKey(String key, KeyAlgorithms.Factory algorithm)
|
||||
throws Throwable {
|
||||
SshdConfigBuilder configBuilder = SshdConfigBuilder
|
||||
.defaultBuilder()
|
||||
.with("PubkeyAcceptedAlgorithms", "rsa-sha2-512,rsa-sha2-256,ssh-ed25519");
|
||||
withSshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||
.withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
|
||||
Config c = new DefaultConfig();
|
||||
c.setKeyAlgorithms(List.of(KeyAlgorithms.RSASHA512(), KeyAlgorithms.RSASHA256(), algorithm));
|
||||
|
||||
SSHClient client = sshd.getConnectedClient(c);
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
|
||||
client.disconnect();
|
||||
});
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "Should connect to a default server with host key {1} with a default config")
|
||||
@MethodSource("hostKeysAndAlgorithms")
|
||||
public void shouldConnectToDefaultServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
|
||||
withSshdContainer(SshdContainer.Builder.defaultBuilder().addHostKey("test-container/host_keys/" + key),
|
||||
sshd -> {
|
||||
SSHClient client = sshd.getConnectedClient();
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
|
||||
client.disconnect();
|
||||
});
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "Should connect to a server that only supports ssh-rsa with host key {1}")
|
||||
@MethodSource("hostKeysAndAlgorithms")
|
||||
public void shouldConnectToSshRsaOnlyServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
|
||||
SshdConfigBuilder configBuilder = SshdConfigBuilder
|
||||
.defaultBuilder()
|
||||
.with("PubkeyAcceptedAlgorithms", "ssh-rsa,ssh-ed25519");
|
||||
|
||||
withSshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||
.withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
|
||||
Config c = new DefaultConfig();
|
||||
c.setKeyAlgorithms(List.of(KeyAlgorithms.SSHRSA(), algorithm));
|
||||
SSHClient client = sshd.getConnectedClient(c);
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
client.disconnect();
|
||||
});
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,77 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import org.testcontainers.containers.wait.strategy.WaitStrategy;
|
||||
import org.testcontainers.containers.wait.strategy.WaitStrategyTarget;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.InetSocketAddress;
|
||||
import java.net.Socket;
|
||||
import java.nio.charset.StandardCharsets;
|
||||
import java.time.Duration;
|
||||
import java.util.Arrays;
|
||||
|
||||
/**
|
||||
* A wait strategy designed for {@link SshdContainer} to wait until the SSH server is ready, to avoid races when a test
|
||||
* tries to connect to a server before the server has started.
|
||||
*/
|
||||
public class SshServerWaitStrategy implements WaitStrategy {
|
||||
private Duration startupTimeout = Duration.ofMinutes(1);
|
||||
|
||||
@Override
|
||||
public void waitUntilReady(WaitStrategyTarget waitStrategyTarget) {
|
||||
long expectedEnd = System.nanoTime() + startupTimeout.toNanos();
|
||||
while (waitStrategyTarget.isRunning()) {
|
||||
long attemptStart = System.nanoTime();
|
||||
IOException error = null;
|
||||
byte[] buffer = new byte[7];
|
||||
try (Socket socket = new Socket()) {
|
||||
socket.setSoTimeout(500);
|
||||
socket.connect(new InetSocketAddress(
|
||||
waitStrategyTarget.getHost(), waitStrategyTarget.getFirstMappedPort()));
|
||||
// Haven't seen any SSH server that sends the version in two or more packets.
|
||||
//noinspection ResultOfMethodCallIgnored
|
||||
socket.getInputStream().read(buffer);
|
||||
if (!Arrays.equals(buffer, "SSH-2.0".getBytes(StandardCharsets.UTF_8))) {
|
||||
error = new IOException("The version message doesn't look like an SSH server version");
|
||||
}
|
||||
} catch (IOException err) {
|
||||
error = err;
|
||||
}
|
||||
|
||||
if (error == null) {
|
||||
break;
|
||||
} else if (System.nanoTime() >= expectedEnd) {
|
||||
throw new RuntimeException(error);
|
||||
}
|
||||
|
||||
try {
|
||||
//noinspection BusyWait
|
||||
Thread.sleep(Math.max(0L, 500L - (System.nanoTime() - attemptStart) / 1_000_000));
|
||||
} catch (InterruptedException e) {
|
||||
Thread.currentThread().interrupt();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public WaitStrategy withStartupTimeout(Duration startupTimeout) {
|
||||
this.startupTimeout = startupTimeout;
|
||||
return this;
|
||||
}
|
||||
}
|
||||
246
src/itest/java/com/hierynomus/sshj/SshdContainer.java
Normal file
246
src/itest/java/com/hierynomus/sshj/SshdContainer.java
Normal file
@@ -0,0 +1,246 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj;
|
||||
|
||||
import ch.qos.logback.classic.Level;
|
||||
import ch.qos.logback.classic.Logger;
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.transport.verification.PromiscuousVerifier;
|
||||
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
import org.junit.jupiter.api.function.ThrowingConsumer;
|
||||
import org.slf4j.LoggerFactory;
|
||||
import org.testcontainers.containers.GenericContainer;
|
||||
import org.testcontainers.images.builder.ImageFromDockerfile;
|
||||
import org.testcontainers.images.builder.dockerfile.DockerfileBuilder;
|
||||
import org.testcontainers.utility.DockerLoggerFactory;
|
||||
|
||||
import java.util.function.Consumer;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.nio.file.Paths;
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import java.util.concurrent.Future;
|
||||
|
||||
/**
|
||||
* A JUnit4 rule for launching a generic SSH server container.
|
||||
*/
|
||||
public class SshdContainer extends GenericContainer<SshdContainer> {
|
||||
|
||||
/**
|
||||
* A workaround for strange logger names of testcontainers. They contain no
|
||||
* dots, but contain slashes,
|
||||
* square brackets, and even emoji. It's uneasy to set the logging level via the
|
||||
* XML file of logback, the
|
||||
* result would be less readable than the code below.
|
||||
*/
|
||||
public static class DebugLoggingImageFromDockerfile extends ImageFromDockerfile {
|
||||
public DebugLoggingImageFromDockerfile() {
|
||||
super();
|
||||
Logger logger = (Logger) LoggerFactory.getILoggerFactory()
|
||||
.getLogger(DockerLoggerFactory.getLogger(getDockerImageName()).getName());
|
||||
logger.setLevel(Level.DEBUG);
|
||||
}
|
||||
}
|
||||
|
||||
public static class SshdConfigBuilder {
|
||||
public static final String DEFAULT_SSHD_CONFIG = "" +
|
||||
"PermitRootLogin yes\n" +
|
||||
"AuthorizedKeysFile .ssh/authorized_keys\n" +
|
||||
"Subsystem sftp /usr/lib/ssh/sftp-server\n" +
|
||||
"KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1\n"
|
||||
+
|
||||
"macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512\n"
|
||||
+
|
||||
"TrustedUserCAKeys /etc/ssh/trusted_ca_keys\n" +
|
||||
"Ciphers 3des-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com,chacha20-poly1305@openssh.com\n"
|
||||
+
|
||||
"LogLevel DEBUG2\n";
|
||||
private String sshdConfig;
|
||||
|
||||
public SshdConfigBuilder(@NotNull String sshdConfig) {
|
||||
this.sshdConfig = sshdConfig;
|
||||
}
|
||||
|
||||
public static SshdConfigBuilder defaultBuilder() {
|
||||
return new SshdConfigBuilder(DEFAULT_SSHD_CONFIG);
|
||||
}
|
||||
|
||||
public @NotNull SshdConfigBuilder withHostKey(@NotNull String hostKey) {
|
||||
sshdConfig += "HostKey /etc/ssh/" + Paths.get(hostKey).getFileName() + "\n";
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull SshdConfigBuilder withHostKeyCertificate(@NotNull String hostKeyCertificate) {
|
||||
sshdConfig += "HostCertificate /etc/ssh/" + Paths.get(hostKeyCertificate).getFileName() + "\n";
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull SshdConfigBuilder with(String key, String value) {
|
||||
sshdConfig += key + " " + value + "\n";
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull String build() {
|
||||
return sshdConfig;
|
||||
}
|
||||
}
|
||||
|
||||
public static class Builder implements Consumer<DockerfileBuilder> {
|
||||
private List<String> hostKeys = new ArrayList<>();
|
||||
private List<String> certificates = new ArrayList<>();
|
||||
private @NotNull SshdConfigBuilder sshdConfig = SshdConfigBuilder.defaultBuilder();
|
||||
|
||||
public static Builder defaultBuilder() {
|
||||
Builder b = new Builder();
|
||||
|
||||
return b;
|
||||
}
|
||||
|
||||
|
||||
public @NotNull Builder withSshdConfig(@NotNull SshdConfigBuilder sshdConfig) {
|
||||
this.sshdConfig = sshdConfig;
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull Builder withAllKeys() {
|
||||
this.addHostKey("test-container/ssh_host_ecdsa_key");
|
||||
this.addHostKey("test-container/ssh_host_ed25519_key");
|
||||
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_256_key");
|
||||
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_384_key");
|
||||
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_521_key");
|
||||
this.addHostKey("test-container/host_keys/ssh_host_ed25519_384_key");
|
||||
this.addHostKey("test-container/host_keys/ssh_host_rsa_2048_key");
|
||||
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_256_key-cert.pub");
|
||||
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_384_key-cert.pub");
|
||||
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_521_key-cert.pub");
|
||||
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ed25519_384_key-cert.pub");
|
||||
this.addHostKeyCertificate("test-container/host_keys/ssh_host_rsa_2048_key-cert.pub");
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull SshdContainer build() {
|
||||
return new SshdContainer(buildInner());
|
||||
}
|
||||
|
||||
@NotNull Future<String> buildInner() {
|
||||
return new DebugLoggingImageFromDockerfile()
|
||||
.withDockerfileFromBuilder(this)
|
||||
.withFileFromPath(".", Paths.get("src/itest/docker-image"))
|
||||
.withFileFromString("sshd_config", sshdConfig.build());
|
||||
}
|
||||
|
||||
@Override
|
||||
public void accept(@NotNull DockerfileBuilder builder) {
|
||||
builder.from("alpine:3.19.0");
|
||||
builder.run("apk add --no-cache openssh");
|
||||
builder.expose(22);
|
||||
builder.copy("entrypoint.sh", "/entrypoint.sh");
|
||||
|
||||
builder.add("authorized_keys", "/home/sshj/.ssh/authorized_keys");
|
||||
builder.copy("test-container/trusted_ca_keys", "/etc/ssh/trusted_ca_keys");
|
||||
|
||||
for (String hostKey : hostKeys) {
|
||||
builder.copy(hostKey, "/etc/ssh/" + Paths.get(hostKey).getFileName());
|
||||
builder.copy(hostKey + ".pub", "/etc/ssh/" + Paths.get(hostKey).getFileName() + ".pub");
|
||||
}
|
||||
|
||||
for (String certificate : certificates) {
|
||||
builder.copy(certificate, "/etc/ssh/" + Paths.get(certificate).getFileName());
|
||||
}
|
||||
|
||||
|
||||
builder.run("apk add --no-cache tini"
|
||||
+ " && echo \"root:smile\" | chpasswd"
|
||||
+ " && adduser -D -s /bin/ash sshj"
|
||||
+ " && passwd -u sshj"
|
||||
+ " && echo \"sshj:ultrapassword\" | chpasswd"
|
||||
+ " && chmod 600 /home/sshj/.ssh/authorized_keys"
|
||||
+ " && chmod 600 /etc/ssh/ssh_host_*_key"
|
||||
+ " && chmod 644 /etc/ssh/*.pub"
|
||||
+ " && chmod 755 /entrypoint.sh"
|
||||
+ " && chown -R sshj:sshj /home/sshj");
|
||||
builder.entryPoint("/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2");
|
||||
|
||||
builder.add("sshd_config", "/etc/ssh/sshd_config");
|
||||
}
|
||||
|
||||
public @NotNull Builder addHostKey(@NotNull String hostKey) {
|
||||
hostKeys.add(hostKey);
|
||||
sshdConfig.withHostKey(hostKey);
|
||||
return this;
|
||||
}
|
||||
|
||||
public @NotNull Builder addHostKeyCertificate(@NotNull String hostKeyCertificate) {
|
||||
certificates.add(hostKeyCertificate);
|
||||
sshdConfig.withHostKeyCertificate(hostKeyCertificate);
|
||||
return this;
|
||||
}
|
||||
}
|
||||
|
||||
@SuppressWarnings("unused") // Used dynamically by Spock
|
||||
public SshdContainer() {
|
||||
this(new SshdContainer.Builder().withAllKeys().buildInner());
|
||||
}
|
||||
|
||||
public SshdContainer(SshdContainer.Builder builder) {
|
||||
this(builder.buildInner());
|
||||
}
|
||||
|
||||
public SshdContainer(@NotNull Future<String> future) {
|
||||
super(future);
|
||||
withExposedPorts(22);
|
||||
setWaitStrategy(new SshServerWaitStrategy());
|
||||
withLogConsumer(outputFrame -> {
|
||||
switch (outputFrame.getType()) {
|
||||
case STDOUT:
|
||||
logger().info("sshd stdout: {}", outputFrame.getUtf8String().stripTrailing());
|
||||
break;
|
||||
case STDERR:
|
||||
logger().info("sshd stderr: {}", outputFrame.getUtf8String().stripTrailing());
|
||||
break;
|
||||
case END:
|
||||
break;
|
||||
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
public SSHClient getConnectedClient(Config config) throws IOException {
|
||||
SSHClient sshClient = new SSHClient(config);
|
||||
sshClient.addHostKeyVerifier(new PromiscuousVerifier());
|
||||
sshClient.connect("127.0.0.1", getFirstMappedPort());
|
||||
|
||||
return sshClient;
|
||||
}
|
||||
|
||||
public SSHClient getConnectedClient() throws IOException {
|
||||
return getConnectedClient(new DefaultConfig());
|
||||
}
|
||||
|
||||
public static void withSshdContainer(SshdContainer.Builder builder, @NotNull ThrowingConsumer<SshdContainer> consumer) throws Throwable {
|
||||
SshdContainer sshdContainer = new SshdContainer(builder.buildInner());
|
||||
sshdContainer.start();
|
||||
try {
|
||||
consumer.accept(sshdContainer);
|
||||
} finally {
|
||||
sshdContainer.stop();
|
||||
}
|
||||
}
|
||||
}
|
||||
73
src/itest/java/com/hierynomus/sshj/sftp/FileWriteTest.java
Normal file
73
src/itest/java/com/hierynomus/sshj/sftp/FileWriteTest.java
Normal file
@@ -0,0 +1,73 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.sftp;
|
||||
|
||||
import java.nio.charset.StandardCharsets;
|
||||
import java.util.EnumSet;
|
||||
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
import org.testcontainers.shaded.org.bouncycastle.util.Arrays;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.sftp.OpenMode;
|
||||
import net.schmizz.sshj.sftp.RemoteFile;
|
||||
import net.schmizz.sshj.sftp.SFTPClient;
|
||||
|
||||
import static org.assertj.core.api.Assertions.assertThat;
|
||||
|
||||
@Testcontainers
|
||||
public class FileWriteTest {
|
||||
@Container
|
||||
private static SshdContainer sshd = new SshdContainer();
|
||||
|
||||
@Test
|
||||
public void shouldAppendToFile_GH390() throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||
try (SFTPClient sftp = client.newSFTPClient()) {
|
||||
String file = "/home/sshj/test.txt";
|
||||
byte[] initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16);
|
||||
byte[] appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16);
|
||||
|
||||
try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) {
|
||||
initial.write(0, initialText, 0, initialText.length);
|
||||
}
|
||||
|
||||
try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
|
||||
byte[] readBytes = new byte[initialText.length];
|
||||
read.read(0, readBytes, 0, readBytes.length);
|
||||
assertThat(readBytes).isEqualTo(initialText);
|
||||
}
|
||||
|
||||
try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) {
|
||||
initial.write(0, appendText, 0, appendText.length);
|
||||
}
|
||||
|
||||
try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
|
||||
byte[] readBytes = new byte[initialText.length + appendText.length];
|
||||
read.read(0, readBytes, 0, readBytes.length);
|
||||
assertThat(Arrays.copyOfRange(readBytes, 0, initialText.length)).isEqualTo(initialText);
|
||||
assertThat(Arrays.copyOfRange(readBytes, initialText.length, initialText.length + appendText.length)).isEqualTo(appendText);
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,81 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.sftp;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.sftp.SFTPClient;
|
||||
import net.schmizz.sshj.xfer.InMemorySourceFile;
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import java.io.ByteArrayInputStream;
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
import java.util.Random;
|
||||
|
||||
@Testcontainers
|
||||
public class PutFileCompressedTest {
|
||||
|
||||
private static class TestInMemorySourceFile extends InMemorySourceFile {
|
||||
|
||||
private final String name;
|
||||
private final byte[] data;
|
||||
|
||||
public TestInMemorySourceFile(String name, byte[] data) {
|
||||
this.name = name;
|
||||
this.data = data;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
@Override
|
||||
public long getLength() {
|
||||
return data.length;
|
||||
}
|
||||
|
||||
@Override
|
||||
public InputStream getInputStream() throws IOException {
|
||||
return new ByteArrayInputStream(data);
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@Container
|
||||
private static SshdContainer sshd = new SshdContainer();
|
||||
|
||||
@Test
|
||||
public void shouldPutCompressedFile_GH893() throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||
client.useCompression();
|
||||
try (SFTPClient sftp = client.newSFTPClient()) {
|
||||
String filename = "test.txt";
|
||||
// needs to be a larger file for bug taking effect
|
||||
byte[] content = new byte[5000];
|
||||
Random r = new Random(1);
|
||||
r.nextBytes(content);
|
||||
|
||||
sftp.put(new TestInMemorySourceFile(filename,content), "/home/sshj/");
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,65 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature;
|
||||
|
||||
import java.io.File;
|
||||
import java.io.StringReader;
|
||||
import java.nio.file.Files;
|
||||
import java.util.List;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.ValueSource;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.transport.verification.OpenSSHKnownHosts;
|
||||
|
||||
import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
public class HostKeyWithCertificateTest {
|
||||
|
||||
@ParameterizedTest(name = "Should connect to server that has a signed host public key {0}")
|
||||
@ValueSource(strings = { "ssh_host_ecdsa_256_key", "ssh_host_ecdsa_384_key", "ssh_host_ecdsa_521_key",
|
||||
"ssh_host_ed25519_384_key" })
|
||||
// TODO "ssh_host_rsa_2048_key" fails with "HOST_KEY_NOT_VERIFIABLE" after upgrade to new OpenSSH version
|
||||
public void shouldConnectToServerWithSignedHostKey(String hostkey) throws Throwable {
|
||||
File caPubKey = new File("src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub");
|
||||
String caPubKeyContents = Files.readString(caPubKey.toPath());
|
||||
String address = "127.0.0.1";
|
||||
|
||||
SshdConfigBuilder b = SshdConfigBuilder.defaultBuilder().with("PasswordAuthentication", "yes");
|
||||
|
||||
withSshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(b).addHostKey("test-container/host_keys/" + hostkey).addHostKeyCertificate("test-container/host_keys/" + hostkey + "-cert.pub"), sshd -> {
|
||||
String knownHosts = List.of("@cert-authority " + address + " " + caPubKeyContents,
|
||||
"@cert-authority [" + address + "]:" + sshd.getFirstMappedPort() + " " + caPubKeyContents).stream()
|
||||
.reduce("", (a, b1) -> a + "\n" + b1);
|
||||
DefaultConfig cfg = new DefaultConfig();
|
||||
try (SSHClient c = new SSHClient(cfg)) {
|
||||
c.addHostKeyVerifier(new OpenSSHKnownHosts(new StringReader(knownHosts)));
|
||||
c.connect(address, sshd.getFirstMappedPort());
|
||||
|
||||
c.authPassword("sshj", "ultrapassword");
|
||||
|
||||
assertTrue(c.isAuthenticated());
|
||||
}
|
||||
});
|
||||
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,83 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature;
|
||||
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
|
||||
@Testcontainers
|
||||
public class PublicKeyAuthWithCertificateTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com")).withAllKeys());
|
||||
|
||||
public static Stream<String> keys() {
|
||||
return Stream.of(
|
||||
"id_ecdsa_256_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_256_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_256_pem_signed_by_ed25519",
|
||||
"id_ecdsa_256_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_256_pem_signed_by_rsa",
|
||||
"id_ecdsa_256_rfc4716_signed_by_rsa",
|
||||
"id_ecdsa_384_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_384_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_384_pem_signed_by_ed25519",
|
||||
"id_ecdsa_384_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_384_pem_signed_by_rsa",
|
||||
"id_ecdsa_384_rfc4716_signed_by_rsa",
|
||||
"id_ecdsa_521_pem_signed_by_ecdsa",
|
||||
"id_ecdsa_521_rfc4716_signed_by_ecdsa",
|
||||
"id_ecdsa_521_pem_signed_by_ed25519",
|
||||
"id_ecdsa_521_rfc4716_signed_by_ed25519",
|
||||
"id_ecdsa_521_pem_signed_by_rsa",
|
||||
"id_ecdsa_521_rfc4716_signed_by_rsa",
|
||||
"id_rsa_2048_pem_signed_by_ecdsa",
|
||||
"id_rsa_2048_rfc4716_signed_by_ecdsa",
|
||||
"id_rsa_2048_pem_signed_by_ed25519",
|
||||
"id_rsa_2048_rfc4716_signed_by_ed25519",
|
||||
"id_rsa_2048_pem_signed_by_rsa",
|
||||
"id_rsa_2048_rfc4716_signed_by_rsa",
|
||||
"id_ed25519_384_rfc4716_signed_by_ecdsa",
|
||||
"id_ed25519_384_rfc4716_signed_by_ed25519",
|
||||
"id_ed25519_384_rfc4716_signed_by_rsa");
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should authenticate with signed public key {0}")
|
||||
@MethodSource("keys")
|
||||
public void shouldAuthenticateWithSignedPublicKey(String key) throws Throwable {
|
||||
Config c = new DefaultConfig();
|
||||
SSHClient client = sshd.getConnectedClient(c);
|
||||
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/certificates/" + key);
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
|
||||
client.disconnect();
|
||||
}
|
||||
|
||||
}
|
||||
@@ -0,0 +1,57 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature;
|
||||
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
import java.util.List;
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
|
||||
@Testcontainers
|
||||
public class SignatureTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("HostKeyAlgorithms", "+ssh-rsa").with("PubkeyAcceptedAlgorithms", "+ssh-rsa")).withAllKeys());
|
||||
|
||||
public static Stream<KeyAlgorithms.Factory> algs() {
|
||||
return Stream.of(KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512());
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should correctly connect with Signature {0}")
|
||||
@MethodSource("algs")
|
||||
public void shouldCorrectlyConnectWithMac(KeyAlgorithms.Factory alg) throws Throwable {
|
||||
Config c = new DefaultConfig();
|
||||
c.setKeyAlgorithms(List.of(alg));
|
||||
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
@@ -0,0 +1,65 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.cipher;
|
||||
|
||||
import static org.junit.Assert.assertTrue;
|
||||
|
||||
import java.util.List;
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
import net.schmizz.sshj.transport.cipher.Cipher;
|
||||
|
||||
@Testcontainers
|
||||
public class CipherTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer();
|
||||
|
||||
public static Stream<Factory.Named<Cipher>> ciphers() {
|
||||
return Stream.of(BlockCiphers.TripleDESCBC(),
|
||||
BlockCiphers.AES128CBC(),
|
||||
BlockCiphers.AES128CTR(),
|
||||
BlockCiphers.AES192CBC(),
|
||||
BlockCiphers.AES192CTR(),
|
||||
BlockCiphers.AES256CBC(),
|
||||
BlockCiphers.AES256CTR(),
|
||||
GcmCiphers.AES128GCM(),
|
||||
GcmCiphers.AES256GCM(),
|
||||
ChachaPolyCiphers.CHACHA_POLY_OPENSSH());
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should correctly connect with Cipher {0}")
|
||||
@MethodSource("ciphers")
|
||||
public void shouldCorrectlyConnectWithCipher(Factory.Named<Cipher> cipher) throws Throwable {
|
||||
Config c = new DefaultConfig();
|
||||
c.setCipherFactories(List.of(cipher));
|
||||
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,72 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.kex;
|
||||
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
import java.util.List;
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
import net.schmizz.sshj.transport.kex.Curve25519SHA256;
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA1;
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA256;
|
||||
import net.schmizz.sshj.transport.kex.ECDHNistP;
|
||||
import net.schmizz.sshj.transport.kex.KeyExchange;
|
||||
|
||||
@Testcontainers
|
||||
public class KexTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer();
|
||||
|
||||
public static Stream<Factory.Named<KeyExchange>> kex() {
|
||||
return Stream.of(
|
||||
DHGroups.Group1SHA1(),
|
||||
DHGroups.Group14SHA1(),
|
||||
DHGroups.Group14SHA256(),
|
||||
DHGroups.Group16SHA512(),
|
||||
DHGroups.Group18SHA512(),
|
||||
new DHGexSHA1.Factory(),
|
||||
new DHGexSHA256.Factory(),
|
||||
new Curve25519SHA256.Factory(),
|
||||
new Curve25519SHA256.FactoryLibSsh(),
|
||||
new ECDHNistP.Factory256(),
|
||||
new ECDHNistP.Factory384(),
|
||||
new ECDHNistP.Factory521());
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should correctly connect with Key Exchange {0}")
|
||||
@MethodSource("kex")
|
||||
public void shouldCorrectlyConnectWithMac(Factory.Named<KeyExchange> kex) throws Throwable {
|
||||
Config c = new DefaultConfig();
|
||||
c.setKeyExchangeFactories(List.of(kex));
|
||||
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,111 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.kex;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import java.util.stream.Collectors;
|
||||
|
||||
import ch.qos.logback.classic.Logger;
|
||||
import ch.qos.logback.classic.spi.ILoggingEvent;
|
||||
import ch.qos.logback.core.read.ListAppender;
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import org.junit.jupiter.api.AfterEach;
|
||||
import org.junit.jupiter.api.BeforeEach;
|
||||
import org.junit.jupiter.api.Test;
|
||||
import org.slf4j.LoggerFactory;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import static org.assertj.core.api.Assertions.assertThat;
|
||||
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||
|
||||
@Testcontainers
|
||||
class StrictKeyExchangeTest {
|
||||
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer();
|
||||
|
||||
private final List<Logger> watchedLoggers = new ArrayList<>();
|
||||
private final ListAppender<ILoggingEvent> logWatcher = new ListAppender<>();
|
||||
|
||||
@BeforeEach
|
||||
void setUpLogWatcher() {
|
||||
logWatcher.start();
|
||||
setUpLogger("net.schmizz.sshj.transport.Decoder");
|
||||
setUpLogger("net.schmizz.sshj.transport.Encoder");
|
||||
setUpLogger("net.schmizz.sshj.transport.KeyExchanger");
|
||||
}
|
||||
|
||||
@AfterEach
|
||||
void tearDown() {
|
||||
watchedLoggers.forEach(Logger::detachAndStopAllAppenders);
|
||||
}
|
||||
|
||||
private void setUpLogger(String className) {
|
||||
Logger logger = ((Logger) LoggerFactory.getLogger(className));
|
||||
logger.addAppender(logWatcher);
|
||||
watchedLoggers.add(logger);
|
||||
}
|
||||
|
||||
@Test
|
||||
void strictKeyExchange() throws Throwable {
|
||||
try (SSHClient client = sshd.getConnectedClient()) {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
List<String> keyExchangerLogs = getLogs("KeyExchanger");
|
||||
assertThat(keyExchangerLogs).containsSequence(
|
||||
"Initiating key exchange",
|
||||
"Sending SSH_MSG_KEXINIT",
|
||||
"Received SSH_MSG_KEXINIT",
|
||||
"Enabling strict key exchange extension"
|
||||
);
|
||||
List<String> decoderLogs = getLogs("Decoder").stream()
|
||||
.map(log -> log.split(":")[0])
|
||||
.collect(Collectors.toList());
|
||||
assertThat(decoderLogs).containsExactly(
|
||||
"Received packet #0",
|
||||
"Received packet #1",
|
||||
"Received packet #2",
|
||||
"Received packet #0",
|
||||
"Received packet #1",
|
||||
"Received packet #2",
|
||||
"Received packet #3"
|
||||
);
|
||||
List<String> encoderLogs = getLogs("Encoder").stream()
|
||||
.map(log -> log.split(":")[0])
|
||||
.collect(Collectors.toList());
|
||||
assertThat(encoderLogs).containsExactly(
|
||||
"Encoding packet #0",
|
||||
"Encoding packet #1",
|
||||
"Encoding packet #2",
|
||||
"Encoding packet #0",
|
||||
"Encoding packet #1",
|
||||
"Encoding packet #2",
|
||||
"Encoding packet #3"
|
||||
);
|
||||
}
|
||||
|
||||
private List<String> getLogs(String className) {
|
||||
return logWatcher.list.stream()
|
||||
.filter(event -> event.getLoggerName().endsWith(className))
|
||||
.map(ILoggingEvent::getFormattedMessage)
|
||||
.collect(Collectors.toList());
|
||||
}
|
||||
|
||||
}
|
||||
@@ -0,0 +1,54 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.mac;
|
||||
|
||||
import static org.junit.Assert.assertTrue;
|
||||
|
||||
import java.util.List;
|
||||
import java.util.stream.Stream;
|
||||
|
||||
import org.junit.jupiter.params.ParameterizedTest;
|
||||
import org.junit.jupiter.params.provider.MethodSource;
|
||||
import org.testcontainers.junit.jupiter.Container;
|
||||
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||
|
||||
import com.hierynomus.sshj.SshdContainer;
|
||||
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.DefaultConfig;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
|
||||
@Testcontainers
|
||||
public class MacTest {
|
||||
@Container
|
||||
private static final SshdContainer sshd = new SshdContainer();
|
||||
|
||||
public static Stream<Macs.Factory> macs() {
|
||||
return Stream.of(Macs.HMACSHA2256(), Macs.HMACSHA2512(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm());
|
||||
}
|
||||
|
||||
@ParameterizedTest(name = "should correctly connect with MAC {0}")
|
||||
@MethodSource("macs")
|
||||
public void shouldCorrectlyConnectWithMac(Macs.Factory mac) throws Throwable {
|
||||
Config c = new DefaultConfig();
|
||||
c.setMACFactories(List.of(mac));
|
||||
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||
|
||||
assertTrue(client.isAuthenticated());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,3 @@
|
||||
-----BEGIN OPENSSH PRIVATE KEY-----
|
||||
b3BlbnNzaC1rZXktdjEAAAAACmFlczEyOC1jYmMAAAAGYmNyeXB0AAAAGAAAABDfrL8SxDyrkNlsJdAmc7Z0AAAAEAAAAAEAAAAzAAAAC3NzaC1lZDI1NTE5AAAAICYfPGSYFOHuSzTJ67H0ynvKJDfgDmwPOj7iJaLGbIBiAAAAkLVqaDIfs+sPBNyy7ytdLnP/xH7Nt5FIXx3Upw6wKuMGdBzbFQLcvu60Le+SFP3uUfXE8TcHramXbH0n+UBMW6raCAKOkHUU1BtrKxPG1eKU/LBx3Bk5FxyKm7fo0XsCUmqSVK25EHOJfYq1QwIbWICkvQUNu+2Hg8/MQKoFJMentI+GqjdaG76f6Wf+aj9UwA==
|
||||
-----END OPENSSH PRIVATE KEY-----
|
||||
34
src/itest/resources/logback-test.xml
Normal file
34
src/itest/resources/logback-test.xml
Normal file
@@ -0,0 +1,34 @@
|
||||
<!--
|
||||
|
||||
Copyright (C)2009 - SSHJ Contributors
|
||||
|
||||
Licensed under the Apache License, Version 2.0 (the "License");
|
||||
you may not use this file except in compliance with the License.
