mirror of
https://github.com/hierynomus/sshj.git
synced 2025-12-09 00:18:39 +03:00
Compare commits
78 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
31ed35407c | ||
|
|
f4f8071020 | ||
|
|
f525ed0e5b | ||
|
|
93046f315e | ||
|
|
54376b7622 | ||
|
|
f0e92c920f | ||
|
|
09e2ca512e | ||
|
|
607e80591c | ||
|
|
079cb08fb0 | ||
|
|
cf340c2a09 | ||
|
|
586a66420e | ||
|
|
624fe839cb | ||
|
|
81d77d277c | ||
|
|
70af58d199 | ||
|
|
c0d1519ee2 | ||
|
|
03f8b2224d | ||
|
|
f94444bc53 | ||
|
|
dc6b20772b | ||
|
|
81e87a4d35 | ||
|
|
a262f51900 | ||
|
|
50c753dc58 | ||
|
|
1c547886c8 | ||
|
|
b7dc869a13 | ||
|
|
4774721b49 | ||
|
|
542bb35bda | ||
|
|
3b67d2b476 | ||
|
|
9b9b208434 | ||
|
|
a3cce0d2f9 | ||
|
|
5d040dd4bb | ||
|
|
461c0e46d4 | ||
|
|
f4d34d899d | ||
|
|
2bef99c875 | ||
|
|
a186dbf0bc | ||
|
|
a5fdb29fad | ||
|
|
3069138482 | ||
|
|
a3c9c61a09 | ||
|
|
31d156b19f | ||
|
|
ec69d109e8 | ||
|
|
f35c2bd4ce | ||
|
|
07837098eb | ||
|
|
39a7be9221 | ||
|
|
e7614db94a | ||
|
|
233c0dcaa6 | ||
|
|
0d16fbe146 | ||
|
|
154a202384 | ||
|
|
830a39dc24 | ||
|
|
dcfa1833d7 | ||
|
|
6e7fb96d07 | ||
|
|
d5d6096d5d | ||
|
|
2551f8e559 | ||
|
|
430cbfcf13 | ||
|
|
ec467a3875 | ||
|
|
1b258f0677 | ||
|
|
559384ac91 | ||
|
|
5674072666 | ||
|
|
f33bfecbf5 | ||
|
|
c0f6000ff5 | ||
|
|
3de0302c84 | ||
|
|
d7e402c557 | ||
|
|
8ef996b406 | ||
|
|
e9cb90901c | ||
|
|
69812e9a81 | ||
|
|
9a939d029b | ||
|
|
50efeb6519 | ||
|
|
aabb1be52e | ||
|
|
32329e547e | ||
|
|
8cf63a96a9 | ||
|
|
cab7731928 | ||
|
|
50073db6c1 | ||
|
|
90099bbf5e | ||
|
|
ce0a7d5193 | ||
|
|
ced27fc898 | ||
|
|
624747c527 | ||
|
|
d8697c2228 | ||
|
|
7c14098f7d | ||
|
|
d5805a6c64 | ||
|
|
8a66dc5336 | ||
|
|
a5c10ab50f |
1
.gitattributes
vendored
1
.gitattributes
vendored
@@ -1 +1,2 @@
|
|||||||
*.bat text eol=crlf
|
*.bat text eol=crlf
|
||||||
|
src/itest/docker-image/** eol=lf
|
||||||
|
|||||||
24
.github/workflows/gradle.yml
vendored
24
.github/workflows/gradle.yml
vendored
@@ -6,35 +6,37 @@ name: Build SSHJ
|
|||||||
|
|
||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
branches: [ master ]
|
|
||||||
pull_request:
|
pull_request:
|
||||||
branches: [ master ]
|
branches: [ master ]
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
java12:
|
java12:
|
||||||
name: Build with Java 12
|
name: Build with Java 11
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v4
|
||||||
- name: Set up JDK 12
|
- name: Set up Java 11
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v4
|
||||||
with:
|
with:
|
||||||
java-version: 12
|
distribution: 'temurin'
|
||||||
|
java-version: 11
|
||||||
- name: Grant execute permission for gradlew
|
- name: Grant execute permission for gradlew
|
||||||
run: chmod +x gradlew
|
run: chmod +x gradlew
|
||||||
- name: Build with Gradle
|
- name: Build with Gradle
|
||||||
run: ./gradlew check
|
run: ./gradlew check
|
||||||
|
- name: Codecov
|
||||||
|
uses: codecov/codecov-action@v2
|
||||||
|
|
||||||
integration:
|
integration:
|
||||||
name: Integration test
|
name: Integration test
|
||||||
needs: [java12]
|
runs-on: ubuntu-latest
|
||||||
runs-on: [ubuntu-latest]
|
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v4
|
||||||
- run: git fetch --depth=1 origin +refs/tags/*:refs/tags/*
|
- run: git fetch --depth=1 origin +refs/tags/*:refs/tags/*
|
||||||
- uses: actions/setup-java@v1
|
- uses: actions/setup-java@v4
|
||||||
with:
|
with:
|
||||||
java-version: 12
|
distribution: 'temurin'
|
||||||
|
java-version: 11
|
||||||
- name: Grant execute permission for gradlew
|
- name: Grant execute permission for gradlew
|
||||||
run: chmod +x gradlew
|
run: chmod +x gradlew
|
||||||
- name: Build with Gradle
|
- name: Build with Gradle
|
||||||
|
|||||||
14
.github/workflows/release.yml
vendored
14
.github/workflows/release.yml
vendored
@@ -13,12 +13,13 @@ jobs:
|
|||||||
name: Build with Java 12
|
name: Build with Java 12
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
fetch-depth: 0
|
fetch-depth: 0
|
||||||
- name: Set up JDK 12
|
- name: Set up JDK 12
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v4
|
||||||
with:
|
with:
|
||||||
|
distribution: 'zulu'
|
||||||
java-version: 12
|
java-version: 12
|
||||||
- name: Grant execute permission for gradlew
|
- name: Grant execute permission for gradlew
|
||||||
run: chmod +x gradlew
|
run: chmod +x gradlew
|
||||||
@@ -29,21 +30,20 @@ jobs:
|
|||||||
needs: [java12]
|
needs: [java12]
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v4
|
||||||
with:
|
with:
|
||||||
fetch-depth: 0
|
fetch-depth: 0
|
||||||
- uses: actions/setup-java@v1
|
- uses: actions/setup-java@v4
|
||||||
with:
|
with:
|
||||||
|
distribution: 'zulu'
|
||||||
java-version: 12
|
java-version: 12
|
||||||
- name: Grant execute permission for gradlew
|
- name: Grant execute permission for gradlew
|
||||||
run: chmod +x gradlew
|
run: chmod +x gradlew
|
||||||
- name: Release
|
- name: Release
|
||||||
run: ./gradlew release -Prelease.disableChecks -Prelease.pushTagsOnly -Prelease.customUsername=${{ github.actor }} -Prelease.customPassword=${{ github.token }}
|
run: ./gradlew clean publishToSonatype closeAndReleaseSonatypeStagingRepository
|
||||||
env:
|
env:
|
||||||
ORG_GRADLE_PROJECT_signingKey: ${{ secrets.SIGNINGKEY }}
|
ORG_GRADLE_PROJECT_signingKey: ${{ secrets.SIGNINGKEY }}
|
||||||
ORG_GRADLE_PROJECT_signingKeyId: ${{ secrets.SIGNINGKEYID }}
|
ORG_GRADLE_PROJECT_signingKeyId: ${{ secrets.SIGNINGKEYID }}
|
||||||
ORG_GRADLE_PROJECT_signingPassword: ${{ secrets.SIGNINGPASSWORD }}
|
ORG_GRADLE_PROJECT_signingPassword: ${{ secrets.SIGNINGPASSWORD }}
|
||||||
ORG_GRADLE_PROJECT_sonatypeUsername: ${{ secrets.OSSRH_USERNAME }}
|
ORG_GRADLE_PROJECT_sonatypeUsername: ${{ secrets.OSSRH_USERNAME }}
|
||||||
ORG_GRADLE_PROJECT_sonatypePassword: ${{ secrets.OSSRH_PASSWORD }}
|
ORG_GRADLE_PROJECT_sonatypePassword: ${{ secrets.OSSRH_PASSWORD }}
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
68
README.adoc
68
README.adoc
@@ -1,7 +1,7 @@
|
|||||||
= sshj - SSHv2 library for Java
|
= sshj - SSHv2 library for Java
|
||||||
Jeroen van Erp
|
Jeroen van Erp
|
||||||
:sshj_groupid: com.hierynomus
|
:sshj_groupid: com.hierynomus
|
||||||
:sshj_version: 0.31.0
|
:sshj_version: 0.38.0
|
||||||
:source-highlighter: pygments
|
:source-highlighter: pygments
|
||||||
|
|
||||||
image:https://github.com/hierynomus/sshj/actions/workflows/gradle.yml/badge.svg[link="https://github.com/hierynomus/sshj/actions/workflows/gradle.yml"]
|
image:https://github.com/hierynomus/sshj/actions/workflows/gradle.yml/badge.svg[link="https://github.com/hierynomus/sshj/actions/workflows/gradle.yml"]
|
||||||
@@ -10,6 +10,8 @@ image:https://codecov.io/gh/hierynomus/sshj/branch/master/graph/badge.svg["codec
|
|||||||
image:http://www.javadoc.io/badge/com.hierynomus/sshj.svg?color=blue["JavaDocs", link="http://www.javadoc.io/doc/com.hierynomus/sshj"]
|
image:http://www.javadoc.io/badge/com.hierynomus/sshj.svg?color=blue["JavaDocs", link="http://www.javadoc.io/doc/com.hierynomus/sshj"]
|
||||||
image:https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj/badge.svg["Maven Central",link="https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj"]
|
image:https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj/badge.svg["Maven Central",link="https://maven-badges.herokuapp.com/maven-central/com.hierynomus/sshj"]
|
||||||
|
|
||||||
|
WARNING: SSHJ versions up to and including 0.37.0 are vulnerable to https://nvd.nist.gov/vuln/detail/CVE-2023-48795[CVE-2023-48795 - Terrapin]. Please upgrade to 0.38.0 or higher.
|
||||||
|
|
||||||
To get started, have a look at one of the examples. Hopefully you will find the API pleasant to work with :)
|
To get started, have a look at one of the examples. Hopefully you will find the API pleasant to work with :)
|
||||||
|
|
||||||
== Getting SSHJ
|
== Getting SSHJ
|
||||||
@@ -46,7 +48,7 @@ If your project is built using another build tool that uses the Maven Central re
|
|||||||
In the `examples` directory, there is a separate Maven project that shows how the library can be used in some sample cases. If you want to run them, follow these guidelines:
|
In the `examples` directory, there is a separate Maven project that shows how the library can be used in some sample cases. If you want to run them, follow these guidelines:
|
||||||
|
|
||||||
. Install http://maven.apache.org/[Maven 2.2.1] or up.
|
. Install http://maven.apache.org/[Maven 2.2.1] or up.
|
||||||
. Clone the Overthere repository.
|
. Clone the SSHJ repository.
|
||||||
. Go into the `examples` directory and run the command `mvn eclipse:eclipse`.
|
. Go into the `examples` directory and run the command `mvn eclipse:eclipse`.
|
||||||
. Import the `examples` project into Eclipse.
|
. Import the `examples` project into Eclipse.
|
||||||
. Change the login details in the example classes (address, username and password) and run them!
|
. Change the login details in the example classes (address, username and password) and run them!
|
||||||
@@ -95,7 +97,11 @@ If you need something that is not included, it shouldn't be too hard to add (do
|
|||||||
http://ssh-comparison.quendi.de/comparison.html[SSH Implementation Comparison]
|
http://ssh-comparison.quendi.de/comparison.html[SSH Implementation Comparison]
|
||||||
|
|
||||||
== Dependencies
|
== Dependencies
|
||||||
Java 6+. http://www.slf4j.org/download.html[slf4j] is required. http://www.bouncycastle.org/java.html[bouncycastle] is highly recommended and required for using some of the crypto algorithms. http://www.jcraft.com/jzlib/[jzlib] is required for using zlib compression.
|
|
||||||
|
- Java 8 or higher
|
||||||
|
- https://www.slf4j.org/[SLF4J 2.0.0]
|
||||||
|
- https://www.bouncycastle.org[Bouncy Castle]
|
||||||
|
|
||||||
|
|
||||||
== Reporting bugs
|
== Reporting bugs
|
||||||
Issue tracker: https://github.com/hierynomus/sshj/issues
|
Issue tracker: https://github.com/hierynomus/sshj/issues
|
||||||
@@ -104,8 +110,62 @@ Issue tracker: https://github.com/hierynomus/sshj/issues
|
|||||||
Fork away!
|
Fork away!
|
||||||
|
|
||||||
== Release history
|
== Release history
|
||||||
|
SSHJ 0.38.0 (2024-01-02)::
|
||||||
|
* Mitigated CVE-2023-48795 - Terrapin
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/917[#917]: Implement OpenSSH strict key exchange extension
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/903[#903]: Fix for writing known hosts key string
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/913[#913]: Prevent remote port forwarding buffers to grow without bounds
|
||||||
|
* Moved tests to JUnit5
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/827[#827]: Fallback to posix-rename@openssh.com extension if available
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/904[#904]: Add ChaCha20-Poly1305 support for OpenSSH keys
|
||||||
|
SSHJ 0.37.0 (2023-10-11)::
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/899[#899]: Add support for AES-GCM OpenSSH private keys
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/901[#901]: Fix ZLib compression bug
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/898[#898]: Improved malformed file handling for OpenSSH private keys
|
||||||
|
SSHJ 0.36.0 (2023-09-04)::
|
||||||
|
* Rewrote Integration tests to JUnit5
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/851[#851]: Fix race condition in key exchange causing intermittent SSH_MSG_UNIMPLEMENTED
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/861[#861]: Add DefaultSecurityProviderConfig with has BouncyCastle disabled
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/881[#881]: Rewrote test classes to JUnit Jupiter engine
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/880[#880]: Removed Java 7 backport Socket utilities
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/879[#879]: Replaced custom Base64 with java.util.Base64
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/852[#852]: Removed unused bcrypt password hashing methods
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/874[#874]: Java 8 minimum version + dependency upgrades
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/876[#876]: Change `newStatefulSFTPClient` to return `StatefulSFTPClient`
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/860[#860]: Upgrade to Gradle 7.6.1
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/838[#838]: Replaced Curve25519 class with X25519 Key agreement
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/772[#772]: Remove dependency on jzlib
|
||||||
|
SSHJ 0.35.0 (2023-01-30)::
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/835[#835]: TimeoutException message improved
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/815[#815]: Support authPassword on FreeBSD
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/813[#813]: Prevent `CHANNEL_CLOSE` between isOpen and write call.
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/811[#811]: Add `Transport.isKeyExchangeREquired` to prevent unnecessary KEXINIT
|
||||||
|
SSHJ 0.34.0 (2022-08-10)::
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/743[#743]: Use default client credentials for AuthGssApiWithMic
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/801[#801]: Restore thread interrupt status after catching InterruptedException
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/793[#793]: Merge PKCS5 and PKCS8 classes
|
||||||
|
* Upgraded dependencies SLF4J (1.7.36) and Logback (1.2.11)
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/791[#791]: Update KeepAlive examples
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/775[#775]: Add SFTP resume support
|
||||||
|
SSHJ 0.33.0 (2022-04-22)::
|
||||||
|
* Upgraded dependencies BouncyCastle (1.70)
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/687[#687]: Correctly close connection when remote closes connection.
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/741[#741]: Add support for testcontainers in test setup to test more scenarios
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/733[#733]: Send correct key proposal if client knows CA key
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/746[#746]: Fix bug in reading Putty private key file with passphrase
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/742[#742]: Use Config.keyAlgorithms to determine rsa-sha2 support
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/754[#754]: Use SFTP protocol version to set FXP rename flags conditionally
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/752[#752]: Correctly start and terminate KeepAlive thread
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/753[#753]: Provide better thread names
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/724[#724]: Add parameter to limit read ahead length
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/763[#763]: Try all public key algorithms for a specific key type
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/756[#756]: Remove deprecated proxy connect methods
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/770[#770]: Add support for `ed25519` `aes-128-cbc` keys
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/773[#773]: Fix NPE when reading empty OpenSSHKeyV1KeyFile
|
||||||
|
* Merged https://github.com/hierynomus/sshj/pull/777[#777]: Don't request too many read-ahead packets
|
||||||
|
|
||||||
SSHJ 0.32.0 (2021-10-12)::
|
SSHJ 0.32.0 (2021-10-12)::
|
||||||
* Send EOF on channel close (Fixes https://github.com/hierynomus/sshj/issue/143[#143], https://github.com/hierynomus/sshj/issue/496[#496], https://github.com/hierynomus/sshj/issue/553[#553], https://github.com/hierynomus/sshj/issue/554[#554])
|
* Send EOF on channel close (Fixes https://github.com/hierynomus/sshj/issues/143[#143], https://github.com/hierynomus/sshj/issues/496[#496], https://github.com/hierynomus/sshj/issues/553[#553], https://github.com/hierynomus/sshj/issues/554[#554])
|
||||||
* Merged https://github.com/hierynomus/sshj/pull/726[#726]: Parse OpenSSH v1 keys with full CRT information present
|
* Merged https://github.com/hierynomus/sshj/pull/726[#726]: Parse OpenSSH v1 keys with full CRT information present
|
||||||
* Merged https://github.com/hierynomus/sshj/pull/721[#721]: Prefer known host key algorithm for host key verification
|
* Merged https://github.com/hierynomus/sshj/pull/721[#721]: Prefer known host key algorithm for host key verification
|
||||||
* Merged https://github.com/hierynomus/sshj/pull/716[#716], https://github.com/hierynomus/sshj/pull/729[#729] and https://github.com/hierynomus/sshj/pull/730[#730]: Add full support for PuTTY v3 key files.
|
* Merged https://github.com/hierynomus/sshj/pull/716[#716], https://github.com/hierynomus/sshj/pull/729[#729] and https://github.com/hierynomus/sshj/pull/730[#730]: Add full support for PuTTY v3 key files.