|
||||
You may obtain a copy of the License at
|
||||
|
||||
http://www.apache.org/licenses/LICENSE-2.0
|
||||
|
||||
Unless required by applicable law or agreed to in writing, software
|
||||
distributed under the License is distributed on an "AS IS" BASIS,
|
||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
|
||||
-->
|
||||
<configuration>
|
||||
|
||||
<appender name="STDOUT" class="ch.qos.logback.core.ConsoleAppender">
|
||||
<encoder>
|
||||
<pattern>%d{yyyy-MM-dd HH:mm:ss.SSS} [%.-20thread] %-5level %logger{36} - %msg%n</pattern>
|
||||
</encoder>
|
||||
</appender>
|
||||
|
||||
<root level="info">
|
||||
<appender-ref ref="STDOUT"/>
|
||||
</root>
|
||||
|
||||
<logger name="org.apache.sshd.server" level="debug" />
|
||||
<logger name="net.schmizz.sshj" level="debug"/>
|
||||
<logger name="net.schmizz.sshj.transport" level="trace" />
|
||||
|
||||
</configuration>
|
||||
@@ -1,78 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.backport;
|
||||
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
import java.net.*;
|
||||
|
||||
public class Jdk7HttpProxySocket extends Socket {
|
||||
|
||||
private Proxy httpProxy = null;
|
||||
|
||||
public Jdk7HttpProxySocket(Proxy proxy) {
|
||||
super(proxy.type() == Proxy.Type.HTTP ? Proxy.NO_PROXY : proxy);
|
||||
if (proxy.type() == Proxy.Type.HTTP) {
|
||||
this.httpProxy = proxy;
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public void connect(SocketAddress endpoint, int timeout) throws IOException {
|
||||
if (httpProxy != null) {
|
||||
connectHttpProxy(endpoint, timeout);
|
||||
} else {
|
||||
super.connect(endpoint, timeout);
|
||||
}
|
||||
}
|
||||
|
||||
private void connectHttpProxy(SocketAddress endpoint, int timeout) throws IOException {
|
||||
super.connect(httpProxy.address(), timeout);
|
||||
|
||||
if (!(endpoint instanceof InetSocketAddress)) {
|
||||
throw new SocketException("Expected an InetSocketAddress to connect to, got: " + endpoint);
|
||||
}
|
||||
InetSocketAddress isa = (InetSocketAddress) endpoint;
|
||||
String httpConnect = "CONNECT " + isa.getHostName() + ":" + isa.getPort() + " HTTP/1.0\n\n";
|
||||
getOutputStream().write(httpConnect.getBytes(IOUtils.UTF8));
|
||||
checkAndFlushProxyResponse();
|
||||
}
|
||||
|
||||
private void checkAndFlushProxyResponse()throws IOException {
|
||||
InputStream socketInput = getInputStream();
|
||||
byte[] tmpBuffer = new byte[512];
|
||||
int len = socketInput.read(tmpBuffer, 0, tmpBuffer.length);
|
||||
|
||||
if (len == 0) {
|
||||
throw new SocketException("Empty response from proxy");
|
||||
}
|
||||
|
||||
String proxyResponse = new String(tmpBuffer, 0, len, IOUtils.UTF8);
|
||||
|
||||
// Expecting HTTP/1.x 200 OK
|
||||
if (proxyResponse.contains("200")) {
|
||||
// Flush any outstanding message in buffer
|
||||
if (socketInput.available() > 0) {
|
||||
socketInput.skip(socketInput.available());
|
||||
}
|
||||
// Proxy Connect Successful
|
||||
} else {
|
||||
throw new SocketException("Fail to create Socket\nResponse was:" + proxyResponse);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,41 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.backport;
|
||||
|
||||
import java.io.Closeable;
|
||||
import java.io.IOException;
|
||||
import java.net.Socket;
|
||||
|
||||
public class Sockets {
|
||||
|
||||
/**
|
||||
* Java 7 and up have Socket implemented as Closeable, whereas Java6 did not have this inheritance.
|
||||
* @param socket The socket to wrap as Closeable
|
||||
* @return The (potentially wrapped) Socket as a Closeable.
|
||||
*/
|
||||
public static Closeable asCloseable(final Socket socket) {
|
||||
if (Closeable.class.isAssignableFrom(socket.getClass())) {
|
||||
return Closeable.class.cast(socket);
|
||||
} else {
|
||||
return new Closeable() {
|
||||
@Override
|
||||
public void close() throws IOException {
|
||||
socket.close();
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -13,14 +13,15 @@
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.backport;
|
||||
package com.hierynomus.sshj.common;
|
||||
|
||||
public class JavaVersion {
|
||||
public static boolean isJava7OrEarlier() {
|
||||
String property = System.getProperty("java.specification.version");
|
||||
float diff = Float.parseFloat(property) - 1.7f;
|
||||
|
||||
return diff < 0.01;
|
||||
}
|
||||
import java.net.InetSocketAddress;
|
||||
|
||||
public interface RemoteAddressProvider {
|
||||
/**
|
||||
* Get Remote Socket Address associated with transport connection
|
||||
*
|
||||
* @return Remote Socket Address or null when not connected
|
||||
*/
|
||||
InetSocketAddress getRemoteSocketAddress();
|
||||
}
|
||||
@@ -0,0 +1,36 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.common;
|
||||
|
||||
import java.net.InetSocketAddress;
|
||||
|
||||
public class ThreadNameProvider {
|
||||
private static final String DISCONNECTED = "DISCONNECTED";
|
||||
|
||||
/**
|
||||
* Set Thread Name prefixed with sshj followed by class and remote address when connected
|
||||
*
|
||||
* @param thread Class of Thread being named
|
||||
* @param remoteAddressProvider Remote Address Provider associated with Thread
|
||||
*/
|
||||
public static void setThreadName(final Thread thread, final RemoteAddressProvider remoteAddressProvider) {
|
||||
final InetSocketAddress remoteSocketAddress = remoteAddressProvider.getRemoteSocketAddress();
|
||||
final String address = remoteSocketAddress == null ? DISCONNECTED : remoteSocketAddress.toString();
|
||||
final long started = System.currentTimeMillis();
|
||||
final String threadName = String.format("sshj-%s-%s-%d", thread.getClass().getSimpleName(), address, started);
|
||||
thread.setName(threadName);
|
||||
}
|
||||
}
|
||||
@@ -22,13 +22,8 @@ import net.schmizz.sshj.signature.SignatureDSA;
|
||||
import net.schmizz.sshj.signature.SignatureECDSA;
|
||||
import net.schmizz.sshj.signature.SignatureRSA;
|
||||
|
||||
import java.util.Arrays;
|
||||
import java.util.List;
|
||||
|
||||
public class KeyAlgorithms {
|
||||
|
||||
public static List<String> SSH_RSA_SHA2_ALGORITHMS = Arrays.asList("rsa-sha2-512", "rsa-sha2-256");
|
||||
|
||||
public static Factory SSHRSA() { return new Factory("ssh-rsa", new SignatureRSA.FactorySSHRSA(), KeyType.RSA); }
|
||||
public static Factory SSHRSACertV01() { return new Factory("ssh-rsa-cert-v01@openssh.com", new SignatureRSA.FactoryCERT(), KeyType.RSA_CERT); }
|
||||
public static Factory RSASHA256() { return new Factory("rsa-sha2-256", new SignatureRSA.FactoryRSASHA256(), KeyType.RSA); }
|
||||
@@ -61,9 +56,18 @@ public class KeyAlgorithms {
|
||||
return algorithmName;
|
||||
}
|
||||
|
||||
public KeyType getKeyType() {
|
||||
return keyType;
|
||||
}
|
||||
|
||||
@Override
|
||||
public KeyAlgorithm create() {
|
||||
return new BaseKeyAlgorithm(algorithmName, signatureFactory, keyType);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return algorithmName;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -16,9 +16,8 @@
|
||||
package com.hierynomus.sshj.transport.cipher;
|
||||
|
||||
import java.security.GeneralSecurityException;
|
||||
import java.security.InvalidAlgorithmParameterException;
|
||||
import java.security.InvalidKeyException;
|
||||
|
||||
import java.security.MessageDigest;
|
||||
import java.security.spec.AlgorithmParameterSpec;
|
||||
import java.util.Arrays;
|
||||
import javax.crypto.spec.IvParameterSpec;
|
||||
@@ -82,8 +81,7 @@ public class ChachaPolyCipher extends BaseCipher {
|
||||
}
|
||||
|
||||
@Override
|
||||
protected void initCipher(javax.crypto.Cipher cipher, Mode mode, byte[] key, byte[] iv)
|
||||
throws InvalidKeyException, InvalidAlgorithmParameterException {
|
||||
protected void initCipher(javax.crypto.Cipher cipher, Mode mode, byte[] key, byte[] iv) {
|
||||
this.mode = mode;
|
||||
|
||||
cipherKey = getKeySpec(Arrays.copyOfRange(key, 0, CHACHA_KEY_SIZE));
|
||||
@@ -127,28 +125,34 @@ public class ChachaPolyCipher extends BaseCipher {
|
||||
|
||||
@Override
|
||||
public void update(byte[] input, int inputOffset, int inputLen) {
|
||||
if (inputOffset != AAD_LENGTH) {
|
||||
if (inputOffset != 0 && inputOffset != AAD_LENGTH) {
|
||||
throw new IllegalArgumentException("updateAAD called with inputOffset " + inputOffset);
|
||||
}
|
||||
|
||||
final int macInputLength = AAD_LENGTH + inputLen;
|
||||
|
||||
final int macInputLength = inputOffset + inputLen;
|
||||
if (mode == Mode.Decrypt) {
|
||||
byte[] macInput = new byte[macInputLength];
|
||||
System.arraycopy(encryptedAad, 0, macInput, 0, AAD_LENGTH);
|
||||
System.arraycopy(input, AAD_LENGTH, macInput, AAD_LENGTH, inputLen);
|
||||
final byte[] macInput = new byte[macInputLength];
|
||||
|
||||
byte[] expectedPolyTag = mac.doFinal(macInput);
|
||||
byte[] actualPolyTag = Arrays.copyOfRange(input, macInputLength, macInputLength + POLY_TAG_LENGTH);
|
||||
if (!Arrays.equals(actualPolyTag, expectedPolyTag)) {
|
||||
if (inputOffset == 0) {
|
||||
// Handle decryption without AAD
|
||||
System.arraycopy(input, 0, macInput, 0, inputLen);
|
||||
} else {
|
||||
// Handle decryption with previous AAD from updateAAD()
|
||||
System.arraycopy(encryptedAad, 0, macInput, 0, AAD_LENGTH);
|
||||
System.arraycopy(input, AAD_LENGTH, macInput, AAD_LENGTH, inputLen);
|
||||
}
|
||||
|
||||
final byte[] expectedPolyTag = mac.doFinal(macInput);
|
||||
final byte[] actualPolyTag = Arrays.copyOfRange(input, macInputLength, macInputLength + POLY_TAG_LENGTH);
|
||||
if (!MessageDigest.isEqual(actualPolyTag, expectedPolyTag)) {
|
||||
throw new SSHRuntimeException("MAC Error");
|
||||
}
|
||||
}
|
||||
|
||||
try {
|
||||
cipher.update(input, AAD_LENGTH, inputLen, input, AAD_LENGTH);
|
||||
cipher.update(input, inputOffset, inputLen, input, inputOffset);
|
||||
} catch (GeneralSecurityException e) {
|
||||
throw new SSHRuntimeException("Error updating data through cipher", e);
|
||||
throw new SSHRuntimeException("ChaCha20 cipher processing failed", e);
|
||||
}
|
||||
|
||||
if (mode == Mode.Encrypt) {
|
||||
|
||||
@@ -89,6 +89,11 @@ public class DHGroups {
|
||||
public String getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name;
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -15,13 +15,13 @@
|
||||
*/
|
||||
package com.hierynomus.sshj.transport.verification;
|
||||
|
||||
import net.schmizz.sshj.common.Base64;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.common.SSHException;
|
||||
import net.schmizz.sshj.transport.mac.MAC;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Base64;
|
||||
import java.util.List;
|
||||
import java.util.regex.Pattern;
|
||||
|
||||
@@ -85,12 +85,12 @@ public class KnownHostMatchers {
|
||||
|
||||
private String hashHost(String host) throws IOException {
|
||||
sha1.init(getSaltyBytes());
|
||||
return "|1|" + salt + "|" + Base64.encodeBytes(sha1.doFinal(host.getBytes(IOUtils.UTF8)));
|
||||
return "|1|" + salt + "|" + Base64.getEncoder().encodeToString(sha1.doFinal(host.getBytes(IOUtils.UTF8)));
|
||||
}
|
||||
|
||||
private byte[] getSaltyBytes() throws IOException {
|
||||
private byte[] getSaltyBytes() {
|
||||
if (saltyBytes == null) {
|
||||
saltyBytes = Base64.decode(salt);
|
||||
saltyBytes = Base64.getDecoder().decode(salt);
|
||||
}
|
||||
return saltyBytes;
|
||||
}
|
||||
|
||||
@@ -15,7 +15,6 @@
|
||||
*/
|
||||
package com.hierynomus.sshj.userauth.keyprovider;
|
||||
|
||||
import net.schmizz.sshj.common.Base64;
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.KeyType;
|
||||
|
||||
@@ -24,6 +23,7 @@ import java.io.File;
|
||||
import java.io.IOException;
|
||||
import java.io.Reader;
|
||||
import java.security.PublicKey;
|
||||
import java.util.Base64;
|
||||
|
||||
public class OpenSSHKeyFileUtil {
|
||||
private OpenSSHKeyFileUtil() {
|
||||
@@ -56,7 +56,7 @@ public class OpenSSHKeyFileUtil {
|
||||
if (parts.length >= 2) {
|
||||
return new ParsedPubKey(
|
||||
KeyType.fromString(parts[0]),
|
||||
new Buffer.PlainBuffer(Base64.decode(parts[1])).readPublicKey()
|
||||
new Buffer.PlainBuffer(Base64.getDecoder().decode(parts[1])).readPublicKey()
|
||||
);
|
||||
} else {
|
||||
throw new IOException("Got line with only one column");
|
||||
|
||||
@@ -18,11 +18,18 @@ package com.hierynomus.sshj.userauth.keyprovider;
|
||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
||||
import com.hierynomus.sshj.common.KeyDecryptionFailedException;
|
||||
import com.hierynomus.sshj.transport.cipher.BlockCiphers;
|
||||
import com.hierynomus.sshj.transport.cipher.ChachaPolyCiphers;
|
||||
import com.hierynomus.sshj.transport.cipher.GcmCiphers;
|
||||
import net.i2p.crypto.eddsa.EdDSAPrivateKey;
|
||||
import net.i2p.crypto.eddsa.spec.EdDSANamedCurveTable;
|
||||
import net.i2p.crypto.eddsa.spec.EdDSAPrivateKeySpec;
|
||||
import net.schmizz.sshj.common.*;
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.Buffer.PlainBuffer;
|
||||
import net.schmizz.sshj.common.ByteArrayUtils;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.common.KeyType;
|
||||
import net.schmizz.sshj.common.SSHRuntimeException;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
import net.schmizz.sshj.transport.cipher.Cipher;
|
||||
import net.schmizz.sshj.userauth.keyprovider.BaseFileKeyProvider;
|
||||
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
||||
@@ -31,6 +38,7 @@ import org.bouncycastle.asn1.nist.NISTNamedCurves;
|
||||
import org.bouncycastle.asn1.x9.X9ECParameters;
|
||||
import org.bouncycastle.jce.spec.ECNamedCurveSpec;
|
||||
import com.hierynomus.sshj.userauth.keyprovider.bcrypt.BCrypt;
|
||||
import org.bouncycastle.openssl.EncryptionException;
|
||||
import org.slf4j.Logger;
|
||||
import org.slf4j.LoggerFactory;
|
||||
|
||||
@@ -42,23 +50,43 @@ import java.io.Reader;
|
||||
import java.math.BigInteger;
|
||||
import java.nio.ByteBuffer;
|
||||
import java.nio.CharBuffer;
|
||||
import java.nio.charset.Charset;
|
||||
import java.nio.charset.StandardCharsets;
|
||||
import java.security.*;
|
||||
import java.security.spec.ECPrivateKeySpec;
|
||||
import java.security.spec.RSAPrivateCrtKeySpec;
|
||||
import java.util.Arrays;
|
||||
import java.util.Base64;
|
||||
import java.util.HashMap;
|
||||
import java.util.Map;
|
||||
|
||||
/**
|
||||
* Reads a key file in the new OpenSSH format.
|
||||
* The format is described in the following document: https://github.com/openssh/openssh-portable/blob/master/PROTOCOL.key
|
||||
*/
|
||||
public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||
private static final Logger logger = LoggerFactory.getLogger(OpenSSHKeyV1KeyFile.class);
|
||||
private static final String BEGIN = "-----BEGIN ";
|
||||
private static final String END = "-----END ";
|
||||
private static final byte[] AUTH_MAGIC = "openssh-key-v1\0".getBytes();
|
||||
public static final String OPENSSH_PRIVATE_KEY = "OPENSSH PRIVATE KEY-----";
|
||||
public static final String BCRYPT = "bcrypt";
|
||||
|
||||
private static final String NONE_CIPHER = "none";
|
||||
|
||||
private static final Map<String, Factory.Named<Cipher>> SUPPORTED_CIPHERS = new HashMap<>();
|
||||
|
||||
static {
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.TripleDESCBC().getName(), BlockCiphers.TripleDESCBC());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES128CBC().getName(), BlockCiphers.AES128CBC());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES192CBC().getName(), BlockCiphers.AES192CBC());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES256CBC().getName(), BlockCiphers.AES256CBC());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES128CTR().getName(), BlockCiphers.AES128CTR());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES192CTR().getName(), BlockCiphers.AES192CTR());
|
||||
SUPPORTED_CIPHERS.put(BlockCiphers.AES256CTR().getName(), BlockCiphers.AES256CTR());
|
||||
SUPPORTED_CIPHERS.put(GcmCiphers.AES256GCM().getName(), GcmCiphers.AES256GCM());
|
||||
SUPPORTED_CIPHERS.put(GcmCiphers.AES128GCM().getName(), GcmCiphers.AES128GCM());
|
||||
SUPPORTED_CIPHERS.put(ChachaPolyCiphers.CHACHA_POLY_OPENSSH().getName(), ChachaPolyCiphers.CHACHA_POLY_OPENSSH());
|
||||
}
|
||||
|
||||
private PublicKey pubKey;
|
||||
|
||||
public static class Factory
|
||||
@@ -92,19 +120,19 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||
|
||||
@Override
|
||||
protected KeyPair readKeyPair() throws IOException {
|
||||
BufferedReader reader = new BufferedReader(resource.getReader());
|
||||
final BufferedReader reader = new BufferedReader(resource.getReader());
|
||||
try {
|
||||
if (!checkHeader(reader)) {
|
||||
throw new IOException("This key is not in 'openssh-key-v1' format");
|
||||
if (checkHeader(reader)) {
|
||||
final String encodedPrivateKey = readEncodedKey(reader);
|
||||
byte[] decodedPrivateKey = Base64.getDecoder().decode(encodedPrivateKey);
|
||||
final PlainBuffer bufferedPrivateKey = new PlainBuffer(decodedPrivateKey);
|
||||
return readDecodedKeyPair(bufferedPrivateKey);
|
||||
} else {
|
||||
final String message = String.format("File header not found [%s%s]", BEGIN, OPENSSH_PRIVATE_KEY);
|
||||
throw new IOException(message);
|
||||
}
|
||||
|
||||
String keyFile = readKeyFile(reader);
|
||||
byte[] decode = Base64.decode(keyFile);
|
||||
PlainBuffer keyBuffer = new PlainBuffer(decode);
|
||||
return readDecodedKeyPair(keyBuffer);
|
||||
|
||||
} catch (GeneralSecurityException e) {
|
||||
throw new SSHRuntimeException(e);
|
||||
} catch (final GeneralSecurityException e) {
|
||||
throw new SSHRuntimeException("Read OpenSSH Version 1 Key failed", e);
|
||||
} finally {
|
||||
IOUtils.closeQuietly(reader);
|
||||
}
|
||||
@@ -129,86 +157,143 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||
|
||||
int nrKeys = keyBuffer.readUInt32AsInt(); // int number of keys N; Should be 1
|
||||
if (nrKeys != 1) {
|
||||
throw new IOException("We don't support having more than 1 key in the file (yet).");
|
||||
final String message = String.format("OpenSSH Private Key number of keys not supported [%d]", nrKeys);
|
||||
throw new IOException(message);
|
||||
}
|
||||
PublicKey publicKey = pubKey;
|
||||
if (publicKey == null) {
|
||||
publicKey = readPublicKey(new PlainBuffer(keyBuffer.readBytes()));
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
keyBuffer.readBytes();
|
||||
}
|
||||
PlainBuffer privateKeyBuffer = new PlainBuffer(keyBuffer.readBytes()); // string (possibly) encrypted, padded list of private keys
|
||||
if ("none".equals(cipherName)) {
|
||||
logger.debug("Reading unencrypted keypair");
|
||||
|
||||
final byte[] privateKeyEncoded = keyBuffer.readBytes();
|
||||
final PlainBuffer privateKeyBuffer = new PlainBuffer(privateKeyEncoded);
|
||||
|
||||
if (NONE_CIPHER.equals(cipherName)) {
|
||||
return readUnencrypted(privateKeyBuffer, publicKey);
|
||||
} else {
|
||||
logger.info("Keypair is encrypted with: " + cipherName + ", " + kdfName + ", " + Arrays.toString(kdfOptions));
|
||||
final byte[] encryptedPrivateKey = readEncryptedPrivateKey(privateKeyEncoded, keyBuffer);
|
||||
while (true) {
|
||||
PlainBuffer decryptionBuffer = new PlainBuffer(privateKeyBuffer);
|
||||
PlainBuffer decrypted = decryptBuffer(decryptionBuffer, cipherName, kdfName, kdfOptions);
|
||||
final byte[] encrypted = encryptedPrivateKey.clone();
|
||||
try {
|
||||
final PlainBuffer decrypted = decryptPrivateKey(encrypted, privateKeyEncoded.length, cipherName, kdfName, kdfOptions);
|
||||
return readUnencrypted(decrypted, publicKey);
|
||||
} catch (KeyDecryptionFailedException e) {
|
||||
if (pwdf == null || !pwdf.shouldRetry(resource))
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
// throw new IOException("Cannot read encrypted keypair with " + cipherName + " yet.");
|
||||
}
|
||||
}
|
||||
|
||||
private PlainBuffer decryptBuffer(PlainBuffer privateKeyBuffer, String cipherName, String kdfName, byte[] kdfOptions) throws IOException {
|
||||
Cipher cipher = createCipher(cipherName);
|
||||
initializeCipher(kdfName, kdfOptions, cipher);
|
||||
byte[] array = privateKeyBuffer.array();
|
||||
cipher.update(array, 0, privateKeyBuffer.available());
|
||||
return new PlainBuffer(array);
|
||||
private byte[] readEncryptedPrivateKey(final byte[] privateKeyEncoded, final PlainBuffer inputBuffer) throws Buffer.BufferException {
|
||||
final byte[] encryptedPrivateKey;
|
||||
|
||||
final int bufferRemaining = inputBuffer.available();
|
||||
if (bufferRemaining == 0) {
|
||||
encryptedPrivateKey = privateKeyEncoded;
|
||||
} else {
|
||||
// Read Authentication Tag for AES-GCM or ChaCha20-Poly1305
|
||||
final byte[] authenticationTag = new byte[bufferRemaining];
|
||||
inputBuffer.readRawBytes(authenticationTag);
|
||||
|
||||
final int encryptedBufferLength = privateKeyEncoded.length + authenticationTag.length;
|
||||
final PlainBuffer encryptedBuffer = new PlainBuffer(encryptedBufferLength);
|
||||
encryptedBuffer.putRawBytes(privateKeyEncoded);
|
||||
encryptedBuffer.putRawBytes(authenticationTag);
|
||||
|
||||
encryptedPrivateKey = new byte[encryptedBufferLength];
|
||||
encryptedBuffer.readRawBytes(encryptedPrivateKey);
|
||||
}
|
||||
|
||||
return encryptedPrivateKey;
|
||||
}
|
||||
|
||||
private void initializeCipher(String kdfName, byte[] kdfOptions, Cipher cipher) throws Buffer.BufferException {
|
||||
private PlainBuffer decryptPrivateKey(final byte[] privateKey, final int privateKeyLength, final String cipherName, final String kdfName, final byte[] kdfOptions) throws IOException {
|
||||
try {
|
||||
final Cipher cipher = createCipher(cipherName);
|
||||
initializeCipher(kdfName, kdfOptions, cipher);
|
||||
cipher.update(privateKey, 0, privateKeyLength);
|
||||
} catch (final SSHRuntimeException e) {
|
||||
final String message = String.format("OpenSSH Private Key decryption failed with cipher [%s]", cipherName);
|
||||
throw new KeyDecryptionFailedException(new EncryptionException(message, e));
|
||||
}
|
||||
final PlainBuffer decryptedPrivateKey = new PlainBuffer(privateKeyLength);
|
||||
decryptedPrivateKey.putRawBytes(privateKey, 0, privateKeyLength);
|
||||
return decryptedPrivateKey;
|
||||
}
|
||||
|
||||
private void initializeCipher(final String kdfName, final byte[] kdfOptions, final Cipher cipher) throws Buffer.BufferException {
|
||||
if (kdfName.equals(BCRYPT)) {
|
||||
PlainBuffer opts = new PlainBuffer(kdfOptions);
|
||||
final PlainBuffer bufferedOptions = new PlainBuffer(kdfOptions);
|
||||
byte[] passphrase = new byte[0];
|
||||
if (pwdf != null) {
|
||||
CharBuffer charBuffer = CharBuffer.wrap(pwdf.reqPassword(null));
|
||||
ByteBuffer byteBuffer = Charset.forName("UTF-8").encode(charBuffer);
|
||||
final CharBuffer charBuffer = CharBuffer.wrap(pwdf.reqPassword(null));
|
||||
final ByteBuffer byteBuffer = StandardCharsets.UTF_8.encode(charBuffer);
|
||||
passphrase = Arrays.copyOfRange(byteBuffer.array(), byteBuffer.position(), byteBuffer.limit());
|
||||
Arrays.fill(charBuffer.array(), '\u0000');
|
||||
Arrays.fill(byteBuffer.array(), (byte) 0);
|
||||
}
|
||||
byte[] keyiv = new byte[48];
|
||||
new BCrypt().pbkdf(passphrase, opts.readBytes(), opts.readUInt32AsInt(), keyiv);
|
||||
|
||||
final int ivSize = cipher.getIVSize();
|
||||
final int blockSize = cipher.getBlockSize();
|
||||
final int parameterSize = ivSize + blockSize;
|
||||
final byte[] keyIvParameters = new byte[parameterSize];
|
||||
|
||||
final byte[] salt = bufferedOptions.readBytes();
|
||||
final int iterations = bufferedOptions.readUInt32AsInt();
|
||||
new BCrypt().pbkdf(passphrase, salt, iterations, keyIvParameters);
|
||||
Arrays.fill(passphrase, (byte) 0);
|
||||
byte[] key = Arrays.copyOfRange(keyiv, 0, 32);
|
||||
byte[] iv = Arrays.copyOfRange(keyiv, 32, 48);
|
||||
|
||||
final byte[] key = Arrays.copyOfRange(keyIvParameters, 0, blockSize);
|
||||
final byte[] iv = Arrays.copyOfRange(keyIvParameters, blockSize, parameterSize);
|
||||
|
||||
cipher.init(Cipher.Mode.Decrypt, key, iv);
|
||||
} else {
|
||||
throw new IllegalStateException("No support for KDF '" + kdfName + "'.");
|
||||
final String message = String.format("OpenSSH Private Key encryption KDF not supported [%s]", kdfName);
|
||||
throw new IllegalStateException(message);
|
||||
}
|
||||
}
|
||||
|
||||
private Cipher createCipher(String cipherName) {
|
||||
if (cipherName.equals(BlockCiphers.AES256CTR().getName())) {
|
||||
return BlockCiphers.AES256CTR().create();
|
||||
} else if (cipherName.equals(BlockCiphers.AES256CBC().getName())) {
|
||||
return BlockCiphers.AES256CBC().create();
|
||||
private Cipher createCipher(final String cipherName) {
|
||||
final Cipher cipher;
|
||||
|
||||
if (SUPPORTED_CIPHERS.containsKey(cipherName)) {
|
||||
final Factory.Named<Cipher> cipherFactory = SUPPORTED_CIPHERS.get(cipherName);
|
||||
cipher = cipherFactory.create();
|
||||
} else {
|
||||
final String message = String.format("OpenSSH Key encryption cipher not supported [%s]", cipherName);
|
||||
throw new IllegalStateException(message);
|
||||
}
|
||||
throw new IllegalStateException("Cipher '" + cipherName + "' not currently implemented for openssh-key-v1 format");
|
||||
|
||||
return cipher;
|
||||
}
|
||||
|
||||
private PublicKey readPublicKey(final PlainBuffer plainBuffer) throws Buffer.BufferException, GeneralSecurityException {
|
||||
return KeyType.fromString(plainBuffer.readString()).readPubKeyFromBuffer(plainBuffer);
|
||||
}
|
||||
|
||||
private String readKeyFile(final BufferedReader reader) throws IOException {
|
||||
StringBuilder sb = new StringBuilder();
|
||||
private String readEncodedKey(final BufferedReader reader) throws IOException {
|
||||
final StringBuilder builder = new StringBuilder();
|
||||
|
||||
boolean footerFound = false;
|
||||
String line = reader.readLine();
|
||||
while (!line.startsWith(END)) {
|
||||
sb.append(line);
|
||||
while (line != null) {
|
||||
if (line.startsWith(END)) {
|
||||
footerFound = true;
|
||||
break;
|
||||
}
|
||||
builder.append(line);
|
||||
line = reader.readLine();
|
||||
}
|
||||
return sb.toString();
|
||||
|
||||
if (footerFound) {
|
||||
return builder.toString();
|
||||
} else {
|
||||
final String message = String.format("File footer not found [%s%s]", END, OPENSSH_PRIVATE_KEY);
|
||||
throw new IOException(message);
|
||||
}
|
||||
}
|
||||
|
||||
private boolean checkHeader(final BufferedReader reader) throws IOException {
|
||||
@@ -216,6 +301,9 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||
while (line != null && !line.startsWith(BEGIN)) {
|
||||
line = reader.readLine();
|
||||
}
|
||||
if (line == null) {
|
||||
return false;
|
||||
}
|
||||
line = line.substring(BEGIN.length());
|
||||
return line.startsWith(OPENSSH_PRIVATE_KEY);
|
||||
}
|
||||
@@ -228,12 +316,12 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||
int checkInt1 = keyBuffer.readUInt32AsInt(); // uint32 checkint1
|
||||
int checkInt2 = keyBuffer.readUInt32AsInt(); // uint32 checkint2
|
||||
if (checkInt1 != checkInt2) {
|
||||
throw new KeyDecryptionFailedException();
|
||||
throw new KeyDecryptionFailedException(new EncryptionException("OpenSSH Private Key integer comparison failed"));
|
||||
}
|
||||
// The private key section contains both the public key and the private key
|
||||
String keyType = keyBuffer.readString(); // string keytype
|
||||
KeyType kt = KeyType.fromString(keyType);
|
||||
logger.info("Read key type: {}", keyType, kt);
|
||||
|
||||
KeyPair kp;
|
||||
switch (kt) {
|
||||
case ED25519:
|
||||
|
||||
@@ -14,11 +14,9 @@
|
||||
|
||||
package com.hierynomus.sshj.userauth.keyprovider.bcrypt;
|
||||
|
||||
import java.io.UnsupportedEncodingException;
|
||||
import java.security.DigestException;
|
||||
import java.security.MessageDigest;
|
||||
import java.security.NoSuchAlgorithmException;
|
||||
import java.security.SecureRandom;
|
||||
|
||||
/**
|
||||
* BCrypt implements OpenBSD-style Blowfish password hashing using
|
||||
@@ -30,32 +28,6 @@ import java.security.SecureRandom;
|
||||
* based on Bruce Schneier's Blowfish cipher. The work factor of
|
||||
* the algorithm is parameterised, so it can be increased as
|
||||
* computers get faster.
|
||||
* <p>
|
||||
* Usage is really simple. To hash a password for the first time,
|
||||
* call the hashpw method with a random salt, like this:
|
||||
* <p>
|
||||
* <code>
|
||||
* String pw_hash = BCrypt.hashpw(plain_password, BCrypt.gensalt()); <br>
|
||||
* </code>
|
||||
* <p>
|
||||
* To check whether a plaintext password matches one that has been
|
||||
* hashed previously, use the checkpw method:
|
||||
* <p>
|
||||
* <code>
|
||||
* if (BCrypt.checkpw(candidate_password, stored_hash))<br>
|
||||
* System.out.println("It matches");<br>
|
||||
* else<br>
|
||||
* System.out.println("It does not match");<br>
|
||||
* </code>
|
||||
* <p>
|
||||
* The gensalt() method takes an optional parameter (log_rounds)
|
||||
* that determines the computational complexity of the hashing:
|
||||
* <p>
|
||||
* <code>
|
||||
* String strong_salt = BCrypt.gensalt(10)<br>
|
||||
* String stronger_salt = BCrypt.gensalt(12)<br>
|
||||
* </code>
|
||||
* <p>
|
||||
* The amount of work increases exponentially (2**log_rounds), so
|
||||
* each increment is twice as much work. The default log_rounds is
|
||||
* 10, and the valid range is 4 to 30.
|
||||
@@ -64,22 +36,18 @@ import java.security.SecureRandom;
|
||||
* @version 0.2
|
||||
*/
|
||||
public class BCrypt {
|
||||
// BCrypt parameters
|
||||
private static final int GENSALT_DEFAULT_LOG2_ROUNDS = 10;
|
||||
private static final int BCRYPT_SALT_LEN = 16;
|
||||
|
||||
// Blowfish parameters
|
||||
private static final int BLOWFISH_NUM_ROUNDS = 16;
|
||||
|
||||
// Initial contents of key schedule
|
||||
private static final int P_orig[] = {
|
||||
private static final int[] P_orig = {
|
||||
0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344,
|
||||
0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89,
|
||||
0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c,
|
||||
0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917,
|
||||
0x9216d5d9, 0x8979fb1b
|
||||
};
|
||||
private static final int S_orig[] = {
|
||||
private static final int[] S_orig = {
|
||||
0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7,
|
||||
0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99,
|
||||
0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16,
|
||||
@@ -344,149 +312,9 @@ public class BCrypt {
|
||||
0x66697368, 0x53776174, 0x44796e61, 0x6d697465,
|
||||
};
|
||||
|
||||
// bcrypt IV: "OrpheanBeholderScryDoubt". The C implementation calls
|
||||
// this "ciphertext", but it is really plaintext or an IV. We keep
|
||||
// the name to make code comparison easier.
|
||||
static private final int bf_crypt_ciphertext[] = {
|
||||
0x4f727068, 0x65616e42, 0x65686f6c,
|
||||
0x64657253, 0x63727944, 0x6f756274
|
||||
};
|
||||
|
||||
// Table for Base64 encoding
|
||||
static private final char base64_code[] = {
|
||||
'.', '/', 'A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J',
|
||||
'K', 'L', 'M', 'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V',
|
||||
'W', 'X', 'Y', 'Z', 'a', 'b', 'c', 'd', 'e', 'f', 'g', 'h',
|
||||
'i', 'j', 'k', 'l', 'm', 'n', 'o', 'p', 'q', 'r', 's', 't',
|
||||
'u', 'v', 'w', 'x', 'y', 'z', '0', '1', '2', '3', '4', '5',
|
||||
'6', '7', '8', '9'
|
||||
};
|
||||
|
||||
// Table for Base64 decoding
|
||||
static private final byte index_64[] = {
|
||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
||||
-1, -1, -1, -1, -1, -1, 0, 1, 54, 55,
|
||||
56, 57, 58, 59, 60, 61, 62, 63, -1, -1,
|
||||
-1, -1, -1, -1, -1, 2, 3, 4, 5, 6,
|
||||
7, 8, 9, 10, 11, 12, 13, 14, 15, 16,
|
||||
17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27,
|
||||
-1, -1, -1, -1, -1, -1, 28, 29, 30,
|
||||
31, 32, 33, 34, 35, 36, 37, 38, 39, 40,
|
||||
41, 42, 43, 44, 45, 46, 47, 48, 49, 50,
|
||||
51, 52, 53, -1, -1, -1, -1, -1
|
||||
};
|
||||
|
||||
// Expanded Blowfish key
|
||||
private int P[];
|
||||
private int S[];
|
||||
|
||||
/**
|
||||
* Encode a byte array using bcrypt's slightly-modified base64
|
||||
* encoding scheme. Note that this is *not* compatible with
|
||||
* the standard MIME-base64 encoding.
|
||||
*
|
||||
* @param d the byte array to encode
|
||||
* @param len the number of bytes to encode
|
||||
* @return base64-encoded string
|
||||
* @exception IllegalArgumentException if the length is invalid
|
||||
*/
|
||||
private static String encode_base64(byte d[], int len)
|
||||
throws IllegalArgumentException {
|
||||
int off = 0;
|
||||
StringBuffer rs = new StringBuffer();
|
||||
int c1, c2;
|
||||
|
||||
if (len <= 0 || len > d.length)
|
||||
throw new IllegalArgumentException ("Invalid len");
|
||||
|
||||
while (off < len) {
|
||||
c1 = d[off++] & 0xff;
|
||||
rs.append(base64_code[(c1 >> 2) & 0x3f]);
|
||||
c1 = (c1 & 0x03) << 4;
|
||||
if (off >= len) {
|
||||
rs.append(base64_code[c1 & 0x3f]);
|
||||
break;
|
||||
}
|
||||
c2 = d[off++] & 0xff;
|
||||
c1 |= (c2 >> 4) & 0x0f;
|
||||
rs.append(base64_code[c1 & 0x3f]);
|
||||
c1 = (c2 & 0x0f) << 2;
|
||||
if (off >= len) {
|
||||
rs.append(base64_code[c1 & 0x3f]);
|
||||
break;
|
||||
}
|
||||
c2 = d[off++] & 0xff;
|
||||
c1 |= (c2 >> 6) & 0x03;
|
||||
rs.append(base64_code[c1 & 0x3f]);
|
||||
rs.append(base64_code[c2 & 0x3f]);
|
||||
}
|
||||
return rs.toString();
|
||||
}
|
||||
|
||||
/**
|
||||
* Look up the 3 bits base64-encoded by the specified character,
|
||||
* range-checking againt conversion table
|
||||
* @param x the base64-encoded value
|
||||
* @return the decoded value of x
|
||||
*/
|
||||
private static byte char64(char x) {
|
||||
if ((int)x < 0 || (int)x > index_64.length)
|
||||
return -1;
|
||||
return index_64[(int)x];
|
||||
}
|
||||
|
||||
/**
|
||||
* Decode a string encoded using bcrypt's base64 scheme to a
|
||||
* byte array. Note that this is *not* compatible with
|
||||
* the standard MIME-base64 encoding.
|
||||
* @param s the string to decode
|
||||
* @param maxolen the maximum number of bytes to decode
|
||||
* @return an array containing the decoded bytes
|
||||
* @throws IllegalArgumentException if maxolen is invalid
|
||||
*/
|
||||
private static byte[] decode_base64(String s, int maxolen)
|
||||
throws IllegalArgumentException {
|
||||
StringBuffer rs = new StringBuffer();
|
||||
int off = 0, slen = s.length(), olen = 0;
|
||||
byte ret[];
|
||||
byte c1, c2, c3, c4, o;
|
||||
|
||||
if (maxolen <= 0)
|
||||
throw new IllegalArgumentException ("Invalid maxolen");
|
||||
|
||||
while (off < slen - 1 && olen < maxolen) {
|
||||
c1 = char64(s.charAt(off++));
|
||||
c2 = char64(s.charAt(off++));
|
||||
if (c1 == -1 || c2 == -1)
|
||||
break;
|
||||
o = (byte)(c1 << 2);
|
||||
o |= (c2 & 0x30) >> 4;
|
||||
rs.append((char)o);
|
||||
if (++olen >= maxolen || off >= slen)
|
||||
break;
|
||||
c3 = char64(s.charAt(off++));
|
||||
if (c3 == -1)
|
||||
break;
|
||||
o = (byte)((c2 & 0x0f) << 4);
|
||||
o |= (c3 & 0x3c) >> 2;
|
||||
rs.append((char)o);
|
||||
if (++olen >= maxolen || off >= slen)
|
||||
break;
|
||||
c4 = char64(s.charAt(off++));
|
||||
o = (byte)((c3 & 0x03) << 6);
|
||||
o |= c4;
|
||||
rs.append((char)o);
|
||||
++olen;
|
||||
}
|
||||
|
||||
ret = new byte[olen];
|
||||
for (off = 0; off < olen; off++)
|
||||
ret[off] = (byte)rs.charAt(off);
|
||||
return ret;
|
||||
}
|
||||
private int[] P;
|
||||
private int[] S;
|
||||
|
||||
/**
|
||||
* Blowfish encipher a single 64-bit block encoded as
|
||||
@@ -494,7 +322,7 @@ public class BCrypt {
|
||||
* @param lr an array containing the two 32-bit half blocks
|
||||
* @param off the position in the array of the blocks
|
||||
*/
|
||||
private final void encipher(int lr[], int off) {
|
||||
private void encipher(int[] lr, int off) {
|
||||
int i, n, l = lr[off], r = lr[off + 1];
|
||||
|
||||
l ^= P[0];
|
||||
@@ -524,7 +352,7 @@ public class BCrypt {
|
||||
* current offset into data
|
||||
* @return the next word of material from data
|
||||
*/
|
||||
private static int streamtoword(byte data[], int offp[]) {
|
||||
private static int streamtoword(byte[] data, int[] offp) {
|
||||
int i;
|
||||
int word = 0;
|
||||
int off = offp[0];
|
||||
@@ -542,18 +370,18 @@ public class BCrypt {
|
||||
* Initialise the Blowfish key schedule
|
||||
*/
|
||||
private void init_key() {
|
||||
P = (int[])P_orig.clone();
|
||||
S = (int[])S_orig.clone();
|
||||
P = P_orig.clone();
|
||||
S = S_orig.clone();
|
||||
}
|
||||
|
||||
/**
|
||||
* Key the Blowfish cipher
|
||||
* @param key an array containing the key
|
||||
*/
|
||||
private void key(byte key[]) {
|
||||
private void key(byte[] key) {
|
||||
int i;
|
||||
int koffp[] = { 0 };
|
||||
int lr[] = { 0, 0 };
|
||||
int[] koffp = { 0 };
|
||||
int[] lr = { 0, 0 };
|
||||
int plen = P.length, slen = S.length;
|
||||
|
||||
for (i = 0; i < plen; i++)
|
||||
@@ -579,10 +407,10 @@ public class BCrypt {
|
||||
* @param data salt information
|
||||
* @param key password information
|
||||
*/
|
||||
private void ekskey(byte data[], byte key[]) {
|
||||
private void ekskey(byte[] data, byte[] key) {
|
||||
int i;
|
||||
int koffp[] = { 0 }, doffp[] = { 0 };
|
||||
int lr[] = { 0, 0 };
|
||||
int[] koffp = { 0 }, doffp = { 0 };
|
||||
int[] lr = { 0, 0 };
|
||||
int plen = P.length, slen = S.length;
|
||||
|
||||
for (i = 0; i < plen; i++)
|
||||
@@ -687,183 +515,4 @@ public class BCrypt {
|
||||
throw new RuntimeException(e);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Perform the central password hashing step in the
|
||||
* bcrypt scheme
|
||||
* @param password the password to hash
|
||||
* @param salt the binary salt to hash with the password
|
||||
* @param log_rounds the binary logarithm of the number
|
||||
* of rounds of hashing to apply
|
||||
* @param cdata the plaintext to encrypt
|
||||
* @return an array containing the binary hashed password
|
||||
*/
|
||||
public byte[] crypt_raw(byte password[], byte salt[], int log_rounds,
|
||||
int cdata[]) {
|
||||
int rounds, i, j;
|
||||
int clen = cdata.length;
|
||||
byte ret[];
|
||||
|
||||
if (log_rounds < 4 || log_rounds > 30)
|
||||
throw new IllegalArgumentException ("Bad number of rounds");
|
||||
rounds = 1 << log_rounds;
|
||||
if (salt.length != BCRYPT_SALT_LEN)
|
||||
throw new IllegalArgumentException ("Bad salt length");
|
||||
|
||||
init_key();
|
||||
ekskey(salt, password);
|
||||
for (i = 0; i != rounds; i++) {
|
||||
key(password);
|
||||
key(salt);
|
||||
}
|
||||
|
||||
for (i = 0; i < 64; i++) {
|
||||
for (j = 0; j < (clen >> 1); j++)
|
||||
encipher(cdata, j << 1);
|
||||
}
|
||||
|
||||
ret = new byte[clen * 4];
|
||||
for (i = 0, j = 0; i < clen; i++) {
|
||||
ret[j++] = (byte)((cdata[i] >> 24) & 0xff);
|
||||
ret[j++] = (byte)((cdata[i] >> 16) & 0xff);
|
||||
ret[j++] = (byte)((cdata[i] >> 8) & 0xff);
|
||||
ret[j++] = (byte)(cdata[i] & 0xff);
|
||||
}
|
||||
return ret;
|
||||
}
|
||||
|
||||
/**
|
||||
* Hash a password using the OpenBSD bcrypt scheme
|
||||
* @param password the password to hash
|
||||
* @param salt the salt to hash with (perhaps generated
|
||||
* using BCrypt.gensalt)
|
||||
* @return the hashed password
|
||||
*/
|
||||
public static String hashpw(String password, String salt) {
|
||||
BCrypt B;
|
||||
String real_salt;
|
||||
byte passwordb[], saltb[], hashed[];
|
||||
char minor = (char)0;
|
||||
int rounds, off = 0;
|
||||
StringBuffer rs = new StringBuffer();
|
||||
|
||||
if (salt.charAt(0) != '$' || salt.charAt(1) != '2')
|
||||
throw new IllegalArgumentException ("Invalid salt version");
|
||||
if (salt.charAt(2) == '$')
|
||||
off = 3;
|
||||
else {
|
||||
minor = salt.charAt(2);
|
||||
if (minor != 'a' || salt.charAt(3) != '$')
|
||||
throw new IllegalArgumentException ("Invalid salt revision");
|
||||
off = 4;
|
||||
}
|
||||
|
||||
// Extract number of rounds
|
||||
if (salt.charAt(off + 2) > '$')
|
||||
throw new IllegalArgumentException ("Missing salt rounds");
|
||||
rounds = Integer.parseInt(salt.substring(off, off + 2));
|
||||
|
||||
real_salt = salt.substring(off + 3, off + 25);
|
||||
try {
|
||||
passwordb = (password + (minor >= 'a' ? "\000" : "")).getBytes("UTF-8");
|
||||
} catch (UnsupportedEncodingException uee) {
|
||||
throw new AssertionError("UTF-8 is not supported");
|
||||
}
|
||||
|
||||
saltb = decode_base64(real_salt, BCRYPT_SALT_LEN);
|
||||
|
||||
B = new BCrypt();
|
||||
hashed = B.crypt_raw(passwordb, saltb, rounds,
|
||||
(int[])bf_crypt_ciphertext.clone());
|
||||
|
||||
rs.append("$2");
|
||||
if (minor >= 'a')
|
||||
rs.append(minor);
|
||||
rs.append("$");
|
||||
if (rounds < 10)
|
||||
rs.append("0");
|
||||
if (rounds > 30) {
|
||||
throw new IllegalArgumentException(
|
||||
"rounds exceeds maximum (30)");
|
||||
}
|
||||
rs.append(Integer.toString(rounds));
|
||||
rs.append("$");
|
||||
rs.append(encode_base64(saltb, saltb.length));
|
||||
rs.append(encode_base64(hashed,
|
||||
bf_crypt_ciphertext.length * 4 - 1));
|
||||
return rs.toString();
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate a salt for use with the BCrypt.hashpw() method
|
||||
* @param log_rounds the log2 of the number of rounds of
|
||||
* hashing to apply - the work factor therefore increases as
|
||||
* 2**log_rounds.
|
||||
* @param random an instance of SecureRandom to use
|
||||
* @return an encoded salt value
|
||||
*/
|
||||
public static String gensalt(int log_rounds, SecureRandom random) {
|
||||
StringBuffer rs = new StringBuffer();
|
||||
byte rnd[] = new byte[BCRYPT_SALT_LEN];
|
||||
|
||||
random.nextBytes(rnd);
|
||||
|
||||
rs.append("$2a$");
|
||||
if (log_rounds < 10)
|
||||
rs.append("0");
|
||||
if (log_rounds > 30) {
|
||||
throw new IllegalArgumentException(
|
||||
"log_rounds exceeds maximum (30)");
|
||||
}
|
||||
rs.append(Integer.toString(log_rounds));
|
||||
rs.append("$");
|
||||
rs.append(encode_base64(rnd, rnd.length));
|
||||
return rs.toString();
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate a salt for use with the BCrypt.hashpw() method
|
||||
* @param log_rounds the log2 of the number of rounds of
|
||||
* hashing to apply - the work factor therefore increases as
|
||||
* 2**log_rounds.
|
||||
* @return an encoded salt value
|
||||
*/
|
||||
public static String gensalt(int log_rounds) {
|
||||
return gensalt(log_rounds, new SecureRandom());
|
||||
}
|
||||
|
||||
/**
|
||||
* Generate a salt for use with the BCrypt.hashpw() method,
|
||||
* selecting a reasonable default for the number of hashing
|
||||
* rounds to apply
|
||||
* @return an encoded salt value
|
||||
*/
|
||||
public static String gensalt() {
|
||||
return gensalt(GENSALT_DEFAULT_LOG2_ROUNDS);
|
||||
}
|
||||
|
||||
/**
|
||||
* Check that a plaintext password matches a previously hashed
|
||||
* one
|
||||
* @param plaintext the plaintext password to verify
|
||||
* @param hashed the previously-hashed password
|
||||
* @return true if the passwords match, false otherwise
|
||||
*/
|
||||
public static boolean checkpw(String plaintext, String hashed) {
|
||||
byte hashed_bytes[];
|
||||
byte try_bytes[];
|
||||
try {
|
||||
String try_pw = hashpw(plaintext, hashed);
|
||||
hashed_bytes = hashed.getBytes("UTF-8");
|
||||
try_bytes = try_pw.getBytes("UTF-8");
|
||||
} catch (UnsupportedEncodingException uee) {
|
||||
return false;
|
||||
}
|
||||
if (hashed_bytes.length != try_bytes.length)
|
||||
return false;
|
||||
byte ret = 0;
|
||||
for (int i = 0; i < try_bytes.length; i++)
|
||||
ret |= hashed_bytes[i] ^ try_bytes[i];
|
||||
return ret == 0;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,918 +0,0 @@
|
||||
/* Ported from C to Java by Dmitry Skiba [sahn0], 23/02/08.
|
||||
* Original: http://cds.xs4all.nl:8081/ecdh/
|
||||
*/
|
||||
/* Generic 64-bit integer implementation of Curve25519 ECDH
|
||||
* Written by Matthijs van Duin, 200608242056
|
||||
* Public domain.
|
||||
*
|
||||
* Based on work by Daniel J Bernstein, http://cr.yp.to/ecdh.html
|
||||
*/
|
||||
package djb;
|
||||
|
||||
public class Curve25519 {
|
||||
|
||||
/* key size */
|
||||
public static final int KEY_SIZE = 32;
|
||||
|
||||
/* 0 */
|
||||
public static final byte[] ZERO = {
|
||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
|
||||
};
|
||||
|
||||
/* the prime 2^255-19 */
|
||||
public static final byte[] PRIME = {
|
||||
(byte)237, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
||||
(byte)255, (byte)255, (byte)255, (byte)127
|
||||
};
|
||||
|
||||
/* group order (a prime near 2^252+2^124) */
|
||||
public static final byte[] ORDER = {
|
||||
(byte)237, (byte)211, (byte)245, (byte)92,
|
||||
(byte)26, (byte)99, (byte)18, (byte)88,
|
||||
(byte)214, (byte)156, (byte)247, (byte)162,
|
||||
(byte)222, (byte)249, (byte)222, (byte)20,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)16
|
||||
};
|
||||
|
||||
/********* KEY AGREEMENT *********/
|
||||
|
||||
/* Private key clamping
|
||||
* k [out] your private key for key agreement
|
||||
* k [in] 32 random bytes
|
||||
*/
|
||||
public static final void clamp(byte[] k) {
|
||||
k[31] &= 0x7F;
|
||||
k[31] |= 0x40;
|
||||
k[ 0] &= 0xF8;
|
||||
}
|
||||
|
||||
/* Key-pair generation
|
||||
* P [out] your public key
|
||||
* s [out] your private key for signing
|
||||
* k [out] your private key for key agreement
|
||||
* k [in] 32 random bytes
|
||||
* s may be NULL if you don't care
|
||||
*
|
||||
* WARNING: if s is not NULL, this function has data-dependent timing */
|
||||
public static final void keygen(byte[] P, byte[] s, byte[] k) {
|
||||
clamp(k);
|
||||
core(P, s, k, null);
|
||||
}
|
||||
|
||||
/* Key agreement
|
||||
* Z [out] shared secret (needs hashing before use)
|
||||
* k [in] your private key for key agreement
|
||||
* P [in] peer's public key
|
||||
*/
|
||||
public static final void curve(byte[] Z, byte[] k, byte[] P) {
|
||||
core(Z, null, k, P);
|
||||
}
|
||||
|
||||
/********* DIGITAL SIGNATURES *********/
|
||||
|
||||
/* deterministic EC-KCDSA
|
||||
*
|
||||
* s is the private key for signing
|
||||
* P is the corresponding public key
|
||||
* Z is the context data (signer public key or certificate, etc)
|
||||
*
|
||||
* signing:
|
||||
*
|
||||
* m = hash(Z, message)
|
||||
* x = hash(m, s)
|
||||
* keygen25519(Y, NULL, x);
|
||||
* r = hash(Y);
|
||||
* h = m XOR r
|
||||
* sign25519(v, h, x, s);
|
||||
*
|
||||
* output (v,r) as the signature
|
||||
*
|
||||
* verification:
|
||||
*
|
||||
* m = hash(Z, message);
|
||||
* h = m XOR r
|
||||
* verify25519(Y, v, h, P)
|
||||
*
|
||||
* confirm r == hash(Y)
|
||||
*
|
||||
* It would seem to me that it would be simpler to have the signer directly do
|
||||
* h = hash(m, Y) and send that to the recipient instead of r, who can verify
|
||||
* the signature by checking h == hash(m, Y). If there are any problems with
|
||||
* such a scheme, please let me know.
|
||||
*
|
||||
* Also, EC-KCDSA (like most DS algorithms) picks x random, which is a waste of
|
||||
* perfectly good entropy, but does allow Y to be calculated in advance of (or
|
||||
* parallel to) hashing the message.
|
||||
*/
|
||||
|
||||
/* Signature generation primitive, calculates (x-h)s mod q
|
||||
* v [out] signature value
|
||||
* h [in] signature hash (of message, signature pub key, and context data)
|
||||
* x [in] signature private key
|
||||
* s [in] private key for signing
|
||||
* returns true on success, false on failure (use different x or h)
|
||||
*/
|
||||
public static final boolean sign(byte[] v, byte[] h, byte[] x, byte[] s) {
|
||||
// v = (x - h) s mod q
|
||||
int w, i;
|
||||
byte[] h1 = new byte[32], x1 = new byte[32];
|
||||
byte[] tmp1 = new byte[64];
|
||||
byte[] tmp2 = new byte[64];
|
||||
|
||||
// Don't clobber the arguments, be nice!
|
||||
cpy32(h1, h);
|
||||
cpy32(x1, x);
|
||||
|
||||
// Reduce modulo group order
|
||||
byte[] tmp3=new byte[32];
|
||||
divmod(tmp3, h1, 32, ORDER, 32);
|
||||
divmod(tmp3, x1, 32, ORDER, 32);
|
||||
|
||||
// v = x1 - h1
|
||||
// If v is negative, add the group order to it to become positive.
|
||||
// If v was already positive we don't have to worry about overflow
|
||||
// when adding the order because v < ORDER and 2*ORDER < 2^256
|
||||
mula_small(v, x1, 0, h1, 32, -1);
|
||||
mula_small(v, v , 0, ORDER, 32, 1);
|
||||
|
||||
// tmp1 = (x-h)*s mod q
|
||||
mula32(tmp1, v, s, 32, 1);
|
||||
divmod(tmp2, tmp1, 64, ORDER, 32);
|
||||
|
||||
for (w = 0, i = 0; i < 32; i++)
|
||||
w |= v[i] = tmp1[i];
|
||||
return w != 0;
|
||||
}
|
||||
|
||||
/* Signature verification primitive, calculates Y = vP + hG
|
||||
* Y [out] signature public key
|
||||
* v [in] signature value
|
||||
* h [in] signature hash
|
||||
* P [in] public key
|
||||
*/
|
||||
public static final void verify(byte[] Y, byte[] v, byte[] h, byte[] P) {
|
||||
/* Y = v abs(P) + h G */
|
||||
byte[] d=new byte[32];
|
||||
long10[]
|
||||
p=new long10[]{new long10(),new long10()},
|
||||
s=new long10[]{new long10(),new long10()},
|
||||
yx=new long10[]{new long10(),new long10(),new long10()},
|
||||
yz=new long10[]{new long10(),new long10(),new long10()},
|
||||
t1=new long10[]{new long10(),new long10(),new long10()},
|
||||
t2=new long10[]{new long10(),new long10(),new long10()};
|
||||
|
||||
int vi = 0, hi = 0, di = 0, nvh=0, i, j, k;
|
||||
|
||||
/* set p[0] to G and p[1] to P */
|
||||
|
||||
set(p[0], 9);
|
||||
unpack(p[1], P);
|
||||
|
||||
/* set s[0] to P+G and s[1] to P-G */
|
||||
|
||||
/* s[0] = (Py^2 + Gy^2 - 2 Py Gy)/(Px - Gx)^2 - Px - Gx - 486662 */
|
||||
/* s[1] = (Py^2 + Gy^2 + 2 Py Gy)/(Px - Gx)^2 - Px - Gx - 486662 */
|
||||
|
||||
x_to_y2(t1[0], t2[0], p[1]); /* t2[0] = Py^2 */
|
||||
sqrt(t1[0], t2[0]); /* t1[0] = Py or -Py */
|
||||
j = is_negative(t1[0]); /* ... check which */
|
||||
t2[0]._0 += 39420360; /* t2[0] = Py^2 + Gy^2 */
|
||||
mul(t2[1], BASE_2Y, t1[0]);/* t2[1] = 2 Py Gy or -2 Py Gy */
|
||||
sub(t1[j], t2[0], t2[1]); /* t1[0] = Py^2 + Gy^2 - 2 Py Gy */
|
||||
add(t1[1-j], t2[0], t2[1]);/* t1[1] = Py^2 + Gy^2 + 2 Py Gy */
|
||||
cpy(t2[0], p[1]); /* t2[0] = Px */
|
||||
t2[0]._0 -= 9; /* t2[0] = Px - Gx */
|
||||
sqr(t2[1], t2[0]); /* t2[1] = (Px - Gx)^2 */
|
||||
recip(t2[0], t2[1], 0); /* t2[0] = 1/(Px - Gx)^2 */
|
||||
mul(s[0], t1[0], t2[0]); /* s[0] = t1[0]/(Px - Gx)^2 */
|
||||
sub(s[0], s[0], p[1]); /* s[0] = t1[0]/(Px - Gx)^2 - Px */
|
||||
s[0]._0 -= 9 + 486662; /* s[0] = X(P+G) */
|
||||
mul(s[1], t1[1], t2[0]); /* s[1] = t1[1]/(Px - Gx)^2 */
|
||||
sub(s[1], s[1], p[1]); /* s[1] = t1[1]/(Px - Gx)^2 - Px */
|
||||
s[1]._0 -= 9 + 486662; /* s[1] = X(P-G) */
|
||||
mul_small(s[0], s[0], 1); /* reduce s[0] */
|
||||
mul_small(s[1], s[1], 1); /* reduce s[1] */
|
||||
|
||||
|
||||
/* prepare the chain */
|
||||
for (i = 0; i < 32; i++) {
|
||||
vi = (vi >> 8) ^ (v[i] & 0xFF) ^ ((v[i] & 0xFF) << 1);
|
||||
hi = (hi >> 8) ^ (h[i] & 0xFF) ^ ((h[i] & 0xFF) << 1);
|
||||
nvh = ~(vi ^ hi);
|
||||
di = (nvh & (di & 0x80) >> 7) ^ vi;
|
||||
di ^= nvh & (di & 0x01) << 1;
|
||||
di ^= nvh & (di & 0x02) << 1;
|
||||
di ^= nvh & (di & 0x04) << 1;
|
||||
di ^= nvh & (di & 0x08) << 1;
|
||||
di ^= nvh & (di & 0x10) << 1;
|
||||
di ^= nvh & (di & 0x20) << 1;
|
||||
di ^= nvh & (di & 0x40) << 1;
|
||||
d[i] = (byte)di;
|
||||
}
|
||||
|
||||
di = ((nvh & (di & 0x80) << 1) ^ vi) >> 8;
|
||||
|
||||
/* initialize state */
|
||||
set(yx[0], 1);
|
||||
cpy(yx[1], p[di]);
|
||||
cpy(yx[2], s[0]);
|
||||
set(yz[0], 0);
|
||||
set(yz[1], 1);
|
||||
set(yz[2], 1);
|
||||
|
||||
/* y[0] is (even)P + (even)G
|
||||
* y[1] is (even)P + (odd)G if current d-bit is 0
|
||||
* y[1] is (odd)P + (even)G if current d-bit is 1
|
||||
* y[2] is (odd)P + (odd)G
|
||||
*/
|
||||
|
||||
vi = 0;
|
||||
hi = 0;
|
||||
|
||||
/* and go for it! */
|
||||
for (i = 32; i--!=0; ) {
|
||||
vi = (vi << 8) | (v[i] & 0xFF);
|
||||
hi = (hi << 8) | (h[i] & 0xFF);
|
||||
di = (di << 8) | (d[i] & 0xFF);
|
||||
|
||||
for (j = 8; j--!=0; ) {
|
||||
mont_prep(t1[0], t2[0], yx[0], yz[0]);
|
||||
mont_prep(t1[1], t2[1], yx[1], yz[1]);
|
||||
mont_prep(t1[2], t2[2], yx[2], yz[2]);
|
||||
|
||||
k = ((vi ^ vi >> 1) >> j & 1)
|
||||
+ ((hi ^ hi >> 1) >> j & 1);
|
||||
mont_dbl(yx[2], yz[2], t1[k], t2[k], yx[0], yz[0]);
|
||||
|
||||
k = (di >> j & 2) ^ ((di >> j & 1) << 1);
|
||||
mont_add(t1[1], t2[1], t1[k], t2[k], yx[1], yz[1],
|
||||
p[di >> j & 1]);
|
||||
|
||||
mont_add(t1[2], t2[2], t1[0], t2[0], yx[2], yz[2],
|
||||
s[((vi ^ hi) >> j & 2) >> 1]);
|
||||
}
|
||||
}
|
||||
|
||||
k = (vi & 1) + (hi & 1);
|
||||
recip(t1[0], yz[k], 0);
|
||||
mul(t1[1], yx[k], t1[0]);
|
||||
|
||||
pack(t1[1], Y);
|
||||
}
|
||||
|
||||
///////////////////////////////////////////////////////////////////////////
|
||||
|
||||
/* sahn0:
|
||||
* Using this class instead of long[10] to avoid bounds checks. */
|
||||
private static final class long10 {
|
||||
public long10() {}
|
||||
public long10(
|
||||
long _0, long _1, long _2, long _3, long _4,
|
||||
long _5, long _6, long _7, long _8, long _9)
|
||||
{
|
||||
this._0=_0; this._1=_1; this._2=_2;
|
||||
this._3=_3; this._4=_4; this._5=_5;
|
||||
this._6=_6; this._7=_7; this._8=_8;
|
||||
this._9=_9;
|
||||
}
|
||||
public long _0,_1,_2,_3,_4,_5,_6,_7,_8,_9;
|
||||
}
|
||||
|
||||
/********************* radix 2^8 math *********************/
|
||||
|
||||
private static final void cpy32(byte[] d, byte[] s) {
|
||||
int i;
|
||||
for (i = 0; i < 32; i++)
|
||||
d[i] = s[i];
|
||||
}
|
||||
|
||||
/* p[m..n+m-1] = q[m..n+m-1] + z * x */
|
||||
/* n is the size of x */
|
||||
/* n+m is the size of p and q */
|
||||
private static final int mula_small(byte[] p,byte[] q,int m,byte[] x,int n,int z) {
|
||||
int v=0;
|
||||
for (int i=0;i<n;++i) {
|
||||
v+=(q[i+m] & 0xFF)+z*(x[i] & 0xFF);
|
||||
p[i+m]=(byte)v;
|
||||
v>>=8;
|
||||
}
|
||||
return v;
|
||||
}
|
||||
|
||||
/* p += x * y * z where z is a small integer
|
||||
* x is size 32, y is size t, p is size 32+t
|
||||
* y is allowed to overlap with p+32 if you don't care about the upper half */
|
||||
private static final int mula32(byte[] p, byte[] x, byte[] y, int t, int z) {
|
||||
final int n = 31;
|
||||
int w = 0;
|
||||
int i = 0;
|
||||
for (; i < t; i++) {
|
||||
int zy = z * (y[i] & 0xFF);
|
||||
w += mula_small(p, p, i, x, n, zy) +
|
||||
(p[i+n] & 0xFF) + zy * (x[n] & 0xFF);
|
||||
p[i+n] = (byte)w;
|
||||
w >>= 8;
|
||||
}
|
||||
p[i+n] = (byte)(w + (p[i+n] & 0xFF));
|
||||
return w >> 8;
|
||||
}
|
||||
|
||||
/* divide r (size n) by d (size t), returning quotient q and remainder r
|
||||
* quotient is size n-t+1, remainder is size t
|
||||
* requires t > 0 && d[t-1] != 0
|
||||
* requires that r[-1] and d[-1] are valid memory locations
|
||||
* q may overlap with r+t */
|
||||
private static final void divmod(byte[] q, byte[] r, int n, byte[] d, int t) {
|
||||
int rn = 0;
|
||||
int dt = ((d[t-1] & 0xFF) << 8);
|
||||
if (t>1) {
|
||||
dt |= (d[t-2] & 0xFF);
|
||||
}
|
||||
while (n-- >= t) {
|
||||
int z = (rn << 16) | ((r[n] & 0xFF) << 8);
|
||||
if (n>0) {
|
||||
z |= (r[n-1] & 0xFF);
|
||||
}
|
||||
z/=dt;
|
||||
rn += mula_small(r,r, n-t+1, d, t, -z);
|
||||
q[n-t+1] = (byte)((z + rn) & 0xFF); /* rn is 0 or -1 (underflow) */
|
||||
mula_small(r,r, n-t+1, d, t, -rn);
|
||||
rn = (r[n] & 0xFF);
|
||||
r[n] = 0;
|
||||
}
|
||||
r[t-1] = (byte)rn;
|
||||
}
|
||||
|
||||
private static final int numsize(byte[] x,int n) {
|
||||
while (n--!=0 && x[n]==0)
|
||||
;
|
||||
return n+1;
|
||||
}
|
||||
|
||||
/* Returns x if a contains the gcd, y if b.