|
||||||
|
|||||||
@@ -23,7 +23,6 @@ dependencies {
|
|||||||
compile "org.slf4j:slf4j-api:1.7.7"
|
compile "org.slf4j:slf4j-api:1.7.7"
|
||||||
compile "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
|
compile "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
|
||||||
compile "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
|
compile "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
|
||||||
compile "com.jcraft:jzlib:1.1.3"
|
|
||||||
|
|
||||||
testCompile "junit:junit:4.11"
|
testCompile "junit:junit:4.11"
|
||||||
testCompile "org.mockito:mockito-core:1.9.5"
|
testCompile "org.mockito:mockito-core:1.9.5"
|
||||||
|
|||||||
235
build.gradle
235
build.gradle
@@ -1,29 +1,27 @@
|
|||||||
import java.text.SimpleDateFormat
|
|
||||||
import com.bmuschko.gradle.docker.tasks.container.*
|
|
||||||
import com.bmuschko.gradle.docker.tasks.image.*
|
|
||||||
|
|
||||||
plugins {
|
plugins {
|
||||||
id "java"
|
id "java"
|
||||||
|
id "jvm-test-suite"
|
||||||
id "groovy"
|
id "groovy"
|
||||||
id "jacoco"
|
id "jacoco"
|
||||||
id "com.github.blindpirate.osgi" version '0.0.6'
|
id "com.github.blindpirate.osgi" version '0.0.6'
|
||||||
id "maven-publish"
|
id "maven-publish"
|
||||||
id "signing"
|
id "signing"
|
||||||
id 'pl.allegro.tech.build.axion-release' version '1.13.3'
|
id 'pl.allegro.tech.build.axion-release' version '1.15.3'
|
||||||
id "com.bmuschko.docker-remote-api" version "7.1.0"
|
|
||||||
id "com.github.hierynomus.license" version "0.16.1"
|
id "com.github.hierynomus.license" version "0.16.1"
|
||||||
id 'ru.vyarus.github-info' version '1.2.0'
|
id "com.bmuschko.docker-remote-api" version "9.2.1"
|
||||||
id "io.github.gradle-nexus.publish-plugin" version "1.0.0"
|
id 'ru.vyarus.github-info' version '1.5.0'
|
||||||
|
id "io.github.gradle-nexus.publish-plugin" version "1.3.0"
|
||||||
}
|
}
|
||||||
|
|
||||||
|
group = "com.hierynomus"
|
||||||
|
ext.moduleName = "${project.group}.${project.name}"
|
||||||
|
|
||||||
|
defaultTasks "build"
|
||||||
|
|
||||||
repositories {
|
repositories {
|
||||||
mavenCentral()
|
mavenCentral()
|
||||||
}
|
}
|
||||||
|
|
||||||
group = "com.hierynomus"
|
|
||||||
defaultTasks ["build"]
|
|
||||||
ext.moduleName = "${project.group}.${project.name}"
|
|
||||||
|
|
||||||
scmVersion {
|
scmVersion {
|
||||||
tag {
|
tag {
|
||||||
prefix = 'v'
|
prefix = 'v'
|
||||||
@@ -37,30 +35,21 @@ scmVersion {
|
|||||||
|
|
||||||
project.version = scmVersion.version
|
project.version = scmVersion.version
|
||||||
|
|
||||||
|
compileJava {
|
||||||
|
options.release = 8
|
||||||
|
}
|
||||||
|
|
||||||
configurations.implementation.transitive = false
|
configurations.implementation.transitive = false
|
||||||
|
|
||||||
def bouncycastleVersion = "1.69"
|
def bouncycastleVersion = "1.78.1"
|
||||||
def sshdVersion = "2.1.0"
|
def sshdVersion = "2.12.1"
|
||||||
|
|
||||||
dependencies {
|
dependencies {
|
||||||
implementation "org.slf4j:slf4j-api:1.7.32"
|
implementation "org.slf4j:slf4j-api:2.0.13"
|
||||||
implementation "org.bouncycastle:bcprov-jdk15on:$bouncycastleVersion"
|
implementation "org.bouncycastle:bcprov-jdk18on:$bouncycastleVersion"
|
||||||
implementation "org.bouncycastle:bcpkix-jdk15on:$bouncycastleVersion"
|
implementation "org.bouncycastle:bcpkix-jdk18on:$bouncycastleVersion"
|
||||||
implementation "com.jcraft:jzlib:1.1.3"
|
|
||||||
implementation "com.hierynomus:asn-one:0.6.0"
|
implementation "com.hierynomus:asn-one:0.6.0"
|
||||||
|
|
||||||
implementation "net.i2p.crypto:eddsa:0.3.0"
|
implementation "net.i2p.crypto:eddsa:0.3.0"
|
||||||
|
|
||||||
testImplementation "junit:junit:4.12"
|
|
||||||
testImplementation 'org.spockframework:spock-core:1.3-groovy-2.4'
|
|
||||||
testImplementation "org.mockito:mockito-core:2.28.2"
|
|
||||||
testImplementation "org.apache.sshd:sshd-core:$sshdVersion"
|
|
||||||
testImplementation "org.apache.sshd:sshd-sftp:$sshdVersion"
|
|
||||||
testImplementation "org.apache.sshd:sshd-scp:$sshdVersion"
|
|
||||||
testRuntimeOnly "ch.qos.logback:logback-classic:1.2.6"
|
|
||||||
testImplementation 'org.glassfish.grizzly:grizzly-http-server:2.4.4'
|
|
||||||
testImplementation 'org.apache.httpcomponents:httpclient:4.5.9'
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
license {
|
license {
|
||||||
@@ -69,7 +58,15 @@ license {
|
|||||||
mapping {
|
mapping {
|
||||||
java = 'SLASHSTAR_STYLE'
|
java = 'SLASHSTAR_STYLE'
|
||||||
}
|
}
|
||||||
excludes(['**/djb/Curve25519.java', '**/sshj/common/Base64.java', '**/com/hierynomus/sshj/userauth/keyprovider/bcrypt/*.java'])
|
excludes([
|
||||||
|
'**/com/hierynomus/sshj/userauth/keyprovider/bcrypt/*.java',
|
||||||
|
'**/files/test_file_*.txt',
|
||||||
|
])
|
||||||
|
}
|
||||||
|
|
||||||
|
java {
|
||||||
|
withJavadocJar()
|
||||||
|
withSourcesJar()
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!JavaVersion.current().isJava9Compatible()) {
|
if (!JavaVersion.current().isJava9Compatible()) {
|
||||||
@@ -83,10 +80,82 @@ if (JavaVersion.current().isJava8Compatible()) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
compileJava {
|
testing {
|
||||||
options.compilerArgs.addAll(['--release', '7'])
|
suites {
|
||||||
|
configureEach {
|
||||||
|
useJUnitJupiter()
|
||||||
|
dependencies {
|
||||||
|
implementation "org.slf4j:slf4j-api:2.0.13"
|
||||||
|
implementation 'org.spockframework:spock-core:2.3-groovy-3.0'
|
||||||
|
implementation "org.mockito:mockito-core:4.11.0"
|
||||||
|
implementation "org.assertj:assertj-core:3.24.2"
|
||||||
|
implementation "ru.vyarus:spock-junit5:1.2.0"
|
||||||
|
implementation "org.apache.sshd:sshd-core:$sshdVersion"
|
||||||
|
implementation "org.apache.sshd:sshd-sftp:$sshdVersion"
|
||||||
|
implementation "org.apache.sshd:sshd-scp:$sshdVersion"
|
||||||
|
implementation "ch.qos.logback:logback-classic:1.3.14"
|
||||||
|
implementation 'org.glassfish.grizzly:grizzly-http-server:3.0.1'
|
||||||
|
}
|
||||||
|
|
||||||
|
targets {
|
||||||
|
all {
|
||||||
|
testTask.configure {
|
||||||
|
testLogging {
|
||||||
|
showStandardStreams = false
|
||||||
|
exceptionFormat = 'full'
|
||||||
|
}
|
||||||
|
include "**/*Test.*"
|
||||||
|
include "**/*Spec.*"
|
||||||
|
afterSuite { descriptor, result ->
|
||||||
|
def indicator = "\u001B[32m✓\u001b[0m"
|
||||||
|
if (result.failedTestCount > 0) {
|
||||||
|
indicator = "\u001B[31m✘\u001b[0m"
|
||||||
|
}
|
||||||
|
logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
test {
|
||||||
|
sources {
|
||||||
|
groovy {
|
||||||
|
srcDirs = ['src/test/groovy']
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
integrationTest(JvmTestSuite) {
|
||||||
|
dependencies {
|
||||||
|
implementation project()
|
||||||
|
implementation 'org.testcontainers:testcontainers:1.19.8'
|
||||||
|
implementation 'org.testcontainers:junit-jupiter:1.19.8'
|
||||||
|
}
|
||||||
|
|
||||||
|
sources {
|
||||||
|
java {
|
||||||
|
srcDirs = ['src/itest/java']
|
||||||
|
}
|
||||||
|
|
||||||
|
resources {
|
||||||
|
srcDirs = ['src/itest/resources']
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
targets {
|
||||||
|
all {
|
||||||
|
testTask.configure {
|
||||||
|
shouldRunAfter(test)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
project.tasks.compileGroovy.onlyIf { false }
|
||||||
|
|
||||||
task writeSshjVersionProperties {
|
task writeSshjVersionProperties {
|
||||||
doLast {
|
doLast {
|
||||||
project.file("${project.buildDir}/resources/main").mkdirs()
|
project.file("${project.buildDir}/resources/main").mkdirs()
|
||||||
@@ -120,12 +189,6 @@ jar {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
java {
|
|
||||||
withJavadocJar()
|
|
||||||
withSourcesJar()
|
|
||||||
}
|
|
||||||
|
|
||||||
sourcesJar {
|
sourcesJar {
|
||||||
manifest {
|
manifest {
|
||||||
attributes(
|
attributes(
|
||||||
@@ -139,53 +202,6 @@ sourcesJar {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
configurations {
|
|
||||||
integrationTestImplementation.extendsFrom testImplementation
|
|
||||||
integrationTestRuntimeOnly.extendsFrom testRuntimeOnly
|
|
||||||
}
|
|
||||||
|
|
||||||
sourceSets {
|
|
||||||
integrationTest {
|
|
||||||
groovy {
|
|
||||||
compileClasspath += sourceSets.main.output + sourceSets.test.output
|
|
||||||
runtimeClasspath += sourceSets.main.output + sourceSets.test.output
|
|
||||||
srcDir file('src/itest/groovy')
|
|
||||||
}
|
|
||||||
resources.srcDir file('src/itest/resources')
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
task integrationTest(type: Test) {
|
|
||||||
testClassesDirs = sourceSets.integrationTest.output.classesDirs
|
|
||||||
classpath = sourceSets.integrationTest.runtimeClasspath
|
|
||||||
}
|
|
||||||
|
|
||||||
tasks.withType(Test) {
|
|
||||||
testLogging {
|
|
||||||
exceptionFormat = 'full'
|
|
||||||
}
|
|
||||||
include "**/*Test.*"
|
|
||||||
include "**/*Spec.*"
|
|
||||||
if (!project.hasProperty("allTests")) {
|
|
||||||
useJUnit {
|
|
||||||
excludeCategories 'com.hierynomus.sshj.test.SlowTests'
|
|
||||||
excludeCategories 'com.hierynomus.sshj.test.KnownFailingTests'
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
afterSuite { descriptor, result ->
|
|
||||||
if (descriptor.className != null) {
|
|
||||||
def indicator = "\u001B[32m✓\u001b[0m"
|
|
||||||
if (result.failedTestCount > 0) {
|
|
||||||
indicator = "\u001B[31m✘\u001b[0m"
|
|
||||||
}
|
|
||||||
logger.lifecycle("$indicator Test ${descriptor.name}; Executed: ${result.testCount}/\u001B[32m${result.successfulTestCount}\u001B[0m/\u001B[31m${result.failedTestCount}\u001B[0m")
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
project.tasks.compileGroovy.onlyIf { false }
|
|
||||||
|
|
||||||
github {
|
github {
|
||||||
user 'hierynomus'
|
user 'hierynomus'
|
||||||
license 'Apache'
|
license 'Apache'
|
||||||
@@ -271,54 +287,11 @@ nexusPublishing {
|
|||||||
|
|
||||||
jacocoTestReport {
|
jacocoTestReport {
|
||||||
reports {
|
reports {
|
||||||
xml.enabled true
|
xml.required = true
|
||||||
html.enabled true
|
html.required = true
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
task buildItestImage(type: DockerBuildImage) {
|
|
||||||
inputDir = file('src/itest/docker-image')
|
|
||||||
images.add('sshj/sshd-itest:latest')
|
|
||||||
}
|
|
||||||
|
|
||||||
task createItestContainer(type: DockerCreateContainer) {
|
|
||||||
dependsOn buildItestImage
|
|
||||||
targetImageId buildItestImage.getImageId()
|
|
||||||
hostConfig.portBindings = ['2222:22']
|
|
||||||
hostConfig.autoRemove = true
|
|
||||||
}
|
|
||||||
|
|
||||||
task startItestContainer(type: DockerStartContainer) {
|
|
||||||
dependsOn createItestContainer
|
|
||||||
targetContainerId createItestContainer.getContainerId()
|
|
||||||
}
|
|
||||||
|
|
||||||
task logItestContainer(type: DockerLogsContainer) {
|
|
||||||
dependsOn createItestContainer
|
|
||||||
targetContainerId createItestContainer.getContainerId()
|
|
||||||
showTimestamps = true
|
|
||||||
stdErr = true
|
|
||||||
stdOut = true
|
|
||||||
tailAll = true
|
|
||||||
}
|
|
||||||
|
|
||||||
task stopItestContainer(type: DockerStopContainer) {
|
|
||||||
targetContainerId createItestContainer.getContainerId()
|
|
||||||
}
|
|
||||||
|
|
||||||
task forkedUploadRelease(type: GradleBuild) {
|
|
||||||
buildFile = project.buildFile
|
|
||||||
tasks = ["clean", "publishToSonatype", "closeAndReleaseSonatypeStagingRepository"]
|
|
||||||
}
|
|
||||||
|
|
||||||
project.tasks.integrationTest.dependsOn(startItestContainer)
|
|
||||||
project.tasks.integrationTest.finalizedBy(stopItestContainer)
|
|
||||||
|
|
||||||
// Being enabled, it pollutes logs on CI. Uncomment when debugging some test to get sshd logs.
|
|
||||||
// project.tasks.stopItestContainer.dependsOn(logItestContainer)
|
|
||||||
|
|
||||||
project.tasks.release.dependsOn([project.tasks.integrationTest, project.tasks.build])
|
project.tasks.release.dependsOn([project.tasks.integrationTest, project.tasks.build])
|
||||||
project.tasks.release.finalizedBy(project.tasks.forkedUploadRelease)
|
|
||||||
project.tasks.jacocoTestReport.dependsOn(project.tasks.test)
|
project.tasks.jacocoTestReport.dependsOn(project.tasks.test)
|
||||||
project.tasks.check.dependsOn(project.tasks.jacocoTestReport)
|
project.tasks.check.dependsOn(project.tasks.jacocoTestReport)
|
||||||
|
|||||||
@@ -24,7 +24,7 @@
|
|||||||
<groupId>com.hierynomus</groupId>
|
<groupId>com.hierynomus</groupId>
|
||||||
<artifactId>sshj-examples</artifactId>
|
<artifactId>sshj-examples</artifactId>
|
||||||
<packaging>jar</packaging>
|
<packaging>jar</packaging>
|
||||||
<version>0.19.1</version>
|
<version>0.37.0</version>
|
||||||
|
|
||||||
<name>sshj-examples</name>
|
<name>sshj-examples</name>
|
||||||
<description>Examples for SSHv2 library for Java</description>
|
<description>Examples for SSHv2 library for Java</description>
|
||||||
@@ -55,7 +55,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.hierynomus</groupId>
|
<groupId>com.hierynomus</groupId>
|
||||||
<artifactId>sshj</artifactId>
|
<artifactId>sshj</artifactId>
|
||||||
<version>0.31.0</version>
|
<version>0.33.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
|
|
||||||
|
|||||||
@@ -19,8 +19,9 @@ public class KeepAlive {
|
|||||||
final SSHClient ssh = new SSHClient(defaultConfig);
|
final SSHClient ssh = new SSHClient(defaultConfig);
|
||||||
try {
|
try {
|
||||||
ssh.addHostKeyVerifier(new PromiscuousVerifier());
|
ssh.addHostKeyVerifier(new PromiscuousVerifier());
|
||||||
|
// Set interval to enable keep-alive before connecting
|
||||||
|
ssh.getConnection().getKeepAlive().setKeepAliveInterval(5);
|
||||||
ssh.connect(args[0]);
|
ssh.connect(args[0]);
|
||||||
ssh.getConnection().getKeepAlive().setKeepAliveInterval(5); //every 60sec
|
|
||||||
ssh.authPassword(args[1], args[2]);
|
ssh.authPassword(args[1], args[2]);
|
||||||
Session session = ssh.startSession();
|
Session session = ssh.startSession();
|
||||||
session.allocateDefaultPTY();
|
session.allocateDefaultPTY();
|
||||||
|
|||||||
@@ -19,6 +19,7 @@ public class RemotePF {
|
|||||||
client.loadKnownHosts();
|
client.loadKnownHosts();
|
||||||
|
|
||||||
client.connect("localhost");
|
client.connect("localhost");
|
||||||
|
client.getConnection().getKeepAlive().setKeepAliveInterval(5);
|
||||||
try {
|
try {
|
||||||
|
|
||||||
client.authPublickey(System.getProperty("user.name"));
|
client.authPublickey(System.getProperty("user.name"));
|
||||||
@@ -33,8 +34,6 @@ public class RemotePF {
|
|||||||
// what we do with incoming connections that are forwarded to us
|
// what we do with incoming connections that are forwarded to us
|
||||||
new SocketForwardingConnectListener(new InetSocketAddress("google.com", 80)));
|
new SocketForwardingConnectListener(new InetSocketAddress("google.com", 80)));
|
||||||
|
|
||||||
client.getTransport().setHeartbeatInterval(30);
|
|
||||||
|
|
||||||
// Something to hang on to so that the forwarding stays
|
// Something to hang on to so that the forwarding stays
|
||||||
client.getTransport().join();
|
client.getTransport().join();
|
||||||
|
|
||||||
|
|||||||
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
Binary file not shown.
2
gradle/wrapper/gradle-wrapper.properties
vendored
2
gradle/wrapper/gradle-wrapper.properties
vendored
@@ -1,5 +1,5 @@
|
|||||||
distributionBase=GRADLE_USER_HOME
|
distributionBase=GRADLE_USER_HOME
|
||||||
distributionPath=wrapper/dists
|
distributionPath=wrapper/dists
|
||||||
distributionUrl=https\://services.gradle.org/distributions/gradle-7.0-bin.zip
|
distributionUrl=https\://services.gradle.org/distributions/gradle-8.2-bin.zip
|
||||||
zipStoreBase=GRADLE_USER_HOME
|
zipStoreBase=GRADLE_USER_HOME
|
||||||
zipStorePath=wrapper/dists
|
zipStorePath=wrapper/dists
|
||||||
|
|||||||
269
gradlew
vendored
269
gradlew
vendored
@@ -1,7 +1,7 @@
|
|||||||
#!/usr/bin/env sh
|
#!/bin/sh
|
||||||
|
|
||||||
#
|
#
|
||||||
# Copyright 2015 the original author or authors.
|
# Copyright © 2015-2021 the original authors.
|
||||||
#
|
#
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
# you may not use this file except in compliance with the License.
|
# you may not use this file except in compliance with the License.
|
||||||
@@ -17,78 +17,113 @@
|
|||||||
#
|
#
|
||||||
|
|
||||||
##############################################################################
|
##############################################################################
|
||||||
##
|
#
|
||||||
## Gradle start up script for UN*X
|
# Gradle start up script for POSIX generated by Gradle.
|
||||||
##
|
#
|
||||||
|
# Important for running:
|
||||||
|
#
|
||||||
|
# (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
|
||||||
|
# noncompliant, but you have some other compliant shell such as ksh or
|
||||||
|
# bash, then to run this script, type that shell name before the whole
|
||||||
|
# command line, like:
|
||||||
|
#
|
||||||
|
# ksh Gradle
|
||||||
|
#
|
||||||
|
# Busybox and similar reduced shells will NOT work, because this script
|
||||||
|
# requires all of these POSIX shell features:
|
||||||
|
# * functions;
|
||||||
|
# * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
|
||||||
|
# «${var#prefix}», «${var%suffix}», and «$( cmd )»;
|
||||||
|
# * compound commands having a testable exit status, especially «case»;
|
||||||
|
# * various built-in commands including «command», «set», and «ulimit».
|
||||||
|
#
|
||||||
|
# Important for patching:
|
||||||
|
#
|
||||||
|
# (2) This script targets any POSIX shell, so it avoids extensions provided
|
||||||
|
# by Bash, Ksh, etc; in particular arrays are avoided.
|
||||||
|
#
|
||||||
|
# The "traditional" practice of packing multiple parameters into a
|
||||||
|
# space-separated string is a well documented source of bugs and security
|
||||||
|
# problems, so this is (mostly) avoided, by progressively accumulating
|
||||||
|
# options in "$@", and eventually passing that to Java.
|
||||||
|
#
|
||||||
|
# Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
|
||||||
|
# and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
|
||||||
|
# see the in-line comments for details.
|
||||||
|
#
|
||||||
|
# There are tweaks for specific operating systems such as AIX, CygWin,
|
||||||
|
# Darwin, MinGW, and NonStop.
|
||||||
|
#
|
||||||
|
# (3) This script is generated from the Groovy template
|
||||||
|
# https://github.com/gradle/gradle/blob/master/subprojects/plugins/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
|
||||||
|
# within the Gradle project.
|
||||||
|
#
|
||||||
|
# You can find Gradle at https://github.com/gradle/gradle/.
|
||||||
|
#
|
||||||
##############################################################################
|
##############################################################################
|
||||||
|
|
||||||
# Attempt to set APP_HOME
|
# Attempt to set APP_HOME
|
||||||
|
|
||||||
# Resolve links: $0 may be a link
|
# Resolve links: $0 may be a link
|
||||||
PRG="$0"
|
app_path=$0
|
||||||
# Need this for relative symlinks.
|
|
||||||
while [ -h "$PRG" ] ; do
|
# Need this for daisy-chained symlinks.
|
||||||
ls=`ls -ld "$PRG"`
|
while
|
||||||
link=`expr "$ls" : '.*-> \(.*\)$'`
|
APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path
|
||||||
if expr "$link" : '/.*' > /dev/null; then
|
[ -h "$app_path" ]
|
||||||
PRG="$link"
|
do
|
||||||
else
|
ls=$( ls -ld "$app_path" )
|
||||||
PRG=`dirname "$PRG"`"/$link"
|
link=${ls#*' -> '}
|
||||||
fi
|
case $link in #(
|
||||||
|
/*) app_path=$link ;; #(
|
||||||
|
*) app_path=$APP_HOME$link ;;
|
||||||
|
esac
|
||||||
done
|
done
|
||||||
SAVED="`pwd`"
|
|
||||||
cd "`dirname \"$PRG\"`/" >/dev/null
|
APP_HOME=$( cd "${APP_HOME:-./}" && pwd -P ) || exit
|
||||||
APP_HOME="`pwd -P`"
|
|
||||||
cd "$SAVED" >/dev/null
|
|
||||||
|
|
||||||
APP_NAME="Gradle"
|
APP_NAME="Gradle"
|
||||||
APP_BASE_NAME=`basename "$0"`
|
APP_BASE_NAME=${0##*/}
|
||||||
|
|
||||||
# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
|
# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
|
||||||
DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
|
DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
|
||||||
|
|
||||||
# Use the maximum available, or set MAX_FD != -1 to use that value.
|
# Use the maximum available, or set MAX_FD != -1 to use that value.
|
||||||
MAX_FD="maximum"
|
MAX_FD=maximum
|
||||||
|
|
||||||
warn () {
|
warn () {
|
||||||
echo "$*"
|
echo "$*"
|
||||||
}
|
} >&2
|
||||||
|
|
||||||
die () {
|
die () {
|
||||||
echo
|
echo
|
||||||
echo "$*"
|
echo "$*"
|
||||||
echo
|
echo
|
||||||
exit 1
|
exit 1
|
||||||
}
|
} >&2
|
||||||
|
|
||||||
# OS specific support (must be 'true' or 'false').
|
# OS specific support (must be 'true' or 'false').
|
||||||
cygwin=false
|
cygwin=false
|
||||||
msys=false
|
msys=false
|
||||||
darwin=false
|
darwin=false
|
||||||
nonstop=false
|
nonstop=false
|
||||||
case "`uname`" in
|
case "$( uname )" in #(
|
||||||
CYGWIN* )
|
CYGWIN* ) cygwin=true ;; #(
|
||||||
cygwin=true
|
Darwin* ) darwin=true ;; #(
|
||||||
;;
|
MSYS* | MINGW* ) msys=true ;; #(
|
||||||
Darwin* )
|
NONSTOP* ) nonstop=true ;;
|
||||||
darwin=true
|
|
||||||
;;
|
|
||||||
MINGW* )
|
|
||||||
msys=true
|
|
||||||
;;
|
|
||||||
NONSTOP* )
|
|
||||||
nonstop=true
|
|
||||||
;;
|
|
||||||
esac
|
esac
|
||||||
|
|
||||||
CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
|
CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
|
||||||
|
|
||||||
|
|
||||||
# Determine the Java command to use to start the JVM.
|
# Determine the Java command to use to start the JVM.
|
||||||
if [ -n "$JAVA_HOME" ] ; then
|
if [ -n "$JAVA_HOME" ] ; then
|
||||||
if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
|
if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
|
||||||
# IBM's JDK on AIX uses strange locations for the executables
|
# IBM's JDK on AIX uses strange locations for the executables
|
||||||
JAVACMD="$JAVA_HOME/jre/sh/java"
|
JAVACMD=$JAVA_HOME/jre/sh/java
|
||||||
else
|
else
|
||||||
JAVACMD="$JAVA_HOME/bin/java"
|
JAVACMD=$JAVA_HOME/bin/java
|
||||||
fi
|
fi
|
||||||
if [ ! -x "$JAVACMD" ] ; then
|
if [ ! -x "$JAVACMD" ] ; then
|
||||||
die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
|
die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
|
||||||
@@ -97,7 +132,7 @@ Please set the JAVA_HOME variable in your environment to match the
|
|||||||
location of your Java installation."
|
location of your Java installation."
|
||||||
fi
|
fi
|
||||||
else
|
else
|
||||||
JAVACMD="java"
|
JAVACMD=java
|
||||||
which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
||||||
|
|
||||||
Please set the JAVA_HOME variable in your environment to match the
|
Please set the JAVA_HOME variable in your environment to match the
|
||||||
@@ -105,79 +140,95 @@ location of your Java installation."