|
||||
* Also, the returned buffer contains the inverse of a mod b,
|
||||
* as 32-byte signed.
|
||||
* x and y must have 64 bytes space for temporary use.
|
||||
* requires that a[-1] and b[-1] are valid memory locations */
|
||||
private static final byte[] egcd32(byte[] x,byte[] y,byte[] a,byte[] b) {
|
||||
int an, bn = 32, qn, i;
|
||||
for (i = 0; i < 32; i++)
|
||||
x[i] = y[i] = 0;
|
||||
x[0] = 1;
|
||||
an = numsize(a, 32);
|
||||
if (an==0)
|
||||
return y; /* division by zero */
|
||||
byte[] temp=new byte[32];
|
||||
while (true) {
|
||||
qn = bn - an + 1;
|
||||
divmod(temp, b, bn, a, an);
|
||||
bn = numsize(b, bn);
|
||||
if (bn==0)
|
||||
return x;
|
||||
mula32(y, x, temp, qn, -1);
|
||||
|
||||
qn = an - bn + 1;
|
||||
divmod(temp, a, an, b, bn);
|
||||
an = numsize(a, an);
|
||||
if (an==0)
|
||||
return y;
|
||||
mula32(x, y, temp, qn, -1);
|
||||
}
|
||||
}
|
||||
|
||||
/********************* radix 2^25.5 GF(2^255-19) math *********************/
|
||||
|
||||
private static final int P25=33554431; /* (1 << 25) - 1 */
|
||||
private static final int P26=67108863; /* (1 << 26) - 1 */
|
||||
|
||||
/* Convert to internal format from little-endian byte format */
|
||||
private static final void unpack(long10 x,byte[] m) {
|
||||
x._0 = ((m[0] & 0xFF)) | ((m[1] & 0xFF))<<8 |
|
||||
(m[2] & 0xFF)<<16 | ((m[3] & 0xFF)& 3)<<24;
|
||||
x._1 = ((m[3] & 0xFF)&~ 3)>>2 | (m[4] & 0xFF)<<6 |
|
||||
(m[5] & 0xFF)<<14 | ((m[6] & 0xFF)& 7)<<22;
|
||||
x._2 = ((m[6] & 0xFF)&~ 7)>>3 | (m[7] & 0xFF)<<5 |
|
||||
(m[8] & 0xFF)<<13 | ((m[9] & 0xFF)&31)<<21;
|
||||
x._3 = ((m[9] & 0xFF)&~31)>>5 | (m[10] & 0xFF)<<3 |
|
||||
(m[11] & 0xFF)<<11 | ((m[12] & 0xFF)&63)<<19;
|
||||
x._4 = ((m[12] & 0xFF)&~63)>>6 | (m[13] & 0xFF)<<2 |
|
||||
(m[14] & 0xFF)<<10 | (m[15] & 0xFF) <<18;
|
||||
x._5 = (m[16] & 0xFF) | (m[17] & 0xFF)<<8 |
|
||||
(m[18] & 0xFF)<<16 | ((m[19] & 0xFF)& 1)<<24;
|
||||
x._6 = ((m[19] & 0xFF)&~ 1)>>1 | (m[20] & 0xFF)<<7 |
|
||||
(m[21] & 0xFF)<<15 | ((m[22] & 0xFF)& 7)<<23;
|
||||
x._7 = ((m[22] & 0xFF)&~ 7)>>3 | (m[23] & 0xFF)<<5 |
|
||||
(m[24] & 0xFF)<<13 | ((m[25] & 0xFF)&15)<<21;
|
||||
x._8 = ((m[25] & 0xFF)&~15)>>4 | (m[26] & 0xFF)<<4 |
|
||||
(m[27] & 0xFF)<<12 | ((m[28] & 0xFF)&63)<<20;
|
||||
x._9 = ((m[28] & 0xFF)&~63)>>6 | (m[29] & 0xFF)<<2 |
|
||||
(m[30] & 0xFF)<<10 | (m[31] & 0xFF) <<18;
|
||||
}
|
||||
|
||||
/* Check if reduced-form input >= 2^255-19 */
|
||||
private static final boolean is_overflow(long10 x) {
|
||||
return (
|
||||
((x._0 > P26-19)) &&
|
||||
((x._1 & x._3 & x._5 & x._7 & x._9) == P25) &&
|
||||
((x._2 & x._4 & x._6 & x._8) == P26)
|
||||
) || (x._9 > P25);
|
||||
}
|
||||
|
||||
/* Convert from internal format to little-endian byte format. The
|
||||
* number must be in a reduced form which is output by the following ops:
|
||||
* unpack, mul, sqr
|
||||
* set -- if input in range 0 .. P25
|
||||
* If you're unsure if the number is reduced, first multiply it by 1. */
|
||||
private static final void pack(long10 x,byte[] m) {
|
||||
int ld = 0, ud = 0;
|
||||
long t;
|
||||
ld = (is_overflow(x)?1:0) - ((x._9 < 0)?1:0);
|
||||
ud = ld * -(P25+1);
|
||||
ld *= 19;
|
||||
t = ld + x._0 + (x._1 << 26);
|
||||
m[ 0] = (byte)t;
|
||||
m[ 1] = (byte)(t >> 8);
|
||||
m[ 2] = (byte)(t >> 16);
|
||||
m[ 3] = (byte)(t >> 24);
|
||||
t = (t >> 32) + (x._2 << 19);
|
||||
m[ 4] = (byte)t;
|
||||
m[ 5] = (byte)(t >> 8);
|
||||
m[ 6] = (byte)(t >> 16);
|
||||
m[ 7] = (byte)(t >> 24);
|
||||
t = (t >> 32) + (x._3 << 13);
|
||||
m[ 8] = (byte)t;
|
||||
m[ 9] = (byte)(t >> 8);
|
||||
m[10] = (byte)(t >> 16);
|
||||
m[11] = (byte)(t >> 24);
|
||||
t = (t >> 32) + (x._4 << 6);
|
||||
m[12] = (byte)t;
|
||||
m[13] = (byte)(t >> 8);
|
||||
m[14] = (byte)(t >> 16);
|
||||
m[15] = (byte)(t >> 24);
|
||||
t = (t >> 32) + x._5 + (x._6 << 25);
|
||||
m[16] = (byte)t;
|
||||
m[17] = (byte)(t >> 8);
|
||||
m[18] = (byte)(t >> 16);
|
||||
m[19] = (byte)(t >> 24);
|
||||
t = (t >> 32) + (x._7 << 19);
|
||||
m[20] = (byte)t;
|
||||
m[21] = (byte)(t >> 8);
|
||||
m[22] = (byte)(t >> 16);
|
||||
m[23] = (byte)(t >> 24);
|
||||
t = (t >> 32) + (x._8 << 12);
|
||||
m[24] = (byte)t;
|
||||
m[25] = (byte)(t >> 8);
|
||||
m[26] = (byte)(t >> 16);
|
||||
m[27] = (byte)(t >> 24);
|
||||
t = (t >> 32) + ((x._9 + ud) << 6);
|
||||
m[28] = (byte)t;
|
||||
m[29] = (byte)(t >> 8);
|
||||
m[30] = (byte)(t >> 16);
|
||||
m[31] = (byte)(t >> 24);
|
||||
}
|
||||
|
||||
/* Copy a number */
|
||||
private static final void cpy(long10 out, long10 in) {
|
||||
out._0=in._0; out._1=in._1;
|
||||
out._2=in._2; out._3=in._3;
|
||||
out._4=in._4; out._5=in._5;
|
||||
out._6=in._6; out._7=in._7;
|
||||
out._8=in._8; out._9=in._9;
|
||||
}
|
||||
|
||||
/* Set a number to value, which must be in range -185861411 .. 185861411 */
|
||||
private static final void set(long10 out, int in) {
|
||||
out._0=in; out._1=0;
|
||||
out._2=0; out._3=0;
|
||||
out._4=0; out._5=0;
|
||||
out._6=0; out._7=0;
|
||||
out._8=0; out._9=0;
|
||||
}
|
||||
|
||||
/* Add/subtract two numbers. The inputs must be in reduced form, and the
|
||||
* output isn't, so to do another addition or subtraction on the output,
|
||||
* first multiply it by one to reduce it. */
|
||||
private static final void add(long10 xy, long10 x, long10 y) {
|
||||
xy._0 = x._0 + y._0; xy._1 = x._1 + y._1;
|
||||
xy._2 = x._2 + y._2; xy._3 = x._3 + y._3;
|
||||
xy._4 = x._4 + y._4; xy._5 = x._5 + y._5;
|
||||
xy._6 = x._6 + y._6; xy._7 = x._7 + y._7;
|
||||
xy._8 = x._8 + y._8; xy._9 = x._9 + y._9;
|
||||
}
|
||||
private static final void sub(long10 xy, long10 x, long10 y) {
|
||||
xy._0 = x._0 - y._0; xy._1 = x._1 - y._1;
|
||||
xy._2 = x._2 - y._2; xy._3 = x._3 - y._3;
|
||||
xy._4 = x._4 - y._4; xy._5 = x._5 - y._5;
|
||||
xy._6 = x._6 - y._6; xy._7 = x._7 - y._7;
|
||||
xy._8 = x._8 - y._8; xy._9 = x._9 - y._9;
|
||||
}
|
||||
|
||||
/* Multiply a number by a small integer in range -185861411 .. 185861411.
|
||||
* The output is in reduced form, the input x need not be. x and xy may point
|
||||
* to the same buffer. */
|
||||
private static final long10 mul_small(long10 xy, long10 x, long y) {
|
||||
long t;
|
||||
t = (x._8*y);
|
||||
xy._8 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x._9*y);
|
||||
xy._9 = (t & ((1 << 25) - 1));
|
||||
t = 19 * (t >> 25) + (x._0*y);
|
||||
xy._0 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x._1*y);
|
||||
xy._1 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x._2*y);
|
||||
xy._2 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x._3*y);
|
||||
xy._3 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x._4*y);
|
||||
xy._4 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x._5*y);
|
||||
xy._5 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x._6*y);
|
||||
xy._6 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x._7*y);
|
||||
xy._7 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + xy._8;
|
||||
xy._8 = (t & ((1 << 26) - 1));
|
||||
xy._9 += (t >> 26);
|
||||
return xy;
|
||||
}
|
||||
|
||||
/* Multiply two numbers. The output is in reduced form, the inputs need not
|
||||
* be. */
|
||||
private static final long10 mul(long10 xy, long10 x, long10 y) {
|
||||
/* sahn0:
|
||||
* Using local variables to avoid class access.
|
||||
* This seem to improve performance a bit...
|
||||
*/
|
||||
long
|
||||
x_0=x._0,x_1=x._1,x_2=x._2,x_3=x._3,x_4=x._4,
|
||||
x_5=x._5,x_6=x._6,x_7=x._7,x_8=x._8,x_9=x._9;
|
||||
long
|
||||
y_0=y._0,y_1=y._1,y_2=y._2,y_3=y._3,y_4=y._4,
|
||||
y_5=y._5,y_6=y._6,y_7=y._7,y_8=y._8,y_9=y._9;
|
||||
long t;
|
||||
t = (x_0*y_8) + (x_2*y_6) + (x_4*y_4) + (x_6*y_2) +
|
||||
(x_8*y_0) + 2 * ((x_1*y_7) + (x_3*y_5) +
|
||||
(x_5*y_3) + (x_7*y_1)) + 38 *
|
||||
(x_9*y_9);
|
||||
xy._8 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x_0*y_9) + (x_1*y_8) + (x_2*y_7) +
|
||||
(x_3*y_6) + (x_4*y_5) + (x_5*y_4) +
|
||||
(x_6*y_3) + (x_7*y_2) + (x_8*y_1) +
|
||||
(x_9*y_0);
|
||||
xy._9 = (t & ((1 << 25) - 1));
|
||||
t = (x_0*y_0) + 19 * ((t >> 25) + (x_2*y_8) + (x_4*y_6)
|
||||
+ (x_6*y_4) + (x_8*y_2)) + 38 *
|
||||
((x_1*y_9) + (x_3*y_7) + (x_5*y_5) +
|
||||
(x_7*y_3) + (x_9*y_1));
|
||||
xy._0 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x_0*y_1) + (x_1*y_0) + 19 * ((x_2*y_9)
|
||||
+ (x_3*y_8) + (x_4*y_7) + (x_5*y_6) +
|
||||
(x_6*y_5) + (x_7*y_4) + (x_8*y_3) +
|
||||
(x_9*y_2));
|
||||
xy._1 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x_0*y_2) + (x_2*y_0) + 19 * ((x_4*y_8)
|
||||
+ (x_6*y_6) + (x_8*y_4)) + 2 * (x_1*y_1)
|
||||
+ 38 * ((x_3*y_9) + (x_5*y_7) +
|
||||
(x_7*y_5) + (x_9*y_3));
|
||||
xy._2 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x_0*y_3) + (x_1*y_2) + (x_2*y_1) +
|
||||
(x_3*y_0) + 19 * ((x_4*y_9) + (x_5*y_8) +
|
||||
(x_6*y_7) + (x_7*y_6) +
|
||||
(x_8*y_5) + (x_9*y_4));
|
||||
xy._3 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x_0*y_4) + (x_2*y_2) + (x_4*y_0) + 19 *
|
||||
((x_6*y_8) + (x_8*y_6)) + 2 * ((x_1*y_3) +
|
||||
(x_3*y_1)) + 38 *
|
||||
((x_5*y_9) + (x_7*y_7) + (x_9*y_5));
|
||||
xy._4 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x_0*y_5) + (x_1*y_4) + (x_2*y_3) +
|
||||
(x_3*y_2) + (x_4*y_1) + (x_5*y_0) + 19 *
|
||||
((x_6*y_9) + (x_7*y_8) + (x_8*y_7) +
|
||||
(x_9*y_6));
|
||||
xy._5 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x_0*y_6) + (x_2*y_4) + (x_4*y_2) +
|
||||
(x_6*y_0) + 19 * (x_8*y_8) + 2 * ((x_1*y_5) +
|
||||
(x_3*y_3) + (x_5*y_1)) + 38 *
|
||||
((x_7*y_9) + (x_9*y_7));
|
||||
xy._6 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + (x_0*y_7) + (x_1*y_6) + (x_2*y_5) +
|
||||
(x_3*y_4) + (x_4*y_3) + (x_5*y_2) +
|
||||
(x_6*y_1) + (x_7*y_0) + 19 * ((x_8*y_9) +
|
||||
(x_9*y_8));
|
||||
xy._7 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + xy._8;
|
||||
xy._8 = (t & ((1 << 26) - 1));
|
||||
xy._9 += (t >> 26);
|
||||
return xy;
|
||||
}
|
||||
|
||||
/* Square a number. Optimization of mul25519(x2, x, x) */
|
||||
private static final long10 sqr(long10 x2, long10 x) {
|
||||
long
|
||||
x_0=x._0,x_1=x._1,x_2=x._2,x_3=x._3,x_4=x._4,
|
||||
x_5=x._5,x_6=x._6,x_7=x._7,x_8=x._8,x_9=x._9;
|
||||
long t;
|
||||
t = (x_4*x_4) + 2 * ((x_0*x_8) + (x_2*x_6)) + 38 *
|
||||
(x_9*x_9) + 4 * ((x_1*x_7) + (x_3*x_5));
|
||||
x2._8 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + 2 * ((x_0*x_9) + (x_1*x_8) + (x_2*x_7) +
|
||||
(x_3*x_6) + (x_4*x_5));
|
||||
x2._9 = (t & ((1 << 25) - 1));
|
||||
t = 19 * (t >> 25) + (x_0*x_0) + 38 * ((x_2*x_8) +
|
||||
(x_4*x_6) + (x_5*x_5)) + 76 * ((x_1*x_9)
|
||||
+ (x_3*x_7));
|
||||
x2._0 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + 2 * (x_0*x_1) + 38 * ((x_2*x_9) +
|
||||
(x_3*x_8) + (x_4*x_7) + (x_5*x_6));
|
||||
x2._1 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + 19 * (x_6*x_6) + 2 * ((x_0*x_2) +
|
||||
(x_1*x_1)) + 38 * (x_4*x_8) + 76 *
|
||||
((x_3*x_9) + (x_5*x_7));
|
||||
x2._2 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + 2 * ((x_0*x_3) + (x_1*x_2)) + 38 *
|
||||
((x_4*x_9) + (x_5*x_8) + (x_6*x_7));
|
||||
x2._3 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + (x_2*x_2) + 2 * (x_0*x_4) + 38 *
|
||||
((x_6*x_8) + (x_7*x_7)) + 4 * (x_1*x_3) + 76 *
|
||||
(x_5*x_9);
|
||||
x2._4 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + 2 * ((x_0*x_5) + (x_1*x_4) + (x_2*x_3))
|
||||
+ 38 * ((x_6*x_9) + (x_7*x_8));
|
||||
x2._5 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + 19 * (x_8*x_8) + 2 * ((x_0*x_6) +
|
||||
(x_2*x_4) + (x_3*x_3)) + 4 * (x_1*x_5) +
|
||||
76 * (x_7*x_9);
|
||||
x2._6 = (t & ((1 << 26) - 1));
|
||||
t = (t >> 26) + 2 * ((x_0*x_7) + (x_1*x_6) + (x_2*x_5) +
|
||||
(x_3*x_4)) + 38 * (x_8*x_9);
|
||||
x2._7 = (t & ((1 << 25) - 1));
|
||||
t = (t >> 25) + x2._8;
|
||||
x2._8 = (t & ((1 << 26) - 1));
|
||||
x2._9 += (t >> 26);
|
||||
return x2;
|
||||
}
|
||||
|
||||
/* Calculates a reciprocal. The output is in reduced form, the inputs need not
|
||||
* be. Simply calculates y = x^(p-2) so it's not too fast. */
|
||||
/* When sqrtassist is true, it instead calculates y = x^((p-5)/8) */
|
||||
private static final void recip(long10 y, long10 x, int sqrtassist) {
|
||||
long10
|
||||
t0=new long10(),
|
||||
t1=new long10(),
|
||||
t2=new long10(),
|
||||
t3=new long10(),
|
||||
t4=new long10();
|
||||
int i;
|
||||
/* the chain for x^(2^255-21) is straight from djb's implementation */
|
||||
sqr(t1, x); /* 2 == 2 * 1 */
|
||||
sqr(t2, t1); /* 4 == 2 * 2 */
|
||||
sqr(t0, t2); /* 8 == 2 * 4 */
|
||||
mul(t2, t0, x); /* 9 == 8 + 1 */
|
||||
mul(t0, t2, t1); /* 11 == 9 + 2 */
|
||||
sqr(t1, t0); /* 22 == 2 * 11 */
|
||||
mul(t3, t1, t2); /* 31 == 22 + 9
|
||||
== 2^5 - 2^0 */
|
||||
sqr(t1, t3); /* 2^6 - 2^1 */
|
||||
sqr(t2, t1); /* 2^7 - 2^2 */
|
||||
sqr(t1, t2); /* 2^8 - 2^3 */
|
||||
sqr(t2, t1); /* 2^9 - 2^4 */
|
||||
sqr(t1, t2); /* 2^10 - 2^5 */
|
||||
mul(t2, t1, t3); /* 2^10 - 2^0 */
|
||||
sqr(t1, t2); /* 2^11 - 2^1 */
|
||||
sqr(t3, t1); /* 2^12 - 2^2 */
|
||||
for (i = 1; i < 5; i++) {
|
||||
sqr(t1, t3);
|
||||
sqr(t3, t1);
|
||||
} /* t3 */ /* 2^20 - 2^10 */
|
||||
mul(t1, t3, t2); /* 2^20 - 2^0 */
|
||||
sqr(t3, t1); /* 2^21 - 2^1 */
|
||||
sqr(t4, t3); /* 2^22 - 2^2 */
|
||||
for (i = 1; i < 10; i++) {
|
||||
sqr(t3, t4);
|
||||
sqr(t4, t3);
|
||||
} /* t4 */ /* 2^40 - 2^20 */
|
||||
mul(t3, t4, t1); /* 2^40 - 2^0 */
|
||||
for (i = 0; i < 5; i++) {
|
||||
sqr(t1, t3);
|
||||
sqr(t3, t1);
|
||||
} /* t3 */ /* 2^50 - 2^10 */
|
||||
mul(t1, t3, t2); /* 2^50 - 2^0 */
|
||||
sqr(t2, t1); /* 2^51 - 2^1 */
|
||||
sqr(t3, t2); /* 2^52 - 2^2 */
|
||||
for (i = 1; i < 25; i++) {
|
||||
sqr(t2, t3);
|
||||
sqr(t3, t2);
|
||||
} /* t3 */ /* 2^100 - 2^50 */
|
||||
mul(t2, t3, t1); /* 2^100 - 2^0 */
|
||||
sqr(t3, t2); /* 2^101 - 2^1 */
|
||||
sqr(t4, t3); /* 2^102 - 2^2 */
|
||||
for (i = 1; i < 50; i++) {
|
||||
sqr(t3, t4);
|
||||
sqr(t4, t3);
|
||||
} /* t4 */ /* 2^200 - 2^100 */
|
||||
mul(t3, t4, t2); /* 2^200 - 2^0 */
|
||||
for (i = 0; i < 25; i++) {
|
||||
sqr(t4, t3);
|
||||
sqr(t3, t4);
|
||||
} /* t3 */ /* 2^250 - 2^50 */
|
||||
mul(t2, t3, t1); /* 2^250 - 2^0 */
|
||||
sqr(t1, t2); /* 2^251 - 2^1 */
|
||||
sqr(t2, t1); /* 2^252 - 2^2 */
|
||||
if (sqrtassist!=0) {
|
||||
mul(y, x, t2); /* 2^252 - 3 */
|
||||
} else {
|
||||
sqr(t1, t2); /* 2^253 - 2^3 */
|
||||
sqr(t2, t1); /* 2^254 - 2^4 */
|
||||
sqr(t1, t2); /* 2^255 - 2^5 */
|
||||
mul(y, t1, t0); /* 2^255 - 21 */
|
||||
}
|
||||
}
|
||||
|
||||
/* checks if x is "negative", requires reduced input */
|
||||
private static final int is_negative(long10 x) {
|
||||
return (int)(((is_overflow(x) || (x._9 < 0))?1:0) ^ (x._0 & 1));
|
||||
}
|
||||
|
||||
/* a square root */
|
||||
private static final void sqrt(long10 x, long10 u) {
|
||||
long10 v=new long10(), t1=new long10(), t2=new long10();
|
||||
add(t1, u, u); /* t1 = 2u */
|
||||
recip(v, t1, 1); /* v = (2u)^((p-5)/8) */
|
||||
sqr(x, v); /* x = v^2 */
|
||||
mul(t2, t1, x); /* t2 = 2uv^2 */
|
||||
t2._0--; /* t2 = 2uv^2-1 */
|
||||
mul(t1, v, t2); /* t1 = v(2uv^2-1) */
|
||||
mul(x, u, t1); /* x = uv(2uv^2-1) */
|
||||
}
|
||||
|
||||
/********************* Elliptic curve *********************/
|
||||
|
||||
/* y^2 = x^3 + 486662 x^2 + x over GF(2^255-19) */
|
||||
|
||||
/* t1 = ax + az
|
||||
* t2 = ax - az */
|
||||
private static final void mont_prep(long10 t1, long10 t2, long10 ax, long10 az) {
|
||||
add(t1, ax, az);
|
||||
sub(t2, ax, az);
|
||||
}
|
||||
|
||||
/* A = P + Q where
|
||||
* X(A) = ax/az
|
||||
* X(P) = (t1+t2)/(t1-t2)
|
||||
* X(Q) = (t3+t4)/(t3-t4)
|
||||
* X(P-Q) = dx
|
||||
* clobbers t1 and t2, preserves t3 and t4 */
|
||||
private static final void mont_add(long10 t1, long10 t2, long10 t3, long10 t4,long10 ax, long10 az, long10 dx) {
|
||||
mul(ax, t2, t3);
|
||||
mul(az, t1, t4);
|
||||
add(t1, ax, az);
|
||||
sub(t2, ax, az);
|
||||
sqr(ax, t1);
|
||||
sqr(t1, t2);
|
||||
mul(az, t1, dx);
|
||||
}
|
||||
|
||||
/* B = 2 * Q where
|
||||
* X(B) = bx/bz
|
||||
* X(Q) = (t3+t4)/(t3-t4)
|
||||
* clobbers t1 and t2, preserves t3 and t4 */
|
||||
private static final void mont_dbl(long10 t1, long10 t2, long10 t3, long10 t4,long10 bx, long10 bz) {
|
||||
sqr(t1, t3);
|
||||
sqr(t2, t4);
|
||||
mul(bx, t1, t2);
|
||||
sub(t2, t1, t2);
|
||||
mul_small(bz, t2, 121665);
|
||||
add(t1, t1, bz);
|
||||
mul(bz, t1, t2);
|
||||
}
|
||||
|
||||
/* Y^2 = X^3 + 486662 X^2 + X
|
||||
* t is a temporary */
|
||||
private static final void x_to_y2(long10 t, long10 y2, long10 x) {
|
||||
sqr(t, x);
|
||||
mul_small(y2, x, 486662);
|
||||
add(t, t, y2);
|
||||
t._0++;
|
||||
mul(y2, t, x);
|
||||
}
|
||||
|
||||
/* P = kG and s = sign(P)/k */
|
||||
private static final void core(byte[] Px, byte[] s, byte[] k, byte[] Gx) {
|
||||
long10
|
||||
dx=new long10(),
|
||||
t1=new long10(),
|
||||
t2=new long10(),
|
||||
t3=new long10(),
|
||||
t4=new long10();
|
||||
long10[]
|
||||
x=new long10[]{new long10(),new long10()},
|
||||
z=new long10[]{new long10(),new long10()};
|
||||
int i, j;
|
||||
|
||||
/* unpack the base */
|
||||
if (Gx!=null)
|
||||
unpack(dx, Gx);
|
||||
else
|
||||
set(dx, 9);
|
||||
|
||||
/* 0G = point-at-infinity */
|
||||
set(x[0], 1);
|
||||
set(z[0], 0);
|
||||
|
||||
/* 1G = G */
|
||||
cpy(x[1], dx);
|
||||
set(z[1], 1);
|
||||
|
||||
for (i = 32; i--!=0; ) {
|
||||
if (i==0) {
|
||||
i=0;
|
||||
}
|
||||
for (j = 8; j--!=0; ) {
|
||||
/* swap arguments depending on bit */
|
||||
int bit1 = (k[i] & 0xFF) >> j & 1;
|
||||
int bit0 = ~(k[i] & 0xFF) >> j & 1;
|
||||
long10 ax = x[bit0];
|
||||
long10 az = z[bit0];
|
||||
long10 bx = x[bit1];
|
||||
long10 bz = z[bit1];
|
||||
|
||||
/* a' = a + b */
|
||||
/* b' = 2 b */
|
||||
mont_prep(t1, t2, ax, az);
|
||||
mont_prep(t3, t4, bx, bz);
|
||||
mont_add(t1, t2, t3, t4, ax, az, dx);
|
||||
mont_dbl(t1, t2, t3, t4, bx, bz);
|
||||
}
|
||||
}
|
||||
|
||||
recip(t1, z[0], 0);
|
||||
mul(dx, x[0], t1);
|
||||
pack(dx, Px);
|
||||
|
||||
/* calculate s such that s abs(P) = G .. assumes G is std base point */
|
||||
if (s!=null) {
|
||||
x_to_y2(t2, t1, dx); /* t1 = Py^2 */
|
||||
recip(t3, z[1], 0); /* where Q=P+G ... */
|
||||
mul(t2, x[1], t3); /* t2 = Qx */
|
||||
add(t2, t2, dx); /* t2 = Qx + Px */
|
||||
t2._0 += 9 + 486662; /* t2 = Qx + Px + Gx + 486662 */
|
||||
dx._0 -= 9; /* dx = Px - Gx */
|
||||
sqr(t3, dx); /* t3 = (Px - Gx)^2 */
|
||||
mul(dx, t2, t3); /* dx = t2 (Px - Gx)^2 */
|
||||
sub(dx, dx, t1); /* dx = t2 (Px - Gx)^2 - Py^2 */
|
||||
dx._0 -= 39420360; /* dx = t2 (Px - Gx)^2 - Py^2 - Gy^2 */
|
||||
mul(t1, dx, BASE_R2Y); /* t1 = -Py */
|
||||
if (is_negative(t1)!=0) /* sign is 1, so just copy */
|
||||
cpy32(s, k);
|
||||
else /* sign is -1, so negate */
|
||||
mula_small(s, ORDER_TIMES_8, 0, k, 32, -1);
|
||||
|
||||
/* reduce s mod q
|
||||
* (is this needed? do it just in case, it's fast anyway) */
|
||||
//divmod((dstptr) t1, s, 32, order25519, 32);
|
||||
|
||||
/* take reciprocal of s mod q */
|
||||
byte[] temp1=new byte[32];
|
||||
byte[] temp2=new byte[64];
|
||||
byte[] temp3=new byte[64];
|
||||
cpy32(temp1, ORDER);
|
||||
cpy32(s, egcd32(temp2, temp3, s, temp1));
|
||||
if ((s[31] & 0x80)!=0)
|
||||
mula_small(s, s, 0, ORDER, 32, 1);
|
||||
}
|
||||
}
|
||||
|
||||
/* smallest multiple of the order that's >= 2^255 */
|
||||
private static final byte[] ORDER_TIMES_8 = {
|
||||
(byte)104, (byte)159, (byte)174, (byte)231,
|
||||
(byte)210, (byte)24, (byte)147, (byte)192,
|
||||
(byte)178, (byte)230, (byte)188, (byte)23,
|
||||
(byte)245, (byte)206, (byte)247, (byte)166,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
||||
(byte)0, (byte)0, (byte)0, (byte)128
|
||||
};
|
||||
|
||||
/* constants 2Gy and 1/(2Gy) */
|
||||
private static final long10 BASE_2Y = new long10(
|
||||
39999547, 18689728, 59995525, 1648697, 57546132,
|
||||
24010086, 19059592, 5425144, 63499247, 16420658
|
||||
);
|
||||
private static final long10 BASE_R2Y = new long10(
|
||||
5744, 8160848, 4790893, 13779497, 35730846,
|
||||
12541209, 49101323, 30047407, 40071253, 6226132
|
||||
);
|
||||
}
|
||||
@@ -136,7 +136,7 @@ public class Promise<V, T extends Throwable> {
|
||||
throws T {
|
||||
final V value = tryRetrieve(timeout, unit);
|
||||
if (value == null)
|
||||
throw chainer.chain(new TimeoutException("Timeout expired"));
|
||||
throw chainer.chain(new TimeoutException("Timeout expired: " + timeout + " " + unit));
|
||||
else
|
||||
return value;
|
||||
}
|
||||
@@ -176,6 +176,7 @@ public class Promise<V, T extends Throwable> {
|
||||
}
|
||||
return val;
|
||||
} catch (InterruptedException ie) {
|
||||
Thread.currentThread().interrupt();
|
||||
throw chainer.chain(ie);
|
||||
} finally {
|
||||
lock.unlock();
|
||||
|
||||
@@ -24,7 +24,7 @@ final class Heartbeater
|
||||
extends KeepAlive {
|
||||
|
||||
Heartbeater(ConnectionImpl conn) {
|
||||
super(conn, "heartbeater");
|
||||
super(conn, "sshj-Heartbeater");
|
||||
}
|
||||
|
||||
@Override
|
||||
|
||||
@@ -20,6 +20,8 @@ import net.schmizz.sshj.connection.ConnectionImpl;
|
||||
import net.schmizz.sshj.transport.TransportException;
|
||||
import org.slf4j.Logger;
|
||||
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
public abstract class KeepAlive extends Thread {
|
||||
protected final Logger log;
|
||||
protected final ConnectionImpl conn;
|
||||
@@ -33,40 +35,49 @@ public abstract class KeepAlive extends Thread {
|
||||
setDaemon(true);
|
||||
}
|
||||
|
||||
/**
|
||||
* KeepAlive enabled based on KeepAlive interval
|
||||
*
|
||||
* @return Enabled when KeepInterval is greater than 0
|
||||
*/
|
||||
public boolean isEnabled() {
|
||||
return keepAliveInterval > 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get KeepAlive interval in seconds
|
||||
*
|
||||
* @return KeepAlive interval in seconds defaults to 0
|
||||
*/
|
||||
public synchronized int getKeepAliveInterval() {
|
||||
return keepAliveInterval;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set KeepAlive interval in seconds
|
||||
*
|
||||
* @param keepAliveInterval KeepAlive interval in seconds
|
||||
*/
|
||||
public synchronized void setKeepAliveInterval(int keepAliveInterval) {
|
||||
this.keepAliveInterval = keepAliveInterval;
|
||||
if (keepAliveInterval > 0 && getState() == State.NEW) {
|
||||
start();
|
||||
}
|
||||
notify();
|
||||
}
|
||||
|
||||
synchronized protected int getPositiveInterval()
|
||||
throws InterruptedException {
|
||||
while (keepAliveInterval <= 0) {
|
||||
wait();
|
||||
}
|
||||
return keepAliveInterval;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void run() {
|
||||
log.debug("Starting {}, sending keep-alive every {} seconds", getClass().getSimpleName(), keepAliveInterval);
|
||||
log.debug("{} Started with interval [{} seconds]", getClass().getSimpleName(), keepAliveInterval);
|
||||
try {
|
||||
while (!isInterrupted()) {
|
||||
final int hi = getPositiveInterval();
|
||||
final int interval = getKeepAliveInterval();
|
||||
if (conn.getTransport().isRunning()) {
|
||||
log.debug("Sending keep-alive since {} seconds elapsed", hi);
|
||||
log.debug("{} Sending after interval [{} seconds]", getClass().getSimpleName(), interval);
|
||||
doKeepAlive();
|
||||
}
|
||||
Thread.sleep(hi * 1000);
|
||||
TimeUnit.SECONDS.sleep(interval);
|
||||
}
|
||||
} catch (InterruptedException e) {
|
||||
// Interrupt signal may be catched when sleeping.
|
||||
// this is almost certainly a planned interruption, but even so, no harm in setting the interrupt flag
|
||||
Thread.currentThread().interrupt();
|
||||
log.trace("{} Interrupted while sleeping", getClass().getSimpleName());
|
||||
} catch (Exception e) {
|
||||
// If we weren't interrupted, kill the transport, then this exception was unexpected.
|
||||
// Else we're in shutdown-mode already, so don't forcibly kill the transport.
|
||||
@@ -74,9 +85,7 @@ public abstract class KeepAlive extends Thread {
|
||||
conn.getTransport().die(e);
|
||||
}
|
||||
}
|
||||
|
||||
log.debug("Stopping {}", getClass().getSimpleName());
|
||||
|
||||
log.debug("{} Stopped", getClass().getSimpleName());
|
||||
}
|
||||
|
||||
protected abstract void doKeepAlive() throws TransportException, ConnectionException;
|
||||
|
||||
@@ -37,7 +37,7 @@ public class KeepAliveRunner extends KeepAlive {
|
||||
new LinkedList<Promise<SSHPacket, ConnectionException>>();
|
||||
|
||||
KeepAliveRunner(ConnectionImpl conn) {
|
||||
super(conn, "keep-alive");
|
||||
super(conn, "sshj-KeepAliveRunner");
|
||||
}
|
||||
|
||||
synchronized public int getMaxAliveCount() {
|
||||
|
||||
@@ -19,8 +19,6 @@ import com.hierynomus.sshj.key.KeyAlgorithm;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
import net.schmizz.sshj.transport.random.JCERandom;
|
||||
import net.schmizz.sshj.transport.random.SingletonRandomFactory;
|
||||
|
||||
import java.util.Arrays;
|
||||
|
||||
@@ -34,7 +32,6 @@ public class AndroidConfig
|
||||
SecurityUtils.registerSecurityProvider("org.spongycastle.jce.provider.BouncyCastleProvider");
|
||||
}
|
||||
|
||||
|
||||
@Override
|
||||
protected void initKeyAlgorithms() {
|
||||
setKeyAlgorithms(Arrays.<Factory.Named<KeyAlgorithm>>asList(
|
||||
@@ -43,10 +40,4 @@ public class AndroidConfig
|
||||
KeyAlgorithms.SSHDSA()
|
||||
));
|
||||
}
|
||||
|
||||
@Override
|
||||
protected void initRandomFactory(boolean ignored) {
|
||||
setRandomFactory(new SingletonRandomFactory(new JCERandom.Factory()));
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -200,4 +200,8 @@ public interface Config {
|
||||
* See {@link #isVerifyHostKeyCertificates()}.
|
||||
*/
|
||||
void setVerifyHostKeyCertificates(boolean value);
|
||||
|
||||
int getMaxCircularBufferSize();
|
||||
|
||||
void setMaxCircularBufferSize(int maxCircularBufferSize);
|
||||
}
|
||||
|
||||
@@ -26,6 +26,7 @@ import net.schmizz.sshj.transport.mac.MAC;
|
||||
import net.schmizz.sshj.transport.random.Random;
|
||||
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
import java.util.List;
|
||||
|
||||
@@ -48,6 +49,8 @@ public class ConfigImpl
|
||||
private boolean waitForServerIdentBeforeSendingClientIdent = false;
|
||||
private LoggerFactory loggerFactory;
|
||||
private boolean verifyHostKeyCertificates = true;
|
||||
// HF-982: default to 16MB buffers.
|
||||
private int maxCircularBufferSize = 16 * 1024 * 1024;
|
||||
|
||||
@Override
|
||||
public List<Factory.Named<Cipher>> getCipherFactories() {
|
||||
@@ -174,6 +177,16 @@ public class ConfigImpl
|
||||
return loggerFactory;
|
||||
}
|
||||
|
||||
@Override
|
||||
public int getMaxCircularBufferSize() {
|
||||
return maxCircularBufferSize;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void setMaxCircularBufferSize(int maxCircularBufferSize) {
|
||||
this.maxCircularBufferSize = maxCircularBufferSize;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void setLoggerFactory(LoggerFactory loggerFactory) {
|
||||
this.loggerFactory = loggerFactory;
|
||||
@@ -188,4 +201,30 @@ public class ConfigImpl
|
||||
public void setVerifyHostKeyCertificates(boolean value) {
|
||||
verifyHostKeyCertificates = value;
|
||||
}
|
||||
|
||||
/**
|
||||
* Modern servers neglect the key algorithm ssh-rsa. OpenSSH 8.8 even dropped its support by default in favour
|
||||
* of rsa-sha2-*. However, there are legacy servers like Apache SSHD that don't support the newer replacements
|
||||
* for ssh-rsa.
|
||||
*
|
||||
* If ssh-rsa factory is in {@link #getKeyAlgorithms()}, this methods makes ssh-rsa key algorithm more preferred
|
||||
* than any of rsa-sha2-*. Otherwise, nothing happens.
|
||||
*/
|
||||
public void prioritizeSshRsaKeyAlgorithm() {
|
||||
List<Factory.Named<KeyAlgorithm>> keyAlgorithms = getKeyAlgorithms();
|
||||
for (int sshRsaIndex = 0; sshRsaIndex < keyAlgorithms.size(); ++ sshRsaIndex) {
|
||||
if ("ssh-rsa".equals(keyAlgorithms.get(sshRsaIndex).getName())) {
|
||||
for (int i = 0; i < sshRsaIndex; ++i) {
|
||||
final String algo = keyAlgorithms.get(i).getName();
|
||||
if ("rsa-sha2-256".equals(algo) || "rsa-sha2-512".equals(algo)) {
|
||||
keyAlgorithms = new ArrayList<>(keyAlgorithms);
|
||||
keyAlgorithms.add(i, keyAlgorithms.remove(sshRsaIndex));
|
||||
setKeyAlgorithms(keyAlgorithms);
|
||||
break;
|
||||
}
|
||||
}
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -29,23 +29,24 @@ import com.hierynomus.sshj.userauth.keyprovider.OpenSSHKeyV1KeyFile;
|
||||
import net.schmizz.keepalive.KeepAliveProvider;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
import net.schmizz.sshj.common.LoggerFactory;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
import net.schmizz.sshj.transport.cipher.Cipher;
|
||||
import net.schmizz.sshj.transport.compression.NoneCompression;
|
||||
import net.schmizz.sshj.transport.kex.Curve25519SHA256;
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA1;
|
||||
import net.schmizz.sshj.transport.kex.DHGexSHA256;
|
||||
import net.schmizz.sshj.transport.kex.ECDHNistP;
|
||||
import net.schmizz.sshj.transport.random.BouncyCastleRandom;
|
||||
import net.schmizz.sshj.transport.random.JCERandom;
|
||||
import net.schmizz.sshj.transport.random.SingletonRandomFactory;
|
||||
import net.schmizz.sshj.userauth.keyprovider.OpenSSHKeyFile;
|
||||
import net.schmizz.sshj.userauth.keyprovider.PKCS5KeyFile;
|
||||
import net.schmizz.sshj.userauth.keyprovider.PKCS8KeyFile;
|
||||
import net.schmizz.sshj.userauth.keyprovider.PuTTYKeyFile;
|
||||
import org.slf4j.Logger;
|
||||
|
||||
import java.util.*;
|
||||
import java.util.Arrays;
|
||||
import java.util.List;
|
||||
import java.util.LinkedList;
|
||||
import java.util.ListIterator;
|
||||
import java.util.Properties;
|
||||
|
||||
/**
|
||||
* A {@link net.schmizz.sshj.Config} that is initialized as follows. Items marked with an asterisk are added to the config only if
|
||||
@@ -64,8 +65,6 @@ import java.util.*;
|
||||
* <li>{@link net.schmizz.sshj.ConfigImpl#setVersion Client version}: {@code "NET_3_0"}</li>
|
||||
* </ul>
|
||||
* <p/>
|
||||
* [1] It is worth noting that Sun's JRE does not have the unlimited cryptography extension enabled by default. This
|
||||
* prevents using ciphers with strength greater than 128.
|
||||
*/
|
||||
public class DefaultConfig
|
||||
extends ConfigImpl {
|
||||
@@ -75,11 +74,10 @@ public class DefaultConfig
|
||||
public DefaultConfig() {
|
||||
setLoggerFactory(LoggerFactory.DEFAULT);
|
||||
setVersion(readVersionFromProperties());
|
||||
final boolean bouncyCastleRegistered = SecurityUtils.isBouncyCastleRegistered();
|
||||
initKeyExchangeFactories(bouncyCastleRegistered);
|
||||
initKeyExchangeFactories();
|
||||
initKeyAlgorithms();
|
||||
initRandomFactory(bouncyCastleRegistered);
|
||||
initFileKeyProviderFactories(bouncyCastleRegistered);
|
||||
initRandomFactory();
|
||||
initFileKeyProviderFactories();
|
||||
initCipherFactories();
|
||||
initCompressionFactories();
|
||||
initMACFactories();
|
||||
@@ -104,35 +102,32 @@ public class DefaultConfig
|
||||
log = loggerFactory.getLogger(getClass());
|
||||
}
|
||||
|
||||
protected void initKeyExchangeFactories(boolean bouncyCastleRegistered) {
|
||||
if (bouncyCastleRegistered) {
|
||||
setKeyExchangeFactories(
|
||||
new Curve25519SHA256.Factory(),
|
||||
new Curve25519SHA256.FactoryLibSsh(),
|
||||
new DHGexSHA256.Factory(),
|
||||
new ECDHNistP.Factory521(),
|
||||
new ECDHNistP.Factory384(),
|
||||
new ECDHNistP.Factory256(),
|
||||
new DHGexSHA1.Factory(),
|
||||
DHGroups.Group1SHA1(),
|
||||
DHGroups.Group14SHA1(),
|
||||
DHGroups.Group14SHA256(),
|
||||
DHGroups.Group15SHA512(),
|
||||
DHGroups.Group16SHA512(),
|
||||
DHGroups.Group17SHA512(),
|
||||
DHGroups.Group18SHA512(),
|
||||
ExtendedDHGroups.Group14SHA256AtSSH(),
|
||||
ExtendedDHGroups.Group15SHA256(),
|
||||
ExtendedDHGroups.Group15SHA256AtSSH(),
|
||||
ExtendedDHGroups.Group15SHA384AtSSH(),
|
||||
ExtendedDHGroups.Group16SHA256(),
|
||||
ExtendedDHGroups.Group16SHA384AtSSH(),
|
||||
ExtendedDHGroups.Group16SHA512AtSSH(),
|
||||
ExtendedDHGroups.Group18SHA512AtSSH(),
|
||||
new ExtInfoClientFactory());
|
||||
} else {
|
||||
setKeyExchangeFactories(DHGroups.Group1SHA1(), new DHGexSHA1.Factory());
|
||||
}
|
||||
protected void initKeyExchangeFactories() {
|
||||
setKeyExchangeFactories(
|
||||
new Curve25519SHA256.Factory(),
|
||||
new Curve25519SHA256.FactoryLibSsh(),
|
||||
new DHGexSHA256.Factory(),
|
||||
new ECDHNistP.Factory521(),
|
||||
new ECDHNistP.Factory384(),
|
||||
new ECDHNistP.Factory256(),
|
||||
new DHGexSHA1.Factory(),
|
||||
DHGroups.Group1SHA1(),
|
||||
DHGroups.Group14SHA1(),
|
||||
DHGroups.Group14SHA256(),
|
||||
DHGroups.Group15SHA512(),
|
||||
DHGroups.Group16SHA512(),
|
||||
DHGroups.Group17SHA512(),
|
||||
DHGroups.Group18SHA512(),
|
||||
ExtendedDHGroups.Group14SHA256AtSSH(),
|
||||
ExtendedDHGroups.Group15SHA256(),
|
||||
ExtendedDHGroups.Group15SHA256AtSSH(),
|
||||
ExtendedDHGroups.Group15SHA384AtSSH(),
|
||||
ExtendedDHGroups.Group16SHA256(),
|
||||
ExtendedDHGroups.Group16SHA384AtSSH(),
|
||||
ExtendedDHGroups.Group16SHA512AtSSH(),
|
||||
ExtendedDHGroups.Group18SHA512AtSSH(),
|
||||
new ExtInfoClientFactory()
|
||||
);
|
||||
}
|
||||
|
||||
protected void initKeyAlgorithms() {
|
||||
@@ -153,22 +148,19 @@ public class DefaultConfig
|
||||
KeyAlgorithms.SSHDSA()));
|
||||
}
|
||||
|
||||
protected void initRandomFactory(boolean bouncyCastleRegistered) {
|
||||
protected void initRandomFactory() {
|
||||
setRandomFactory(new SingletonRandomFactory(new JCERandom.Factory()));
|
||||
}
|
||||
|
||||
protected void initFileKeyProviderFactories(boolean bouncyCastleRegistered) {
|
||||
if (bouncyCastleRegistered) {
|
||||
setFileKeyProviderFactories(
|
||||
new OpenSSHKeyV1KeyFile.Factory(),
|
||||
new PKCS8KeyFile.Factory(),
|
||||
new PKCS5KeyFile.Factory(),
|
||||
new OpenSSHKeyFile.Factory(),
|
||||
new PuTTYKeyFile.Factory());
|
||||
}
|
||||
protected void initFileKeyProviderFactories() {
|
||||
setFileKeyProviderFactories(
|
||||
new OpenSSHKeyV1KeyFile.Factory(),
|
||||
new PKCS8KeyFile.Factory(),
|
||||
new OpenSSHKeyFile.Factory(),
|
||||
new PuTTYKeyFile.Factory()
|
||||
);
|
||||
}
|
||||
|
||||
|
||||
protected void initCipherFactories() {
|
||||
List<Factory.Named<Cipher>> avail = new LinkedList<Factory.Named<Cipher>>(Arrays.<Factory.Named<Cipher>>asList(
|
||||
ChachaPolyCiphers.CHACHA_POLY_OPENSSH(),
|
||||
@@ -206,27 +198,22 @@ public class DefaultConfig
|
||||
StreamCiphers.Arcfour256())
|
||||
);
|
||||
|
||||
boolean warn = false;
|
||||
// Ref. https://issues.apache.org/jira/browse/SSHD-24
|
||||
// "AES256 and AES192 requires unlimited cryptography extension"
|
||||
for (Iterator<Factory.Named<Cipher>> i = avail.iterator(); i.hasNext(); ) {
|
||||
final Factory.Named<Cipher> f = i.next();
|
||||
final ListIterator<Factory.Named<Cipher>> factories = avail.listIterator();
|
||||
while (factories.hasNext()) {
|
||||
final Factory.Named<Cipher> factory = factories.next();
|
||||
try {
|
||||
final Cipher c = f.create();
|
||||
final byte[] key = new byte[c.getBlockSize()];
|
||||
final byte[] iv = new byte[c.getIVSize()];
|
||||
c.init(Cipher.Mode.Encrypt, key, iv);
|
||||
final Cipher cipher = factory.create();
|
||||
final byte[] key = new byte[cipher.getBlockSize()];
|
||||
final byte[] iv = new byte[cipher.getIVSize()];
|
||||
cipher.init(Cipher.Mode.Encrypt, key, iv);
|
||||
} catch (Exception e) {
|
||||
warn = true;
|
||||
log.warn(e.getCause().getMessage());
|
||||
i.remove();
|
||||
log.info("Cipher [{}] disabled: {}", factory.getName(), e.getCause().getMessage());
|
||||
factories.remove();
|
||||
}
|
||||
}
|
||||
if (warn)
|
||||
log.warn("Disabling high-strength ciphers: cipher strengths apparently limited by JCE policy");
|
||||
|
||||
setCipherFactories(avail);
|
||||
log.debug("Available cipher factories: {}", avail);
|
||||
log.debug("Available Ciphers {}", avail);
|
||||
}
|
||||
|
||||
protected void initMACFactories() {
|
||||
|
||||
@@ -13,22 +13,16 @@
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package com.hierynomus.sshj.signature
|
||||
package net.schmizz.sshj;
|
||||
|
||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
||||
import net.schmizz.sshj.DefaultConfig
|
||||
import spock.lang.Unroll
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
|
||||
class RsaSignatureClientKeySpec extends IntegrationBaseSpec {
|
||||
@Unroll
|
||||
def "should correctly connect using publickey auth with RSA key with signature"() {
|
||||
given:
|
||||
def client = getConnectedClient(new DefaultConfig())
|
||||
|
||||
when:
|
||||
client.authPublickey(USERNAME, "src/itest/resources/keyfiles/id_rsa2")
|
||||
|
||||
then:
|
||||
client.authenticated
|
||||
/**
|
||||
* SSHJ Configuration that uses the default Security Provider configuration from java.security and disables Bouncy Castle registration
|
||||
*/
|
||||
public class DefaultSecurityProviderConfig extends DefaultConfig {
|
||||
static {
|
||||
// Disable Bouncy Castle Provider registration prior to invoking constructors
|
||||
SecurityUtils.setRegisterBouncyCastle(false);
|
||||
}
|
||||
}
|
||||
@@ -15,6 +15,8 @@
|
||||
*/
|
||||
package net.schmizz.sshj;
|
||||
|
||||
import net.schmizz.keepalive.KeepAlive;
|
||||
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||
import net.schmizz.sshj.common.*;
|
||||
import net.schmizz.sshj.connection.Connection;
|
||||
import net.schmizz.sshj.connection.ConnectionException;
|
||||
@@ -26,7 +28,6 @@ import net.schmizz.sshj.connection.channel.forwarded.RemotePortForwarder.Forward
|
||||
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder;
|
||||
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder.X11Channel;
|
||||
import net.schmizz.sshj.sftp.SFTPClient;
|
||||
import net.schmizz.sshj.sftp.SFTPEngine;
|
||||
import net.schmizz.sshj.sftp.StatefulSFTPClient;
|
||||
import net.schmizz.sshj.transport.Transport;
|
||||
import net.schmizz.sshj.transport.TransportException;
|
||||
@@ -55,6 +56,7 @@ import javax.security.auth.login.LoginContext;
|
||||
import java.io.Closeable;
|
||||
import java.io.File;
|
||||
import java.io.IOException;
|
||||
import java.net.InetSocketAddress;
|
||||
import java.net.ServerSocket;
|
||||
import java.nio.charset.Charset;
|
||||
import java.security.KeyPair;
|
||||
@@ -424,6 +426,7 @@ public class SSHClient
|
||||
@Override
|
||||
public void disconnect()
|
||||
throws IOException {
|
||||
conn.getKeepAlive().interrupt();
|
||||
for (LocalPortForwarder forwarder : forwarders) {
|
||||
try {
|
||||
forwarder.close();
|
||||
@@ -441,6 +444,16 @@ public class SSHClient
|
||||
return conn;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get Remote Socket Address from Transport
|
||||
*
|
||||
* @return Remote Socket Address or null when not connected
|
||||
*/
|
||||
@Override
|
||||
public InetSocketAddress getRemoteSocketAddress() {
|
||||
return trans.getRemoteSocketAddress();
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the character set used to communicate with the remote machine for certain strings (like paths).
|
||||
*
|
||||
@@ -537,7 +550,7 @@ public class SSHClient
|
||||
* Creates a {@link KeyProvider} instance from given location on the file system. Currently the following private key files are supported:
|
||||
* <ul>
|
||||
* <li>PKCS8 (OpenSSH uses this format)</li>
|
||||
* <li>PKCS5</li>
|
||||
* <li>PEM-encoded PKCS1</li>
|
||||
* <li>Putty keyfile</li>
|
||||
* <li>openssh-key-v1 (New OpenSSH keyfile format)</li>
|
||||
* </ul>
|
||||
@@ -719,7 +732,7 @@ public class SSHClient
|
||||
throws IOException {
|
||||
checkConnected();
|
||||
checkAuthenticated();
|
||||
return new SFTPClient(new SFTPEngine(this).init());
|
||||
return new SFTPClient(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -728,11 +741,11 @@ public class SSHClient
|
||||
*
|
||||
* @throws IOException if there is an error starting the {@code sftp} subsystem
|
||||
*/
|
||||
public SFTPClient newStatefulSFTPClient()
|
||||
public StatefulSFTPClient newStatefulSFTPClient()
|
||||
throws IOException {
|
||||
checkConnected();
|
||||
checkAuthenticated();
|
||||
return new StatefulSFTPClient(new SFTPEngine(this).init());
|
||||
return new StatefulSFTPClient(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -791,6 +804,11 @@ public class SSHClient
|
||||
throws IOException {
|
||||
super.onConnect();
|
||||
trans.init(getRemoteHostname(), getRemotePort(), getInputStream(), getOutputStream());
|
||||
final KeepAlive keepAliveThread = conn.getKeepAlive();
|
||||
if (keepAliveThread.isEnabled()) {
|
||||
ThreadNameProvider.setThreadName(conn.getKeepAlive(), trans);
|
||||
keepAliveThread.start();
|
||||
}
|
||||
doKex();
|
||||
}
|
||||
|
||||
|
||||
@@ -15,8 +15,6 @@
|
||||
*/
|
||||
package net.schmizz.sshj;
|
||||
|
||||
import com.hierynomus.sshj.backport.JavaVersion;
|
||||
import com.hierynomus.sshj.backport.Jdk7HttpProxySocket;
|
||||
import net.schmizz.sshj.connection.channel.Channel;
|
||||
import net.schmizz.sshj.connection.channel.direct.DirectConnection;
|
||||
|
||||
@@ -26,7 +24,6 @@ import java.io.InputStream;
|
||||
import java.io.OutputStream;
|
||||
import java.net.InetAddress;
|
||||
import java.net.InetSocketAddress;
|
||||
import java.net.Proxy;
|
||||
import java.net.Socket;
|
||||
|
||||
public abstract class SocketClient {
|
||||
@@ -57,73 +54,6 @@ public abstract class SocketClient {
|
||||
return new InetSocketAddress(hostname, port);
|
||||
}
|
||||
|
||||
/**
|
||||
* Connect to a host via a proxy.
|
||||
* @param hostname The host name to connect to.
|
||||
* @param proxy The proxy to connect via.
|
||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
||||
*/
|
||||
@Deprecated
|
||||
public void connect(String hostname, Proxy proxy) throws IOException {
|
||||
connect(hostname, defaultPort, proxy);
|
||||
}
|
||||
|
||||
/**
|
||||
* Connect to a host via a proxy.
|
||||
* @param hostname The host name to connect to.
|
||||
* @param port The port to connect to.
|
||||
* @param proxy The proxy to connect via.
|
||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
||||
*/
|
||||
@Deprecated
|
||||
public void connect(String hostname, int port, Proxy proxy) throws IOException {
|
||||
this.hostname = hostname;
|
||||
this.port = port;
|
||||
if (JavaVersion.isJava7OrEarlier() && proxy.type() == Proxy.Type.HTTP) {
|
||||
// Java7 and earlier have no support for HTTP Connect proxies, return our custom socket.
|
||||
socket = new Jdk7HttpProxySocket(proxy);
|
||||
} else {
|
||||
socket = new Socket(proxy);
|
||||
}
|
||||
socket.connect(makeInetSocketAddress(hostname, port), connectTimeout);
|
||||
onConnect();
|
||||
}
|
||||
|
||||
/**
|
||||
* Connect to a host via a proxy.
|
||||
* @param host The host address to connect to.
|
||||
* @param proxy The proxy to connect via.
|
||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
||||
*/
|
||||
@Deprecated
|
||||
public void connect(InetAddress host, Proxy proxy) throws IOException {
|
||||
connect(host, defaultPort, proxy);
|
||||
}
|
||||
|
||||
/**
|
||||
* Connect to a host via a proxy.
|
||||
* @param host The host address to connect to.
|
||||
* @param port The port to connect to.
|
||||
* @param proxy The proxy to connect via.
|
||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
||||
*/
|
||||
@Deprecated
|
||||
public void connect(InetAddress host, int port, Proxy proxy) throws IOException {
|
||||
this.port = port;
|
||||
if (JavaVersion.isJava7OrEarlier() && proxy.type() == Proxy.Type.HTTP) {
|
||||
// Java7 and earlier have no support for HTTP Connect proxies, return our custom socket.
|
||||
socket = new Jdk7HttpProxySocket(proxy);
|
||||
} else {
|
||||
socket = new Socket(proxy);
|
||||
}
|
||||
socket.connect(new InetSocketAddress(host, port), connectTimeout);
|
||||
onConnect();
|
||||
}
|
||||
|
||||
public void connect(String hostname) throws IOException {
|
||||
connect(hostname, defaultPort);
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
194
src/main/java/net/schmizz/sshj/common/CircularBuffer.java
Normal file
194
src/main/java/net/schmizz/sshj/common/CircularBuffer.java
Normal file
@@ -0,0 +1,194 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package net.schmizz.sshj.common;
|
||||
|
||||
public class CircularBuffer<T extends CircularBuffer<T>> {
|
||||
|
||||
public static class CircularBufferException
|
||||
extends SSHException {
|
||||
|
||||
public CircularBufferException(String message) {
|
||||
super(message);
|
||||
}
|
||||
}
|
||||
|
||||
public static final class PlainCircularBuffer
|
||||
extends CircularBuffer<PlainCircularBuffer> {
|
||||
|
||||
public PlainCircularBuffer(int size, int maxSize) {
|
||||
super(size, maxSize);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Maximum size of the internal array (one plus the maximum capacity of the buffer).
|
||||
*/
|
||||
private final int maxSize;
|
||||
/**
|
||||
* Internal array for the data. All bytes minus one can be used to avoid empty vs full ambiguity when rpos == wpos.
|
||||
*/
|
||||
private byte[] data;
|
||||
/**
|
||||
* Next read position. Wraps around the end of the internal array. When it reaches wpos, the buffer becomes empty.
|
||||
* Can take the value data.length, which is equivalent to 0.
|
||||
*/
|
||||
private int rpos;
|
||||
/**
|
||||
* Next write position. Wraps around the end of the internal array. If it is equal to rpos, then the buffer is
|
||||
* empty; the code does not allow wpos to reach rpos from the left. This implies that the buffer can store up to
|
||||
* data.length - 1 bytes. Can take the value data.length, which is equivalent to 0.
|
||||
*/
|
||||
private int wpos;
|
||||
|
||||
/**
|
||||
* Determines the size to which to grow the internal array.
|
||||
*/
|
||||
private int getNextSize(int currentSize) {
|
||||
// Use next power of 2.
|
||||
int nextSize = 1;
|
||||
while (nextSize < currentSize) {
|
||||
nextSize <<= 1;
|
||||
if (nextSize <= 0) {
|
||||
return maxSize;
|
||||
}
|
||||
}
|
||||
return Math.min(nextSize, maxSize); // limit to max size
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a new circular buffer of the given size. The capacity of the buffer is one less than the size/
|
||||
*/
|
||||
public CircularBuffer(int size, int maxSize) {
|
||||
this.maxSize = maxSize;
|
||||
if (size > maxSize) {
|
||||
throw new IllegalArgumentException(
|
||||
String.format("Initial requested size %d larger than maximum size %d", size, maxSize));
|
||||
}
|
||||
int initialSize = getNextSize(size);
|
||||
this.data = new byte[initialSize];
|
||||
this.rpos = 0;
|
||||
this.wpos = 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Data available in the buffer for reading.
|
||||
*/
|
||||
public int available() {
|
||||
int available = wpos - rpos;
|
||||
return available >= 0 ? available : available + data.length; // adjust if wpos is left of rpos
|
||||
}
|
||||
|
||||
private void ensureAvailable(int a)
|
||||
throws CircularBufferException {
|
||||
if (available() < a) {
|
||||
throw new CircularBufferException("Underflow");
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns how many more bytes this buffer can receive.
|
||||
*/
|
||||
public int maxPossibleRemainingCapacity() {
|
||||
// Remaining capacity is one less than remaining space to ensure that wpos does not reach rpos from the left.
|
||||
int remaining = rpos - wpos - 1;
|
||||
if (remaining < 0) {
|
||||
remaining += data.length; // adjust if rpos is left of wpos
|
||||
}
|
||||
// Add the maximum amount the internal array can grow.
|
||||
return remaining + maxSize - data.length;
|
||||
}
|
||||
|
||||
/**
|
||||
* If the internal array does not have room for "capacity" more bytes, resizes the array to make that room.
|
||||
*/
|
||||
void ensureCapacity(int capacity) throws CircularBufferException {
|
||||
int available = available();
|
||||
int remaining = data.length - available;
|
||||
// If capacity fits exactly in the remaining space, expand it; otherwise, wpos would reach rpos from the left.
|
||||
if (remaining <= capacity) {
|
||||
int neededSize = available + capacity + 1;
|
||||
int nextSize = getNextSize(neededSize);
|
||||
if (nextSize < neededSize) {
|
||||
throw new CircularBufferException("Attempted overflow");
|
||||
}
|
||||
byte[] tmp = new byte[nextSize];
|
||||
// Copy data to the beginning of the new array.
|
||||
if (wpos >= rpos) {
|
||||
System.arraycopy(data, rpos, tmp, 0, available);
|
||||
wpos -= rpos; // wpos must be relative to the new rpos, which will be 0
|
||||
} else {
|
||||
int tail = data.length - rpos;
|
||||
System.arraycopy(data, rpos, tmp, 0, tail); // segment right of rpos
|
||||
System.arraycopy(data, 0, tmp, tail, wpos); // segment left of wpos
|
||||
wpos += tail; // wpos must be relative to the new rpos, which will be 0
|
||||
}
|
||||
rpos = 0;
|
||||
data = tmp;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Reads data from this buffer into the provided array.
|
||||
*/
|
||||
public void readRawBytes(byte[] destination, int offset, int length) throws CircularBufferException {
|
||||
ensureAvailable(length);
|
||||
|
||||
int rposNext = rpos + length;
|
||||
if (rposNext <= data.length) {
|
||||
System.arraycopy(data, rpos, destination, offset, length);
|
||||
} else {
|
||||
int tail = data.length - rpos;
|
||||
System.arraycopy(data, rpos, destination, offset, tail); // segment right of rpos
|
||||
rposNext = length - tail; // rpos wraps around the end of the buffer
|
||||
System.arraycopy(data, 0, destination, offset + tail, rposNext); // remainder
|
||||
}
|
||||
// This can make rpos equal data.length, which has the same effect as wpos being 0.