|
|||||||
fi
|
fi
|
||||||
|
|
||||||
# Increase the maximum file descriptors if we can.
|
# Increase the maximum file descriptors if we can.
|
||||||
if [ "$cygwin" = "false" -a "$darwin" = "false" -a "$nonstop" = "false" ] ; then
|
if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
|
||||||
MAX_FD_LIMIT=`ulimit -H -n`
|
case $MAX_FD in #(
|
||||||
if [ $? -eq 0 ] ; then
|
max*)
|
||||||
if [ "$MAX_FD" = "maximum" -o "$MAX_FD" = "max" ] ; then
|
MAX_FD=$( ulimit -H -n ) ||
|
||||||
MAX_FD="$MAX_FD_LIMIT"
|
warn "Could not query maximum file descriptor limit"
|
||||||
fi
|
esac
|
||||||
ulimit -n $MAX_FD
|
case $MAX_FD in #(
|
||||||
if [ $? -ne 0 ] ; then
|
'' | soft) :;; #(
|
||||||
warn "Could not set maximum file descriptor limit: $MAX_FD"
|
*)
|
||||||
fi
|
ulimit -n "$MAX_FD" ||
|
||||||
else
|
warn "Could not set maximum file descriptor limit to $MAX_FD"
|
||||||
warn "Could not query maximum file descriptor limit: $MAX_FD_LIMIT"
|
|
||||||
fi
|
|
||||||
fi
|
|
||||||
|
|
||||||
# For Darwin, add options to specify how the application appears in the dock
|
|
||||||
if $darwin; then
|
|
||||||
GRADLE_OPTS="$GRADLE_OPTS \"-Xdock:name=$APP_NAME\" \"-Xdock:icon=$APP_HOME/media/gradle.icns\""
|
|
||||||
fi
|
|
||||||
|
|
||||||
# For Cygwin or MSYS, switch paths to Windows format before running java
|
|
||||||
if [ "$cygwin" = "true" -o "$msys" = "true" ] ; then
|
|
||||||
APP_HOME=`cygpath --path --mixed "$APP_HOME"`
|
|
||||||
CLASSPATH=`cygpath --path --mixed "$CLASSPATH"`
|
|
||||||
JAVACMD=`cygpath --unix "$JAVACMD"`
|
|
||||||
|
|
||||||
# We build the pattern for arguments to be converted via cygpath
|
|
||||||
ROOTDIRSRAW=`find -L / -maxdepth 1 -mindepth 1 -type d 2>/dev/null`
|
|
||||||
SEP=""
|
|
||||||
for dir in $ROOTDIRSRAW ; do
|
|
||||||
ROOTDIRS="$ROOTDIRS$SEP$dir"
|
|
||||||
SEP="|"
|
|
||||||
done
|
|
||||||
OURCYGPATTERN="(^($ROOTDIRS))"
|
|
||||||
# Add a user-defined pattern to the cygpath arguments
|
|
||||||
if [ "$GRADLE_CYGPATTERN" != "" ] ; then
|
|
||||||
OURCYGPATTERN="$OURCYGPATTERN|($GRADLE_CYGPATTERN)"
|
|
||||||
fi
|
|
||||||
# Now convert the arguments - kludge to limit ourselves to /bin/sh
|
|
||||||
i=0
|
|
||||||
for arg in "$@" ; do
|
|
||||||
CHECK=`echo "$arg"|egrep -c "$OURCYGPATTERN" -`
|
|
||||||
CHECK2=`echo "$arg"|egrep -c "^-"` ### Determine if an option
|
|
||||||
|
|
||||||
if [ $CHECK -ne 0 ] && [ $CHECK2 -eq 0 ] ; then ### Added a condition
|
|
||||||
eval `echo args$i`=`cygpath --path --ignore --mixed "$arg"`
|
|
||||||
else
|
|
||||||
eval `echo args$i`="\"$arg\""
|
|
||||||
fi
|
|
||||||
i=`expr $i + 1`
|
|
||||||
done
|
|
||||||
case $i in
|
|
||||||
0) set -- ;;
|
|
||||||
1) set -- "$args0" ;;
|
|
||||||
2) set -- "$args0" "$args1" ;;
|
|
||||||
3) set -- "$args0" "$args1" "$args2" ;;
|
|
||||||
4) set -- "$args0" "$args1" "$args2" "$args3" ;;
|
|
||||||
5) set -- "$args0" "$args1" "$args2" "$args3" "$args4" ;;
|
|
||||||
6) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" ;;
|
|
||||||
7) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" ;;
|
|
||||||
8) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" ;;
|
|
||||||
9) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" "$args8" ;;
|
|
||||||
esac
|
esac
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# Escape application args
|
# Collect all arguments for the java command, stacking in reverse order:
|
||||||
save () {
|
# * args from the command line
|
||||||
for i do printf %s\\n "$i" | sed "s/'/'\\\\''/g;1s/^/'/;\$s/\$/' \\\\/" ; done
|
# * the main class name
|
||||||
echo " "
|
# * -classpath
|
||||||
}
|
# * -D...appname settings
|
||||||
APP_ARGS=`save "$@"`
|
# * --module-path (only if needed)
|
||||||
|
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
|
||||||
|
|
||||||
# Collect all arguments for the java command, following the shell quoting and substitution rules
|
# For Cygwin or MSYS, switch paths to Windows format before running java
|
||||||
eval set -- $DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS "\"-Dorg.gradle.appname=$APP_BASE_NAME\"" -classpath "\"$CLASSPATH\"" org.gradle.wrapper.GradleWrapperMain "$APP_ARGS"
|
if "$cygwin" || "$msys" ; then
|
||||||
|
APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
|
||||||
|
CLASSPATH=$( cygpath --path --mixed "$CLASSPATH" )
|
||||||
|
|
||||||
|
JAVACMD=$( cygpath --unix "$JAVACMD" )
|
||||||
|
|
||||||
|
# Now convert the arguments - kludge to limit ourselves to /bin/sh
|
||||||
|
for arg do
|
||||||
|
if
|
||||||
|
case $arg in #(
|
||||||
|
-*) false ;; # don't mess with options #(
|
||||||
|
/?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath
|
||||||
|
[ -e "$t" ] ;; #(
|
||||||
|
*) false ;;
|
||||||
|
esac
|
||||||
|
then
|
||||||
|
arg=$( cygpath --path --ignore --mixed "$arg" )
|
||||||
|
fi
|
||||||
|
# Roll the args list around exactly as many times as the number of
|
||||||
|
# args, so each arg winds up back in the position where it started, but
|
||||||
|
# possibly modified.
|
||||||
|
#
|
||||||
|
# NB: a `for` loop captures its iteration list before it begins, so
|
||||||
|
# changing the positional parameters here affects neither the number of
|
||||||
|
# iterations, nor the values presented in `arg`.
|
||||||
|
shift # remove old arg
|
||||||
|
set -- "$@" "$arg" # push replacement arg
|
||||||
|
done
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Collect all arguments for the java command;
|
||||||
|
# * $DEFAULT_JVM_OPTS, $JAVA_OPTS, and $GRADLE_OPTS can contain fragments of
|
||||||
|
# shell script including quotes and variable substitutions, so put them in
|
||||||
|
# double quotes to make sure that they get re-expanded; and
|
||||||
|
# * put everything else in single quotes, so that it's not re-expanded.
|
||||||
|
|
||||||
|
set -- \
|
||||||
|
"-Dorg.gradle.appname=$APP_BASE_NAME" \
|
||||||
|
-classpath "$CLASSPATH" \
|
||||||
|
org.gradle.wrapper.GradleWrapperMain \
|
||||||
|
"$@"
|
||||||
|
|
||||||
|
# Use "xargs" to parse quoted args.
|
||||||
|
#
|
||||||
|
# With -n1 it outputs one arg per line, with the quotes and backslashes removed.
|
||||||
|
#
|
||||||
|
# In Bash we could simply go:
|
||||||
|
#
|
||||||
|
# readarray ARGS < <( xargs -n1 <<<"$var" ) &&
|
||||||
|
# set -- "${ARGS[@]}" "$@"
|
||||||
|
#
|
||||||
|
# but POSIX shell has neither arrays nor command substitution, so instead we
|
||||||
|
# post-process each arg (as a line of input to sed) to backslash-escape any
|
||||||
|
# character that might be a shell metacharacter, then use eval to reverse
|
||||||
|
# that process (while maintaining the separation between arguments), and wrap
|
||||||
|
# the whole thing up as a single "set" statement.
|
||||||
|
#
|
||||||
|
# This will of course break if any of these variables contains a newline or
|
||||||
|
# an unmatched quote.
|
||||||
|
#
|
||||||
|
|
||||||
|
eval "set -- $(
|
||||||
|
printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
|
||||||
|
xargs -n1 |
|
||||||
|
sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
|
||||||
|
tr '\n' ' '
|
||||||
|
)" '"$@"'
|
||||||
|
|
||||||
exec "$JAVACMD" "$@"
|
exec "$JAVACMD" "$@"
|
||||||
|
|||||||
22
gradlew.bat
vendored
22
gradlew.bat
vendored
@@ -40,7 +40,7 @@ if defined JAVA_HOME goto findJavaFromJavaHome
|
|||||||
|
|
||||||
set JAVA_EXE=java.exe
|
set JAVA_EXE=java.exe
|
||||||
%JAVA_EXE% -version >NUL 2>&1
|
%JAVA_EXE% -version >NUL 2>&1
|
||||||
if "%ERRORLEVEL%" == "0" goto init
|
if "%ERRORLEVEL%" == "0" goto execute
|
||||||
|
|
||||||
echo.
|
echo.
|
||||||
echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
||||||
@@ -54,7 +54,7 @@ goto fail
|
|||||||
set JAVA_HOME=%JAVA_HOME:"=%
|
set JAVA_HOME=%JAVA_HOME:"=%
|
||||||
set JAVA_EXE=%JAVA_HOME%/bin/java.exe
|
set JAVA_EXE=%JAVA_HOME%/bin/java.exe
|
||||||
|
|
||||||
if exist "%JAVA_EXE%" goto init
|
if exist "%JAVA_EXE%" goto execute
|
||||||
|
|
||||||
echo.
|
echo.
|
||||||
echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
|
echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
|
||||||
@@ -64,28 +64,14 @@ echo location of your Java installation.
|
|||||||
|
|
||||||
goto fail
|
goto fail
|
||||||
|
|
||||||
:init
|
|
||||||
@rem Get command-line arguments, handling Windows variants
|
|
||||||
|
|
||||||
if not "%OS%" == "Windows_NT" goto win9xME_args
|
|
||||||
|
|
||||||
:win9xME_args
|
|
||||||
@rem Slurp the command line arguments.
|
|
||||||
set CMD_LINE_ARGS=
|
|
||||||
set _SKIP=2
|
|
||||||
|
|
||||||
:win9xME_args_slurp
|
|
||||||
if "x%~1" == "x" goto execute
|
|
||||||
|
|
||||||
set CMD_LINE_ARGS=%*
|
|
||||||
|
|
||||||
:execute
|
:execute
|
||||||
@rem Setup the command line
|
@rem Setup the command line
|
||||||
|
|
||||||
set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
|
set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
|
||||||
|
|
||||||
|
|
||||||
@rem Execute Gradle
|
@rem Execute Gradle
|
||||||
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %CMD_LINE_ARGS%
|
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %*
|
||||||
|
|
||||||
:end
|
:end
|
||||||
@rem End local scope for the variables with windows NT shell
|
@rem End local scope for the variables with windows NT shell
|
||||||
|
|||||||
@@ -1,24 +0,0 @@
|
|||||||
FROM sickp/alpine-sshd:7.5-r2
|
|
||||||
|
|
||||||
ADD authorized_keys /home/sshj/.ssh/authorized_keys
|
|
||||||
|
|
||||||
ADD test-container/ssh_host_ecdsa_key /etc/ssh/ssh_host_ecdsa_key
|
|
||||||
ADD test-container/ssh_host_ecdsa_key.pub /etc/ssh/ssh_host_ecdsa_key.pub
|
|
||||||
ADD test-container/ssh_host_ed25519_key /etc/ssh/ssh_host_ed25519_key
|
|
||||||
ADD test-container/ssh_host_ed25519_key.pub /etc/ssh/ssh_host_ed25519_key.pub
|
|
||||||
ADD test-container/sshd_config /etc/ssh/sshd_config
|
|
||||||
COPY test-container/trusted_ca_keys /etc/ssh/trusted_ca_keys
|
|
||||||
COPY test-container/host_keys/* /etc/ssh/
|
|
||||||
|
|
||||||
RUN apk add --no-cache tini
|
|
||||||
RUN \
|
|
||||||
echo "root:smile" | chpasswd && \
|
|
||||||
adduser -D -s /bin/ash sshj && \
|
|
||||||
passwd -u sshj && \
|
|
||||||
echo "sshj:ultrapassword" | chpasswd && \
|
|
||||||
chmod 600 /home/sshj/.ssh/authorized_keys && \
|
|
||||||
chmod 600 /etc/ssh/ssh_host_*_key && \
|
|
||||||
chmod 644 /etc/ssh/*.pub && \
|
|
||||||
chown -R sshj:sshj /home/sshj
|
|
||||||
|
|
||||||
ENTRYPOINT ["/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2"]
|
|
||||||
@@ -3,6 +3,7 @@ ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAIbmlzdHAyNTYAAABBBHQiZm0w
|
|||||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDAdJiRkkBM8yC8seTEoAn2PfwbLKrkcahZ0xxPoWICJ root@sshj
|
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIDAdJiRkkBM8yC8seTEoAn2PfwbLKrkcahZ0xxPoWICJ root@sshj
|
||||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIJ8ww4hJG/gHJYdkjTTBDF1GNz+228nuWprPV+NbQauA ajvanerp@Heimdall.local
|
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIJ8ww4hJG/gHJYdkjTTBDF1GNz+228nuWprPV+NbQauA ajvanerp@Heimdall.local
|
||||||
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIOaWrwt3drIOjeBq2LSHRavxAT7ja2f+5soOUJl/zKSI ajvanerp@Heimdall.xebialabs.com
|
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIOaWrwt3drIOjeBq2LSHRavxAT7ja2f+5soOUJl/zKSI ajvanerp@Heimdall.xebialabs.com
|
||||||
|
ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAICYfPGSYFOHuSzTJ67H0ynvKJDfgDmwPOj7iJaLGbIBi sshjtest@TranceLove
|
||||||
ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAoZ9l6Tkm2aL1tSBy2yw4xU5s8BE9MfqS/4J7DzvsYJxF6oQmTIjmStuhH/CT7UjuDtKXdXZUsIhKtafiizxGO8kHSzKDeitpth2RSr8ddMzZKyD6RNs7MfsgjA3UTtrrSrCXEY6O43S2cnuJrWzkPxtwxaQ3zOvDbS2tiulzyq0VzYmuhA/a4CyuQtJBuu+P2oqmu6pU/VB6IzONpvBvYbNPsH1WDmP7zko5wHPihXPCliztspKxS4DRtOZ7BGXyvg44UmIy0Kf4jOkaBV/eCCA4qH7ZHz71/5ceMOpszPcNOEmLGGYhwI+P3OuGMpkrSAv1f8IY6R8spZNncP6UaQ== no-passphrase
|
ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAoZ9l6Tkm2aL1tSBy2yw4xU5s8BE9MfqS/4J7DzvsYJxF6oQmTIjmStuhH/CT7UjuDtKXdXZUsIhKtafiizxGO8kHSzKDeitpth2RSr8ddMzZKyD6RNs7MfsgjA3UTtrrSrCXEY6O43S2cnuJrWzkPxtwxaQ3zOvDbS2tiulzyq0VzYmuhA/a4CyuQtJBuu+P2oqmu6pU/VB6IzONpvBvYbNPsH1WDmP7zko5wHPihXPCliztspKxS4DRtOZ7BGXyvg44UmIy0Kf4jOkaBV/eCCA4qH7ZHz71/5ceMOpszPcNOEmLGGYhwI+P3OuGMpkrSAv1f8IY6R8spZNncP6UaQ== no-passphrase
|
||||||
ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQDKRyZAtOJJfAhPU6xE6ZXY564vwErAI3n3Yn4lTHL9bxev9Ily6eCqPLcV0WbSV04pztngFn9MjT7yb8mcXheHpIaWEH569sMpmpOtyfn4p68SceuXBGyyPGMIcfOTknkASd1JYSD4EPkd9rZmCzcx3vEnLu8ChnA/G221xSVQ5VC/jD/c/CgNUayhQ+xbn57qHKKtZwfTa21QmwIabGYJNwlVjlKTCdddeVnZfKqKrG7cxHQApsxd21rhM9IT/C/f4Y/Tx3WUUVeam0iZ265oiPHoPALqJIWSQIUheRYAxYAQqJwSQ0Or9MM8XXun2Iy3RUSGk6eIvrCsFbNURsHNs7Pu0UnpYv6FZ3vCkFep/1pAT6fQvY7pDOOWDHKXArD4watc9gIWaQBH73wDW/KgBcnMRSoGWgQjsYqIamP4oV1+HqUI3lRAsXZaX+eiBGt3+3A5KebP27UJ1YUwhwlzs7wzTKaCu0OaL+hOsP1F2AxAa995bgFksMd23645ux3YCJKXG4sGpJ1Z/Hs49K72gv+QjLZVxXqY623c8+3OUhlixqoEFd4iG7UMc5a552ch/VA+jaspmLZoFhPz99aBRVb1oCSPxSwLw+Q/wxv6pZmT+14rqTzY2farjU53hM+CsUPh7dnWXhGG7RuA5wCdeOXOYjuksfzAoHIZhPqTgQ== ajvanerp@Heimdall.local
|
ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQDKRyZAtOJJfAhPU6xE6ZXY564vwErAI3n3Yn4lTHL9bxev9Ily6eCqPLcV0WbSV04pztngFn9MjT7yb8mcXheHpIaWEH569sMpmpOtyfn4p68SceuXBGyyPGMIcfOTknkASd1JYSD4EPkd9rZmCzcx3vEnLu8ChnA/G221xSVQ5VC/jD/c/CgNUayhQ+xbn57qHKKtZwfTa21QmwIabGYJNwlVjlKTCdddeVnZfKqKrG7cxHQApsxd21rhM9IT/C/f4Y/Tx3WUUVeam0iZ265oiPHoPALqJIWSQIUheRYAxYAQqJwSQ0Or9MM8XXun2Iy3RUSGk6eIvrCsFbNURsHNs7Pu0UnpYv6FZ3vCkFep/1pAT6fQvY7pDOOWDHKXArD4watc9gIWaQBH73wDW/KgBcnMRSoGWgQjsYqIamP4oV1+HqUI3lRAsXZaX+eiBGt3+3A5KebP27UJ1YUwhwlzs7wzTKaCu0OaL+hOsP1F2AxAa995bgFksMd23645ux3YCJKXG4sGpJ1Z/Hs49K72gv+QjLZVxXqY623c8+3OUhlixqoEFd4iG7UMc5a552ch/VA+jaspmLZoFhPz99aBRVb1oCSPxSwLw+Q/wxv6pZmT+14rqTzY2farjU53hM+CsUPh7dnWXhGG7RuA5wCdeOXOYjuksfzAoHIZhPqTgQ== ajvanerp@Heimdall.local
|
||||||
ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBMvfRYSe44VQGwxexOMibcM3+fWeUP1jrBofOxFDRRrzRF8dK/vll2svqTPXMRnITnT1UoemEcB5OHtvH4hzfh/HFeDxJ5S7UncYxoClTSa8MeMFG2Zj9CoUZs1SHbwSGg== root@sshj
|
ecdsa-sha2-nistp384 AAAAE2VjZHNhLXNoYTItbmlzdHAzODQAAAAIbmlzdHAzODQAAABhBMvfRYSe44VQGwxexOMibcM3+fWeUP1jrBofOxFDRRrzRF8dK/vll2svqTPXMRnITnT1UoemEcB5OHtvH4hzfh/HFeDxJ5S7UncYxoClTSa8MeMFG2Zj9CoUZs1SHbwSGg== root@sshj
|
||||||
|
|||||||
7
src/itest/docker-image/entrypoint.sh
Normal file
7
src/itest/docker-image/entrypoint.sh
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
#!/bin/ash
|
||||||
|
|
||||||
|
# generate host keys if not present
|
||||||
|
ssh-keygen -A
|
||||||
|
|
||||||
|
# do not detach (-D), log to stderr (-e), passthrough other arguments
|
||||||
|
exec /usr/sbin/sshd -D -e "$@"
|
||||||
@@ -1,158 +0,0 @@
|
|||||||
# $OpenBSD: sshd_config,v 1.101 2017/03/14 07:19:07 djm Exp $
|
|
||||||
|
|
||||||
# This is the sshd server system-wide configuration file. See
|
|
||||||
# sshd_config(5) for more information.
|
|
||||||
|
|
||||||
# This sshd was compiled with PATH=/bin:/usr/bin:/sbin:/usr/sbin
|
|
||||||
|
|
||||||
# The strategy used for options in the default sshd_config shipped with
|
|
||||||
# OpenSSH is to specify options with their default value where
|
|
||||||
# possible, but leave them commented. Uncommented options override the
|
|
||||||
# default value.
|
|
||||||
|
|
||||||
#Port 22
|
|
||||||
#AddressFamily any
|
|
||||||
#ListenAddress 0.0.0.0
|
|
||||||
#ListenAddress ::