|
||||
rpos = rposNext;
|
||||
}
|
||||
|
||||
/**
|
||||
* Writes data to this buffer from the provided array.
|
||||
*/
|
||||
@SuppressWarnings("unchecked")
|
||||
public T putRawBytes(byte[] source, int offset, int length) throws CircularBufferException {
|
||||
ensureCapacity(length);
|
||||
|
||||
int wposNext = wpos + length;
|
||||
if (wposNext <= data.length) {
|
||||
System.arraycopy(source, offset, data, wpos, length);
|
||||
} else {
|
||||
int tail = data.length - wpos;
|
||||
System.arraycopy(source, offset, data, wpos, tail); // segment right of wpos
|
||||
wposNext = length - tail; // wpos wraps around the end of the buffer
|
||||
System.arraycopy(source, offset + tail, data, 0, wposNext); // remainder
|
||||
}
|
||||
// This can make wpos equal data.length, which has the same effect as wpos being 0.
|
||||
wpos = wposNext;
|
||||
|
||||
return (T) this;
|
||||
}
|
||||
|
||||
// Used only for testing.
|
||||
int length() {
|
||||
return data.length;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return "CircularBuffer [rpos=" + rpos + ", wpos=" + wpos + ", size=" + data.length + "]";
|
||||
}
|
||||
|
||||
}
|
||||
@@ -57,9 +57,6 @@ class ECDSAVariationsAdapter {
|
||||
|
||||
static PublicKey readPubKeyFromBuffer(Buffer<?> buf, String variation) throws GeneralSecurityException {
|
||||
String algorithm = BASE_ALGORITHM_NAME + variation;
|
||||
if (!SecurityUtils.isBouncyCastleRegistered()) {
|
||||
throw new GeneralSecurityException("BouncyCastle is required to read a key of type " + algorithm);
|
||||
}
|
||||
try {
|
||||
// final String algo = buf.readString(); it has been already read
|
||||
final String curveName = buf.readString();
|
||||
|
||||
@@ -259,6 +259,11 @@ public class SecurityUtils {
|
||||
return false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Configure whether to register the Bouncy Castle Security Provider. Must be called prior to other methods
|
||||
*
|
||||
* @param registerBouncyCastle Enable or disable Bouncy Castle Provider registration on subsequent method invocation
|
||||
*/
|
||||
public static synchronized void setRegisterBouncyCastle(boolean registerBouncyCastle) {
|
||||
SecurityUtils.registerBouncyCastle = registerBouncyCastle;
|
||||
registrationDone = false;
|
||||
|
||||
@@ -145,8 +145,14 @@ public class StreamCopier {
|
||||
final double sizeKiB = count / 1024.0;
|
||||
log.debug(String.format("%1$,.1f KiB transferred in %2$,.1f seconds (%3$,.2f KiB/s)", sizeKiB, timeSeconds, (sizeKiB / timeSeconds)));
|
||||
|
||||
if (length != -1 && read == -1)
|
||||
throw new IOException("Encountered EOF, could not transfer " + length + " bytes");
|
||||
// Did we encounter EOF?
|
||||
if (read == -1) {
|
||||
// If InputStream was closed we should also close OutputStream
|
||||
out.close();
|
||||
|
||||
if (length != -1)
|
||||
throw new IOException("Encountered EOF, could not transfer " + length + " bytes");
|
||||
}
|
||||
|
||||
return count;
|
||||
}
|
||||
|
||||
@@ -164,8 +164,7 @@ public abstract class AbstractChannel
|
||||
}
|
||||
|
||||
@Override
|
||||
public void handle(Message msg, SSHPacket buf)
|
||||
throws ConnectionException, TransportException {
|
||||
public void handle(Message msg, SSHPacket buf) throws SSHException {
|
||||
switch (msg) {
|
||||
|
||||
case CHANNEL_DATA:
|
||||
@@ -304,6 +303,25 @@ public abstract class AbstractChannel
|
||||
}
|
||||
}
|
||||
|
||||
// Prevent CHANNEL_CLOSE to be sent between isOpen and a Transport.write call in the runnable, otherwise
|
||||
// a disconnect with a "packet referred to nonexistent channel" message can occur.
|
||||
//
|
||||
// This particularly happens when the transport.Reader thread passes an eof from the server to the
|
||||
// ChannelInputStream, the reading library-user thread returns, and closes the channel at the same time as the
|
||||
// transport.Reader thread receives the subsequent CHANNEL_CLOSE from the server.
|
||||
boolean whileOpen(TransportRunnable runnable) throws TransportException, ConnectionException {
|
||||
openCloseLock.lock();
|
||||
try {
|
||||
if (isOpen()) {
|
||||
runnable.run();
|
||||
return true;
|
||||
}
|
||||
} finally {
|
||||
openCloseLock.unlock();
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
private void gotChannelRequest(SSHPacket buf)
|
||||
throws ConnectionException, TransportException {
|
||||
final String reqType;
|
||||
@@ -335,7 +353,7 @@ public abstract class AbstractChannel
|
||||
}
|
||||
|
||||
protected void gotExtendedData(SSHPacket buf)
|
||||
throws ConnectionException, TransportException {
|
||||
throws SSHException {
|
||||
throw new ConnectionException(DisconnectReason.PROTOCOL_ERROR,
|
||||
"Extended data not supported on " + type + " channel");
|
||||
}
|
||||
@@ -356,7 +374,7 @@ public abstract class AbstractChannel
|
||||
}
|
||||
|
||||
protected void receiveInto(ChannelInputStream stream, SSHPacket buf)
|
||||
throws ConnectionException, TransportException {
|
||||
throws SSHException {
|
||||
final int len;
|
||||
try {
|
||||
len = buf.readUInt32AsInt();
|
||||
@@ -427,5 +445,8 @@ public abstract class AbstractChannel
|
||||
+ rwin + " >";
|
||||
}
|
||||
|
||||
public interface TransportRunnable {
|
||||
void run() throws TransportException, ConnectionException;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -38,7 +38,7 @@ public final class ChannelInputStream
|
||||
private final Channel chan;
|
||||
private final Transport trans;
|
||||
private final Window.Local win;
|
||||
private final Buffer.PlainBuffer buf;
|
||||
private final CircularBuffer.PlainCircularBuffer buf;
|
||||
private final byte[] b = new byte[1];
|
||||
|
||||
private boolean eof;
|
||||
@@ -46,10 +46,11 @@ public final class ChannelInputStream
|
||||
|
||||
public ChannelInputStream(Channel chan, Transport trans, Window.Local win) {
|
||||
this.chan = chan;
|
||||
log = chan.getLoggerFactory().getLogger(getClass());
|
||||
this.log = chan.getLoggerFactory().getLogger(getClass());
|
||||
this.trans = trans;
|
||||
this.win = win;
|
||||
buf = new Buffer.PlainBuffer(chan.getLocalMaxPacketSize());
|
||||
this.buf = new CircularBuffer.PlainCircularBuffer(
|
||||
chan.getLocalMaxPacketSize(), trans.getConfig().getMaxCircularBufferSize());
|
||||
}
|
||||
|
||||
@Override
|
||||
@@ -105,6 +106,7 @@ public final class ChannelInputStream
|
||||
try {
|
||||
buf.wait();
|
||||
} catch (InterruptedException e) {
|
||||
Thread.currentThread().interrupt();
|
||||
throw (IOException) new InterruptedIOException().initCause(e);
|
||||
}
|
||||
}
|
||||
@@ -112,48 +114,44 @@ public final class ChannelInputStream
|
||||
len = buf.available();
|
||||
}
|
||||
buf.readRawBytes(b, off, len);
|
||||
if (buf.rpos() > win.getMaxPacketSize() && buf.available() == 0) {
|
||||
buf.clear();
|
||||
}
|
||||
}
|
||||
|
||||
if (!chan.getAutoExpand()) {
|
||||
checkWindow();
|
||||
if (!chan.getAutoExpand()) {
|
||||
checkWindow();
|
||||
}
|
||||
}
|
||||
|
||||
return len;
|
||||
}
|
||||
|
||||
public void receive(byte[] data, int offset, int len)
|
||||
throws ConnectionException, TransportException {
|
||||
public void receive(byte[] data, int offset, int len) throws SSHException {
|
||||
if (eof) {
|
||||
throw new ConnectionException("Getting data on EOF'ed stream");
|
||||
}
|
||||
synchronized (buf) {
|
||||
buf.putRawBytes(data, offset, len);
|
||||
buf.notifyAll();
|
||||
}
|
||||
// Potential fix for #203 (window consumed below 0).
|
||||
// This seems to be a race condition if we receive more data, while we're already sending a SSH_MSG_CHANNEL_WINDOW_ADJUST
|
||||
// And the window has not expanded yet.
|
||||
synchronized (win) {
|
||||
// Potential fix for #203 (window consumed below 0).
|
||||
// This seems to be a race condition if we receive more data, while we're already sending a SSH_MSG_CHANNEL_WINDOW_ADJUST
|
||||
// And the window has not expanded yet.
|
||||
win.consume(len);
|
||||
}
|
||||
if (chan.getAutoExpand()) {
|
||||
checkWindow();
|
||||
if (chan.getAutoExpand()) {
|
||||
checkWindow();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private void checkWindow()
|
||||
throws TransportException {
|
||||
synchronized (win) {
|
||||
final long adjustment = win.neededAdjustment();
|
||||
if (adjustment > 0) {
|
||||
log.debug("Sending SSH_MSG_CHANNEL_WINDOW_ADJUST to #{} for {} bytes", chan.getRecipient(), adjustment);
|
||||
trans.write(new SSHPacket(Message.CHANNEL_WINDOW_ADJUST)
|
||||
.putUInt32FromInt(chan.getRecipient()).putUInt32(adjustment));
|
||||
win.expand(adjustment);
|
||||
}
|
||||
private void checkWindow() throws TransportException {
|
||||
/*
|
||||
* Window must fit in remaining buffer capacity. We already expect win.size() amount of data to arrive. The
|
||||
* difference between that and the remaining capacity is the maximum adjustment we can make to the window.
|
||||
*/
|
||||
final long maxAdjustment = buf.maxPossibleRemainingCapacity() - win.getSize();
|
||||
final long adjustment = Math.min(win.neededAdjustment(), maxAdjustment);
|
||||
if (adjustment > 0) {
|
||||
log.debug("Sending SSH_MSG_CHANNEL_WINDOW_ADJUST to #{} for {} bytes", chan.getRecipient(), adjustment);
|
||||
trans.write(new SSHPacket(Message.CHANNEL_WINDOW_ADJUST)
|
||||
.putUInt32FromInt(chan.getRecipient()).putUInt32(adjustment));
|
||||
win.expand(adjustment);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -30,7 +30,7 @@ import java.util.concurrent.atomic.AtomicBoolean;
|
||||
*/
|
||||
public final class ChannelOutputStream extends OutputStream implements ErrorNotifiable {
|
||||
|
||||
private final Channel chan;
|
||||
private final AbstractChannel chan;
|
||||
private final Transport trans;
|
||||
private final Window.Remote win;
|
||||
|
||||
@@ -47,6 +47,12 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
|
||||
private final SSHPacket packet = new SSHPacket(Message.CHANNEL_DATA);
|
||||
private final Buffer.PlainBuffer leftOvers = new Buffer.PlainBuffer();
|
||||
private final AbstractChannel.TransportRunnable packetWriteRunnable = new AbstractChannel.TransportRunnable() {
|
||||
@Override
|
||||
public void run() throws TransportException {
|
||||
trans.write(packet);
|
||||
}
|
||||
};
|
||||
|
||||
DataBuffer() {
|
||||
headerOffset = packet.rpos();
|
||||
@@ -99,8 +105,9 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
if (leftOverBytes > 0) {
|
||||
leftOvers.putRawBytes(packet.array(), packet.wpos(), leftOverBytes);
|
||||
}
|
||||
|
||||
trans.write(packet);
|
||||
if (!chan.whileOpen(packetWriteRunnable)) {
|
||||
throwStreamClosed();
|
||||
}
|
||||
win.consume(writeNow);
|
||||
|
||||
packet.rpos(headerOffset);
|
||||
@@ -119,7 +126,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
|
||||
}
|
||||
|
||||
public ChannelOutputStream(Channel chan, Transport trans, Window.Remote win) {
|
||||
public ChannelOutputStream(AbstractChannel chan, Transport trans, Window.Remote win) {
|
||||
this.chan = chan;
|
||||
this.trans = trans;
|
||||
this.win = win;
|
||||
@@ -157,7 +164,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
if (error != null) {
|
||||
throw error;
|
||||
} else {
|
||||
throw new ConnectionException("Stream closed");
|
||||
throwStreamClosed();
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -165,9 +172,14 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
@Override
|
||||
public synchronized void close() throws IOException {
|
||||
// Not closed yet, and underlying channel is open to flush the data to.
|
||||
if (!closed.getAndSet(true) && chan.isOpen()) {
|
||||
buffer.flush(false);
|
||||
trans.write(new SSHPacket(Message.CHANNEL_EOF).putUInt32(chan.getRecipient()));
|
||||
if (!closed.getAndSet(true)) {
|
||||
chan.whileOpen(new AbstractChannel.TransportRunnable() {
|
||||
@Override
|
||||
public void run() throws TransportException, ConnectionException {
|
||||
buffer.flush(false);
|
||||
trans.write(new SSHPacket(Message.CHANNEL_EOF).putUInt32(chan.getRecipient()));
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -188,4 +200,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
||||
return "< ChannelOutputStream for Channel #" + chan.getID() + " >";
|
||||
}
|
||||
|
||||
private static void throwStreamClosed() throws ConnectionException {
|
||||
throw new ConnectionException("Stream closed");
|
||||
}
|
||||
}
|
||||
|
||||
@@ -22,8 +22,6 @@ import java.io.IOException;
|
||||
import java.net.Socket;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
import static com.hierynomus.sshj.backport.Sockets.asCloseable;
|
||||
|
||||
public class SocketStreamCopyMonitor
|
||||
extends Thread {
|
||||
|
||||
@@ -43,7 +41,7 @@ public class SocketStreamCopyMonitor
|
||||
await(y);
|
||||
} catch (IOException ignored) {
|
||||
} finally {
|
||||
IOUtils.closeQuietly(channel, asCloseable(socket));
|
||||
IOUtils.closeQuietly(channel, socket);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -93,6 +93,7 @@ public abstract class Window {
|
||||
throw new ConnectionException("Timeout when trying to expand the window size");
|
||||
}
|
||||
} catch (InterruptedException ie) {
|
||||
Thread.currentThread().interrupt();
|
||||
throw new ConnectionException(ie);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -29,8 +29,6 @@ import java.net.Socket;
|
||||
import java.net.SocketException;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
import static com.hierynomus.sshj.backport.Sockets.asCloseable;
|
||||
|
||||
public class LocalPortForwarder {
|
||||
|
||||
public static class ForwardedChannel
|
||||
@@ -78,7 +76,7 @@ public class LocalPortForwarder {
|
||||
chan.open();
|
||||
chan.start();
|
||||
} catch (IOException e) {
|
||||
IOUtils.closeQuietly(chan, asCloseable(socket));
|
||||
IOUtils.closeQuietly(chan, socket);
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -210,7 +210,7 @@ public class SessionChannel
|
||||
|
||||
@Override
|
||||
protected void gotExtendedData(SSHPacket buf)
|
||||
throws ConnectionException, TransportException {
|
||||
throws SSHException {
|
||||
try {
|
||||
final int dataTypeCode = buf.readUInt32AsInt();
|
||||
if (dataTypeCode == 1)
|
||||
|
||||
@@ -15,10 +15,11 @@
|
||||
*/
|
||||
package net.schmizz.sshj.connection.channel.direct;
|
||||
|
||||
import com.hierynomus.sshj.common.RemoteAddressProvider;
|
||||
import net.schmizz.sshj.common.SSHException;
|
||||
|
||||
/** A factory interface for creating SSH {@link Session session channels}. */
|
||||
public interface SessionFactory {
|
||||
public interface SessionFactory extends RemoteAddressProvider {
|
||||
|
||||
/**
|
||||
* Opens a {@code session} channel. The returned {@link Session} instance allows {@link Session#exec(String)
|
||||
@@ -27,7 +28,7 @@ public interface SessionFactory {
|
||||
*
|
||||
* @return the opened {@code session} channel
|
||||
*
|
||||
* @throws SSHException
|
||||
* @throws SSHException Thrown on session initialization failures
|
||||
* @see Session
|
||||
*/
|
||||
Session startSession()
|
||||
|
||||
@@ -142,6 +142,10 @@ public class RemotePortForwarder
|
||||
// Listen on all IPv4
|
||||
return true;
|
||||
}
|
||||
if ("0.0.0.0".equals(address) && "0:0:0:0:0:0:0:0".equals(channelForward.address)) {
|
||||
// Handle IPv4 requests on IPv6 channel forward
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
|
||||
@@ -41,7 +41,7 @@ public class PacketReader extends Thread {
|
||||
this.engine = engine;
|
||||
log = engine.getLoggerFactory().getLogger(getClass());
|
||||
this.in = engine.getSubsystem().getInputStream();
|
||||
setName("sftp reader");
|
||||
setName("sshj-PacketReader");
|
||||
setDaemon(true);
|
||||
}
|
||||
|
||||
|
||||
@@ -23,6 +23,8 @@ import java.io.ByteArrayInputStream;
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
import java.io.OutputStream;
|
||||
import java.util.ArrayDeque;
|
||||
import java.util.Deque;
|
||||
import java.util.LinkedList;
|
||||
import java.util.Queue;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
@@ -220,49 +222,104 @@ public class RemoteFile
|
||||
|
||||
public class ReadAheadRemoteFileInputStream
|
||||
extends InputStream {
|
||||
private class UnconfirmedRead {
|
||||
private final long offset;
|
||||
private final Promise<Response, SFTPException> promise;
|
||||
private final int length;
|
||||
|
||||
private UnconfirmedRead(long offset, int length, Promise<Response, SFTPException> promise) {
|
||||
this.offset = offset;
|
||||
this.length = length;
|
||||
this.promise = promise;
|
||||
}
|
||||
|
||||
UnconfirmedRead(long offset, int length) throws IOException {
|
||||
this(offset, length, RemoteFile.this.asyncRead(offset, length));
|
||||
}
|
||||
|
||||
public long getOffset() {
|
||||
return offset;
|
||||
}
|
||||
|
||||
public Promise<Response, SFTPException> getPromise() {
|
||||
return promise;
|
||||
}
|
||||
|
||||
public int getLength() {
|
||||
return length;
|
||||
}
|
||||
}
|
||||
|
||||
private final byte[] b = new byte[1];
|
||||
|
||||
private final int maxUnconfirmedReads;
|
||||
private final Queue<Promise<Response, SFTPException>> unconfirmedReads = new LinkedList<Promise<Response, SFTPException>>();
|
||||
private final Queue<Long> unconfirmedReadOffsets = new LinkedList<Long>();
|
||||
private final long readAheadLimit;
|
||||
private final Deque<UnconfirmedRead> unconfirmedReads = new ArrayDeque<>();
|
||||
|
||||
private long requestOffset;
|
||||
private long responseOffset;
|
||||
private long currentOffset;
|
||||
private int maxReadLength = Integer.MAX_VALUE;
|
||||
private boolean eof;
|
||||
|
||||
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads) {
|
||||
assert 0 <= maxUnconfirmedReads;
|
||||
|
||||
this.maxUnconfirmedReads = maxUnconfirmedReads;
|
||||
this(maxUnconfirmedReads, 0L);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @param maxUnconfirmedReads Maximum number of unconfirmed requests to send
|
||||
* @param fileOffset Initial offset in file to read from
|
||||
*/
|
||||
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads, long fileOffset) {
|
||||
this(maxUnconfirmedReads, fileOffset, -1L);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @param maxUnconfirmedReads Maximum number of unconfirmed requests to send
|
||||
* @param fileOffset Initial offset in file to read from
|
||||
* @param readAheadLimit Read ahead is disabled after this limit has been reached
|
||||
*/
|
||||
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads, long fileOffset, long readAheadLimit) {
|
||||
assert 0 <= maxUnconfirmedReads;
|
||||
assert 0 <= fileOffset;
|
||||
|
||||
this.maxUnconfirmedReads = maxUnconfirmedReads;
|
||||
this.requestOffset = this.responseOffset = fileOffset;
|
||||
this.currentOffset = fileOffset;
|
||||
this.readAheadLimit = readAheadLimit > 0 ? fileOffset + readAheadLimit : Long.MAX_VALUE;
|
||||
}
|
||||
|
||||
private ByteArrayInputStream pending = new ByteArrayInputStream(new byte[0]);
|
||||
|
||||
private boolean retrieveUnconfirmedRead(boolean blocking) throws IOException {
|
||||
if (unconfirmedReads.size() <= 0) {
|
||||
final UnconfirmedRead unconfirmedRead = unconfirmedReads.peek();
|
||||
if (unconfirmedRead == null || !blocking && !unconfirmedRead.getPromise().isDelivered()) {
|
||||
return false;
|
||||
}
|
||||
unconfirmedReads.remove(unconfirmedRead);
|
||||
|
||||
if (!blocking && !unconfirmedReads.peek().isDelivered()) {
|
||||
return false;
|
||||
}
|
||||
|
||||
unconfirmedReadOffsets.remove();
|
||||
final Response res = unconfirmedReads.remove().retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||
final Response res = unconfirmedRead.promise.retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||
switch (res.getType()) {
|
||||
case DATA:
|
||||
int recvLen = res.readUInt32AsInt();
|
||||
responseOffset += recvLen;
|
||||
pending = new ByteArrayInputStream(res.array(), res.rpos(), recvLen);
|
||||
if (unconfirmedRead.offset == currentOffset) {
|
||||
currentOffset += recvLen;
|
||||
pending = new ByteArrayInputStream(res.array(), res.rpos(), recvLen);
|
||||
|
||||
if (recvLen < unconfirmedRead.length) {
|
||||
// The server returned a packet smaller than the client had requested.
|
||||
// It can be caused by at least one of the following:
|
||||
// * The file has been read fully. Then, few futile read requests can be sent during
|
||||
// the next read(), but the file will be downloaded correctly anyway.
|
||||
// * The server shapes the request length. Then, the read window will be adjusted,
|
||||
// and all further read-ahead requests won't be shaped.
|
||||
// * The file on the server is not a regular file, it is something like fifo.
|
||||
// Then, the window will shrink, and the client will start reading the file slower than it
|
||||
// hypothetically can. It must be a rare case, and it is not worth implementing a sort of
|
||||
// congestion control algorithm here.
|
||||
maxReadLength = recvLen;
|
||||
unconfirmedReads.clear();
|
||||
}
|
||||
}
|
||||
break;
|
||||
|
||||
case STATUS:
|
||||
@@ -290,40 +347,31 @@ public class RemoteFile
|
||||
// we also need to go here for len <= 0, because pending may be at
|
||||
// EOF in which case it would return -1 instead of 0
|
||||
|
||||
long requestOffset;
|
||||
if (unconfirmedReads.isEmpty()) {
|
||||
requestOffset = currentOffset;
|
||||
}
|
||||
else {
|
||||
final UnconfirmedRead lastRequest = unconfirmedReads.getLast();
|
||||
requestOffset = lastRequest.offset + lastRequest.length;
|
||||
}
|
||||
while (unconfirmedReads.size() <= maxUnconfirmedReads) {
|
||||
// Send read requests as long as there is no EOF and we have not reached the maximum parallelism
|
||||
int reqLen = Math.max(1024, len); // don't be shy!
|
||||
unconfirmedReads.add(RemoteFile.this.asyncRead(requestOffset, reqLen));
|
||||
unconfirmedReadOffsets.add(requestOffset);
|
||||
int reqLen = Math.min(Math.max(1024, len), maxReadLength);
|
||||
if (readAheadLimit > requestOffset) {
|
||||
long remaining = readAheadLimit - requestOffset;
|
||||
if (reqLen > remaining) {
|
||||
reqLen = (int) remaining;
|
||||
}
|
||||
}
|
||||
unconfirmedReads.add(new UnconfirmedRead(requestOffset, reqLen));
|
||||
requestOffset += reqLen;
|
||||
if (requestOffset >= readAheadLimit) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
long nextOffset = unconfirmedReadOffsets.peek();
|
||||
if (responseOffset != nextOffset) {
|
||||
|
||||
// the server could not give us all the data we needed, so
|
||||
// we try to fill the gap synchronously
|
||||
|
||||
assert responseOffset < nextOffset;
|
||||
assert 0 < (nextOffset - responseOffset);
|
||||
assert (nextOffset - responseOffset) <= Integer.MAX_VALUE;
|
||||
|
||||
byte[] buf = new byte[(int) (nextOffset - responseOffset)];
|
||||
int recvLen = RemoteFile.this.read(responseOffset, buf, 0, buf.length);
|
||||
|
||||
if (recvLen < 0) {
|
||||
eof = true;
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (0 == recvLen) {
|
||||
// avoid infinite loops
|
||||
throw new SFTPException("Unexpected response size (0), bailing out");
|
||||
}
|
||||
|
||||
responseOffset += recvLen;
|
||||
pending = new ByteArrayInputStream(buf, 0, recvLen);
|
||||
} else if (!retrieveUnconfirmedRead(true /*blocking*/)) {
|
||||
if (!retrieveUnconfirmedRead(true /*blocking*/)) {
|
||||
|
||||
// this may happen if we change prefetch strategy
|
||||
// currently, we should never get here...
|
||||
|
||||
@@ -15,6 +15,7 @@
|
||||
*/
|
||||
package net.schmizz.sshj.sftp;
|
||||
|
||||
import net.schmizz.sshj.connection.channel.direct.SessionFactory;
|
||||
import net.schmizz.sshj.xfer.FilePermission;
|
||||
import net.schmizz.sshj.xfer.LocalDestFile;
|
||||
import net.schmizz.sshj.xfer.LocalSourceFile;
|
||||
@@ -39,6 +40,13 @@ public class SFTPClient
|
||||
this.xfer = new SFTPFileTransfer(engine);
|
||||
}
|
||||
|
||||
public SFTPClient(SessionFactory sessionFactory) throws IOException {
|
||||
this.engine = new SFTPEngine(sessionFactory);
|
||||
this.engine.init();
|
||||
log = engine.getLoggerFactory().getLogger(getClass());
|
||||
this.xfer = new SFTPFileTransfer(engine);
|
||||
}
|
||||
|
||||
public SFTPEngine getSFTPEngine() {
|
||||
return engine;
|
||||
}
|
||||
@@ -233,21 +241,41 @@ public class SFTPClient
|
||||
xfer.download(source, dest);
|
||||
}
|
||||
|
||||
public void get(String source, String dest, long byteOffset)
|
||||
throws IOException {
|
||||
xfer.download(source, dest, byteOffset);
|
||||
}
|
||||
|
||||
public void put(String source, String dest)
|
||||
throws IOException {
|
||||
xfer.upload(source, dest);
|
||||
}
|
||||
|
||||
public void put(String source, String dest, long byteOffset)
|
||||
throws IOException {
|
||||
xfer.upload(source, dest, byteOffset);
|
||||
}
|
||||
|
||||
public void get(String source, LocalDestFile dest)
|
||||
throws IOException {
|
||||
xfer.download(source, dest);
|
||||
}
|
||||
|
||||
public void get(String source, LocalDestFile dest, long byteOffset)
|
||||
throws IOException {
|
||||
xfer.download(source, dest, byteOffset);
|
||||
}
|
||||
|
||||
public void put(LocalSourceFile source, String dest)
|
||||
throws IOException {
|
||||
xfer.upload(source, dest);
|
||||
}
|
||||
|
||||
public void put(LocalSourceFile source, String dest, long byteOffset)
|
||||
throws IOException {
|
||||
xfer.upload(source, dest, byteOffset);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void close()
|
||||
throws IOException {
|
||||
|
||||
@@ -15,6 +15,7 @@
|
||||
*/
|
||||
package net.schmizz.sshj.sftp;
|
||||
|
||||
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||
import net.schmizz.concurrent.Promise;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.common.LoggerFactory;
|
||||
@@ -68,6 +69,7 @@ public class SFTPEngine
|
||||
sub = session.startSubsystem("sftp");
|
||||
out = sub.getOutputStream();
|
||||
reader = new PacketReader(this);
|
||||
ThreadNameProvider.setThreadName(reader, ssh);
|
||||
pathHelper = new PathHelper(new PathHelper.Canonicalizer() {
|
||||
@Override
|
||||
public String canonicalize(String path)
|
||||
@@ -79,7 +81,23 @@ public class SFTPEngine
|
||||
|
||||
public SFTPEngine init()
|
||||
throws IOException {
|
||||
transmit(new SFTPPacket<Request>(PacketType.INIT).putUInt32(MAX_SUPPORTED_VERSION));
|
||||
return init(MAX_SUPPORTED_VERSION);
|
||||
}
|
||||
|
||||
/**
|
||||
* Introduced for internal use by testcases.
|
||||
* @param requestedVersion
|
||||
* @throws IOException
|
||||
*/
|
||||
protected SFTPEngine init(int requestedVersion)
|
||||
throws IOException {
|
||||
if (requestedVersion > MAX_SUPPORTED_VERSION)
|
||||
throw new SFTPException("You requested an unsupported protocol version: " + requestedVersion + " (requested) > " + MAX_SUPPORTED_VERSION + " (supported)");
|
||||
|
||||
if (requestedVersion < MAX_SUPPORTED_VERSION)
|
||||
log.debug("Client version {} is smaller than MAX_SUPPORTED_VERSION {}", requestedVersion, MAX_SUPPORTED_VERSION);
|
||||
|
||||
transmit(new SFTPPacket<Request>(PacketType.INIT).putUInt32(requestedVersion));
|
||||
|
||||
final SFTPPacket<Response> response = reader.readPacket();
|
||||
|
||||
@@ -89,7 +107,7 @@ public class SFTPEngine
|
||||
|
||||
operativeVersion = response.readUInt32AsInt();
|
||||
log.debug("Server version {}", operativeVersion);
|
||||
if (MAX_SUPPORTED_VERSION < operativeVersion)
|
||||
if (requestedVersion < operativeVersion)
|
||||
throw new SFTPException("Server reported incompatible protocol version: " + operativeVersion);
|
||||
|
||||
while (response.available() > 0)
|
||||
@@ -232,17 +250,79 @@ public class SFTPEngine
|
||||
|
||||
public void rename(String oldPath, String newPath, Set<RenameFlags> flags)
|
||||
throws IOException {
|
||||
if (operativeVersion < 1)
|
||||
if (operativeVersion < 1) {
|
||||
throw new SFTPException("RENAME is not supported in SFTPv" + operativeVersion);
|
||||
|
||||
long renameFlagMask = 0L;
|
||||
for (RenameFlags flag : flags) {
|
||||
renameFlagMask = renameFlagMask | flag.longValue();
|
||||
}
|
||||
|
||||
doRequest(
|
||||
newRequest(PacketType.RENAME).putString(oldPath, sub.getRemoteCharset()).putString(newPath, sub.getRemoteCharset()).putUInt32(renameFlagMask)
|
||||
).ensureStatusPacketIsOK();
|
||||
// request variables to be determined
|
||||
PacketType type = PacketType.RENAME; // Default
|
||||
long renameFlagMask = 0L;
|
||||
String serverExtension = null;
|
||||
|
||||
if (!flags.isEmpty()) {
|
||||
// SFTP Version 5 introduced rename flags according to Section 6.5 of the specification
|
||||
if (operativeVersion >= 5) {
|
||||
for (RenameFlags flag : flags) {
|
||||
renameFlagMask = renameFlagMask | flag.longValue();
|
||||
}
|
||||
}
|
||||
// Try to find a fallback solution if flags are not supported by the server.
|
||||
|
||||
// "posix-rename@openssh.com" provides ATOMIC and OVERWRITE behaviour.
|
||||
// From the SFTP-spec, Section 6.5:
|
||||
// "If SSH_FXP_RENAME_OVERWRITE is specified, the server MAY perform an atomic rename even if it is
|
||||
// not requested."
|
||||
// So, if overwrite is allowed we can always use the posix-rename as a fallback.
|
||||
else if (flags.contains(RenameFlags.OVERWRITE) &&
|
||||
supportsServerExtension("posix-rename","openssh.com")) {
|
||||
|
||||
type = PacketType.EXTENDED;
|
||||
serverExtension = "posix-rename@openssh.com";
|
||||
}
|
||||
|
||||
// Because the OVERWRITE flag changes the behaviour in a possibly unintended way, it has to be
|
||||
// explicitly requested for the above fallback to be applicable.
|
||||
// Tell this to the developer if ATOMIC is requested without OVERWRITE.
|
||||
else if (flags.contains(RenameFlags.ATOMIC) &&
|
||||
!flags.contains(RenameFlags.OVERWRITE) &&
|
||||
!flags.contains(RenameFlags.NATIVE) && // see next case below
|
||||
supportsServerExtension("posix-rename","openssh.com")) {
|
||||
throw new SFTPException("RENAME-FLAGS are not supported in SFTPv" + operativeVersion + " but " +
|
||||
"the \"posix-rename@openssh.com\" extension could be used as fallback if OVERWRITE " +
|
||||
"behaviour is acceptable (needs to be activated via RenameFlags.OVERWRITE).");
|
||||
}
|
||||
|
||||
// From the SFTP-spec, Section 6.5:
|
||||
// "If flags includes SSH_FXP_RENAME_NATIVE, the server is free to do the rename operation in whatever
|
||||
// fashion it deems appropriate. Other flag values are considered hints as to desired behavior, but not
|
||||
// requirements."
|
||||
else if (flags.contains(RenameFlags.NATIVE)) {
|
||||
log.debug("Flags are not supported but NATIVE-flag allows to ignore other requested flags: " +
|
||||
flags.toString());
|
||||
}
|
||||
|
||||
// finally: let the user know that the server does not support what was asked
|
||||
else {
|
||||
throw new SFTPException("RENAME-FLAGS are not supported in SFTPv" + operativeVersion + " and no " +
|
||||
"supported server extension could be found to achieve a similar result.");
|
||||
}
|
||||
}
|
||||
|
||||
// build and send request
|
||||
final Request request = newRequest(type);
|
||||
|
||||
if (serverExtension != null) {
|
||||
request.putString(serverExtension);
|
||||
}
|
||||
|
||||
request.putString(oldPath, sub.getRemoteCharset())
|
||||
.putString(newPath, sub.getRemoteCharset());
|
||||
|
||||
if (renameFlagMask != 0L) {
|
||||
request.putUInt32(renameFlagMask);
|
||||
}
|
||||
|
||||
doRequest(request).ensureStatusPacketIsOK();
|
||||
}
|
||||
|
||||
public String canonicalize(String path)
|
||||
|
||||
@@ -50,25 +50,47 @@ public class SFTPFileTransfer
|
||||
@Override
|
||||
public void upload(String source, String dest)
|
||||
throws IOException {
|
||||
upload(new FileSystemFile(source), dest);
|
||||
upload(source, dest, 0);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void upload(String source, String dest, long byteOffset)
|
||||
throws IOException {
|
||||
upload(new FileSystemFile(source), dest, byteOffset);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void download(String source, String dest)
|
||||
throws IOException {
|
||||
download(source, new FileSystemFile(dest));
|
||||
download(source, dest, 0);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void download(String source, String dest, long byteOffset)
|
||||
throws IOException {
|
||||
download(source, new FileSystemFile(dest), byteOffset);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void upload(LocalSourceFile localFile, String remotePath) throws IOException {
|
||||
new Uploader(localFile, remotePath).upload(getTransferListener());
|
||||
upload(localFile, remotePath, 0);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void upload(LocalSourceFile localFile, String remotePath, long byteOffset) throws IOException {
|
||||
new Uploader(localFile, remotePath).upload(getTransferListener(), byteOffset);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void download(String source, LocalDestFile dest) throws IOException {
|
||||
download(source, dest, 0);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void download(String source, LocalDestFile dest, long byteOffset) throws IOException {
|
||||
final PathComponents pathComponents = engine.getPathHelper().getComponents(source);
|
||||
final FileAttributes attributes = engine.stat(source);
|
||||
new Downloader().download(getTransferListener(), new RemoteResourceInfo(pathComponents, attributes), dest);
|
||||
new Downloader().download(getTransferListener(), new RemoteResourceInfo(pathComponents, attributes), dest, byteOffset);
|
||||
}
|
||||
|
||||
public void setUploadFilter(LocalFileFilter uploadFilter) {
|
||||
@@ -92,7 +114,8 @@ public class SFTPFileTransfer
|
||||
@SuppressWarnings("PMD.MissingBreakInSwitch")
|
||||
private void download(final TransferListener listener,
|
||||
final RemoteResourceInfo remote,
|
||||
final LocalDestFile local) throws IOException {
|
||||
final LocalDestFile local,
|
||||
final long byteOffset) throws IOException {
|
||||
final LocalDestFile adjustedFile;
|
||||
switch (remote.getAttributes().getType()) {
|
||||
case DIRECTORY:
|
||||
@@ -101,8 +124,9 @@ public class SFTPFileTransfer
|
||||
case UNKNOWN:
|
||||
log.warn("Server did not supply information about the type of file at `{}` " +
|
||||
"-- assuming it is a regular file!", remote.getPath());
|
||||
// fall through
|
||||
case REGULAR:
|
||||
adjustedFile = downloadFile(listener.file(remote.getName(), remote.getAttributes().getSize()), remote, local);
|
||||
adjustedFile = downloadFile(listener.file(remote.getName(), remote.getAttributes().getSize()), remote, local, byteOffset);
|
||||
break;
|
||||
default:
|
||||
throw new IOException(remote + " is not a regular file or directory");
|
||||
@@ -119,7 +143,7 @@ public class SFTPFileTransfer
|
||||
final RemoteDirectory rd = engine.openDir(remote.getPath());
|
||||
try {
|
||||
for (RemoteResourceInfo rri : rd.scan(getDownloadFilter()))
|
||||
download(listener, rri, adjusted.getChild(rri.getName()));
|
||||
download(listener, rri, adjusted.getChild(rri.getName()), 0); // not supporting individual byte offsets for these files
|
||||
} finally {
|
||||
rd.close();
|
||||
}
|
||||
@@ -128,13 +152,15 @@ public class SFTPFileTransfer
|
||||
|
||||
private LocalDestFile downloadFile(final StreamCopier.Listener listener,
|
||||
final RemoteResourceInfo remote,
|
||||
final LocalDestFile local)
|
||||
final LocalDestFile local,
|
||||
final long byteOffset)
|
||||
throws IOException {
|
||||
final LocalDestFile adjusted = local.getTargetFile(remote.getName());
|
||||
final RemoteFile rf = engine.open(remote.getPath());
|
||||
try {
|
||||
final RemoteFile.ReadAheadRemoteFileInputStream rfis = rf.new ReadAheadRemoteFileInputStream(16);
|
||||
final OutputStream os = adjusted.getOutputStream();
|
||||
log.debug("Attempting to download {} with offset={}", remote.getPath(), byteOffset);
|
||||
final RemoteFile.ReadAheadRemoteFileInputStream rfis = rf.new ReadAheadRemoteFileInputStream(16, byteOffset);
|
||||
final OutputStream os = adjusted.getOutputStream(byteOffset != 0);
|
||||
try {
|
||||
new StreamCopier(rfis, os, engine.getLoggerFactory())
|
||||
.bufSize(engine.getSubsystem().getLocalMaxPacketSize())
|
||||
@@ -173,17 +199,17 @@ public class SFTPFileTransfer
|
||||
this.remote = remote;
|
||||
}
|
||||
|
||||
private void upload(final TransferListener listener) throws IOException {
|
||||
private void upload(final TransferListener listener, long byteOffset) throws IOException {
|
||||
if (source.isDirectory()) {
|
||||
makeDirIfNotExists(remote); // Ensure that the directory exists
|
||||
uploadDir(listener.directory(source.getName()), source, remote);
|
||||
setAttributes(source, remote);
|
||||
} else if (source.isFile() && isDirectory(remote)) {
|
||||
String adjustedRemote = engine.getPathHelper().adjustForParent(this.remote, source.getName());
|
||||
uploadFile(listener.file(source.getName(), source.getLength()), source, adjustedRemote);
|
||||
uploadFile(listener.file(source.getName(), source.getLength()), source, adjustedRemote, byteOffset);
|
||||
setAttributes(source, adjustedRemote);
|
||||
} else if (source.isFile()) {
|
||||
uploadFile(listener.file(source.getName(), source.getLength()), source, remote);
|
||||
uploadFile(listener.file(source.getName(), source.getLength()), source, remote, byteOffset);
|
||||
setAttributes(source, remote);
|
||||
} else {
|
||||
throw new IOException(source + " is not a file or directory");
|
||||
@@ -192,13 +218,14 @@ public class SFTPFileTransfer
|
||||
|
||||
private void upload(final TransferListener listener,
|
||||
final LocalSourceFile local,
|
||||
final String remote)
|
||||
final String remote,
|
||||
final long byteOffset)
|
||||
throws IOException {
|
||||
final String adjustedPath;
|
||||
if (local.isDirectory()) {
|
||||
adjustedPath = uploadDir(listener.directory(local.getName()), local, remote);
|
||||
} else if (local.isFile()) {
|
||||
adjustedPath = uploadFile(listener.file(local.getName(), local.getLength()), local, remote);
|
||||
adjustedPath = uploadFile(listener.file(local.getName(), local.getLength()), local, remote, byteOffset);
|
||||
} else {
|
||||
throw new IOException(local + " is not a file or directory");
|
||||
}
|
||||
@@ -217,22 +244,34 @@ public class SFTPFileTransfer
|
||||
throws IOException {
|
||||
makeDirIfNotExists(remote);
|
||||
for (LocalSourceFile f : local.getChildren(getUploadFilter()))
|
||||
upload(listener, f, engine.getPathHelper().adjustForParent(remote, f.getName()));
|
||||
upload(listener, f, engine.getPathHelper().adjustForParent(remote, f.getName()), 0); // not supporting individual byte offsets for these files
|
||||
return remote;
|
||||
}
|
||||
|
||||
private String uploadFile(final StreamCopier.Listener listener,
|
||||
final LocalSourceFile local,
|
||||
final String remote)
|
||||
final String remote,
|
||||
final long byteOffset)
|
||||
throws IOException {
|
||||
final String adjusted = prepareFile(local, remote);
|
||||
final String adjusted = prepareFile(local, remote, byteOffset);
|
||||
RemoteFile rf = null;
|
||||
InputStream fis = null;
|
||||
RemoteFile.RemoteFileOutputStream rfos = null;
|
||||
EnumSet<OpenMode> modes;
|
||||
try {
|
||||
rf = engine.open(adjusted, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT, OpenMode.TRUNC));
|
||||
if (byteOffset == 0) {
|
||||
// Starting at the beginning, overwrite/create
|
||||
modes = EnumSet.of(OpenMode.WRITE, OpenMode.CREAT, OpenMode.TRUNC);
|
||||
} else {
|
||||
// Starting at some offset, append
|
||||
modes = EnumSet.of(OpenMode.WRITE, OpenMode.APPEND);
|
||||
}
|
||||
|
||||
log.debug("Attempting to upload {} with offset={}", local.getName(), byteOffset);
|
||||
rf = engine.open(adjusted, modes);
|
||||
fis = local.getInputStream();
|
||||
rfos = rf.new RemoteFileOutputStream(0, 16);
|
||||
fis.skip(byteOffset);
|
||||
rfos = rf.new RemoteFileOutputStream(byteOffset, 16);
|
||||
new StreamCopier(fis, rfos, engine.getLoggerFactory())
|
||||
.bufSize(engine.getSubsystem().getRemoteMaxPacketSize() - rf.getOutgoingPacketOverhead())
|
||||
.keepFlushing(false)
|
||||
@@ -294,7 +333,7 @@ public class SFTPFileTransfer
|
||||
}
|
||||
}
|
||||
|
||||
private String prepareFile(final LocalSourceFile local, final String remote)
|
||||
private String prepareFile(final LocalSourceFile local, final String remote, final long byteOffset)
|
||||
throws IOException {
|
||||
final FileAttributes attrs;
|
||||
try {
|
||||
@@ -309,7 +348,7 @@ public class SFTPFileTransfer
|
||||
if (attrs.getMode().getType() == FileMode.Type.DIRECTORY) {
|
||||
throw new IOException("Trying to upload file " + local.getName() + " to path " + remote + " but that is a directory");
|
||||
} else {
|
||||
log.debug("probeFile: {} is a {} file that will be replaced", remote, attrs.getMode().getType());
|
||||
log.debug("probeFile: {} is a {} file that will be {}", remote, attrs.getMode().getType(), byteOffset > 0 ? "resumed" : "replaced");
|
||||
return remote;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -15,6 +15,7 @@
|
||||
*/
|
||||
package net.schmizz.sshj.sftp;
|
||||
|
||||
import net.schmizz.sshj.connection.channel.direct.SessionFactory;
|
||||
import net.schmizz.sshj.xfer.LocalDestFile;
|
||||
import net.schmizz.sshj.xfer.LocalSourceFile;
|
||||
|
||||
@@ -34,6 +35,12 @@ public class StatefulSFTPClient
|
||||
log.debug("Start dir = {}", cwd);
|
||||
}
|
||||
|
||||
public StatefulSFTPClient(SessionFactory sessionFactory) throws IOException {
|
||||
super(sessionFactory);
|
||||
this.cwd = getSFTPEngine().canonicalize(".");
|
||||
log.debug("Start dir = {}", cwd);
|
||||
}
|
||||
|
||||
private synchronized String cwdify(String path) {
|
||||
return engine.getPathHelper().adjustForParent(cwd, path);
|
||||
}
|
||||
|
||||
@@ -51,6 +51,14 @@ abstract class Converter {
|
||||
return seq;
|
||||
}
|
||||
|
||||
void resetSequenceNumber() {
|
||||
seq = -1;
|
||||
}
|
||||
|
||||
boolean isSequenceNumberAtMax() {
|
||||
return seq == 0xffffffffL;
|
||||
}
|
||||
|
||||
void setAlgorithms(Cipher cipher, MAC mac, Compression compression) {
|
||||
this.cipher = cipher;
|
||||
this.mac = mac;
|
||||
|
||||
@@ -60,6 +60,10 @@ final class KeyExchanger
|
||||
|
||||
private final AtomicBoolean kexOngoing = new AtomicBoolean();
|
||||
|
||||
private final AtomicBoolean initialKex = new AtomicBoolean(true);
|
||||
|
||||
private final AtomicBoolean strictKex = new AtomicBoolean();
|
||||
|
||||
/** What we are expecting from the next packet */
|
||||
private Expected expected = Expected.KEXINIT;
|
||||
|
||||
@@ -123,6 +127,14 @@ final class KeyExchanger
|
||||
return kexOngoing.get();
|
||||
}
|
||||
|
||||
boolean isStrictKex() {
|
||||
return strictKex.get();
|
||||
}
|
||||
|
||||
boolean isInitialKex() {
|
||||
return initialKex.get();
|
||||
}
|
||||
|
||||
/**
|
||||
* Starts key exchange by sending a {@code SSH_MSG_KEXINIT} packet. Key exchange needs to be done once mandatorily
|
||||
* after initializing the {@link Transport} for it to be usable and may be initiated at any later point e.g. if
|
||||
@@ -136,13 +148,25 @@ final class KeyExchanger
|
||||
void startKex(boolean waitForDone)
|
||||
throws TransportException {
|
||||
if (!kexOngoing.getAndSet(true)) {
|
||||
done.clear();
|
||||
sendKexInit();
|
||||
if (isKeyExchangeAllowed()) {
|
||||
log.debug("Initiating key exchange");
|
||||
done.clear();
|
||||
sendKexInit();
|
||||
} else {
|
||||
kexOngoing.set(false);
|
||||
}
|
||||
}
|
||||
if (waitForDone)
|
||||
waitForDone();
|
||||
}
|
||||
|
||||
/**
|
||||
* Key exchange can be initiated exactly once while connecting or later after authentication when re-keying.
|
||||
*/
|
||||
private boolean isKeyExchangeAllowed() {
|
||||
return !isKexDone() || transport.isAuthenticated();
|
||||
}
|
||||
|
||||
void waitForDone()
|
||||
throws TransportException {
|
||||
done.await(transport.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||
@@ -171,7 +195,7 @@ final class KeyExchanger
|
||||
throws TransportException {
|
||||
log.debug("Sending SSH_MSG_KEXINIT");
|
||||
List<String> knownHostAlgs = findKnownHostAlgs(transport.getRemoteHost(), transport.getRemotePort());
|
||||
clientProposal = new Proposal(transport.getConfig(), knownHostAlgs);
|
||||
clientProposal = new Proposal(transport.getConfig(), knownHostAlgs, initialKex.get());
|
||||
transport.write(clientProposal.getPacket());
|
||||
kexInitSent.set();
|
||||
}
|
||||
@@ -190,6 +214,9 @@ final class KeyExchanger
|
||||
throws TransportException {
|
||||
log.debug("Sending SSH_MSG_NEWKEYS");
|
||||
transport.write(new SSHPacket(Message.NEWKEYS));
|
||||
if (strictKex.get()) {
|
||||
transport.getEncoder().resetSequenceNumber();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -222,6 +249,10 @@ final class KeyExchanger
|
||||
|
||||
private void setKexDone() {
|
||||
kexOngoing.set(false);
|
||||
initialKex.set(false);
|
||||
if (strictKex.get()) {
|
||||
transport.getDecoder().resetSequenceNumber();
|
||||
}
|
||||
kexInitSent.clear();
|
||||
done.set();
|
||||
}
|
||||
@@ -230,6 +261,7 @@ final class KeyExchanger
|
||||
throws TransportException {
|
||||
buf.rpos(buf.rpos() - 1);
|
||||
final Proposal serverProposal = new Proposal(buf);
|
||||
gotStrictKexInfo(serverProposal);
|
||||
negotiatedAlgs = clientProposal.negotiate(serverProposal);
|
||||
log.debug("Negotiated algorithms: {}", negotiatedAlgs);
|
||||
for(AlgorithmsVerifier v: algorithmVerifiers) {
|
||||
@@ -243,7 +275,6 @@ final class KeyExchanger
|
||||
negotiatedAlgs.getKeyExchangeAlgorithm());
|
||||
transport.setHostKeyAlgorithm(Factory.Named.Util.create(transport.getConfig().getKeyAlgorithms(),
|
||||
negotiatedAlgs.getSignatureAlgorithm()));
|
||||
transport.setRSASHA2Support(negotiatedAlgs.getRSASHA2Support());
|
||||
|
||||
try {
|
||||
kex.init(transport,
|
||||
@@ -254,6 +285,18 @@ final class KeyExchanger
|
||||
}
|
||||
}
|
||||
|
||||
private void gotStrictKexInfo(Proposal serverProposal) throws TransportException {
|
||||
if (initialKex.get() && serverProposal.isStrictKeyExchangeSupportedByServer()) {
|
||||
strictKex.set(true);
|
||||
log.debug("Enabling strict key exchange extension");
|
||||
if (transport.getDecoder().getSequenceNumber() != 0) {
|
||||
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||
"SSH_MSG_KEXINIT was not first package during strict key exchange"
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Private method used while putting new keys into use that will resize the key used to initialize the cipher to the
|
||||
* needed length.
|
||||
|
||||
@@ -26,10 +26,8 @@ public final class NegotiatedAlgorithms {
|
||||
private final String c2sComp;
|
||||
private final String s2cComp;
|
||||
|
||||
private final boolean rsaSHA2Support;
|
||||
|
||||
NegotiatedAlgorithms(String kex, String sig, String c2sCipher, String s2cCipher, String c2sMAC, String s2cMAC,
|
||||
String c2sComp, String s2cComp, boolean rsaSHA2Support) {
|
||||
String c2sComp, String s2cComp) {
|
||||
this.kex = kex;
|
||||
this.sig = sig;
|
||||
this.c2sCipher = c2sCipher;
|
||||
@@ -38,7 +36,6 @@ public final class NegotiatedAlgorithms {
|
||||
this.s2cMAC = s2cMAC;
|
||||
this.c2sComp = c2sComp;
|
||||
this.s2cComp = s2cComp;
|
||||
this.rsaSHA2Support = rsaSHA2Support;
|
||||
}
|
||||
|
||||
public String getKeyExchangeAlgorithm() {
|
||||
@@ -73,10 +70,6 @@ public final class NegotiatedAlgorithms {
|
||||
return s2cComp;
|
||||
}
|
||||
|
||||
public boolean getRSASHA2Support() {
|
||||
return rsaSHA2Support;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return ("[ " +
|
||||
@@ -88,7 +81,6 @@ public final class NegotiatedAlgorithms {
|
||||
"s2cMAC=" + s2cMAC + "; " +
|
||||
"c2sComp=" + c2sComp + "; " +
|
||||
"s2cComp=" + s2cComp + "; " +
|
||||
"rsaSHA2Support=" + rsaSHA2Support +
|
||||
" ]");
|
||||
}
|
||||
|
||||
|
||||
@@ -15,7 +15,6 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport;
|
||||
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
@@ -38,8 +37,11 @@ class Proposal {
|
||||
private final List<String> s2cComp;
|
||||
private final SSHPacket packet;
|
||||
|
||||
public Proposal(Config config, List<String> knownHostAlgs) {
|
||||
public Proposal(Config config, List<String> knownHostAlgs, boolean initialKex) {
|
||||
kex = Factory.Named.Util.getNames(config.getKeyExchangeFactories());
|
||||
if (initialKex) {
|
||||
kex.add("kex-strict-c-v00@openssh.com");
|
||||
}
|
||||
sig = filterKnownHostKeyAlgorithms(Factory.Named.Util.getNames(config.getKeyAlgorithms()), knownHostAlgs);
|
||||
c2sCipher = s2cCipher = Factory.Named.Util.getNames(config.getCipherFactories());
|
||||
c2sMAC = s2cMAC = Factory.Named.Util.getNames(config.getMACFactories());
|
||||
@@ -92,6 +94,10 @@ class Proposal {
|
||||
return kex;
|
||||
}
|
||||
|
||||
public boolean isStrictKeyExchangeSupportedByServer() {
|
||||
return kex.contains("kex-strict-s-v00@openssh.com");
|
||||
}
|
||||
|
||||
public List<String> getHostKeyAlgorithms() {
|
||||
return sig;
|
||||
}
|
||||
@@ -140,8 +146,8 @@ class Proposal {
|
||||
firstMatch("Client2ServerCompressionAlgorithms", this.getClient2ServerCompressionAlgorithms(),
|
||||
other.getClient2ServerCompressionAlgorithms()),
|
||||
firstMatch("Server2ClientCompressionAlgorithms", this.getServer2ClientCompressionAlgorithms(),
|
||||
other.getServer2ClientCompressionAlgorithms()),
|
||||
other.getHostKeyAlgorithms().containsAll(KeyAlgorithms.SSH_RSA_SHA2_ALGORITHMS));
|
||||
other.getServer2ClientCompressionAlgorithms())
|
||||
);
|
||||
}
|
||||
|
||||
private List<String> filterKnownHostKeyAlgorithms(List<String> configuredKeyAlgorithms, List<String> knownHostKeyAlgorithms) {
|
||||
|
||||
@@ -29,7 +29,7 @@ public final class Reader
|
||||
public Reader(TransportImpl trans) {
|
||||
this.trans = trans;
|
||||
log = trans.getConfig().getLoggerFactory().getLogger(getClass());
|
||||
setName("reader");
|
||||
setName("sshj-Reader");
|
||||
setDaemon(true);
|
||||
}
|
||||
|
||||
|
||||
@@ -15,6 +15,7 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport;
|
||||
|
||||
import com.hierynomus.sshj.common.RemoteAddressProvider;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithm;
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.Service;
|
||||
@@ -27,11 +28,12 @@ import net.schmizz.sshj.transport.verification.HostKeyVerifier;
|
||||
|
||||
import java.io.InputStream;
|
||||
import java.io.OutputStream;
|
||||
import java.util.List;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
/** Transport layer of the SSH protocol. */
|
||||
public interface Transport
|
||||
extends SSHPacketHandler {
|
||||
extends SSHPacketHandler, RemoteAddressProvider {
|
||||
|
||||
/**
|
||||
* Sets the host information and the streams to be used by this transport. Identification information is exchanged
|
||||
@@ -208,7 +210,7 @@ public interface Transport
|
||||
/**
|
||||
* Specify a {@code listener} that will be notified upon disconnection.
|
||||
*
|
||||
* @param listener
|
||||
* @param listener Disconnect Listener to be configured
|
||||
*/
|
||||
void setDisconnectListener(DisconnectListener listener);
|
||||
|
||||
@@ -223,5 +225,5 @@ public interface Transport
|
||||
void die(Exception e);
|
||||
|
||||
KeyAlgorithm getHostKeyAlgorithm();
|
||||
KeyAlgorithm getClientKeyAlgorithm(KeyType keyType) throws TransportException;
|
||||
List<KeyAlgorithm> getClientKeyAlgorithms(KeyType keyType) throws TransportException;
|
||||
}
|
||||
|
||||
@@ -15,6 +15,7 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport;
|
||||
|
||||
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithm;
|
||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||
import com.hierynomus.sshj.transport.IdentificationStringParser;
|
||||
@@ -22,7 +23,6 @@ import net.schmizz.concurrent.ErrorDeliveryUtil;
|
||||
import net.schmizz.concurrent.Event;
|
||||
import net.schmizz.sshj.AbstractService;
|
||||
import net.schmizz.sshj.Config;
|
||||
import net.schmizz.sshj.SSHClient;
|
||||
import net.schmizz.sshj.Service;
|
||||
import net.schmizz.sshj.common.*;
|
||||
import net.schmizz.sshj.transport.verification.AlgorithmsVerifier;
|
||||
@@ -32,6 +32,8 @@ import org.slf4j.Logger;
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
import java.io.OutputStream;
|
||||
import java.net.InetSocketAddress;
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
import java.util.concurrent.locks.ReentrantLock;
|
||||
@@ -86,8 +88,6 @@ public final class TransportImpl
|
||||
|
||||
private KeyAlgorithm hostKeyAlgorithm;
|
||||
|
||||
private boolean rsaSHA2Support;
|
||||
|
||||
private final Event<TransportException> serviceAccept;
|
||||
|
||||
private final Event<TransportException> close;
|
||||
@@ -130,8 +130,8 @@ public final class TransportImpl
|
||||
public TransportImpl(Config config) {
|
||||
this.config = config;
|
||||
this.loggerFactory = config.getLoggerFactory();
|
||||
this.serviceAccept = new Event<TransportException>("service accept", TransportException.chainer, loggerFactory);
|
||||
this.close = new Event<TransportException>("transport close", TransportException.chainer, loggerFactory);
|
||||
this.serviceAccept = new Event<>("service accept", TransportException.chainer, loggerFactory);
|
||||
this.close = new Event<>("transport close", TransportException.chainer, loggerFactory);
|
||||
this.nullService = new NullService(this);
|
||||
this.service = nullService;
|
||||
this.log = loggerFactory.getLogger(getClass());
|
||||
@@ -165,9 +165,20 @@ public final class TransportImpl
|
||||
throw new TransportException(e);
|
||||
}
|
||||
|
||||
ThreadNameProvider.setThreadName(reader, this);
|
||||
reader.start();
|
||||
}
|
||||
|
||||
/**
|
||||
* Get Remote Socket Address using Connection Information
|
||||
*
|
||||
* @return Remote Socket Address or null when not connected
|
||||
*/
|
||||
@Override
|
||||
public InetSocketAddress getRemoteSocketAddress() {
|
||||
return connInfo == null ? null : new InetSocketAddress(getRemoteHost(), getRemotePort());
|
||||
}
|
||||
|
||||
/**
|
||||
* TransportImpl implements its own default DisconnectListener.
|
||||
*/
|
||||
@@ -211,7 +222,7 @@ public final class TransportImpl
|
||||
*
|
||||
* @param buffer The buffer to read from.
|
||||
* @return empty string if full ident string has not yet been received
|
||||
* @throws IOException
|
||||
* @throws IOException Thrown when protocol version is not supported
|
||||
*/
|
||||
private String readIdentification(Buffer.PlainBuffer buffer)
|
||||
throws IOException {
|
||||
@@ -415,7 +426,7 @@ public final class TransportImpl
|
||||
assert m != Message.KEXINIT;
|
||||
kexer.waitForDone();
|
||||
}
|
||||
} else if (encoder.getSequenceNumber() == 0) // We get here every 2**32th packet
|
||||
} else if (encoder.isSequenceNumberAtMax()) // We get here every 2**32th packet
|
||||
kexer.startKex(true);
|
||||
|
||||
final long seq = encoder.encode(payload);
|
||||
@@ -468,9 +479,20 @@ public final class TransportImpl
|
||||
|
||||
log.trace("Received packet {}", msg);
|
||||
|
||||
if (kexer.isInitialKex()) {
|
||||
if (decoder.isSequenceNumberAtMax()) {
|
||||
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||
"Sequence number of decoder is about to wrap during initial key exchange");
|
||||
}
|
||||
if (kexer.isStrictKex() && !isKexerPacket(msg) && msg != Message.DISCONNECT) {
|
||||
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||
"Unexpected packet type during initial strict key exchange");
|
||||
}
|
||||
}
|
||||
|
||||
if (msg.geq(50)) { // not a transport layer packet
|
||||
service.handle(msg, buf);
|
||||
} else if (msg.in(20, 21) || msg.in(30, 49)) { // kex packet
|
||||
} else if (isKexerPacket(msg)) {
|
||||
kexer.handle(msg, buf);
|
||||
} else {
|
||||
switch (msg) {
|
||||
@@ -502,6 +524,10 @@ public final class TransportImpl
|
||||
}
|
||||
}
|
||||
|
||||
private static boolean isKexerPacket(Message msg) {
|
||||
return msg.in(20, 21) || msg.in(30, 49);
|
||||
}
|
||||
|
||||
private void gotDebug(SSHPacket buf)
|
||||
throws TransportException {
|
||||
try {
|
||||
@@ -544,7 +570,7 @@ public final class TransportImpl
|
||||
* Got an SSH_MSG_UNIMPLEMENTED, so lets see where we're at and act accordingly.