|
|
||||||
|
|
||||||
#HostKey /etc/ssh/ssh_host_rsa_key
|
|
||||||
#HostKey /etc/ssh/ssh_host_dsa_key
|
|
||||||
#HostKey /etc/ssh/ssh_host_ecdsa_key
|
|
||||||
#HostKey /etc/ssh/ssh_host_ed25519_key
|
|
||||||
|
|
||||||
# Ciphers and keying
|
|
||||||
#RekeyLimit default none
|
|
||||||
|
|
||||||
# Logging
|
|
||||||
#SyslogFacility AUTH
|
|
||||||
#LogLevel INFO
|
|
||||||
|
|
||||||
# Authentication:
|
|
||||||
|
|
||||||
#LoginGraceTime 2m
|
|
||||||
PermitRootLogin yes
|
|
||||||
#StrictModes yes
|
|
||||||
#MaxAuthTries 6
|
|
||||||
#MaxSessions 10
|
|
||||||
|
|
||||||
#PubkeyAuthentication yes
|
|
||||||
|
|
||||||
# The default is to check both .ssh/authorized_keys and .ssh/authorized_keys2
|
|
||||||
# but this is overridden so installations will only check .ssh/authorized_keys
|
|
||||||
AuthorizedKeysFile .ssh/authorized_keys
|
|
||||||
|
|
||||||
#AuthorizedPrincipalsFile none
|
|
||||||
|
|
||||||
#AuthorizedKeysCommand none
|
|
||||||
#AuthorizedKeysCommandUser nobody
|
|
||||||
|
|
||||||
# For this to work you will also need host keys in /etc/ssh/ssh_known_hosts
|
|
||||||
#HostbasedAuthentication no
|
|
||||||
# Change to yes if you don't trust ~/.ssh/known_hosts for
|
|
||||||
# HostbasedAuthentication
|
|
||||||
#IgnoreUserKnownHosts no
|
|
||||||
# Don't read the user's ~/.rhosts and ~/.shosts files
|
|
||||||
#IgnoreRhosts yes
|
|
||||||
|
|
||||||
# To disable tunneled clear text passwords, change to no here!
|
|
||||||
#PasswordAuthentication yes
|
|
||||||
#PermitEmptyPasswords no
|
|
||||||
|
|
||||||
# Change to no to disable s/key passwords
|
|
||||||
#ChallengeResponseAuthentication yes
|
|
||||||
|
|
||||||
# Kerberos options
|
|
||||||
#KerberosAuthentication no
|
|
||||||
#KerberosOrLocalPasswd yes
|
|
||||||
#KerberosTicketCleanup yes
|
|
||||||
#KerberosGetAFSToken no
|
|
||||||
|
|
||||||
# GSSAPI options
|
|
||||||
#GSSAPIAuthentication no
|
|
||||||
#GSSAPICleanupCredentials yes
|
|
||||||
|
|
||||||
# Set this to 'yes' to enable PAM authentication, account processing,
|
|
||||||
# and session processing. If this is enabled, PAM authentication will
|
|
||||||
# be allowed through the ChallengeResponseAuthentication and
|
|
||||||
# PasswordAuthentication. Depending on your PAM configuration,
|
|
||||||
# PAM authentication via ChallengeResponseAuthentication may bypass
|
|
||||||
# the setting of "PermitRootLogin without-password".
|
|
||||||
# If you just want the PAM account and session checks to run without
|
|
||||||
# PAM authentication, then enable this but set PasswordAuthentication
|
|
||||||
# and ChallengeResponseAuthentication to 'no'.
|
|
||||||
#UsePAM no
|
|
||||||
|
|
||||||
#AllowAgentForwarding yes
|
|
||||||
#AllowTcpForwarding yes
|
|
||||||
#GatewayPorts no
|
|
||||||
#X11Forwarding no
|
|
||||||
#X11DisplayOffset 10
|
|
||||||
#X11UseLocalhost yes
|
|
||||||
#PermitTTY yes
|
|
||||||
#PrintMotd yes
|
|
||||||
#PrintLastLog yes
|
|
||||||
#TCPKeepAlive yes
|
|
||||||
#UseLogin no
|
|
||||||
#PermitUserEnvironment no
|
|
||||||
#Compression delayed
|
|
||||||
#ClientAliveInterval 0
|
|
||||||
#ClientAliveCountMax 3
|
|
||||||
#UseDNS no
|
|
||||||
#PidFile /run/sshd.pid
|
|
||||||
#MaxStartups 10:30:100
|
|
||||||
#PermitTunnel no
|
|
||||||
#ChrootDirectory none
|
|
||||||
#VersionAddendum none
|
|
||||||
|
|
||||||
# no default banner path
|
|
||||||
#Banner none
|
|
||||||
|
|
||||||
# override default of no subsystems
|
|
||||||
Subsystem sftp /usr/lib/ssh/sftp-server
|
|
||||||
|
|
||||||
# the following are HPN related configuration options
|
|
||||||
# tcp receive buffer polling. disable in non autotuning kernels
|
|
||||||
#TcpRcvBufPoll yes
|
|
||||||
|
|
||||||
# disable hpn performance boosts
|
|
||||||
#HPNDisabled no
|
|
||||||
|
|
||||||
# buffer size for hpn to non-hpn connections
|
|
||||||
#HPNBufferSize 2048
|
|
||||||
|
|
||||||
|
|
||||||
# Example of overriding settings on a per-user basis
|
|
||||||
#Match User anoncvs
|
|
||||||
# X11Forwarding no
|
|
||||||
# AllowTcpForwarding no
|
|
||||||
# PermitTTY no
|
|
||||||
# ForceCommand cvs server
|
|
||||||
|
|
||||||
KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1
|
|
||||||
macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,hmac-ripemd160-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512,hmac-ripemd160,hmac-ripemd160@openssh.com
|
|
||||||
|
|
||||||
TrustedUserCAKeys /etc/ssh/trusted_ca_keys
|
|
||||||
|
|
||||||
Ciphers 3des-cbc,blowfish-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com,chacha20-poly1305@openssh.com
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_rsa_key
|
|
||||||
HostKey /etc/ssh/ssh_host_dsa_key
|
|
||||||
HostKey /etc/ssh/ssh_host_ecdsa_key
|
|
||||||
HostKey /etc/ssh/ssh_host_ed25519_key
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_ecdsa_256_key
|
|
||||||
HostCertificate /etc/ssh/ssh_host_ecdsa_256_key-cert.pub
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_ecdsa_384_key
|
|
||||||
HostCertificate /etc/ssh/ssh_host_ecdsa_384_key-cert.pub
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_ecdsa_521_key
|
|
||||||
HostCertificate /etc/ssh/ssh_host_ecdsa_521_key-cert.pub
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_ed25519_384_key
|
|
||||||
HostCertificate /etc/ssh/ssh_host_ed25519_384_key-cert.pub
|
|
||||||
|
|
||||||
HostKey /etc/ssh/ssh_host_rsa_2048_key
|
|
||||||
HostCertificate /etc/ssh/ssh_host_rsa_2048_key-cert.pub
|
|
||||||
|
|
||||||
LogLevel DEBUG2
|
|
||||||
@@ -1,42 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj
|
|
||||||
|
|
||||||
import net.schmizz.sshj.Config
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import net.schmizz.sshj.SSHClient
|
|
||||||
import net.schmizz.sshj.transport.verification.PromiscuousVerifier
|
|
||||||
import spock.lang.Specification
|
|
||||||
|
|
||||||
class IntegrationBaseSpec extends Specification {
|
|
||||||
protected static final int DOCKER_PORT = 2222
|
|
||||||
protected static final String USERNAME = "sshj"
|
|
||||||
protected static final String KEYFILE = "src/itest/resources/keyfiles/id_rsa"
|
|
||||||
protected final static String SERVER_IP = System.getProperty("serverIP", "127.0.0.1")
|
|
||||||
|
|
||||||
protected static SSHClient getConnectedClient(Config config) {
|
|
||||||
SSHClient sshClient = new SSHClient(config)
|
|
||||||
sshClient.addHostKeyVerifier(new PromiscuousVerifier())
|
|
||||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
|
||||||
|
|
||||||
return sshClient
|
|
||||||
}
|
|
||||||
|
|
||||||
protected static SSHClient getConnectedClient() throws IOException {
|
|
||||||
return getConnectedClient(new DefaultConfig())
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
|
||||||
@@ -1,95 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithms
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import net.schmizz.sshj.SSHClient
|
|
||||||
import net.schmizz.sshj.transport.TransportException
|
|
||||||
import net.schmizz.sshj.userauth.UserAuthException
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class IntegrationSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should accept correct key for #signatureName"() {
|
|
||||||
given:
|
|
||||||
def config = new DefaultConfig()
|
|
||||||
config.setKeyAlgorithms(Collections.singletonList(signatureFactory))
|
|
||||||
SSHClient sshClient = new SSHClient(config)
|
|
||||||
sshClient.addHostKeyVerifier(fingerprint) // test-containers/ssh_host_ecdsa_key's fingerprint
|
|
||||||
|
|
||||||
when:
|
|
||||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
|
||||||
|
|
||||||
then:
|
|
||||||
sshClient.isConnected()
|
|
||||||
|
|
||||||
where:
|
|
||||||
signatureFactory << [KeyAlgorithms.ECDSASHANistp256(), KeyAlgorithms.EdDSA25519()]
|
|
||||||
fingerprint << ["d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3", "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"]
|
|
||||||
signatureName = signatureFactory.getName()
|
|
||||||
}
|
|
||||||
|
|
||||||
def "should decline wrong key"() throws IOException {
|
|
||||||
given:
|
|
||||||
SSHClient sshClient = new SSHClient(new DefaultConfig())
|
|
||||||
sshClient.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3")
|
|
||||||
|
|
||||||
when:
|
|
||||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
|
||||||
|
|
||||||
then:
|
|
||||||
thrown(TransportException.class)
|
|
||||||
}
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should authenticate with key #key"() {
|
|
||||||
given:
|
|
||||||
SSHClient client = getConnectedClient()
|
|
||||||
|
|
||||||
when:
|
|
||||||
def keyProvider = passphrase != null ? client.loadKeys("src/itest/resources/keyfiles/$key", passphrase) : client.loadKeys("src/itest/resources/keyfiles/$key")
|
|
||||||
client.authPublickey(USERNAME, keyProvider)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.isAuthenticated()
|
|
||||||
|
|
||||||
where:
|
|
||||||
key | passphrase
|
|
||||||
// "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
|
|
||||||
"id_ecdsa_opensshv1" | null
|
|
||||||
"id_ed25519_opensshv1" | null
|
|
||||||
"id_ed25519_opensshv1_aes256cbc.pem" | "foobar"
|
|
||||||
"id_ed25519_opensshv1_protected" | "sshjtest"
|
|
||||||
"id_rsa" | null
|
|
||||||
"id_rsa_opensshv1" | null
|
|
||||||
"id_ecdsa_nistp384_opensshv1" | null
|
|
||||||
"id_ecdsa_nistp521_opensshv1" | null
|
|
||||||
}
|
|
||||||
|
|
||||||
def "should not authenticate with wrong key"() {
|
|
||||||
given:
|
|
||||||
SSHClient client = getConnectedClient()
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key")
|
|
||||||
|
|
||||||
then:
|
|
||||||
thrown(UserAuthException.class)
|
|
||||||
!client.isAuthenticated()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,68 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.sftp
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import net.schmizz.sshj.SSHClient
|
|
||||||
import net.schmizz.sshj.sftp.OpenMode
|
|
||||||
import net.schmizz.sshj.sftp.RemoteFile
|
|
||||||
import net.schmizz.sshj.sftp.SFTPClient
|
|
||||||
|
|
||||||
import java.nio.charset.StandardCharsets
|
|
||||||
|
|
||||||
import static org.codehaus.groovy.runtime.IOGroovyMethods.withCloseable
|
|
||||||
|
|
||||||
class FileWriteSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
def "should append to file (GH issue #390)"() {
|
|
||||||
given:
|
|
||||||
SSHClient client = getConnectedClient()
|
|
||||||
client.authPublickey("sshj", "src/test/resources/id_rsa")
|
|
||||||
SFTPClient sftp = client.newSFTPClient()
|
|
||||||
def file = "/home/sshj/test.txt"
|
|
||||||
def initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16)
|
|
||||||
def appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16)
|
|
||||||
|
|
||||||
when:
|
|
||||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) { RemoteFile initial ->
|
|
||||||
initial.write(0, initialText, 0, initialText.length)
|
|
||||||
}
|
|
||||||
|
|
||||||
then:
|
|
||||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
|
|
||||||
def bytes = new byte[initialText.length]
|
|
||||||
read.read(0, bytes, 0, bytes.length)
|
|
||||||
bytes == initialText
|
|
||||||
}
|
|
||||||
|
|
||||||
when:
|
|
||||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) { RemoteFile append ->
|
|
||||||
append.write(0, appendText, 0, appendText.length)
|
|
||||||
}
|
|
||||||
|
|
||||||
then:
|
|
||||||
withCloseable(sftp.open(file, EnumSet.of(OpenMode.READ))) { RemoteFile read ->
|
|
||||||
def bytes = new byte[initialText.length + appendText.length]
|
|
||||||
read.read(0, bytes, 0, bytes.length)
|
|
||||||
Arrays.copyOfRange(bytes, 0, initialText.length) == initialText
|
|
||||||
Arrays.copyOfRange(bytes, initialText.length, initialText.length + appendText.length) == appendText
|
|
||||||
}
|
|
||||||
|
|
||||||
cleanup:
|
|
||||||
sftp.close()
|
|
||||||
client.close()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,115 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.signature
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import net.schmizz.sshj.SSHClient
|
|
||||||
import net.schmizz.sshj.transport.verification.OpenSSHKnownHosts
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
import java.nio.file.Files
|
|
||||||
import java.util.stream.Collectors
|
|
||||||
|
|
||||||
/**
|
|
||||||
* This is a brief test for verifying connection to a server using keys with certificates.
|
|
||||||
*
|
|
||||||
* Also, take a look at the unit test {@link net.schmizz.sshj.transport.verification.KeyWithCertificateUnitSpec}.
|
|
||||||
*/
|
|
||||||
class KeyWithCertificateSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "authorising with a signed public key #keyName"() {
|
|
||||||
given:
|
|
||||||
def client = getConnectedClient()
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, "src/itest/resources/keyfiles/certificates/$keyName")
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
where:
|
|
||||||
keyName << [
|
|
||||||
"id_ecdsa_256_pem_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_256_rfc4716_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_256_pem_signed_by_ed25519",
|
|
||||||
"id_ecdsa_256_rfc4716_signed_by_ed25519",
|
|
||||||
"id_ecdsa_256_pem_signed_by_rsa",
|
|
||||||
"id_ecdsa_256_rfc4716_signed_by_rsa",
|
|
||||||
"id_ecdsa_384_pem_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_384_rfc4716_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_384_pem_signed_by_ed25519",
|
|
||||||
"id_ecdsa_384_rfc4716_signed_by_ed25519",
|
|
||||||
"id_ecdsa_384_pem_signed_by_rsa",
|
|
||||||
"id_ecdsa_384_rfc4716_signed_by_rsa",
|
|
||||||
"id_ecdsa_521_pem_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_521_rfc4716_signed_by_ecdsa",
|
|
||||||
"id_ecdsa_521_pem_signed_by_ed25519",
|
|
||||||
"id_ecdsa_521_rfc4716_signed_by_ed25519",
|
|
||||||
"id_ecdsa_521_pem_signed_by_rsa",
|
|
||||||
"id_ecdsa_521_rfc4716_signed_by_rsa",
|
|
||||||
"id_rsa_2048_pem_signed_by_ecdsa",
|
|
||||||
"id_rsa_2048_rfc4716_signed_by_ecdsa",
|
|
||||||
"id_rsa_2048_pem_signed_by_ed25519",
|
|
||||||
"id_rsa_2048_rfc4716_signed_by_ed25519",
|
|
||||||
"id_rsa_2048_pem_signed_by_rsa",
|
|
||||||
"id_rsa_2048_rfc4716_signed_by_rsa",
|
|
||||||
"id_ed25519_384_rfc4716_signed_by_ecdsa",
|
|
||||||
"id_ed25519_384_rfc4716_signed_by_ed25519",
|
|
||||||
"id_ed25519_384_rfc4716_signed_by_rsa",
|
|
||||||
]
|
|
||||||
}
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "accepting a signed host public key with type #hostKeyAlgo"() {
|
|
||||||
given:
|
|
||||||
File knownHosts = Files.createTempFile("known_hosts", "").toFile()
|
|
||||||
knownHosts.deleteOnExit()
|
|
||||||
|
|
||||||
and:
|
|
||||||
File caPubKey = new File("src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub")
|
|
||||||
String knownHostsFileContents = "" +
|
|
||||||
"@cert-authority $SERVER_IP ${caPubKey.text}" +
|
|
||||||
"\n@cert-authority [$SERVER_IP]:$DOCKER_PORT ${caPubKey.text}"
|
|
||||||
knownHosts.write(knownHostsFileContents)
|
|
||||||
|
|
||||||
and:
|
|
||||||
def config = new DefaultConfig()
|
|
||||||
config.keyAlgorithms = config.keyAlgorithms.stream()
|
|
||||||
.filter { it.name == hostKeyAlgo }
|
|
||||||
.collect(Collectors.toList())
|
|
||||||
SSHClient sshClient = new SSHClient(config)
|
|
||||||
sshClient.addHostKeyVerifier(new OpenSSHKnownHosts(knownHosts))
|
|
||||||
sshClient.connect(SERVER_IP, DOCKER_PORT)
|
|
||||||
|
|
||||||
when:
|
|
||||||
sshClient.authPassword("sshj", "ultrapassword")
|
|
||||||
|
|
||||||
then:
|
|
||||||
sshClient.authenticated
|
|
||||||
|
|
||||||
and:
|
|
||||||
knownHosts.getText() == knownHostsFileContents
|
|
||||||
|
|
||||||
where:
|
|
||||||
hostKeyAlgo << [
|
|
||||||
"ecdsa-sha2-nistp256-cert-v01@openssh.com",
|
|
||||||
"ssh-ed25519-cert-v01@openssh.com",
|
|
||||||
"ssh-rsa-cert-v01@openssh.com",
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,42 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.signature
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithms
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class SignatureSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should correctly connect with #sig Signature"() {
|
|
||||||
given:
|
|
||||||
def cfg = new DefaultConfig()
|
|
||||||
cfg.setKeyAlgorithms(Collections.singletonList(sigFactory))
|
|
||||||
def client = getConnectedClient(cfg)
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, KEYFILE)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
where:
|
|
||||||
sigFactory << [KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512()]
|
|
||||||
sig = sigFactory.name
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,55 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.transport.cipher
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class CipherSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should correctly connect with #cipher Cipher"() {
|
|
||||||
given:
|
|
||||||
def cfg = new DefaultConfig()
|
|
||||||
cfg.setCipherFactories(cipherFactory)
|
|
||||||
def client = getConnectedClient(cfg)
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, KEYFILE)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
cleanup:
|
|
||||||
client.disconnect()
|
|
||||||
|
|
||||||
where:
|
|
||||||
cipherFactory << [BlockCiphers.TripleDESCBC(),
|
|
||||||
BlockCiphers.BlowfishCBC(),
|
|
||||||
BlockCiphers.AES128CBC(),
|
|
||||||
BlockCiphers.AES128CTR(),
|
|
||||||
BlockCiphers.AES192CBC(),
|
|
||||||
BlockCiphers.AES192CTR(),
|
|
||||||
BlockCiphers.AES256CBC(),
|
|
||||||
BlockCiphers.AES256CTR(),
|
|
||||||
GcmCiphers.AES128GCM(),
|
|
||||||
GcmCiphers.AES256GCM(),
|
|
||||||
ChachaPolyCiphers.CHACHA_POLY_OPENSSH()]
|
|
||||||
cipher = cipherFactory.name
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
|
||||||
@@ -1,61 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.transport.kex
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import com.hierynomus.sshj.transport.mac.Macs
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import net.schmizz.sshj.transport.kex.Curve25519DH
|
|
||||||
import net.schmizz.sshj.transport.kex.Curve25519SHA256
|
|
||||||
import net.schmizz.sshj.transport.kex.DH
|
|
||||||
import net.schmizz.sshj.transport.kex.DHGexSHA1
|
|
||||||
import net.schmizz.sshj.transport.kex.DHGexSHA256
|
|
||||||
import net.schmizz.sshj.transport.kex.ECDH
|
|
||||||
import net.schmizz.sshj.transport.kex.ECDHNistP
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class KexSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should correctly connect with #kex Key Exchange"() {
|
|
||||||
given:
|
|
||||||
def cfg = new DefaultConfig()
|
|
||||||
cfg.setKeyExchangeFactories(kexFactory)
|
|
||||||
def client = getConnectedClient(cfg)
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, KEYFILE)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
where:
|
|
||||||
kexFactory << [DHGroups.Group1SHA1(),
|
|
||||||
DHGroups.Group14SHA1(),
|
|
||||||
DHGroups.Group14SHA256(),
|
|
||||||
DHGroups.Group16SHA512(),
|
|
||||||
DHGroups.Group18SHA512(),
|
|
||||||
new DHGexSHA1.Factory(),
|
|
||||||
new DHGexSHA256.Factory(),
|
|
||||||
new Curve25519SHA256.Factory(),
|
|
||||||
new Curve25519SHA256.FactoryLibSsh(),
|
|
||||||
new ECDHNistP.Factory256(),
|
|
||||||
new ECDHNistP.Factory384(),
|
|
||||||
new ECDHNistP.Factory521()]
|
|
||||||
kex = kexFactory.name
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
|
||||||
@@ -1,65 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.transport.mac
|
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
|
||||||
import net.schmizz.sshj.DefaultConfig
|
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class MacSpec extends IntegrationBaseSpec {
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should correctly connect with #mac MAC"() {
|
|
||||||
given:
|
|
||||||
def cfg = new DefaultConfig()
|
|
||||||
cfg.setMACFactories(macFactory)
|
|
||||||
def client = getConnectedClient(cfg)
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, KEYFILE)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
cleanup:
|
|
||||||
client.disconnect()
|
|
||||||
|
|
||||||
where:
|
|
||||||
macFactory << [Macs.HMACRIPEMD160(), Macs.HMACRIPEMD160OpenSsh(), Macs.HMACSHA2256(), Macs.HMACSHA2512()]
|
|
||||||
mac = macFactory.name
|
|
||||||
}
|
|
||||||
|
|
||||||
@Unroll
|
|
||||||
def "should correctly connect with Encrypt-Then-Mac #mac MAC"() {
|
|
||||||
given:
|
|
||||||
def cfg = new DefaultConfig()
|
|
||||||
cfg.setMACFactories(macFactory)
|
|
||||||
def client = getConnectedClient(cfg)
|
|
||||||
|
|
||||||
when:
|
|
||||||
client.authPublickey(USERNAME, KEYFILE)
|
|
||||||
|
|
||||||
then:
|
|
||||||
client.authenticated
|
|
||||||
|
|
||||||
cleanup:
|
|
||||||
client.disconnect()
|
|
||||||
|
|
||||||
where:
|
|
||||||
macFactory << [Macs.HMACRIPEMD160Etm(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm()]
|
|
||||||
mac = macFactory.name
|
|
||||||
}
|
|
||||||
}
|
|
||||||
72
src/itest/java/com/hierynomus/sshj/HostKeyVerifierTest.java
Normal file
72
src/itest/java/com/hierynomus/sshj/HostKeyVerifierTest.java
Normal file
@@ -0,0 +1,72 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import static org.junit.Assert.assertThrows;
|
||||||
|
import static org.junit.Assert.assertTrue;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.Arguments;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.transport.TransportException;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class HostKeyVerifierTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
public static Stream<Arguments> signatureAlgos() {
|
||||||
|
return Stream.of(
|
||||||
|
Arguments.of(KeyAlgorithms.ECDSASHANistp256(), "d3:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3"),
|
||||||
|
Arguments.of(KeyAlgorithms.EdDSA25519(), "dc:68:38:ce:fc:6f:2c:d6:6d:6b:34:eb:5c:f0:41:6a"));
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "Should connect with signature verified for Key Algorithm {0}")
|
||||||
|
@MethodSource("signatureAlgos")
|
||||||
|
public void shouldConnectWithSignatureVerified(KeyAlgorithms.Factory alg, String fingerprint) throws Throwable {
|
||||||
|
Config config = new DefaultConfig();
|
||||||
|
config.setKeyAlgorithms(List.of(alg));
|
||||||
|
|
||||||
|
try (SSHClient client = new SSHClient(config)) {
|
||||||
|
client.addHostKeyVerifier(fingerprint);
|
||||||
|
client.connect(sshd.getHost(), sshd.getFirstMappedPort());
|
||||||
|
|
||||||
|
assertTrue(client.isConnected());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldDeclineWrongKey() throws Throwable {
|
||||||
|
try (SSHClient client = new SSHClient()) {
|
||||||
|
assertThrows(TransportException.class, () -> {
|
||||||
|
client.addHostKeyVerifier("d4:6a:a9:52:05:ab:b5:48:dd:73:60:18:0c:3a:f0:a3");
|
||||||
|
client.connect(sshd.getHost(), sshd.getFirstMappedPort());
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
74
src/itest/java/com/hierynomus/sshj/ManyChannelsTest.java
Normal file
74
src/itest/java/com/hierynomus/sshj/ManyChannelsTest.java
Normal file
@@ -0,0 +1,74 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.concurrent.ExecutorService;
|
||||||
|
import java.util.concurrent.Executors;
|
||||||
|
import java.util.concurrent.Future;
|
||||||
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.common.IOUtils;
|
||||||
|
import net.schmizz.sshj.connection.channel.direct.Session;
|
||||||
|
|
||||||
|
import static org.assertj.core.api.Assertions.*;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class ManyChannelsTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||||
|
.withSshdConfig(SshdConfigBuilder.defaultBuilder().with("MaxSessions", "200")).withAllKeys());
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldWorkWithManyChannelsWithoutNoExistentChannelError_GH805() throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||||
|
|
||||||
|
List<Future<Exception>> futures = new ArrayList<>();
|
||||||
|
ExecutorService executorService = Executors.newCachedThreadPool();
|
||||||
|
|
||||||
|
for (int i = 0; i < 20; i++) {
|
||||||
|
futures.add(executorService.submit(() -> {
|
||||||
|
try {
|
||||||
|
for (int j = 0; j < 10; j++) {
|
||||||
|
try (Session sshSession = client.startSession()) {
|
||||||
|
try (Session.Command sshCommand = sshSession.exec("ls -la")) {
|
||||||
|
IOUtils.readFully(sshCommand.getInputStream()).toString();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (Exception e) {
|
||||||
|
return e;
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
}));
|
||||||
|
}
|
||||||
|
|
||||||
|
executorService.shutdown();
|
||||||
|
executorService.awaitTermination(1, TimeUnit.DAYS);
|
||||||
|
|
||||||
|
assertThat(futures).allSatisfy(future -> assertThat(future.get()).isNull());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
86
src/itest/java/com/hierynomus/sshj/PublicKeyAuthTest.java
Normal file
86
src/itest/java/com/hierynomus/sshj/PublicKeyAuthTest.java
Normal file
@@ -0,0 +1,86 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import static org.junit.Assert.assertFalse;
|
||||||
|
import static org.junit.Assert.assertThrows;
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.Arguments;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.userauth.UserAuthException;
|
||||||
|
import net.schmizz.sshj.userauth.keyprovider.KeyProvider;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class PublicKeyAuthTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(
|
||||||
|
SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com"))
|
||||||
|
.withAllKeys());
|
||||||
|
|
||||||
|
public static Stream<Arguments> keys() {
|
||||||
|
return Stream.of(
|
||||||
|
Arguments.of("id_rsa2", null),
|
||||||
|
// "id_ecdsa_nistp256" | null // TODO: Need to improve PKCS8 key support.