|
||||
*
|
||||
* @param packet The 'unimplemented' packet received
|
||||
* @throws TransportException
|
||||
* @throws TransportException Thrown when key exchange is ongoing
|
||||
*/
|
||||
private void gotUnimplemented(SSHPacket packet)
|
||||
throws SSHException {
|
||||
@@ -626,21 +652,19 @@ public final class TransportImpl
|
||||
return this.hostKeyAlgorithm;
|
||||
}
|
||||
|
||||
public void setRSASHA2Support(boolean rsaSHA2Support) {
|
||||
this.rsaSHA2Support = rsaSHA2Support;
|
||||
}
|
||||
|
||||
@Override
|
||||
public KeyAlgorithm getClientKeyAlgorithm(KeyType keyType) throws TransportException {
|
||||
if (keyType != KeyType.RSA || !rsaSHA2Support) {
|
||||
return Factory.Named.Util.create(getConfig().getKeyAlgorithms(), keyType.toString());
|
||||
}
|
||||
|
||||
public List<KeyAlgorithm> getClientKeyAlgorithms(KeyType keyType) throws TransportException {
|
||||
List<Factory.Named<KeyAlgorithm>> factories = getConfig().getKeyAlgorithms();
|
||||
List<KeyAlgorithm> available = new ArrayList<>();
|
||||
if (factories != null)
|
||||
for (Factory.Named<KeyAlgorithm> f : factories)
|
||||
if (f.getName().equals("ssh-rsa") || KeyAlgorithms.SSH_RSA_SHA2_ALGORITHMS.contains(f.getName()))
|
||||
return f.create();
|
||||
throw new TransportException("Cannot find an available KeyAlgorithm for type " + keyType);
|
||||
if (
|
||||
f instanceof KeyAlgorithms.Factory && ((KeyAlgorithms.Factory) f).getKeyType().equals(keyType)
|
||||
|| !(f instanceof KeyAlgorithms.Factory) && f.getName().equals(keyType.toString())
|
||||
)
|
||||
available.add(f.create());
|
||||
if (available.isEmpty())
|
||||
throw new TransportException("Cannot find an available KeyAlgorithm for type " + keyType);
|
||||
return available;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -15,18 +15,15 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport.compression;
|
||||
|
||||
import com.jcraft.jzlib.Deflater;
|
||||
import com.jcraft.jzlib.GZIPException;
|
||||
import com.jcraft.jzlib.Inflater;
|
||||
import com.jcraft.jzlib.JZlib;
|
||||
import java.util.zip.DataFormatException;
|
||||
import java.util.zip.Deflater;
|
||||
import java.util.zip.Inflater;
|
||||
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.DisconnectReason;
|
||||
import net.schmizz.sshj.common.SSHRuntimeException;
|
||||
import net.schmizz.sshj.transport.TransportException;
|
||||
|
||||
/** ZLib based Compression. */
|
||||
public class ZlibCompression
|
||||
implements Compression {
|
||||
public class ZlibCompression implements Compression {
|
||||
|
||||
/** Named factory for the ZLib Compression. */
|
||||
public static class Factory
|
||||
@@ -52,19 +49,15 @@ public class ZlibCompression
|
||||
|
||||
@Override
|
||||
public void init(Mode mode) {
|
||||
try {
|
||||
switch (mode) {
|
||||
case DEFLATE:
|
||||
deflater = new Deflater(JZlib.Z_DEFAULT_COMPRESSION);
|
||||
break;
|
||||
case INFLATE:
|
||||
inflater = new Inflater();
|
||||
break;
|
||||
default:
|
||||
assert false;
|
||||
}
|
||||
} catch (GZIPException gze) {
|
||||
|
||||
switch (mode) {
|
||||
case DEFLATE:
|
||||
deflater = new Deflater(Deflater.DEFAULT_COMPRESSION);
|
||||
break;
|
||||
case INFLATE:
|
||||
inflater = new Inflater();
|
||||
break;
|
||||
default:
|
||||
assert false;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -75,43 +68,32 @@ public class ZlibCompression
|
||||
|
||||
@Override
|
||||
public void compress(Buffer buffer) {
|
||||
deflater.setNextIn(buffer.array());
|
||||
deflater.setNextInIndex(buffer.rpos());
|
||||
deflater.setAvailIn(buffer.available());
|
||||
deflater.setInput(buffer.array(), buffer.rpos(), buffer.available());
|
||||
buffer.wpos(buffer.rpos());
|
||||
do {
|
||||
deflater.setNextOut(tempBuf);
|
||||
deflater.setNextOutIndex(0);
|
||||
deflater.setAvailOut(BUF_SIZE);
|
||||
final int status = deflater.deflate(JZlib.Z_PARTIAL_FLUSH);
|
||||
if (status == JZlib.Z_OK) {
|
||||
buffer.putRawBytes(tempBuf, 0, BUF_SIZE - deflater.getAvailOut());
|
||||
while (true) {
|
||||
final int len = deflater.deflate(tempBuf, 0, BUF_SIZE, Deflater.SYNC_FLUSH);
|
||||
if(len > 0) {
|
||||
buffer.putRawBytes(tempBuf, 0, len);
|
||||
} else {
|
||||
throw new SSHRuntimeException("compress: deflate returned " + status);
|
||||
return;
|
||||
}
|
||||
} while (deflater.getAvailOut() == 0);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@Override
|
||||
public void uncompress(Buffer from, Buffer to)
|
||||
throws TransportException {
|
||||
inflater.setNextIn(from.array());
|
||||
inflater.setNextInIndex(from.rpos());
|
||||
inflater.setAvailIn(from.available());
|
||||
inflater.setInput(from.array(), from.rpos(), from.available());
|
||||
while (true) {
|
||||
inflater.setNextOut(tempBuf);
|
||||
inflater.setNextOutIndex(0);
|
||||
inflater.setAvailOut(BUF_SIZE);
|
||||
final int status = inflater.inflate(JZlib.Z_PARTIAL_FLUSH);
|
||||
switch (status) {
|
||||
case JZlib.Z_OK:
|
||||
to.putRawBytes(tempBuf, 0, BUF_SIZE - inflater.getAvailOut());
|
||||
break;
|
||||
case JZlib.Z_BUF_ERROR:
|
||||
try {
|
||||
int len = inflater.inflate(tempBuf, 0, BUF_SIZE);
|
||||
if(len > 0) {
|
||||
to.putRawBytes(tempBuf, 0, len);
|
||||
} else {
|
||||
return;
|
||||
default:
|
||||
throw new TransportException(DisconnectReason.COMPRESSION_ERROR, "uncompress: inflate returned " + status);
|
||||
}
|
||||
} catch (DataFormatException e) {
|
||||
throw new TransportException(DisconnectReason.COMPRESSION_ERROR, "uncompress: inflate returned " + e.getMessage());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -15,50 +15,89 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport.kex;
|
||||
|
||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
||||
import net.schmizz.sshj.common.Factory;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
import net.schmizz.sshj.transport.random.Random;
|
||||
import org.bouncycastle.asn1.x9.X9ECParameters;
|
||||
import org.bouncycastle.crypto.ec.CustomNamedCurves;
|
||||
import org.bouncycastle.jce.spec.ECParameterSpec;
|
||||
|
||||
import java.math.BigInteger;
|
||||
import java.security.GeneralSecurityException;
|
||||
import java.security.KeyFactory;
|
||||
import java.security.KeyPair;
|
||||
import java.security.PublicKey;
|
||||
import java.security.spec.AlgorithmParameterSpec;
|
||||
import java.util.Arrays;
|
||||
import java.security.spec.KeySpec;
|
||||
import java.security.spec.X509EncodedKeySpec;
|
||||
|
||||
/**
|
||||
* Key Exchange Method using Curve25519 as defined in RFC 8731
|
||||
*/
|
||||
public class Curve25519DH extends DHBase {
|
||||
|
||||
private byte[] secretKey;
|
||||
private static final String ALGORITHM = "X25519";
|
||||
|
||||
private static final int ENCODED_ALGORITHM_ID_KEY_LENGTH = 44;
|
||||
|
||||
private static final int ALGORITHM_ID_LENGTH = 12;
|
||||
|
||||
private static final int KEY_LENGTH = 32;
|
||||
|
||||
private final byte[] algorithmId = new byte[ALGORITHM_ID_LENGTH];
|
||||
|
||||
public Curve25519DH() {
|
||||
super(KeyAlgorithm.ECDSA, "ECDH");
|
||||
}
|
||||
|
||||
@Override
|
||||
void computeK(byte[] f) throws GeneralSecurityException {
|
||||
byte[] k = new byte[32];
|
||||
djb.Curve25519.curve(k, secretKey, f);
|
||||
setK(new BigInteger(1, k));
|
||||
}
|
||||
|
||||
@Override
|
||||
public void init(AlgorithmParameterSpec params, Factory<Random> randomFactory) throws GeneralSecurityException {
|
||||
Random random = randomFactory.create();
|
||||
byte[] secretBytes = new byte[32];
|
||||
random.fill(secretBytes);
|
||||
byte[] publicBytes = new byte[32];
|
||||
djb.Curve25519.keygen(publicBytes, null, secretBytes);
|
||||
this.secretKey = Arrays.copyOf(secretBytes, secretBytes.length);
|
||||
setE(publicBytes);
|
||||
super(ALGORITHM, ALGORITHM);
|
||||
}
|
||||
|
||||
/**
|
||||
* TODO want to figure out why BouncyCastle does not work.
|
||||
* @return The initialized curve25519 parameter spec
|
||||
* Compute Shared Secret Key using Diffie-Hellman Curve25519 known as X25519
|
||||
*
|
||||
* @param peerPublicKey Peer public key bytes
|
||||
* @throws GeneralSecurityException Thrown on key agreement failures
|
||||
*/
|
||||
public static AlgorithmParameterSpec getCurve25519Params() {
|
||||
X9ECParameters ecP = CustomNamedCurves.getByName("curve25519");
|
||||
return new ECParameterSpec(ecP.getCurve(), ecP.getG(), ecP.getN(), ecP.getH(), ecP.getSeed());
|
||||
@Override
|
||||
void computeK(final byte[] peerPublicKey) throws GeneralSecurityException {
|
||||
final KeyFactory keyFactory = SecurityUtils.getKeyFactory(ALGORITHM);
|
||||
final KeySpec peerPublicKeySpec = getPeerPublicKeySpec(peerPublicKey);
|
||||
final PublicKey generatedPeerPublicKey = keyFactory.generatePublic(peerPublicKeySpec);
|
||||
|
||||
agreement.doPhase(generatedPeerPublicKey, true);
|
||||
final byte[] sharedSecretKey = agreement.generateSecret();
|
||||
final BigInteger sharedSecretNumber = new BigInteger(BigInteger.ONE.signum(), sharedSecretKey);
|
||||
setK(sharedSecretNumber);
|
||||
}
|
||||
|
||||
/**
|
||||
* Initialize Key Agreement with generated Public and Private Key Pair
|
||||
*
|
||||
* @param params Parameters not used
|
||||
* @param randomFactory Random Factory not used
|
||||
* @throws GeneralSecurityException Thrown on key agreement initialization failures
|
||||
*/
|
||||
@Override
|
||||
public void init(final AlgorithmParameterSpec params, final Factory<Random> randomFactory) throws GeneralSecurityException {
|
||||
final KeyPair keyPair = generator.generateKeyPair();
|
||||
agreement.init(keyPair.getPrivate());
|
||||
setPublicKey(keyPair.getPublic());
|
||||
}
|
||||
|
||||
private void setPublicKey(final PublicKey publicKey) {
|
||||
final byte[] encoded = publicKey.getEncoded();
|
||||
|
||||
// Encoded public key consists of the algorithm identifier and public key
|
||||
if (encoded.length == ENCODED_ALGORITHM_ID_KEY_LENGTH) {
|
||||
final byte[] publicKeyEncoded = new byte[KEY_LENGTH];
|
||||
System.arraycopy(encoded, ALGORITHM_ID_LENGTH, publicKeyEncoded, 0, KEY_LENGTH);
|
||||
setE(publicKeyEncoded);
|
||||
|
||||
// Save Algorithm Identifier byte array
|
||||
System.arraycopy(encoded, 0, algorithmId, 0, ALGORITHM_ID_LENGTH);
|
||||
} else {
|
||||
throw new IllegalArgumentException(String.format("X25519 unsupported public key length [%d]", encoded.length));
|
||||
}
|
||||
}
|
||||
|
||||
private KeySpec getPeerPublicKeySpec(final byte[] peerPublicKey) {
|
||||
final byte[] encodedKeySpec = new byte[ENCODED_ALGORITHM_ID_KEY_LENGTH];
|
||||
System.arraycopy(algorithmId, 0, encodedKeySpec, 0, ALGORITHM_ID_LENGTH);
|
||||
System.arraycopy(peerPublicKey, 0, encodedKeySpec, ALGORITHM_ID_LENGTH, KEY_LENGTH);
|
||||
return new X509EncodedKeySpec(encodedKeySpec);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -56,6 +56,6 @@ public class Curve25519SHA256 extends AbstractDHG {
|
||||
|
||||
@Override
|
||||
protected void initDH(DHBase dh) throws GeneralSecurityException {
|
||||
dh.init(Curve25519DH.getCurve25519Params(), trans.getConfig().getRandomFactory());
|
||||
dh.init(null, trans.getConfig().getRandomFactory());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -15,16 +15,15 @@
|
||||
*/
|
||||
package net.schmizz.sshj.transport.verification;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.security.GeneralSecurityException;
|
||||
import java.security.MessageDigest;
|
||||
import java.security.PublicKey;
|
||||
import java.util.Arrays;
|
||||
import java.util.Base64;
|
||||
import java.util.Collections;
|
||||
import java.util.List;
|
||||
import java.util.regex.Pattern;
|
||||
|
||||
import net.schmizz.sshj.common.Base64;
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.SSHRuntimeException;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
@@ -46,48 +45,40 @@ public class FingerprintVerifier implements HostKeyVerifier {
|
||||
*
|
||||
* @param fingerprint of an SSH fingerprint in MD5 (hex), SHA-1 (base64) or SHA-256(base64) format
|
||||
*
|
||||
* @return
|
||||
* @return Host Key Verifier
|
||||
*/
|
||||
public static HostKeyVerifier getInstance(String fingerprint) {
|
||||
|
||||
try {
|
||||
if (fingerprint.startsWith("SHA1:")) {
|
||||
return new FingerprintVerifier("SHA-1", fingerprint.substring(5));
|
||||
}
|
||||
|
||||
if (fingerprint.startsWith("SHA256:")) {
|
||||
return new FingerprintVerifier("SHA-256", fingerprint.substring(7));
|
||||
}
|
||||
|
||||
final String md5;
|
||||
if (fingerprint.startsWith("MD5:")) {
|
||||
md5 = fingerprint.substring(4); // remove the MD5: prefix
|
||||
} else {
|
||||
md5 = fingerprint;
|
||||
}
|
||||
|
||||
if (!MD5_FINGERPRINT_PATTERN.matcher(md5).matches()) {
|
||||
throw new SSHRuntimeException("Invalid MD5 fingerprint: " + fingerprint);
|
||||
}
|
||||
|
||||
// Use the old default fingerprint verifier for md5 fingerprints
|
||||
return (new HostKeyVerifier() {
|
||||
@Override
|
||||
public boolean verify(String h, int p, PublicKey k) {
|
||||
return SecurityUtils.getFingerprint(k).equals(md5);
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<String> findExistingAlgorithms(String hostname, int port) {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
});
|
||||
} catch (SSHRuntimeException e) {
|
||||
throw e;
|
||||
} catch (IOException e) {
|
||||
throw new SSHRuntimeException(e);
|
||||
if (fingerprint.startsWith("SHA1:")) {
|
||||
return new FingerprintVerifier("SHA-1", fingerprint.substring(5));
|
||||
}
|
||||
|
||||
if (fingerprint.startsWith("SHA256:")) {
|
||||
return new FingerprintVerifier("SHA-256", fingerprint.substring(7));
|
||||
}
|
||||
|
||||
final String md5;
|
||||
if (fingerprint.startsWith("MD5:")) {
|
||||
md5 = fingerprint.substring(4); // remove the MD5: prefix
|
||||
} else {
|
||||
md5 = fingerprint;
|
||||
}
|
||||
|
||||
if (!MD5_FINGERPRINT_PATTERN.matcher(md5).matches()) {
|
||||
throw new SSHRuntimeException("Invalid MD5 fingerprint: " + fingerprint);
|
||||
}
|
||||
|
||||
// Use the old default fingerprint verifier for md5 fingerprints
|
||||
return (new HostKeyVerifier() {
|
||||
@Override
|
||||
public boolean verify(String h, int p, PublicKey k) {
|
||||
return SecurityUtils.getFingerprint(k).equals(md5);
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<String> findExistingAlgorithms(String hostname, int port) {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
private final String digestAlgorithm;
|
||||
@@ -99,10 +90,8 @@ public class FingerprintVerifier implements HostKeyVerifier {
|
||||
* the used digest algorithm
|
||||
* @param base64Fingerprint
|
||||
* base64 encoded fingerprint data
|
||||
*
|
||||
* @throws IOException
|
||||
*/
|
||||
private FingerprintVerifier(String digestAlgorithm, String base64Fingerprint) throws IOException {
|
||||
private FingerprintVerifier(String digestAlgorithm, String base64Fingerprint) {
|
||||
this.digestAlgorithm = digestAlgorithm;
|
||||
|
||||
// if the length is not padded with "=" chars at the end so that it is divisible by 4 the SSHJ Base64 implementation does not work correctly
|
||||
@@ -110,7 +99,7 @@ public class FingerprintVerifier implements HostKeyVerifier {
|
||||
while (base64FingerprintBuilder.length() % 4 != 0) {
|
||||
base64FingerprintBuilder.append("=");
|
||||
}
|
||||
fingerprintData = Base64.decode(base64FingerprintBuilder.toString());
|
||||
fingerprintData = Base64.getDecoder().decode(base64FingerprintBuilder.toString());
|
||||
}
|
||||
|
||||
@Override
|
||||
|
||||
@@ -18,15 +18,31 @@ package net.schmizz.sshj.transport.verification;
|
||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
||||
import com.hierynomus.sshj.transport.verification.KnownHostMatchers;
|
||||
import com.hierynomus.sshj.userauth.certificate.Certificate;
|
||||
import net.schmizz.sshj.common.*;
|
||||
import net.schmizz.sshj.common.Buffer;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.common.KeyType;
|
||||
import net.schmizz.sshj.common.LoggerFactory;
|
||||
import net.schmizz.sshj.common.SSHException;
|
||||
import net.schmizz.sshj.common.SSHRuntimeException;
|
||||
import net.schmizz.sshj.common.SecurityUtils;
|
||||
import org.slf4j.Logger;
|
||||
|
||||
import java.io.*;
|
||||
import java.io.BufferedOutputStream;
|
||||
import java.io.BufferedReader;
|
||||
import java.io.BufferedWriter;
|
||||
import java.io.File;
|
||||
import java.io.FileOutputStream;
|
||||
import java.io.FileReader;
|
||||
import java.io.FileWriter;
|
||||
import java.io.IOException;
|
||||
import java.io.Reader;
|
||||
import java.math.BigInteger;
|
||||
import java.security.KeyFactory;
|
||||
import java.security.PublicKey;
|
||||
import java.security.spec.RSAPublicKeySpec;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
import java.util.Base64;
|
||||
import java.util.List;
|
||||
|
||||
/**
|
||||
@@ -138,7 +154,19 @@ public class OpenSSHKnownHosts
|
||||
for (KnownHostEntry e : entries) {
|
||||
try {
|
||||
if (e.appliesTo(adjustedHostname)) {
|
||||
knownHostAlgorithms.add(e.getType().toString());
|
||||
final KeyType type = e.getType();
|
||||
if (e instanceof HostEntry && ((HostEntry) e).marker == Marker.CA_CERT) {
|
||||
// Only the CA key type is known, but the type of the host key is not.
|
||||
// Adding all supported types for keys with certificates.
|
||||
for (final KeyType candidate : KeyType.values()) {
|
||||
if (candidate.getParent() != null) {
|
||||
knownHostAlgorithms.add(candidate.toString());
|
||||
}
|
||||
}
|
||||
}
|
||||
else {
|
||||
knownHostAlgorithms.add(type.toString());
|
||||
}
|
||||
}
|
||||
} catch (IOException ioe) {
|
||||
}
|
||||
@@ -262,7 +290,7 @@ public class OpenSSHKnownHosts
|
||||
if (type != KeyType.UNKNOWN) {
|
||||
final String sKey = split[i++];
|
||||
try {
|
||||
byte[] keyBytes = Base64.decode(sKey);
|
||||
byte[] keyBytes = Base64.getDecoder().decode(sKey);
|
||||
key = new Buffer.PlainBuffer(keyBytes).readPublicKey();
|
||||
} catch (IOException ioe) {
|
||||
log.warn("Error decoding Base64 key bytes", ioe);
|
||||
@@ -442,7 +470,7 @@ public class OpenSSHKnownHosts
|
||||
|
||||
private String getKeyString(PublicKey pk) {
|
||||
final Buffer.PlainBuffer buf = new Buffer.PlainBuffer().putPublicKey(pk);
|
||||
return Base64.encodeBytes(buf.array(), buf.rpos(), buf.available());
|
||||
return Base64.getEncoder().encodeToString(Arrays.copyOfRange(buf.array(), buf.rpos(), buf.available()));
|
||||
}
|
||||
|
||||
protected String getHostPart() {
|
||||
|
||||
@@ -16,10 +16,9 @@
|
||||
package net.schmizz.sshj.userauth.keyprovider;
|
||||
|
||||
/**
|
||||
* @version $Id:$
|
||||
* Key File Formats
|
||||
*/
|
||||
public enum KeyFormat {
|
||||
PKCS5,
|
||||
PKCS8,
|
||||
OpenSSH,
|
||||
OpenSSHv1,
|
||||
|
||||
@@ -27,9 +27,9 @@ public class KeyProviderUtil {
|
||||
* <p/>
|
||||
* Return values are consistent with the {@code NamedFactory} implementations in the {@code keyprovider} package.
|
||||
*
|
||||
* @param location
|
||||
* @param location File Path to key
|
||||
* @return name of the key file format
|
||||
* @throws java.io.IOException
|
||||
* @throws java.io.IOException Thrown on file processing failures
|
||||
*/
|
||||
public static KeyFormat detectKeyFileFormat(File location)
|
||||
throws IOException {
|
||||
@@ -45,7 +45,7 @@ public class KeyProviderUtil {
|
||||
* @param privateKey Private key stored in a string
|
||||
* @param separatePubKey Is the public key stored separately from the private key
|
||||
* @return name of the key file format
|
||||
* @throws java.io.IOException
|
||||
* @throws java.io.IOException Thrown on file processing failures
|
||||
*/
|
||||
public static KeyFormat detectKeyFileFormat(String privateKey, boolean separatePubKey)
|
||||
throws IOException {
|
||||
@@ -60,7 +60,7 @@ public class KeyProviderUtil {
|
||||
* @param privateKey Private key accessible through a {@code Reader}
|
||||
* @param separatePubKey Is the public key stored separately from the private key
|
||||
* @return name of the key file format
|
||||
* @throws java.io.IOException
|
||||
* @throws java.io.IOException Thrown on file processing failures
|
||||
*/
|
||||
public static KeyFormat detectKeyFileFormat(Reader privateKey, boolean separatePubKey)
|
||||
throws IOException {
|
||||
@@ -94,10 +94,8 @@ public class KeyProviderUtil {
|
||||
} else if (separatePubKey) {
|
||||
// Can delay asking for password since have unencrypted pubkey
|
||||
return KeyFormat.OpenSSH;
|
||||
} else if (header.contains("BEGIN PRIVATE KEY") || header.contains("BEGIN ENCRYPTED PRIVATE KEY")) {
|
||||
return KeyFormat.PKCS8;
|
||||
} else {
|
||||
return KeyFormat.PKCS5;
|
||||
return KeyFormat.PKCS8;
|
||||
}
|
||||
} else if (header.startsWith("PuTTY-User-Key-File-")) {
|
||||
return KeyFormat.PuTTY;
|
||||
|
||||
@@ -1,272 +0,0 @@
|
||||
/*
|
||||
* Copyright (C)2009 - SSHJ Contributors
|
||||
*
|
||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||
* you may not use this file except in compliance with the License.
|
||||
* You may obtain a copy of the License at
|
||||
*
|
||||
* http://www.apache.org/licenses/LICENSE-2.0
|
||||
*
|
||||
* Unless required by applicable law or agreed to in writing, software
|
||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
* See the License for the specific language governing permissions and
|
||||
* limitations under the License.
|
||||
*/
|
||||
package net.schmizz.sshj.userauth.keyprovider;
|
||||
|
||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
||||
import com.hierynomus.sshj.transport.cipher.BlockCiphers;
|
||||
import net.schmizz.sshj.common.Base64;
|
||||
import net.schmizz.sshj.common.ByteArrayUtils;
|
||||
import net.schmizz.sshj.common.IOUtils;
|
||||
import net.schmizz.sshj.common.KeyType;
|
||||
import net.schmizz.sshj.transport.cipher.*;
|
||||
import net.schmizz.sshj.transport.digest.Digest;
|
||||
import net.schmizz.sshj.transport.digest.MD5;
|
||||
|
||||
import java.io.BufferedReader;
|
||||
import java.io.EOFException;
|
||||
import java.io.IOException;
|
||||
import java.math.BigInteger;
|
||||
import java.nio.ByteBuffer;
|
||||
import java.nio.CharBuffer;
|
||||
import java.security.*;
|
||||
import java.security.spec.*;
|
||||
import java.util.Arrays;
|
||||
|
||||
/**
|
||||
* Represents a PKCS5-encoded key file. This is the format typically used by OpenSSH, OpenSSL, Amazon, etc.
|
||||
*/
|
||||
public class PKCS5KeyFile extends BaseFileKeyProvider {
|
||||
|
||||
public static class Factory
|
||||
implements net.schmizz.sshj.common.Factory.Named<FileKeyProvider> {
|
||||
|
||||
@Override
|
||||
public FileKeyProvider create() {
|
||||
return new PKCS5KeyFile();
|
||||
}
|
||||
|
||||
@Override
|
||||
public String getName() {
|
||||
return "PKCS5";
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Indicates a format issue with PKCS5 data
|
||||
*/
|
||||
public static class FormatException
|
||||
extends IOException {
|
||||
|
||||
FormatException(String msg) {
|
||||
super(msg);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Indicates a problem decrypting the data
|
||||
*/
|
||||
public static class DecryptException
|
||||
extends IOException {
|
||||
|
||||
DecryptException(String msg) {
|
||||
super(msg);
|
||||
}
|
||||
}
|
||||
|
||||
protected byte[] data;
|
||||
|
||||
protected KeyPair readKeyPair()
|
||||
throws IOException {
|
||||
|
||||
BufferedReader reader = new BufferedReader(resource.getReader());
|
||||
try {
|
||||
String line = null;
|
||||
Cipher cipher = new NoneCipher();
|
||||
StringBuffer sb = new StringBuffer();
|
||||
byte[] iv = new byte[0]; // salt
|
||||
while ((line = reader.readLine()) != null) {
|
||||
if (line.startsWith("-----BEGIN ") && line.endsWith(" PRIVATE KEY-----")) {
|
||||
int end = line.length() - 17;
|
||||
if (end > 11) {
|
||||
String s = line.substring(11, line.length() - 17);
|
||||
if ("RSA".equals(s)) {
|
||||
type = KeyType.RSA;
|
||||
} else if ("DSA".equals(s)) {
|
||||
type = KeyType.DSA;
|
||||
} else if ("DSS".equals(s)) {
|
||||
type = KeyType.DSA;
|
||||
} else {
|
||||
throw new FormatException("Unrecognized PKCS5 key type");
|
||||
}
|
||||
} else {
|
||||
throw new FormatException("Bad header; possibly PKCS8 format?");
|
||||
}
|
||||
} else if (line.startsWith("-----END")) {
|
||||
break;
|
||||
} else if (type != null) {
|
||||
if (line.startsWith("Proc-Type: ")) {
|
||||
if (!"4,ENCRYPTED".equals(line.substring(11))) {
|
||||
throw new FormatException("Unrecognized Proc-Type");
|
||||
}
|
||||
} else if (line.startsWith("DEK-Info: ")) {
|
||||
int ptr = line.indexOf(",");
|
||||
if (ptr == -1) {
|
||||
throw new FormatException("Unrecognized DEK-Info");
|
||||
} else {
|
||||
String algorithm = line.substring(10, ptr);
|
||||
if ("DES-EDE3-CBC".equals(algorithm)) {
|
||||
cipher = BlockCiphers.TripleDESCBC().create();
|
||||
} else if ("AES-128-CBC".equals(algorithm)) {
|
||||
cipher = BlockCiphers.AES128CBC().create();
|
||||
} else if ("AES-192-CBC".equals(algorithm)) {
|
||||
cipher = BlockCiphers.AES192CBC().create();
|
||||
} else if ("AES-256-CBC".equals(algorithm)) {
|
||||
cipher = BlockCiphers.AES256CBC().create();
|
||||
} else {
|
||||
throw new FormatException("Not a supported algorithm: " + algorithm);
|
||||
}
|
||||
iv = Arrays.copyOfRange(ByteArrayUtils.parseHex(line.substring(ptr + 1)), 0, cipher.getIVSize());
|
||||
}
|
||||
} else if (line.length() > 0) {
|
||||
sb.append(line);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (type == null) {
|
||||
throw new FormatException("PKCS5 header not found");
|
||||
}
|
||||
ASN1Data asn = new ASN1Data(data = decrypt(Base64.decode(sb.toString()), cipher, iv));
|
||||
switch (type) {
|
||||
case RSA: {
|
||||
KeyFactory factory = KeyFactory.getInstance(KeyAlgorithm.RSA);
|
||||
asn.readNext();
|
||||
BigInteger modulus = asn.readNext();
|
||||
BigInteger pubExp = asn.readNext();
|
||||
BigInteger prvExp = asn.readNext();
|
||||
PublicKey pubKey = factory.generatePublic(new RSAPublicKeySpec(modulus, pubExp));
|
||||
PrivateKey prvKey = factory.generatePrivate(new RSAPrivateKeySpec(modulus, prvExp));
|
||||
return new KeyPair(pubKey, prvKey);
|
||||
}
|
||||
case DSA: {
|
||||
KeyFactory factory = KeyFactory.getInstance(KeyAlgorithm.DSA);
|
||||
asn.readNext();
|
||||
BigInteger p = asn.readNext();
|
||||
BigInteger q = asn.readNext();
|
||||
BigInteger g = asn.readNext();
|
||||
BigInteger pub = asn.readNext();
|
||||
BigInteger prv = asn.readNext();
|
||||
PublicKey pubKey = factory.generatePublic(new DSAPublicKeySpec(pub, p, q, g));
|
||||
PrivateKey prvKey = factory.generatePrivate(new DSAPrivateKeySpec(prv, p, q, g));
|
||||
return new KeyPair(pubKey, prvKey);
|
||||
}
|
||||
default:
|
||||
throw new IOException("Unrecognized PKCS5 key type: " + type);
|
||||
}
|
||||
} catch (NoSuchAlgorithmException e) {
|
||||
throw new IOException(e);
|
||||
} catch (InvalidKeySpecException e) {
|
||||
throw new IOException(e);
|
||||
} finally {
|
||||
reader.close();
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return "PKCS5KeyFile{resource=" + resource + "}";
|
||||
}
|
||||
|
||||
private byte[] getPassphraseBytes() {
|
||||
CharBuffer cb = CharBuffer.wrap(pwdf.reqPassword(resource));
|
||||
ByteBuffer bb = IOUtils.UTF8.encode(cb);
|
||||
byte[] result = Arrays.copyOfRange(bb.array(), bb.position(), bb.limit());
|
||||
Arrays.fill(cb.array(), '\u0000');
|
||||
Arrays.fill(bb.array(), (byte) 0);
|
||||
return result;
|
||||
}
|
||||
|
||||
private byte[] decrypt(byte[] raw, Cipher cipher, byte[] iv) throws DecryptException {
|
||||
if (pwdf == null) {
|
||||
return raw;
|
||||
}
|
||||
Digest md5 = new MD5();
|
||||
int bsize = cipher.getBlockSize();
|
||||
int hsize = md5.getBlockSize();
|
||||
int hnlen = bsize / hsize * hsize + (bsize % hsize == 0 ? 0 : hsize);
|
||||
do {
|
||||
md5.init();
|
||||
byte[] hn = new byte[hnlen];
|
||||
byte[] tmp = null;
|
||||
byte[] passphrase = getPassphraseBytes();
|
||||
for (int i = 0; i + hsize <= hn.length; ) {
|
||||
if (tmp != null) {
|
||||
md5.update(tmp, 0, tmp.length);
|
||||
}
|
||||
md5.update(passphrase, 0, passphrase.length);
|
||||
md5.update(iv, 0, iv.length > 8 ? 8 : iv.length);
|
||||
tmp = md5.digest();
|
||||
System.arraycopy(tmp, 0, hn, i, tmp.length);
|
||||
i += tmp.length;
|
||||
}
|
||||
Arrays.fill(passphrase, (byte) 0);
|
||||
byte[] key = Arrays.copyOfRange(hn, 0, bsize);
|
||||
cipher.init(Cipher.Mode.Decrypt, key, iv);
|
||||
Arrays.fill(key, (byte) 0);
|
||||
byte[] decrypted = Arrays.copyOf(raw, raw.length);
|
||||
cipher.update(decrypted, 0, decrypted.length);
|
||||
if (ASN1Data.MAGIC == decrypted[0]) {
|
||||
return decrypted;
|
||||
}
|
||||
} while (pwdf.shouldRetry(resource));
|
||||
throw new DecryptException("Decryption failed");
|
||||
}
|
||||
|
||||
class ASN1Data {
|
||||
static final byte MAGIC = (byte) 0x30;
|
||||
|
||||
private byte[] buff;
|
||||
private int index, length;
|
||||
|
||||
ASN1Data(byte[] buff) throws FormatException {
|
||||
this.buff = buff;
|
||||
index = 0;
|
||||
if (buff[index++] != MAGIC) {
|
||||
throw new FormatException("Not ASN.1 data");
|
||||
}
|
||||
length = buff[index++] & 0xff;
|
||||
if ((length & 0x80) != 0) {
|
||||
int counter = length & 0x7f;
|
||||
length = 0;
|
||||
while (counter-- > 0) {
|
||||
length = (length << 8) + (buff[index++] & 0xff);
|
||||
}
|
||||
}
|
||||
if ((index + length) > buff.length) {
|
||||
throw new FormatException("Length mismatch: " + buff.length + " != " + (index + length));
|
||||
}
|
||||
}
|
||||
|
||||
BigInteger readNext() throws IOException {
|
||||
if (index >= length) {
|
||||
throw new EOFException();
|
||||
} else if (buff[index++] != 0x02) {
|
||||
throw new IOException("Not an int code: " + Integer.toHexString(0xff & buff[index]));
|
||||
}
|
||||
int length = buff[index++] & 0xff;
|
||||
if ((length & 0x80) != 0) {
|
||||
int counter = length & 0x7f;
|
||||
length = 0;
|
||||
while (counter-- > 0) {
|
||||
length = (length << 8) + (buff[index++] & 0xff);
|
||||
}
|
||||
}
|
||||
byte[] sequence = new byte[length];
|
||||
System.arraycopy(buff, index, sequence, 0, length);
|
||||
index += length;
|
||||
return new BigInteger(sequence);
|
||||
}
|
||||
}
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user