|
||||||
|
Arguments.of("id_ecdsa_opensshv1", null),
|
||||||
|
Arguments.of("id_ed25519_opensshv1", null),
|
||||||
|
Arguments.of("id_ed25519_opensshv1_aes256cbc.pem", "foobar"),
|
||||||
|
Arguments.of("id_ed25519_opensshv1_aes128cbc.pem", "sshjtest"),
|
||||||
|
Arguments.of("id_ed25519_opensshv1_protected", "sshjtest"),
|
||||||
|
Arguments.of("id_rsa", null),
|
||||||
|
Arguments.of("id_rsa_opensshv1", null),
|
||||||
|
Arguments.of("id_ecdsa_nistp384_opensshv1", null),
|
||||||
|
Arguments.of("id_ecdsa_nistp521_opensshv1", null));
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should authenticate with signed public key {0}")
|
||||||
|
@MethodSource("keys")
|
||||||
|
public void shouldAuthenticateWithSignedRsaKey(String key, String passphrase) throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
KeyProvider p = null;
|
||||||
|
if (passphrase != null) {
|
||||||
|
p = client.loadKeys("src/itest/resources/keyfiles/" + key, passphrase);
|
||||||
|
} else {
|
||||||
|
p = client.loadKeys("src/itest/resources/keyfiles/" + key);
|
||||||
|
}
|
||||||
|
client.authPublickey("sshj", p);
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldNotAuthenticateWithUnknownKey() throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
assertThrows(UserAuthException.class, () -> {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_unknown_key");
|
||||||
|
});
|
||||||
|
|
||||||
|
assertFalse(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
100
src/itest/java/com/hierynomus/sshj/RsaShaKeySignatureTest.java
Normal file
100
src/itest/java/com/hierynomus/sshj/RsaShaKeySignatureTest.java
Normal file
@@ -0,0 +1,100 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.Arguments;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
|
||||||
|
|
||||||
|
public class RsaShaKeySignatureTest {
|
||||||
|
|
||||||
|
public static Stream<Arguments> hostKeysAndAlgorithms() {
|
||||||
|
return Stream.of(
|
||||||
|
Arguments.of("ssh_host_ecdsa_256_key", KeyAlgorithms.ECDSASHANistp256()),
|
||||||
|
Arguments.of("ssh_host_ecdsa_384_key", KeyAlgorithms.ECDSASHANistp384()),
|
||||||
|
Arguments.of("ssh_host_ecdsa_521_key", KeyAlgorithms.ECDSASHANistp521()),
|
||||||
|
Arguments.of("ssh_host_ed25519_384_key", KeyAlgorithms.EdDSA25519()),
|
||||||
|
Arguments.of("ssh_host_rsa_2048_key", KeyAlgorithms.RSASHA512()));
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "Should connect to server that does not support ssh-rsa with host key {1}")
|
||||||
|
@MethodSource("hostKeysAndAlgorithms")
|
||||||
|
public void shouldConnectToServerThatDoesNotSupportSshRsaWithHostKey(String key, KeyAlgorithms.Factory algorithm)
|
||||||
|
throws Throwable {
|
||||||
|
SshdConfigBuilder configBuilder = SshdConfigBuilder
|
||||||
|
.defaultBuilder()
|
||||||
|
.with("PubkeyAcceptedAlgorithms", "rsa-sha2-512,rsa-sha2-256,ssh-ed25519");
|
||||||
|
withSshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||||
|
.withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setKeyAlgorithms(List.of(KeyAlgorithms.RSASHA512(), KeyAlgorithms.RSASHA256(), algorithm));
|
||||||
|
|
||||||
|
SSHClient client = sshd.getConnectedClient(c);
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
|
||||||
|
client.disconnect();
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "Should connect to a default server with host key {1} with a default config")
|
||||||
|
@MethodSource("hostKeysAndAlgorithms")
|
||||||
|
public void shouldConnectToDefaultServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
|
||||||
|
withSshdContainer(SshdContainer.Builder.defaultBuilder().addHostKey("test-container/host_keys/" + key),
|
||||||
|
sshd -> {
|
||||||
|
SSHClient client = sshd.getConnectedClient();
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
|
||||||
|
client.disconnect();
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "Should connect to a server that only supports ssh-rsa with host key {1}")
|
||||||
|
@MethodSource("hostKeysAndAlgorithms")
|
||||||
|
public void shouldConnectToSshRsaOnlyServer(String key, KeyAlgorithms.Factory algorithm) throws Throwable {
|
||||||
|
SshdConfigBuilder configBuilder = SshdConfigBuilder
|
||||||
|
.defaultBuilder()
|
||||||
|
.with("PubkeyAcceptedAlgorithms", "ssh-rsa,ssh-ed25519");
|
||||||
|
|
||||||
|
withSshdContainer(SshdContainer.Builder.defaultBuilder()
|
||||||
|
.withSshdConfig(configBuilder).addHostKey("test-container/host_keys/" + key), sshd -> {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setKeyAlgorithms(List.of(KeyAlgorithms.SSHRSA(), algorithm));
|
||||||
|
SSHClient client = sshd.getConnectedClient(c);
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
client.disconnect();
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,77 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import org.testcontainers.containers.wait.strategy.WaitStrategy;
|
||||||
|
import org.testcontainers.containers.wait.strategy.WaitStrategyTarget;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.InetSocketAddress;
|
||||||
|
import java.net.Socket;
|
||||||
|
import java.nio.charset.StandardCharsets;
|
||||||
|
import java.time.Duration;
|
||||||
|
import java.util.Arrays;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A wait strategy designed for {@link SshdContainer} to wait until the SSH server is ready, to avoid races when a test
|
||||||
|
* tries to connect to a server before the server has started.
|
||||||
|
*/
|
||||||
|
public class SshServerWaitStrategy implements WaitStrategy {
|
||||||
|
private Duration startupTimeout = Duration.ofMinutes(1);
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void waitUntilReady(WaitStrategyTarget waitStrategyTarget) {
|
||||||
|
long expectedEnd = System.nanoTime() + startupTimeout.toNanos();
|
||||||
|
while (waitStrategyTarget.isRunning()) {
|
||||||
|
long attemptStart = System.nanoTime();
|
||||||
|
IOException error = null;
|
||||||
|
byte[] buffer = new byte[7];
|
||||||
|
try (Socket socket = new Socket()) {
|
||||||
|
socket.setSoTimeout(500);
|
||||||
|
socket.connect(new InetSocketAddress(
|
||||||
|
waitStrategyTarget.getHost(), waitStrategyTarget.getFirstMappedPort()));
|
||||||
|
// Haven't seen any SSH server that sends the version in two or more packets.
|
||||||
|
//noinspection ResultOfMethodCallIgnored
|
||||||
|
socket.getInputStream().read(buffer);
|
||||||
|
if (!Arrays.equals(buffer, "SSH-2.0".getBytes(StandardCharsets.UTF_8))) {
|
||||||
|
error = new IOException("The version message doesn't look like an SSH server version");
|
||||||
|
}
|
||||||
|
} catch (IOException err) {
|
||||||
|
error = err;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (error == null) {
|
||||||
|
break;
|
||||||
|
} else if (System.nanoTime() >= expectedEnd) {
|
||||||
|
throw new RuntimeException(error);
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
//noinspection BusyWait
|
||||||
|
Thread.sleep(Math.max(0L, 500L - (System.nanoTime() - attemptStart) / 1_000_000));
|
||||||
|
} catch (InterruptedException e) {
|
||||||
|
Thread.currentThread().interrupt();
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public WaitStrategy withStartupTimeout(Duration startupTimeout) {
|
||||||
|
this.startupTimeout = startupTimeout;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
246
src/itest/java/com/hierynomus/sshj/SshdContainer.java
Normal file
246
src/itest/java/com/hierynomus/sshj/SshdContainer.java
Normal file
@@ -0,0 +1,246 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj;
|
||||||
|
|
||||||
|
import ch.qos.logback.classic.Level;
|
||||||
|
import ch.qos.logback.classic.Logger;
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.transport.verification.PromiscuousVerifier;
|
||||||
|
|
||||||
|
import org.jetbrains.annotations.NotNull;
|
||||||
|
import org.junit.jupiter.api.function.ThrowingConsumer;
|
||||||
|
import org.slf4j.LoggerFactory;
|
||||||
|
import org.testcontainers.containers.GenericContainer;
|
||||||
|
import org.testcontainers.images.builder.ImageFromDockerfile;
|
||||||
|
import org.testcontainers.images.builder.dockerfile.DockerfileBuilder;
|
||||||
|
import org.testcontainers.utility.DockerLoggerFactory;
|
||||||
|
|
||||||
|
import java.util.function.Consumer;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.nio.file.Paths;
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.concurrent.Future;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A JUnit4 rule for launching a generic SSH server container.
|
||||||
|
*/
|
||||||
|
public class SshdContainer extends GenericContainer<SshdContainer> {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A workaround for strange logger names of testcontainers. They contain no
|
||||||
|
* dots, but contain slashes,
|
||||||
|
* square brackets, and even emoji. It's uneasy to set the logging level via the
|
||||||
|
* XML file of logback, the
|
||||||
|
* result would be less readable than the code below.
|
||||||
|
*/
|
||||||
|
public static class DebugLoggingImageFromDockerfile extends ImageFromDockerfile {
|
||||||
|
public DebugLoggingImageFromDockerfile() {
|
||||||
|
super();
|
||||||
|
Logger logger = (Logger) LoggerFactory.getILoggerFactory()
|
||||||
|
.getLogger(DockerLoggerFactory.getLogger(getDockerImageName()).getName());
|
||||||
|
logger.setLevel(Level.DEBUG);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class SshdConfigBuilder {
|
||||||
|
public static final String DEFAULT_SSHD_CONFIG = "" +
|
||||||
|
"PermitRootLogin yes\n" +
|
||||||
|
"AuthorizedKeysFile .ssh/authorized_keys\n" +
|
||||||
|
"Subsystem sftp /usr/lib/ssh/sftp-server\n" +
|
||||||
|
"KexAlgorithms curve25519-sha256,curve25519-sha256@libssh.org,ecdh-sha2-nistp256,ecdh-sha2-nistp384,ecdh-sha2-nistp521,diffie-hellman-group-exchange-sha256,diffie-hellman-group16-sha512,diffie-hellman-group18-sha512,diffie-hellman-group14-sha256,diffie-hellman-group14-sha1,diffie-hellman-group1-sha1,diffie-hellman-group-exchange-sha1\n"
|
||||||
|
+
|
||||||
|
"macs umac-64-etm@openssh.com,umac-128-etm@openssh.com,hmac-sha2-256-etm@openssh.com,hmac-sha2-512-etm@openssh.com,umac-64@openssh.com,umac-128@openssh.com,hmac-sha2-256,hmac-sha2-512\n"
|
||||||
|
+
|
||||||
|
"TrustedUserCAKeys /etc/ssh/trusted_ca_keys\n" +
|
||||||
|
"Ciphers 3des-cbc,aes128-cbc,aes192-cbc,aes256-cbc,aes128-ctr,aes192-ctr,aes256-ctr,aes128-gcm@openssh.com,aes256-gcm@openssh.com,chacha20-poly1305@openssh.com\n"
|
||||||
|
+
|
||||||
|
"LogLevel DEBUG2\n";
|
||||||
|
private String sshdConfig;
|
||||||
|
|
||||||
|
public SshdConfigBuilder(@NotNull String sshdConfig) {
|
||||||
|
this.sshdConfig = sshdConfig;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static SshdConfigBuilder defaultBuilder() {
|
||||||
|
return new SshdConfigBuilder(DEFAULT_SSHD_CONFIG);
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull SshdConfigBuilder withHostKey(@NotNull String hostKey) {
|
||||||
|
sshdConfig += "HostKey /etc/ssh/" + Paths.get(hostKey).getFileName() + "\n";
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull SshdConfigBuilder withHostKeyCertificate(@NotNull String hostKeyCertificate) {
|
||||||
|
sshdConfig += "HostCertificate /etc/ssh/" + Paths.get(hostKeyCertificate).getFileName() + "\n";
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull SshdConfigBuilder with(String key, String value) {
|
||||||
|
sshdConfig += key + " " + value + "\n";
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull String build() {
|
||||||
|
return sshdConfig;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class Builder implements Consumer<DockerfileBuilder> {
|
||||||
|
private List<String> hostKeys = new ArrayList<>();
|
||||||
|
private List<String> certificates = new ArrayList<>();
|
||||||
|
private @NotNull SshdConfigBuilder sshdConfig = SshdConfigBuilder.defaultBuilder();
|
||||||
|
|
||||||
|
public static Builder defaultBuilder() {
|
||||||
|
Builder b = new Builder();
|
||||||
|
|
||||||
|
return b;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
public @NotNull Builder withSshdConfig(@NotNull SshdConfigBuilder sshdConfig) {
|
||||||
|
this.sshdConfig = sshdConfig;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull Builder withAllKeys() {
|
||||||
|
this.addHostKey("test-container/ssh_host_ecdsa_key");
|
||||||
|
this.addHostKey("test-container/ssh_host_ed25519_key");
|
||||||
|
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_256_key");
|
||||||
|
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_384_key");
|
||||||
|
this.addHostKey("test-container/host_keys/ssh_host_ecdsa_521_key");
|
||||||
|
this.addHostKey("test-container/host_keys/ssh_host_ed25519_384_key");
|
||||||
|
this.addHostKey("test-container/host_keys/ssh_host_rsa_2048_key");
|
||||||
|
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_256_key-cert.pub");
|
||||||
|
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_384_key-cert.pub");
|
||||||
|
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ecdsa_521_key-cert.pub");
|
||||||
|
this.addHostKeyCertificate("test-container/host_keys/ssh_host_ed25519_384_key-cert.pub");
|
||||||
|
this.addHostKeyCertificate("test-container/host_keys/ssh_host_rsa_2048_key-cert.pub");
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull SshdContainer build() {
|
||||||
|
return new SshdContainer(buildInner());
|
||||||
|
}
|
||||||
|
|
||||||
|
@NotNull Future<String> buildInner() {
|
||||||
|
return new DebugLoggingImageFromDockerfile()
|
||||||
|
.withDockerfileFromBuilder(this)
|
||||||
|
.withFileFromPath(".", Paths.get("src/itest/docker-image"))
|
||||||
|
.withFileFromString("sshd_config", sshdConfig.build());
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void accept(@NotNull DockerfileBuilder builder) {
|
||||||
|
builder.from("alpine:3.19.0");
|
||||||
|
builder.run("apk add --no-cache openssh");
|
||||||
|
builder.expose(22);
|
||||||
|
builder.copy("entrypoint.sh", "/entrypoint.sh");
|
||||||
|
|
||||||
|
builder.add("authorized_keys", "/home/sshj/.ssh/authorized_keys");
|
||||||
|
builder.copy("test-container/trusted_ca_keys", "/etc/ssh/trusted_ca_keys");
|
||||||
|
|
||||||
|
for (String hostKey : hostKeys) {
|
||||||
|
builder.copy(hostKey, "/etc/ssh/" + Paths.get(hostKey).getFileName());
|
||||||
|
builder.copy(hostKey + ".pub", "/etc/ssh/" + Paths.get(hostKey).getFileName() + ".pub");
|
||||||
|
}
|
||||||
|
|
||||||
|
for (String certificate : certificates) {
|
||||||
|
builder.copy(certificate, "/etc/ssh/" + Paths.get(certificate).getFileName());
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
builder.run("apk add --no-cache tini"
|
||||||
|
+ " && echo \"root:smile\" | chpasswd"
|
||||||
|
+ " && adduser -D -s /bin/ash sshj"
|
||||||
|
+ " && passwd -u sshj"
|
||||||
|
+ " && echo \"sshj:ultrapassword\" | chpasswd"
|
||||||
|
+ " && chmod 600 /home/sshj/.ssh/authorized_keys"
|
||||||
|
+ " && chmod 600 /etc/ssh/ssh_host_*_key"
|
||||||
|
+ " && chmod 644 /etc/ssh/*.pub"
|
||||||
|
+ " && chmod 755 /entrypoint.sh"
|
||||||
|
+ " && chown -R sshj:sshj /home/sshj");
|
||||||
|
builder.entryPoint("/sbin/tini", "/entrypoint.sh", "-o", "LogLevel=DEBUG2");
|
||||||
|
|
||||||
|
builder.add("sshd_config", "/etc/ssh/sshd_config");
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull Builder addHostKey(@NotNull String hostKey) {
|
||||||
|
hostKeys.add(hostKey);
|
||||||
|
sshdConfig.withHostKey(hostKey);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NotNull Builder addHostKeyCertificate(@NotNull String hostKeyCertificate) {
|
||||||
|
certificates.add(hostKeyCertificate);
|
||||||
|
sshdConfig.withHostKeyCertificate(hostKeyCertificate);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressWarnings("unused") // Used dynamically by Spock
|
||||||
|
public SshdContainer() {
|
||||||
|
this(new SshdContainer.Builder().withAllKeys().buildInner());
|
||||||
|
}
|
||||||
|
|
||||||
|
public SshdContainer(SshdContainer.Builder builder) {
|
||||||
|
this(builder.buildInner());
|
||||||
|
}
|
||||||
|
|
||||||
|
public SshdContainer(@NotNull Future<String> future) {
|
||||||
|
super(future);
|
||||||
|
withExposedPorts(22);
|
||||||
|
setWaitStrategy(new SshServerWaitStrategy());
|
||||||
|
withLogConsumer(outputFrame -> {
|
||||||
|
switch (outputFrame.getType()) {
|
||||||
|
case STDOUT:
|
||||||
|
logger().info("sshd stdout: {}", outputFrame.getUtf8String().stripTrailing());
|
||||||
|
break;
|
||||||
|
case STDERR:
|
||||||
|
logger().info("sshd stderr: {}", outputFrame.getUtf8String().stripTrailing());
|
||||||
|
break;
|
||||||
|
case END:
|
||||||
|
break;
|
||||||
|
|
||||||
|
}
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
public SSHClient getConnectedClient(Config config) throws IOException {
|
||||||
|
SSHClient sshClient = new SSHClient(config);
|
||||||
|
sshClient.addHostKeyVerifier(new PromiscuousVerifier());
|
||||||
|
sshClient.connect("127.0.0.1", getFirstMappedPort());
|
||||||
|
|
||||||
|
return sshClient;
|
||||||
|
}
|
||||||
|
|
||||||
|
public SSHClient getConnectedClient() throws IOException {
|
||||||
|
return getConnectedClient(new DefaultConfig());
|
||||||
|
}
|
||||||
|
|
||||||
|
public static void withSshdContainer(SshdContainer.Builder builder, @NotNull ThrowingConsumer<SshdContainer> consumer) throws Throwable {
|
||||||
|
SshdContainer sshdContainer = new SshdContainer(builder.buildInner());
|
||||||
|
sshdContainer.start();
|
||||||
|
try {
|
||||||
|
consumer.accept(sshdContainer);
|
||||||
|
} finally {
|
||||||
|
sshdContainer.stop();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
73
src/itest/java/com/hierynomus/sshj/sftp/FileWriteTest.java
Normal file
73
src/itest/java/com/hierynomus/sshj/sftp/FileWriteTest.java
Normal file
@@ -0,0 +1,73 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.sftp;
|
||||||
|
|
||||||
|
import java.nio.charset.StandardCharsets;
|
||||||
|
import java.util.EnumSet;
|
||||||
|
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
import org.testcontainers.shaded.org.bouncycastle.util.Arrays;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.sftp.OpenMode;
|
||||||
|
import net.schmizz.sshj.sftp.RemoteFile;
|
||||||
|
import net.schmizz.sshj.sftp.SFTPClient;
|
||||||
|
|
||||||
|
import static org.assertj.core.api.Assertions.assertThat;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class FileWriteTest {
|
||||||
|
@Container
|
||||||
|
private static SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldAppendToFile_GH390() throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||||
|
try (SFTPClient sftp = client.newSFTPClient()) {
|
||||||
|
String file = "/home/sshj/test.txt";
|
||||||
|
byte[] initialText = "This is the initial text.\n".getBytes(StandardCharsets.UTF_16);
|
||||||
|
byte[] appendText = "And here's the appended text.\n".getBytes(StandardCharsets.UTF_16);
|
||||||
|
|
||||||
|
try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT))) {
|
||||||
|
initial.write(0, initialText, 0, initialText.length);
|
||||||
|
}
|
||||||
|
|
||||||
|
try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
|
||||||
|
byte[] readBytes = new byte[initialText.length];
|
||||||
|
read.read(0, readBytes, 0, readBytes.length);
|
||||||
|
assertThat(readBytes).isEqualTo(initialText);
|
||||||
|
}
|
||||||
|
|
||||||
|
try (RemoteFile initial = sftp.open(file, EnumSet.of(OpenMode.WRITE, OpenMode.APPEND))) {
|
||||||
|
initial.write(0, appendText, 0, appendText.length);
|
||||||
|
}
|
||||||
|
|
||||||
|
try (RemoteFile read = sftp.open(file, EnumSet.of(OpenMode.READ))) {
|
||||||
|
byte[] readBytes = new byte[initialText.length + appendText.length];
|
||||||
|
read.read(0, readBytes, 0, readBytes.length);
|
||||||
|
assertThat(Arrays.copyOfRange(readBytes, 0, initialText.length)).isEqualTo(initialText);
|
||||||
|
assertThat(Arrays.copyOfRange(readBytes, initialText.length, initialText.length + appendText.length)).isEqualTo(appendText);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,81 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.sftp;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.sftp.SFTPClient;
|
||||||
|
import net.schmizz.sshj.xfer.InMemorySourceFile;
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import java.io.ByteArrayInputStream;
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.io.InputStream;
|
||||||
|
import java.util.Random;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class PutFileCompressedTest {
|
||||||
|
|
||||||
|
private static class TestInMemorySourceFile extends InMemorySourceFile {
|
||||||
|
|
||||||
|
private final String name;
|
||||||
|
private final byte[] data;
|
||||||
|
|
||||||
|
public TestInMemorySourceFile(String name, byte[] data) {
|
||||||
|
this.name = name;
|
||||||
|
this.data = data;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public long getLength() {
|
||||||
|
return data.length;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public InputStream getInputStream() throws IOException {
|
||||||
|
return new ByteArrayInputStream(data);
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
@Container
|
||||||
|
private static SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldPutCompressedFile_GH893() throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||||
|
client.useCompression();
|
||||||
|
try (SFTPClient sftp = client.newSFTPClient()) {
|
||||||
|
String filename = "test.txt";
|
||||||
|
// needs to be a larger file for bug taking effect
|
||||||
|
byte[] content = new byte[5000];
|
||||||
|
Random r = new Random(1);
|
||||||
|
r.nextBytes(content);
|
||||||
|
|
||||||
|
sftp.put(new TestInMemorySourceFile(filename,content), "/home/sshj/");
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,47 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.sftp;
|
||||||
|
|
||||||
|
import static org.junit.Assert.assertFalse;
|
||||||
|
import static org.junit.Assert.assertNull;
|
||||||
|
|
||||||
|
import org.junit.jupiter.api.Test;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.sftp.FileAttributes;
|
||||||
|
import net.schmizz.sshj.sftp.SFTPClient;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class SftpIntegrationTest {
|
||||||
|
@Container
|
||||||
|
private static SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
@Test
|
||||||
|
public void shouldCheckFileExistsForNonExistingFile_GH894() throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient()) {
|
||||||
|
client.authPublickey("sshj", "src/test/resources/id_rsa");
|
||||||
|
try (SFTPClient sftp = client.newSFTPClient()) {
|
||||||
|
String file = "/home/sshj/i_do_not_exist.txt";
|
||||||
|
FileAttributes exists = sftp.statExistence(file);
|
||||||
|
assertNull(exists);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,65 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.signature;
|
||||||
|
|
||||||
|
import java.io.File;
|
||||||
|
import java.io.StringReader;
|
||||||
|
import java.nio.file.Files;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.ValueSource;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.transport.verification.OpenSSHKnownHosts;
|
||||||
|
|
||||||
|
import static com.hierynomus.sshj.SshdContainer.withSshdContainer;
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
public class HostKeyWithCertificateTest {
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "Should connect to server that has a signed host public key {0}")
|
||||||
|
@ValueSource(strings = { "ssh_host_ecdsa_256_key", "ssh_host_ecdsa_384_key", "ssh_host_ecdsa_521_key",
|
||||||
|
"ssh_host_ed25519_384_key" })
|
||||||
|
// TODO "ssh_host_rsa_2048_key" fails with "HOST_KEY_NOT_VERIFIABLE" after upgrade to new OpenSSH version
|
||||||
|
public void shouldConnectToServerWithSignedHostKey(String hostkey) throws Throwable {
|
||||||
|
File caPubKey = new File("src/itest/resources/keyfiles/certificates/CA_rsa.pem.pub");
|
||||||
|
String caPubKeyContents = Files.readString(caPubKey.toPath());
|
||||||
|
String address = "127.0.0.1";
|
||||||
|
|
||||||
|
SshdConfigBuilder b = SshdConfigBuilder.defaultBuilder().with("PasswordAuthentication", "yes");
|
||||||
|
|
||||||
|
withSshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(b).addHostKey("test-container/host_keys/" + hostkey).addHostKeyCertificate("test-container/host_keys/" + hostkey + "-cert.pub"), sshd -> {
|
||||||
|
String knownHosts = List.of("@cert-authority " + address + " " + caPubKeyContents,
|
||||||
|
"@cert-authority [" + address + "]:" + sshd.getFirstMappedPort() + " " + caPubKeyContents).stream()
|
||||||
|
.reduce("", (a, b1) -> a + "\n" + b1);
|
||||||
|
DefaultConfig cfg = new DefaultConfig();
|
||||||
|
try (SSHClient c = new SSHClient(cfg)) {
|
||||||
|
c.addHostKeyVerifier(new OpenSSHKnownHosts(new StringReader(knownHosts)));
|
||||||
|
c.connect(address, sshd.getFirstMappedPort());
|
||||||
|
|
||||||
|
c.authPassword("sshj", "ultrapassword");
|
||||||
|
|
||||||
|
assertTrue(c.isAuthenticated());
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,83 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.signature;
|
||||||
|
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class PublicKeyAuthWithCertificateTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("PubkeyAcceptedAlgorithms", "+ssh-rsa-cert-v01@openssh.com")).withAllKeys());
|
||||||
|
|
||||||
|
public static Stream<String> keys() {
|
||||||
|
return Stream.of(
|
||||||
|
"id_ecdsa_256_pem_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_256_rfc4716_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_256_pem_signed_by_ed25519",
|
||||||
|
"id_ecdsa_256_rfc4716_signed_by_ed25519",
|
||||||
|
"id_ecdsa_256_pem_signed_by_rsa",
|
||||||
|
"id_ecdsa_256_rfc4716_signed_by_rsa",
|
||||||
|
"id_ecdsa_384_pem_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_384_rfc4716_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_384_pem_signed_by_ed25519",
|
||||||
|
"id_ecdsa_384_rfc4716_signed_by_ed25519",
|
||||||
|
"id_ecdsa_384_pem_signed_by_rsa",
|
||||||
|
"id_ecdsa_384_rfc4716_signed_by_rsa",
|
||||||
|
"id_ecdsa_521_pem_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_521_rfc4716_signed_by_ecdsa",
|
||||||
|
"id_ecdsa_521_pem_signed_by_ed25519",
|
||||||
|
"id_ecdsa_521_rfc4716_signed_by_ed25519",
|
||||||
|
"id_ecdsa_521_pem_signed_by_rsa",
|
||||||
|
"id_ecdsa_521_rfc4716_signed_by_rsa",
|
||||||
|
"id_rsa_2048_pem_signed_by_ecdsa",
|
||||||
|
"id_rsa_2048_rfc4716_signed_by_ecdsa",
|
||||||
|
"id_rsa_2048_pem_signed_by_ed25519",
|
||||||
|
"id_rsa_2048_rfc4716_signed_by_ed25519",
|
||||||
|
"id_rsa_2048_pem_signed_by_rsa",
|
||||||
|
"id_rsa_2048_rfc4716_signed_by_rsa",
|
||||||
|
"id_ed25519_384_rfc4716_signed_by_ecdsa",
|
||||||
|
"id_ed25519_384_rfc4716_signed_by_ed25519",
|
||||||
|
"id_ed25519_384_rfc4716_signed_by_rsa");
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should authenticate with signed public key {0}")
|
||||||
|
@MethodSource("keys")
|
||||||
|
public void shouldAuthenticateWithSignedPublicKey(String key) throws Throwable {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
SSHClient client = sshd.getConnectedClient(c);
|
||||||
|
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/certificates/" + key);
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
|
||||||
|
client.disconnect();
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
@@ -0,0 +1,57 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.signature;
|
||||||
|
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
import com.hierynomus.sshj.SshdContainer.SshdConfigBuilder;
|
||||||
|
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class SignatureTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer(SshdContainer.Builder.defaultBuilder().withSshdConfig(SshdConfigBuilder.defaultBuilder().with("HostKeyAlgorithms", "+ssh-rsa").with("PubkeyAcceptedAlgorithms", "+ssh-rsa")).withAllKeys());
|
||||||
|
|
||||||
|
public static Stream<KeyAlgorithms.Factory> algs() {
|
||||||
|
return Stream.of(KeyAlgorithms.SSHRSA(), KeyAlgorithms.RSASHA256(), KeyAlgorithms.RSASHA512());
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should correctly connect with Signature {0}")
|
||||||
|
@MethodSource("algs")
|
||||||
|
public void shouldCorrectlyConnectWithMac(KeyAlgorithms.Factory alg) throws Throwable {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setKeyAlgorithms(List.of(alg));
|
||||||
|
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
@@ -0,0 +1,65 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.transport.cipher;
|
||||||
|
|
||||||
|
import static org.junit.Assert.assertTrue;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.common.Factory;
|
||||||
|
import net.schmizz.sshj.transport.cipher.Cipher;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class CipherTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
public static Stream<Factory.Named<Cipher>> ciphers() {
|
||||||
|
return Stream.of(BlockCiphers.TripleDESCBC(),
|
||||||
|
BlockCiphers.AES128CBC(),
|
||||||
|
BlockCiphers.AES128CTR(),
|
||||||
|
BlockCiphers.AES192CBC(),
|
||||||
|
BlockCiphers.AES192CTR(),
|
||||||
|
BlockCiphers.AES256CBC(),
|
||||||
|
BlockCiphers.AES256CTR(),
|
||||||
|
GcmCiphers.AES128GCM(),
|
||||||
|
GcmCiphers.AES256GCM(),
|
||||||
|
ChachaPolyCiphers.CHACHA_POLY_OPENSSH());
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should correctly connect with Cipher {0}")
|
||||||
|
@MethodSource("ciphers")
|
||||||
|
public void shouldCorrectlyConnectWithCipher(Factory.Named<Cipher> cipher) throws Throwable {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setCipherFactories(List.of(cipher));
|
||||||
|
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,72 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.transport.kex;
|
||||||
|
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.common.Factory;
|
||||||
|
import net.schmizz.sshj.transport.kex.Curve25519SHA256;
|
||||||
|
import net.schmizz.sshj.transport.kex.DHGexSHA1;
|
||||||
|
import net.schmizz.sshj.transport.kex.DHGexSHA256;
|
||||||
|
import net.schmizz.sshj.transport.kex.ECDHNistP;
|
||||||
|
import net.schmizz.sshj.transport.kex.KeyExchange;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class KexTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
public static Stream<Factory.Named<KeyExchange>> kex() {
|
||||||
|
return Stream.of(
|
||||||
|
DHGroups.Group1SHA1(),
|
||||||
|
DHGroups.Group14SHA1(),
|
||||||
|
DHGroups.Group14SHA256(),
|
||||||
|
DHGroups.Group16SHA512(),
|
||||||
|
DHGroups.Group18SHA512(),
|
||||||
|
new DHGexSHA1.Factory(),
|
||||||
|
new DHGexSHA256.Factory(),
|
||||||
|
new Curve25519SHA256.Factory(),
|
||||||
|
new Curve25519SHA256.FactoryLibSsh(),
|
||||||
|
new ECDHNistP.Factory256(),
|
||||||
|
new ECDHNistP.Factory384(),
|
||||||
|
new ECDHNistP.Factory521());
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should correctly connect with Key Exchange {0}")
|
||||||
|
@MethodSource("kex")
|
||||||
|
public void shouldCorrectlyConnectWithMac(Factory.Named<KeyExchange> kex) throws Throwable {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setKeyExchangeFactories(List.of(kex));
|
||||||
|
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,153 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.transport.kex;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import ch.qos.logback.classic.Logger;
|
||||||
|
import ch.qos.logback.classic.spi.ILoggingEvent;
|
||||||
|
import ch.qos.logback.core.read.ListAppender;
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
import net.schmizz.keepalive.KeepAlive;
|
||||||
|
import net.schmizz.keepalive.KeepAliveProvider;
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
import net.schmizz.sshj.common.Message;
|
||||||
|
import net.schmizz.sshj.common.SSHPacket;
|
||||||
|
import net.schmizz.sshj.connection.ConnectionImpl;
|
||||||
|
import net.schmizz.sshj.transport.TransportException;
|
||||||
|
import org.junit.jupiter.api.AfterEach;
|
||||||
|
import org.junit.jupiter.api.BeforeEach;
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.Arguments;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.slf4j.LoggerFactory;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import static org.assertj.core.api.Assertions.assertThat;
|
||||||
|
import static org.junit.jupiter.api.Assertions.assertTrue;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
class StrictKeyExchangeTest {
|
||||||
|
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
private final List<Logger> watchedLoggers = new ArrayList<>();
|
||||||
|
private final ListAppender<ILoggingEvent> logWatcher = new ListAppender<>();
|
||||||
|
|
||||||
|
@BeforeEach
|
||||||
|
void setUpLogWatcher() {
|
||||||
|
logWatcher.start();
|
||||||
|
setUpLogger("net.schmizz.sshj.transport.Decoder");
|
||||||
|
setUpLogger("net.schmizz.sshj.transport.Encoder");
|
||||||
|
setUpLogger("net.schmizz.sshj.transport.KeyExchanger");
|
||||||
|
}
|
||||||
|
|
||||||
|
@AfterEach
|
||||||
|
void tearDown() {
|
||||||
|
watchedLoggers.forEach(Logger::detachAndStopAllAppenders);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void setUpLogger(String className) {
|
||||||
|
Logger logger = ((Logger) LoggerFactory.getLogger(className));
|
||||||
|
logger.addAppender(logWatcher);
|
||||||
|
watchedLoggers.add(logger);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static Stream<Arguments> strictKeyExchange() {
|
||||||
|
Config defaultConfig = new DefaultConfig();
|
||||||
|
Config heartbeaterConfig = new DefaultConfig();
|
||||||
|
heartbeaterConfig.setKeepAliveProvider(new KeepAliveProvider() {
|
||||||
|
@Override
|
||||||
|
public KeepAlive provide(ConnectionImpl connection) {
|
||||||
|
return new HotLoopHeartbeater(connection);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
return Stream.of(defaultConfig, heartbeaterConfig).map(Arguments::of);
|
||||||
|
}
|
||||||
|
|
||||||
|
@MethodSource
|
||||||
|
@ParameterizedTest
|
||||||
|
void strictKeyExchange(Config config) throws Throwable {
|
||||||
|
try (SSHClient client = sshd.getConnectedClient(config)) {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
List<String> keyExchangerLogs = getLogs("KeyExchanger");
|
||||||
|
assertThat(keyExchangerLogs).contains(
|
||||||
|
"Initiating key exchange",
|
||||||
|
"Sending SSH_MSG_KEXINIT",
|
||||||
|
"Received SSH_MSG_KEXINIT",
|
||||||
|
"Enabling strict key exchange extension"
|
||||||
|
);
|
||||||
|
List<String> decoderLogs = getLogs("Decoder").stream()
|
||||||
|
.map(log -> log.split(":")[0])
|
||||||
|
.collect(Collectors.toList());
|
||||||
|
assertThat(decoderLogs).startsWith(
|
||||||
|
"Received packet #0",
|
||||||
|
"Received packet #1",
|
||||||
|
"Received packet #2",
|
||||||
|
"Received packet #0",
|
||||||
|
"Received packet #1",
|
||||||
|
"Received packet #2",
|
||||||
|
"Received packet #3"
|
||||||
|
);
|
||||||
|
List<String> encoderLogs = getLogs("Encoder").stream()
|
||||||
|
.map(log -> log.split(":")[0])
|
||||||
|
.collect(Collectors.toList());
|
||||||
|
assertThat(encoderLogs).startsWith(
|
||||||
|
"Encoding packet #0",
|
||||||
|
"Encoding packet #1",
|
||||||
|
"Encoding packet #2",
|
||||||
|
"Encoding packet #0",
|
||||||
|
"Encoding packet #1",
|
||||||
|
"Encoding packet #2",
|
||||||
|
"Encoding packet #3"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private List<String> getLogs(String className) {
|
||||||
|
return logWatcher.list.stream()
|
||||||
|
.filter(event -> event.getLoggerName().endsWith(className))
|
||||||
|
.map(ILoggingEvent::getFormattedMessage)
|
||||||
|
.collect(Collectors.toList());
|
||||||
|
}
|
||||||
|
|
||||||
|
private static class HotLoopHeartbeater extends KeepAlive {
|
||||||
|
|
||||||
|
HotLoopHeartbeater(ConnectionImpl conn) {
|
||||||
|
super(conn, "sshj-Heartbeater");
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean isEnabled() {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
protected void doKeepAlive() throws TransportException {
|
||||||
|
conn.getTransport().write(new SSHPacket(Message.IGNORE));
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
@@ -0,0 +1,54 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.transport.mac;
|
||||||
|
|
||||||
|
import static org.junit.Assert.assertTrue;
|
||||||
|
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.stream.Stream;
|
||||||
|
|
||||||
|
import org.junit.jupiter.params.ParameterizedTest;
|
||||||
|
import org.junit.jupiter.params.provider.MethodSource;
|
||||||
|
import org.testcontainers.junit.jupiter.Container;
|
||||||
|
import org.testcontainers.junit.jupiter.Testcontainers;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.SshdContainer;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.Config;
|
||||||
|
import net.schmizz.sshj.DefaultConfig;
|
||||||
|
import net.schmizz.sshj.SSHClient;
|
||||||
|
|
||||||
|
@Testcontainers
|
||||||
|
public class MacTest {
|
||||||
|
@Container
|
||||||
|
private static final SshdContainer sshd = new SshdContainer();
|
||||||
|
|
||||||
|
public static Stream<Macs.Factory> macs() {
|
||||||
|
return Stream.of(Macs.HMACSHA2256(), Macs.HMACSHA2512(), Macs.HMACSHA2256Etm(), Macs.HMACSHA2512Etm());
|
||||||
|
}
|
||||||
|
|
||||||
|
@ParameterizedTest(name = "should correctly connect with MAC {0}")
|
||||||
|
@MethodSource("macs")
|
||||||
|
public void shouldCorrectlyConnectWithMac(Macs.Factory mac) throws Throwable {
|
||||||
|
Config c = new DefaultConfig();
|
||||||
|
c.setMACFactories(List.of(mac));
|
||||||
|
try (SSHClient client = sshd.getConnectedClient(c)) {
|
||||||
|
client.authPublickey("sshj", "src/itest/resources/keyfiles/id_rsa_opensshv1");
|
||||||
|
|
||||||
|
assertTrue(client.isAuthenticated());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,3 @@
|
|||||||
|
-----BEGIN OPENSSH PRIVATE KEY-----
|
||||||
|
b3BlbnNzaC1rZXktdjEAAAAACmFlczEyOC1jYmMAAAAGYmNyeXB0AAAAGAAAABDfrL8SxDyrkNlsJdAmc7Z0AAAAEAAAAAEAAAAzAAAAC3NzaC1lZDI1NTE5AAAAICYfPGSYFOHuSzTJ67H0ynvKJDfgDmwPOj7iJaLGbIBiAAAAkLVqaDIfs+sPBNyy7ytdLnP/xH7Nt5FIXx3Upw6wKuMGdBzbFQLcvu60Le+SFP3uUfXE8TcHramXbH0n+UBMW6raCAKOkHUU1BtrKxPG1eKU/LBx3Bk5FxyKm7fo0XsCUmqSVK25EHOJfYq1QwIbWICkvQUNu+2Hg8/MQKoFJMentI+GqjdaG76f6Wf+aj9UwA==
|
||||||
|
-----END OPENSSH PRIVATE KEY-----
|
||||||
34
src/itest/resources/logback-test.xml
Normal file
34
src/itest/resources/logback-test.xml
Normal file
@@ -0,0 +1,34 @@
|
|||||||
|
<!--
|
||||||
|
|
||||||
|
Copyright (C)2009 - SSHJ Contributors
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
|
||||||
|
-->
|
||||||
|
<configuration>
|
||||||
|
|
||||||
|
<appender name="STDOUT" class="ch.qos.logback.core.ConsoleAppender">
|
||||||
|
<encoder>
|
||||||
|
<pattern>%d{yyyy-MM-dd HH:mm:ss.SSS} [%.-20thread] %-5level %logger{36} - %msg%n</pattern>
|
||||||
|
</encoder>
|
||||||
|
</appender>
|
||||||
|
|
||||||
|
<root level="info">
|
||||||
|
<appender-ref ref="STDOUT"/>
|
||||||
|
</root>
|
||||||
|
|
||||||
|
<logger name="org.apache.sshd.server" level="debug" />
|
||||||
|
<logger name="net.schmizz.sshj" level="debug"/>
|
||||||
|
<logger name="net.schmizz.sshj.transport" level="trace" />
|
||||||
|
|
||||||
|
</configuration>
|
||||||
@@ -1,78 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.backport;
|
|
||||||
|
|
||||||
import net.schmizz.sshj.common.IOUtils;
|
|
||||||
|
|
||||||
import java.io.IOException;
|
|
||||||
import java.io.InputStream;
|
|
||||||
import java.net.*;
|
|
||||||
|
|
||||||
public class Jdk7HttpProxySocket extends Socket {
|
|
||||||
|
|
||||||
private Proxy httpProxy = null;
|
|
||||||
|
|
||||||
public Jdk7HttpProxySocket(Proxy proxy) {
|
|
||||||
super(proxy.type() == Proxy.Type.HTTP ? Proxy.NO_PROXY : proxy);
|
|
||||||
if (proxy.type() == Proxy.Type.HTTP) {
|
|
||||||
this.httpProxy = proxy;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public void connect(SocketAddress endpoint, int timeout) throws IOException {
|
|
||||||
if (httpProxy != null) {
|
|
||||||
connectHttpProxy(endpoint, timeout);
|
|
||||||
} else {
|
|
||||||
super.connect(endpoint, timeout);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
private void connectHttpProxy(SocketAddress endpoint, int timeout) throws IOException {
|
|
||||||
super.connect(httpProxy.address(), timeout);
|
|
||||||
|
|
||||||
if (!(endpoint instanceof InetSocketAddress)) {
|
|
||||||
throw new SocketException("Expected an InetSocketAddress to connect to, got: " + endpoint);
|
|
||||||
}
|
|
||||||
InetSocketAddress isa = (InetSocketAddress) endpoint;
|
|
||||||
String httpConnect = "CONNECT " + isa.getHostName() + ":" + isa.getPort() + " HTTP/1.0\n\n";
|
|
||||||
getOutputStream().write(httpConnect.getBytes(IOUtils.UTF8));
|
|
||||||
checkAndFlushProxyResponse();
|
|
||||||
}
|
|
||||||
|
|
||||||
private void checkAndFlushProxyResponse()throws IOException {
|
|
||||||
InputStream socketInput = getInputStream();
|
|
||||||
byte[] tmpBuffer = new byte[512];
|
|
||||||
int len = socketInput.read(tmpBuffer, 0, tmpBuffer.length);
|
|
||||||
|
|
||||||
if (len == 0) {
|
|
||||||
throw new SocketException("Empty response from proxy");
|
|
||||||
}
|
|
||||||
|
|
||||||
String proxyResponse = new String(tmpBuffer, 0, len, IOUtils.UTF8);
|
|
||||||
|
|
||||||
// Expecting HTTP/1.x 200 OK
|
|
||||||
if (proxyResponse.contains("200")) {
|
|
||||||
// Flush any outstanding message in buffer
|
|
||||||
if (socketInput.available() > 0) {
|
|
||||||
socketInput.skip(socketInput.available());
|
|
||||||
}
|
|
||||||
// Proxy Connect Successful
|
|
||||||
} else {
|
|
||||||
throw new SocketException("Fail to create Socket\nResponse was:" + proxyResponse);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,41 +0,0 @@
|
|||||||
/*
|
|
||||||
* Copyright (C)2009 - SSHJ Contributors
|
|
||||||
*
|
|
||||||
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
* you may not use this file except in compliance with the License.
|
|
||||||
* You may obtain a copy of the License at
|
|
||||||
*
|
|
||||||
* http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
*
|
|
||||||
* Unless required by applicable law or agreed to in writing, software
|
|
||||||
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
* See the License for the specific language governing permissions and
|
|
||||||
* limitations under the License.
|
|
||||||
*/
|
|
||||||
package com.hierynomus.sshj.backport;
|
|
||||||
|
|
||||||
import java.io.Closeable;
|
|
||||||
import java.io.IOException;
|
|
||||||
import java.net.Socket;
|
|
||||||
|
|
||||||
public class Sockets {
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Java 7 and up have Socket implemented as Closeable, whereas Java6 did not have this inheritance.
|
|
||||||
* @param socket The socket to wrap as Closeable
|
|
||||||
* @return The (potentially wrapped) Socket as a Closeable.
|
|
||||||
*/
|
|
||||||
public static Closeable asCloseable(final Socket socket) {
|
|
||||||
if (Closeable.class.isAssignableFrom(socket.getClass())) {
|
|
||||||
return Closeable.class.cast(socket);
|
|
||||||
} else {
|
|
||||||
return new Closeable() {
|
|
||||||
@Override
|
|
||||||
public void close() throws IOException {
|
|
||||||
socket.close();
|
|
||||||
}
|
|
||||||
};
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -13,14 +13,15 @@
|
|||||||
* See the License for the specific language governing permissions and
|
* See the License for the specific language governing permissions and
|
||||||
* limitations under the License.
|
* limitations under the License.
|
||||||
*/
|
*/
|
||||||
package com.hierynomus.sshj.backport;
|
package com.hierynomus.sshj.common;
|
||||||
|
|
||||||
public class JavaVersion {
|
import java.net.InetSocketAddress;
|
||||||
public static boolean isJava7OrEarlier() {
|
|
||||||
String property = System.getProperty("java.specification.version");
|
|
||||||
float diff = Float.parseFloat(property) - 1.7f;
|
|
||||||
|
|
||||||
return diff < 0.01;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
public interface RemoteAddressProvider {
|
||||||
|
/**
|
||||||
|
* Get Remote Socket Address associated with transport connection
|
||||||
|
*
|
||||||
|
* @return Remote Socket Address or null when not connected
|
||||||
|
*/
|
||||||
|
InetSocketAddress getRemoteSocketAddress();
|
||||||
}
|
}
|
||||||
@@ -0,0 +1,36 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.common;
|
||||||
|
|
||||||
|
import java.net.InetSocketAddress;
|
||||||
|
|
||||||
|
public class ThreadNameProvider {
|
||||||
|
private static final String DISCONNECTED = "DISCONNECTED";
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set Thread Name prefixed with sshj followed by class and remote address when connected
|
||||||
|
*
|
||||||
|
* @param thread Class of Thread being named
|
||||||
|
* @param remoteAddressProvider Remote Address Provider associated with Thread
|
||||||
|
*/
|
||||||
|
public static void setThreadName(final Thread thread, final RemoteAddressProvider remoteAddressProvider) {
|
||||||
|
final InetSocketAddress remoteSocketAddress = remoteAddressProvider.getRemoteSocketAddress();
|
||||||
|
final String address = remoteSocketAddress == null ? DISCONNECTED : remoteSocketAddress.toString();
|
||||||
|
final long started = System.currentTimeMillis();
|
||||||
|
final String threadName = String.format("sshj-%s-%s-%d", thread.getClass().getSimpleName(), address, started);
|
||||||
|
thread.setName(threadName);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -22,13 +22,8 @@ import net.schmizz.sshj.signature.SignatureDSA;
|
|||||||
import net.schmizz.sshj.signature.SignatureECDSA;
|
import net.schmizz.sshj.signature.SignatureECDSA;
|
||||||
import net.schmizz.sshj.signature.SignatureRSA;
|
import net.schmizz.sshj.signature.SignatureRSA;
|
||||||
|
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.List;
|
|
||||||
|
|
||||||
public class KeyAlgorithms {
|
public class KeyAlgorithms {
|
||||||
|
|
||||||
public static List<String> SSH_RSA_SHA2_ALGORITHMS = Arrays.asList("rsa-sha2-512", "rsa-sha2-256");
|
|
||||||
|
|
||||||
public static Factory SSHRSA() { return new Factory("ssh-rsa", new SignatureRSA.FactorySSHRSA(), KeyType.RSA); }
|
public static Factory SSHRSA() { return new Factory("ssh-rsa", new SignatureRSA.FactorySSHRSA(), KeyType.RSA); }
|
||||||
public static Factory SSHRSACertV01() { return new Factory("ssh-rsa-cert-v01@openssh.com", new SignatureRSA.FactoryCERT(), KeyType.RSA_CERT); }
|
public static Factory SSHRSACertV01() { return new Factory("ssh-rsa-cert-v01@openssh.com", new SignatureRSA.FactoryCERT(), KeyType.RSA_CERT); }
|
||||||
public static Factory RSASHA256() { return new Factory("rsa-sha2-256", new SignatureRSA.FactoryRSASHA256(), KeyType.RSA); }
|
public static Factory RSASHA256() { return new Factory("rsa-sha2-256", new SignatureRSA.FactoryRSASHA256(), KeyType.RSA); }
|
||||||
@@ -61,9 +56,18 @@ public class KeyAlgorithms {
|
|||||||
return algorithmName;
|
return algorithmName;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public KeyType getKeyType() {
|
||||||
|
return keyType;
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public KeyAlgorithm create() {
|
public KeyAlgorithm create() {
|
||||||
return new BaseKeyAlgorithm(algorithmName, signatureFactory, keyType);
|
return new BaseKeyAlgorithm(algorithmName, signatureFactory, keyType);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return algorithmName;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -13,22 +13,18 @@
|
|||||||
* See the License for the specific language governing permissions and
|
* See the License for the specific language governing permissions and
|
||||||
* limitations under the License.
|
* limitations under the License.
|
||||||
*/
|
*/
|
||||||
package com.hierynomus.sshj.signature
|
package com.hierynomus.sshj.sftp;
|
||||||
|
|
||||||
import com.hierynomus.sshj.IntegrationBaseSpec
|
import com.hierynomus.sshj.sftp.RemoteResourceSelector.Result;
|
||||||
import net.schmizz.sshj.DefaultConfig
|
import net.schmizz.sshj.sftp.RemoteResourceFilter;
|
||||||
import spock.lang.Unroll
|
|
||||||
|
|
||||||
class RsaSignatureClientKeySpec extends IntegrationBaseSpec {
|
public class RemoteResourceFilterConverter {
|
||||||
@Unroll
|
|
||||||
def "should correctly connect using publickey auth with RSA key with signature"() {
|
|
||||||
given:
|
|
||||||
def client = getConnectedClient(new DefaultConfig())
|
|
||||||
|
|
||||||
when:
|
public static RemoteResourceSelector selectorFrom(RemoteResourceFilter filter) {
|
||||||
client.authPublickey(USERNAME, "src/itest/resources/keyfiles/id_rsa2")
|
if (filter == null) {
|
||||||
|
return RemoteResourceSelector.ALL;
|
||||||
|
}
|
||||||
|
|
||||||
then:
|
return resource -> filter.accept(resource) ? Result.ACCEPT : Result.CONTINUE;
|
||||||
client.authenticated
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -0,0 +1,49 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package com.hierynomus.sshj.sftp;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.sftp.RemoteResourceInfo;
|
||||||
|
|
||||||
|
public interface RemoteResourceSelector {
|
||||||
|
public static RemoteResourceSelector ALL = new RemoteResourceSelector() {
|
||||||
|
@Override
|
||||||
|
public Result select(RemoteResourceInfo resource) {
|
||||||
|
return Result.ACCEPT;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
enum Result {
|
||||||
|
/**
|
||||||
|
* Accept the remote resource and add it to the result.
|
||||||
|
*/
|
||||||
|
ACCEPT,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Do not add the remote resource to the result and continue with the next.
|
||||||
|
*/
|
||||||
|
CONTINUE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Do not add the remote resource to the result and stop further execution.
|
||||||
|
*/
|
||||||
|
BREAK;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Decide whether the remote resource should be included in the result and whether execution should continue.
|
||||||
|
*/
|
||||||
|
Result select(RemoteResourceInfo resource);
|
||||||
|
}
|
||||||
@@ -16,9 +16,8 @@
|
|||||||
package com.hierynomus.sshj.transport.cipher;
|
package com.hierynomus.sshj.transport.cipher;
|
||||||
|
|
||||||
import java.security.GeneralSecurityException;
|
import java.security.GeneralSecurityException;
|
||||||
import java.security.InvalidAlgorithmParameterException;
|
|
||||||
import java.security.InvalidKeyException;
|
|
||||||
|
|
||||||
|
import java.security.MessageDigest;
|
||||||
import java.security.spec.AlgorithmParameterSpec;
|
import java.security.spec.AlgorithmParameterSpec;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import javax.crypto.spec.IvParameterSpec;
|
import javax.crypto.spec.IvParameterSpec;
|
||||||
@@ -82,8 +81,7 @@ public class ChachaPolyCipher extends BaseCipher {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected void initCipher(javax.crypto.Cipher cipher, Mode mode, byte[] key, byte[] iv)
|
protected void initCipher(javax.crypto.Cipher cipher, Mode mode, byte[] key, byte[] iv) {
|
||||||
throws InvalidKeyException, InvalidAlgorithmParameterException {
|
|
||||||
this.mode = mode;
|
this.mode = mode;
|
||||||
|
|
||||||
cipherKey = getKeySpec(Arrays.copyOfRange(key, 0, CHACHA_KEY_SIZE));
|
cipherKey = getKeySpec(Arrays.copyOfRange(key, 0, CHACHA_KEY_SIZE));
|
||||||
@@ -127,28 +125,34 @@ public class ChachaPolyCipher extends BaseCipher {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void update(byte[] input, int inputOffset, int inputLen) {
|
public void update(byte[] input, int inputOffset, int inputLen) {
|
||||||
if (inputOffset != AAD_LENGTH) {
|
if (inputOffset != 0 && inputOffset != AAD_LENGTH) {
|
||||||
throw new IllegalArgumentException("updateAAD called with inputOffset " + inputOffset);
|
throw new IllegalArgumentException("updateAAD called with inputOffset " + inputOffset);
|
||||||
}
|
}
|
||||||
|
|
||||||
final int macInputLength = AAD_LENGTH + inputLen;
|
final int macInputLength = inputOffset + inputLen;
|
||||||
|
|
||||||
if (mode == Mode.Decrypt) {
|
if (mode == Mode.Decrypt) {
|
||||||
byte[] macInput = new byte[macInputLength];
|
final byte[] macInput = new byte[macInputLength];
|
||||||
System.arraycopy(encryptedAad, 0, macInput, 0, AAD_LENGTH);
|
|
||||||
System.arraycopy(input, AAD_LENGTH, macInput, AAD_LENGTH, inputLen);
|
|
||||||
|
|
||||||
byte[] expectedPolyTag = mac.doFinal(macInput);
|
if (inputOffset == 0) {
|
||||||
byte[] actualPolyTag = Arrays.copyOfRange(input, macInputLength, macInputLength + POLY_TAG_LENGTH);
|
// Handle decryption without AAD
|
||||||
if (!Arrays.equals(actualPolyTag, expectedPolyTag)) {
|
System.arraycopy(input, 0, macInput, 0, inputLen);
|
||||||
|
} else {
|
||||||
|
// Handle decryption with previous AAD from updateAAD()
|
||||||
|
System.arraycopy(encryptedAad, 0, macInput, 0, AAD_LENGTH);
|
||||||
|
System.arraycopy(input, AAD_LENGTH, macInput, AAD_LENGTH, inputLen);
|
||||||
|
}
|
||||||
|
|
||||||
|
final byte[] expectedPolyTag = mac.doFinal(macInput);
|
||||||
|
final byte[] actualPolyTag = Arrays.copyOfRange(input, macInputLength, macInputLength + POLY_TAG_LENGTH);
|
||||||
|
if (!MessageDigest.isEqual(actualPolyTag, expectedPolyTag)) {
|
||||||
throw new SSHRuntimeException("MAC Error");
|
throw new SSHRuntimeException("MAC Error");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
try {
|
try {
|
||||||
cipher.update(input, AAD_LENGTH, inputLen, input, AAD_LENGTH);
|
cipher.update(input, inputOffset, inputLen, input, inputOffset);
|
||||||
} catch (GeneralSecurityException e) {
|
} catch (GeneralSecurityException e) {
|
||||||
throw new SSHRuntimeException("Error updating data through cipher", e);
|
throw new SSHRuntimeException("ChaCha20 cipher processing failed", e);
|
||||||
}
|
}
|
||||||
|
|
||||||
if (mode == Mode.Encrypt) {
|
if (mode == Mode.Encrypt) {
|
||||||
|
|||||||
@@ -89,6 +89,11 @@ public class DHGroups {
|
|||||||
public String getName() {
|
public String getName() {
|
||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,20 +15,26 @@
|
|||||||
*/
|
*/
|
||||||
package com.hierynomus.sshj.transport.verification;
|
package com.hierynomus.sshj.transport.verification;
|
||||||
|
|
||||||
import net.schmizz.sshj.common.Base64;
|
import net.schmizz.sshj.common.Base64DecodingException;
|
||||||
|
import net.schmizz.sshj.common.Base64Decoder;
|
||||||
import net.schmizz.sshj.common.IOUtils;
|
import net.schmizz.sshj.common.IOUtils;
|
||||||
import net.schmizz.sshj.common.SSHException;
|
import net.schmizz.sshj.common.SSHException;
|
||||||
import net.schmizz.sshj.transport.mac.MAC;
|
import net.schmizz.sshj.transport.mac.MAC;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
|
import java.util.Base64;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.regex.Pattern;
|
import java.util.regex.Pattern;
|
||||||
|
|
||||||
import com.hierynomus.sshj.transport.mac.Macs;
|
import com.hierynomus.sshj.transport.mac.Macs;
|
||||||
|
import org.slf4j.Logger;
|
||||||
|
import org.slf4j.LoggerFactory;
|
||||||
|
|
||||||
public class KnownHostMatchers {
|
public class KnownHostMatchers {
|
||||||
|
|
||||||
|
private static final Logger log = LoggerFactory.getLogger(KnownHostMatchers.class);
|
||||||
|
|
||||||
public static HostMatcher createMatcher(String hostEntry) throws SSHException {
|
public static HostMatcher createMatcher(String hostEntry) throws SSHException {
|
||||||
if (hostEntry.contains(",")) {
|
if (hostEntry.contains(",")) {
|
||||||
return new AnyHostMatcher(hostEntry);
|
return new AnyHostMatcher(hostEntry);
|
||||||
@@ -80,17 +86,22 @@ public class KnownHostMatchers {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean match(String hostname) throws IOException {
|
public boolean match(String hostname) throws IOException {
|
||||||
return hash.equals(hashHost(hostname));
|
try {
|
||||||
|
return hash.equals(hashHost(hostname));
|
||||||
|
} catch (Base64DecodingException err) {
|
||||||
|
log.warn("Hostname [{}] not matched: salt decoding failed", hostname, err);
|
||||||
|
return false;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private String hashHost(String host) throws IOException {
|
private String hashHost(String host) throws IOException, Base64DecodingException {
|
||||||
sha1.init(getSaltyBytes());
|
sha1.init(getSaltyBytes());
|
||||||
return "|1|" + salt + "|" + Base64.encodeBytes(sha1.doFinal(host.getBytes(IOUtils.UTF8)));
|
return "|1|" + salt + "|" + Base64.getEncoder().encodeToString(sha1.doFinal(host.getBytes(IOUtils.UTF8)));
|
||||||
}
|
}
|
||||||
|
|
||||||
private byte[] getSaltyBytes() throws IOException {
|
private byte[] getSaltyBytes() throws IOException, Base64DecodingException {
|
||||||
if (saltyBytes == null) {
|
if (saltyBytes == null) {
|
||||||
saltyBytes = Base64.decode(salt);
|
saltyBytes = Base64Decoder.decode(salt);
|
||||||
}
|
}
|
||||||
return saltyBytes;
|
return saltyBytes;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,7 +15,8 @@
|
|||||||
*/
|
*/
|
||||||
package com.hierynomus.sshj.userauth.keyprovider;
|
package com.hierynomus.sshj.userauth.keyprovider;
|
||||||
|
|
||||||
import net.schmizz.sshj.common.Base64;
|
import net.schmizz.sshj.common.Base64DecodingException;
|
||||||
|
import net.schmizz.sshj.common.Base64Decoder;
|
||||||
import net.schmizz.sshj.common.Buffer;
|
import net.schmizz.sshj.common.Buffer;
|
||||||
import net.schmizz.sshj.common.KeyType;
|
import net.schmizz.sshj.common.KeyType;
|
||||||
|
|
||||||
@@ -54,9 +55,10 @@ public class OpenSSHKeyFileUtil {
|
|||||||
if (!keydata.isEmpty()) {
|
if (!keydata.isEmpty()) {
|
||||||
String[] parts = keydata.trim().split("\\s+");
|
String[] parts = keydata.trim().split("\\s+");
|
||||||
if (parts.length >= 2) {
|
if (parts.length >= 2) {
|
||||||
|
byte[] decodedPublicKey = Base64Decoder.decode(parts[1]);
|
||||||
return new ParsedPubKey(
|
return new ParsedPubKey(
|
||||||
KeyType.fromString(parts[0]),
|
KeyType.fromString(parts[0]),
|
||||||
new Buffer.PlainBuffer(Base64.decode(parts[1])).readPublicKey()
|
new Buffer.PlainBuffer(decodedPublicKey).readPublicKey()
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
throw new IOException("Got line with only one column");
|
throw new IOException("Got line with only one column");
|
||||||
@@ -64,6 +66,8 @@ public class OpenSSHKeyFileUtil {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
throw new IOException("Public key file is blank");
|
throw new IOException("Public key file is blank");
|
||||||
|
} catch (Base64DecodingException err) {
|
||||||
|
throw new IOException("Public key decoding failed", err);
|
||||||
} finally {
|
} finally {
|
||||||
br.close();
|
br.close();
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,6 +18,9 @@ package com.hierynomus.sshj.userauth.keyprovider;
|
|||||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
import com.hierynomus.sshj.common.KeyAlgorithm;
|
||||||
import com.hierynomus.sshj.common.KeyDecryptionFailedException;
|
import com.hierynomus.sshj.common.KeyDecryptionFailedException;
|
||||||
import com.hierynomus.sshj.transport.cipher.BlockCiphers;
|
import com.hierynomus.sshj.transport.cipher.BlockCiphers;
|
||||||
|
import com.hierynomus.sshj.transport.cipher.ChachaPolyCiphers;
|
||||||
|
import com.hierynomus.sshj.transport.cipher.GcmCiphers;
|
||||||
|
import com.hierynomus.sshj.userauth.keyprovider.bcrypt.BCrypt;
|
||||||
import net.i2p.crypto.eddsa.EdDSAPrivateKey;
|
import net.i2p.crypto.eddsa.EdDSAPrivateKey;
|
||||||
import net.i2p.crypto.eddsa.spec.EdDSANamedCurveTable;
|
import net.i2p.crypto.eddsa.spec.EdDSANamedCurveTable;
|
||||||
import net.i2p.crypto.eddsa.spec.EdDSAPrivateKeySpec;
|
import net.i2p.crypto.eddsa.spec.EdDSAPrivateKeySpec;
|
||||||
@@ -27,40 +30,65 @@ import net.schmizz.sshj.transport.cipher.Cipher;
|
|||||||
import net.schmizz.sshj.userauth.keyprovider.BaseFileKeyProvider;
|
import net.schmizz.sshj.userauth.keyprovider.BaseFileKeyProvider;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.KeyFormat;
|
import net.schmizz.sshj.userauth.keyprovider.KeyFormat;
|
||||||
|
import net.schmizz.sshj.userauth.password.PasswordFinder;
|
||||||
import org.bouncycastle.asn1.nist.NISTNamedCurves;
|
import org.bouncycastle.asn1.nist.NISTNamedCurves;
|
||||||
import org.bouncycastle.asn1.x9.X9ECParameters;
|
import org.bouncycastle.asn1.x9.X9ECParameters;
|
||||||
import org.bouncycastle.jce.spec.ECNamedCurveSpec;
|
import org.bouncycastle.jce.spec.ECNamedCurveSpec;
|
||||||
import com.hierynomus.sshj.userauth.keyprovider.bcrypt.BCrypt;
|
import org.bouncycastle.openssl.EncryptionException;
|
||||||
import org.slf4j.Logger;
|
import org.slf4j.Logger;
|
||||||
import org.slf4j.LoggerFactory;
|
import org.slf4j.LoggerFactory;
|
||||||
|
|
||||||
import java.io.BufferedReader;
|
import java.io.*;
|
||||||
import java.io.File;
|
|
||||||
import java.io.FileReader;
|
|
||||||
import java.io.IOException;
|
|
||||||
import java.io.Reader;
|
|
||||||
import java.math.BigInteger;
|
import java.math.BigInteger;
|
||||||
import java.nio.ByteBuffer;
|
import java.nio.ByteBuffer;
|
||||||
import java.nio.CharBuffer;
|
import java.nio.CharBuffer;
|
||||||
import java.nio.charset.Charset;
|
import java.nio.charset.StandardCharsets;
|
||||||
import java.security.*;
|
import java.security.GeneralSecurityException;
|
||||||
|
import java.security.KeyPair;
|
||||||
|
import java.security.PrivateKey;
|
||||||
|
import java.security.PublicKey;
|
||||||
import java.security.spec.ECPrivateKeySpec;
|
import java.security.spec.ECPrivateKeySpec;
|
||||||
import java.security.spec.RSAPrivateCrtKeySpec;
|
import java.security.spec.RSAPrivateCrtKeySpec;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
|
import java.util.HashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reads a key file in the new OpenSSH format.
|
* Reads a key file in the new OpenSSH format.
|
||||||
* The format is described in the following document: https://github.com/openssh/openssh-portable/blob/master/PROTOCOL.key
|
* The format is described in the following document: https://github.com/openssh/openssh-portable/blob/master/PROTOCOL.key
|
||||||
*/
|
*/
|
||||||
public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
||||||
private static final Logger logger = LoggerFactory.getLogger(OpenSSHKeyV1KeyFile.class);
|
|
||||||
private static final String BEGIN = "-----BEGIN ";
|
private static final String BEGIN = "-----BEGIN ";
|
||||||
private static final String END = "-----END ";
|
private static final String END = "-----END ";
|
||||||
private static final byte[] AUTH_MAGIC = "openssh-key-v1\0".getBytes();
|
private static final byte[] AUTH_MAGIC = "openssh-key-v1\0".getBytes();
|
||||||
public static final String OPENSSH_PRIVATE_KEY = "OPENSSH PRIVATE KEY-----";
|
public static final String OPENSSH_PRIVATE_KEY = "OPENSSH PRIVATE KEY-----";
|
||||||
public static final String BCRYPT = "bcrypt";
|
public static final String BCRYPT = "bcrypt";
|
||||||
|
|
||||||
|
private static final String NONE_CIPHER = "none";
|
||||||
|
|
||||||
|
private static final Map<String, Factory.Named<Cipher>> SUPPORTED_CIPHERS = new HashMap<>();
|
||||||
|
|
||||||
|
static {
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.TripleDESCBC().getName(), BlockCiphers.TripleDESCBC());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES128CBC().getName(), BlockCiphers.AES128CBC());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES192CBC().getName(), BlockCiphers.AES192CBC());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES256CBC().getName(), BlockCiphers.AES256CBC());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES128CTR().getName(), BlockCiphers.AES128CTR());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES192CTR().getName(), BlockCiphers.AES192CTR());
|
||||||
|
SUPPORTED_CIPHERS.put(BlockCiphers.AES256CTR().getName(), BlockCiphers.AES256CTR());
|
||||||
|
SUPPORTED_CIPHERS.put(GcmCiphers.AES256GCM().getName(), GcmCiphers.AES256GCM());
|
||||||
|
SUPPORTED_CIPHERS.put(GcmCiphers.AES128GCM().getName(), GcmCiphers.AES128GCM());
|
||||||
|
SUPPORTED_CIPHERS.put(ChachaPolyCiphers.CHACHA_POLY_OPENSSH().getName(), ChachaPolyCiphers.CHACHA_POLY_OPENSSH());
|
||||||
|
}
|
||||||
|
|
||||||
private PublicKey pubKey;
|
private PublicKey pubKey;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public PublicKey getPublic()
|
||||||
|
throws IOException {
|
||||||
|
return pubKey != null ? pubKey : super.getPublic();
|
||||||
|
}
|
||||||
|
|
||||||
public static class Factory
|
public static class Factory
|
||||||
implements net.schmizz.sshj.common.Factory.Named<FileKeyProvider> {
|
implements net.schmizz.sshj.common.Factory.Named<FileKeyProvider> {
|
||||||
|
|
||||||
@@ -78,33 +106,60 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
|||||||
protected final Logger log = LoggerFactory.getLogger(getClass());
|
protected final Logger log = LoggerFactory.getLogger(getClass());
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void init(File location) {
|
public void init(File location, PasswordFinder pwdf) {
|
||||||
File pubKey = OpenSSHKeyFileUtil.getPublicKeyFile(location);
|
File pubKey = OpenSSHKeyFileUtil.getPublicKeyFile(location);
|
||||||
if (pubKey != null)
|
if (pubKey != null) {
|
||||||
try {
|
try {
|
||||||
initPubKey(new FileReader(pubKey));
|
initPubKey(new FileReader(pubKey));
|
||||||
} catch (IOException e) {
|
} catch (IOException e) {
|
||||||
// let super provide both public & private key
|
// let super provide both public & private key
|
||||||
log.warn("Error reading public key file: {}", e.toString());
|
log.warn("Error reading public key file: {}", e.toString());
|
||||||
}
|
}
|
||||||
super.init(location);
|
}
|
||||||
|
super.init(location, pwdf);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void init(String privateKey, String publicKey, PasswordFinder pwdf) {
|
||||||
|
if (pubKey != null) {
|
||||||
|
try {
|
||||||
|
initPubKey(new StringReader(publicKey));
|
||||||
|
} catch (IOException e) {
|
||||||
|
log.warn("Error reading public key file: {}", e.toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
super.init(privateKey, null, pwdf);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void init(Reader privateKey, Reader publicKey, PasswordFinder pwdf) {
|
||||||
|
if (pubKey != null) {
|
||||||
|
try {
|
||||||
|
initPubKey(publicKey);
|
||||||
|
} catch (IOException e) {
|
||||||
|
log.warn("Error reading public key file: {}", e.toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
super.init(privateKey, null, pwdf);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected KeyPair readKeyPair() throws IOException {
|
protected KeyPair readKeyPair() throws IOException {
|
||||||
BufferedReader reader = new BufferedReader(resource.getReader());
|
final BufferedReader reader = new BufferedReader(resource.getReader());
|
||||||
try {
|
try {
|
||||||
if (!checkHeader(reader)) {
|
if (checkHeader(reader)) {
|
||||||
throw new IOException("This key is not in 'openssh-key-v1' format");
|
final String encodedPrivateKey = readEncodedKey(reader);
|
||||||
|
byte[] decodedPrivateKey = Base64Decoder.decode(encodedPrivateKey);
|
||||||
|
final PlainBuffer bufferedPrivateKey = new PlainBuffer(decodedPrivateKey);
|
||||||
|
return readDecodedKeyPair(bufferedPrivateKey);
|
||||||
|
} else {
|
||||||
|
final String message = String.format("File header not found [%s%s]", BEGIN, OPENSSH_PRIVATE_KEY);
|
||||||
|
throw new IOException(message);
|
||||||
}
|
}
|
||||||
|
} catch (final GeneralSecurityException e) {
|
||||||
String keyFile = readKeyFile(reader);
|
throw new SSHRuntimeException("Read OpenSSH Version 1 Key failed", e);
|
||||||
byte[] decode = Base64.decode(keyFile);
|
} catch (Base64DecodingException e) {
|
||||||
PlainBuffer keyBuffer = new PlainBuffer(decode);
|
throw new SSHRuntimeException("Private Key decoding failed", e);
|
||||||
return readDecodedKeyPair(keyBuffer);
|
|
||||||
|
|
||||||
} catch (GeneralSecurityException e) {
|
|
||||||
throw new SSHRuntimeException(e);
|
|
||||||
} finally {
|
} finally {
|
||||||
IOUtils.closeQuietly(reader);
|
IOUtils.closeQuietly(reader);
|
||||||
}
|
}
|
||||||
@@ -129,86 +184,143 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
|||||||
|
|
||||||
int nrKeys = keyBuffer.readUInt32AsInt(); // int number of keys N; Should be 1
|
int nrKeys = keyBuffer.readUInt32AsInt(); // int number of keys N; Should be 1
|
||||||
if (nrKeys != 1) {
|
if (nrKeys != 1) {
|
||||||
throw new IOException("We don't support having more than 1 key in the file (yet).");
|
final String message = String.format("OpenSSH Private Key number of keys not supported [%d]", nrKeys);
|
||||||
|
throw new IOException(message);
|
||||||
}
|
}
|
||||||
PublicKey publicKey = pubKey;
|
PublicKey publicKey = pubKey;
|
||||||
if (publicKey == null) {
|
if (publicKey == null) {
|
||||||
publicKey = readPublicKey(new PlainBuffer(keyBuffer.readBytes()));
|
publicKey = readPublicKey(new PlainBuffer(keyBuffer.readBytes()));
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
keyBuffer.readBytes();
|
keyBuffer.readBytes();
|
||||||
}
|
}
|
||||||
PlainBuffer privateKeyBuffer = new PlainBuffer(keyBuffer.readBytes()); // string (possibly) encrypted, padded list of private keys
|
|
||||||
if ("none".equals(cipherName)) {
|
final byte[] privateKeyEncoded = keyBuffer.readBytes();
|
||||||
logger.debug("Reading unencrypted keypair");
|
final PlainBuffer privateKeyBuffer = new PlainBuffer(privateKeyEncoded);
|
||||||
|
|
||||||
|
if (NONE_CIPHER.equals(cipherName)) {
|
||||||
return readUnencrypted(privateKeyBuffer, publicKey);
|
return readUnencrypted(privateKeyBuffer, publicKey);
|
||||||
} else {
|
} else {
|
||||||
logger.info("Keypair is encrypted with: " + cipherName + ", " + kdfName + ", " + Arrays.toString(kdfOptions));
|
final byte[] encryptedPrivateKey = readEncryptedPrivateKey(privateKeyEncoded, keyBuffer);
|
||||||
while (true) {
|
while (true) {
|
||||||
PlainBuffer decryptionBuffer = new PlainBuffer(privateKeyBuffer);
|
final byte[] encrypted = encryptedPrivateKey.clone();
|
||||||
PlainBuffer decrypted = decryptBuffer(decryptionBuffer, cipherName, kdfName, kdfOptions);
|
|
||||||
try {
|
try {
|
||||||
|
final PlainBuffer decrypted = decryptPrivateKey(encrypted, privateKeyEncoded.length, cipherName, kdfName, kdfOptions);
|
||||||
return readUnencrypted(decrypted, publicKey);
|
return readUnencrypted(decrypted, publicKey);
|
||||||
} catch (KeyDecryptionFailedException e) {
|
} catch (KeyDecryptionFailedException e) {
|
||||||
if (pwdf == null || !pwdf.shouldRetry(resource))
|
if (pwdf == null || !pwdf.shouldRetry(resource))
|
||||||
throw e;
|
throw e;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// throw new IOException("Cannot read encrypted keypair with " + cipherName + " yet.");
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private PlainBuffer decryptBuffer(PlainBuffer privateKeyBuffer, String cipherName, String kdfName, byte[] kdfOptions) throws IOException {
|
private byte[] readEncryptedPrivateKey(final byte[] privateKeyEncoded, final PlainBuffer inputBuffer) throws Buffer.BufferException {
|
||||||
Cipher cipher = createCipher(cipherName);
|
final byte[] encryptedPrivateKey;
|
||||||
initializeCipher(kdfName, kdfOptions, cipher);
|
|
||||||
byte[] array = privateKeyBuffer.array();
|
final int bufferRemaining = inputBuffer.available();
|
||||||
cipher.update(array, 0, privateKeyBuffer.available());
|
if (bufferRemaining == 0) {
|
||||||
return new PlainBuffer(array);
|
encryptedPrivateKey = privateKeyEncoded;
|
||||||
|
} else {
|
||||||
|
// Read Authentication Tag for AES-GCM or ChaCha20-Poly1305
|
||||||
|
final byte[] authenticationTag = new byte[bufferRemaining];
|
||||||
|
inputBuffer.readRawBytes(authenticationTag);
|
||||||
|
|
||||||
|
final int encryptedBufferLength = privateKeyEncoded.length + authenticationTag.length;
|
||||||
|
final PlainBuffer encryptedBuffer = new PlainBuffer(encryptedBufferLength);
|
||||||
|
encryptedBuffer.putRawBytes(privateKeyEncoded);
|
||||||
|
encryptedBuffer.putRawBytes(authenticationTag);
|
||||||
|
|
||||||
|
encryptedPrivateKey = new byte[encryptedBufferLength];
|
||||||
|
encryptedBuffer.readRawBytes(encryptedPrivateKey);
|
||||||
|
}
|
||||||
|
|
||||||
|
return encryptedPrivateKey;
|
||||||
}
|
}
|
||||||
|
|
||||||
private void initializeCipher(String kdfName, byte[] kdfOptions, Cipher cipher) throws Buffer.BufferException {
|
private PlainBuffer decryptPrivateKey(final byte[] privateKey, final int privateKeyLength, final String cipherName, final String kdfName, final byte[] kdfOptions) throws IOException {
|
||||||
|
try {
|
||||||
|
final Cipher cipher = createCipher(cipherName);
|
||||||
|
initializeCipher(kdfName, kdfOptions, cipher);
|
||||||
|
cipher.update(privateKey, 0, privateKeyLength);
|
||||||
|
} catch (final SSHRuntimeException e) {
|
||||||
|
final String message = String.format("OpenSSH Private Key decryption failed with cipher [%s]", cipherName);
|
||||||
|
throw new KeyDecryptionFailedException(new EncryptionException(message, e));
|
||||||
|
}
|
||||||
|
final PlainBuffer decryptedPrivateKey = new PlainBuffer(privateKeyLength);
|
||||||
|
decryptedPrivateKey.putRawBytes(privateKey, 0, privateKeyLength);
|
||||||
|
return decryptedPrivateKey;
|
||||||
|
}
|
||||||
|
|
||||||
|
private void initializeCipher(final String kdfName, final byte[] kdfOptions, final Cipher cipher) throws Buffer.BufferException {
|
||||||
if (kdfName.equals(BCRYPT)) {
|
if (kdfName.equals(BCRYPT)) {
|
||||||
PlainBuffer opts = new PlainBuffer(kdfOptions);
|
final PlainBuffer bufferedOptions = new PlainBuffer(kdfOptions);
|
||||||
byte[] passphrase = new byte[0];
|
byte[] passphrase = new byte[0];
|
||||||
if (pwdf != null) {
|
if (pwdf != null) {
|
||||||
CharBuffer charBuffer = CharBuffer.wrap(pwdf.reqPassword(null));
|
final CharBuffer charBuffer = CharBuffer.wrap(pwdf.reqPassword(null));
|
||||||
ByteBuffer byteBuffer = Charset.forName("UTF-8").encode(charBuffer);
|
final ByteBuffer byteBuffer = StandardCharsets.UTF_8.encode(charBuffer);
|
||||||
passphrase = Arrays.copyOfRange(byteBuffer.array(), byteBuffer.position(), byteBuffer.limit());
|
passphrase = Arrays.copyOfRange(byteBuffer.array(), byteBuffer.position(), byteBuffer.limit());
|
||||||
Arrays.fill(charBuffer.array(), '\u0000');
|
Arrays.fill(charBuffer.array(), '\u0000');
|
||||||
Arrays.fill(byteBuffer.array(), (byte) 0);
|
Arrays.fill(byteBuffer.array(), (byte) 0);
|
||||||
}
|
}
|
||||||
byte[] keyiv = new byte[48];
|
|
||||||
new BCrypt().pbkdf(passphrase, opts.readBytes(), opts.readUInt32AsInt(), keyiv);
|
final int ivSize = cipher.getIVSize();
|
||||||
|
final int blockSize = cipher.getBlockSize();
|
||||||
|
final int parameterSize = ivSize + blockSize;
|
||||||
|
final byte[] keyIvParameters = new byte[parameterSize];
|
||||||
|
|
||||||
|
final byte[] salt = bufferedOptions.readBytes();
|
||||||
|
final int iterations = bufferedOptions.readUInt32AsInt();
|
||||||
|
new BCrypt().pbkdf(passphrase, salt, iterations, keyIvParameters);
|
||||||
Arrays.fill(passphrase, (byte) 0);
|
Arrays.fill(passphrase, (byte) 0);
|
||||||
byte[] key = Arrays.copyOfRange(keyiv, 0, 32);
|
|
||||||
byte[] iv = Arrays.copyOfRange(keyiv, 32, 48);
|
final byte[] key = Arrays.copyOfRange(keyIvParameters, 0, blockSize);
|
||||||
|
final byte[] iv = Arrays.copyOfRange(keyIvParameters, blockSize, parameterSize);
|
||||||
|
|
||||||
cipher.init(Cipher.Mode.Decrypt, key, iv);
|
cipher.init(Cipher.Mode.Decrypt, key, iv);
|
||||||
} else {
|
} else {
|
||||||
throw new IllegalStateException("No support for KDF '" + kdfName + "'.");
|
final String message = String.format("OpenSSH Private Key encryption KDF not supported [%s]", kdfName);
|
||||||
|
throw new IllegalStateException(message);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private Cipher createCipher(String cipherName) {
|
private Cipher createCipher(final String cipherName) {
|
||||||
if (cipherName.equals(BlockCiphers.AES256CTR().getName())) {
|
final Cipher cipher;
|
||||||
return BlockCiphers.AES256CTR().create();
|
|
||||||
} else if (cipherName.equals(BlockCiphers.AES256CBC().getName())) {
|
if (SUPPORTED_CIPHERS.containsKey(cipherName)) {
|
||||||
return BlockCiphers.AES256CBC().create();
|
final Factory.Named<Cipher> cipherFactory = SUPPORTED_CIPHERS.get(cipherName);
|
||||||
|
cipher = cipherFactory.create();
|
||||||
|
} else {
|
||||||
|
final String message = String.format("OpenSSH Key encryption cipher not supported [%s]", cipherName);
|
||||||
|
throw new IllegalStateException(message);
|
||||||
}
|
}
|
||||||
throw new IllegalStateException("Cipher '" + cipherName + "' not currently implemented for openssh-key-v1 format");
|
|
||||||
|
return cipher;
|
||||||
}
|
}
|
||||||
|
|
||||||
private PublicKey readPublicKey(final PlainBuffer plainBuffer) throws Buffer.BufferException, GeneralSecurityException {
|
private PublicKey readPublicKey(final PlainBuffer plainBuffer) throws Buffer.BufferException, GeneralSecurityException {
|
||||||
return KeyType.fromString(plainBuffer.readString()).readPubKeyFromBuffer(plainBuffer);
|
return KeyType.fromString(plainBuffer.readString()).readPubKeyFromBuffer(plainBuffer);
|
||||||
}
|
}
|
||||||
|
|
||||||
private String readKeyFile(final BufferedReader reader) throws IOException {
|
private String readEncodedKey(final BufferedReader reader) throws IOException {
|
||||||
StringBuilder sb = new StringBuilder();
|
final StringBuilder builder = new StringBuilder();
|
||||||
|
|
||||||
|
boolean footerFound = false;
|
||||||
String line = reader.readLine();
|
String line = reader.readLine();
|
||||||
while (!line.startsWith(END)) {
|
while (line != null) {
|
||||||
sb.append(line);
|
if (line.startsWith(END)) {
|
||||||
|
footerFound = true;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
builder.append(line);
|
||||||
line = reader.readLine();
|
line = reader.readLine();
|
||||||
}
|
}
|
||||||
return sb.toString();
|
|
||||||
|
if (footerFound) {
|
||||||
|
return builder.toString();
|
||||||
|
} else {
|
||||||
|
final String message = String.format("File footer not found [%s%s]", END, OPENSSH_PRIVATE_KEY);
|
||||||
|
throw new IOException(message);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private boolean checkHeader(final BufferedReader reader) throws IOException {
|
private boolean checkHeader(final BufferedReader reader) throws IOException {
|
||||||
@@ -216,6 +328,9 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
|||||||
while (line != null && !line.startsWith(BEGIN)) {
|
while (line != null && !line.startsWith(BEGIN)) {
|
||||||
line = reader.readLine();
|
line = reader.readLine();
|
||||||
}
|
}
|
||||||
|
if (line == null) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
line = line.substring(BEGIN.length());
|
line = line.substring(BEGIN.length());
|
||||||
return line.startsWith(OPENSSH_PRIVATE_KEY);
|
return line.startsWith(OPENSSH_PRIVATE_KEY);
|
||||||
}
|
}
|
||||||
@@ -228,12 +343,12 @@ public class OpenSSHKeyV1KeyFile extends BaseFileKeyProvider {
|
|||||||
int checkInt1 = keyBuffer.readUInt32AsInt(); // uint32 checkint1
|
int checkInt1 = keyBuffer.readUInt32AsInt(); // uint32 checkint1
|
||||||
int checkInt2 = keyBuffer.readUInt32AsInt(); // uint32 checkint2
|
int checkInt2 = keyBuffer.readUInt32AsInt(); // uint32 checkint2
|
||||||
if (checkInt1 != checkInt2) {
|
if (checkInt1 != checkInt2) {
|
||||||
throw new KeyDecryptionFailedException();
|
throw new KeyDecryptionFailedException(new EncryptionException("OpenSSH Private Key integer comparison failed"));
|
||||||
}
|
}
|
||||||
// The private key section contains both the public key and the private key
|
// The private key section contains both the public key and the private key
|
||||||
String keyType = keyBuffer.readString(); // string keytype
|
String keyType = keyBuffer.readString(); // string keytype
|
||||||
KeyType kt = KeyType.fromString(keyType);
|
KeyType kt = KeyType.fromString(keyType);
|
||||||
logger.info("Read key type: {}", keyType, kt);
|
|
||||||
KeyPair kp;
|
KeyPair kp;
|
||||||
switch (kt) {
|
switch (kt) {
|
||||||
case ED25519:
|
case ED25519:
|
||||||
|
|||||||
@@ -14,11 +14,9 @@
|
|||||||
|
|
||||||
package com.hierynomus.sshj.userauth.keyprovider.bcrypt;
|
package com.hierynomus.sshj.userauth.keyprovider.bcrypt;
|
||||||
|
|
||||||
import java.io.UnsupportedEncodingException;
|
|
||||||
import java.security.DigestException;
|
import java.security.DigestException;
|
||||||
import java.security.MessageDigest;
|
import java.security.MessageDigest;
|
||||||
import java.security.NoSuchAlgorithmException;
|
import java.security.NoSuchAlgorithmException;
|
||||||
import java.security.SecureRandom;
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* BCrypt implements OpenBSD-style Blowfish password hashing using
|
* BCrypt implements OpenBSD-style Blowfish password hashing using
|
||||||
@@ -30,32 +28,6 @@ import java.security.SecureRandom;
|
|||||||
* based on Bruce Schneier's Blowfish cipher. The work factor of
|
* based on Bruce Schneier's Blowfish cipher. The work factor of
|
||||||
* the algorithm is parameterised, so it can be increased as
|
* the algorithm is parameterised, so it can be increased as
|
||||||
* computers get faster.
|
* computers get faster.
|
||||||
* <p>
|
|
||||||
* Usage is really simple. To hash a password for the first time,
|
|
||||||
* call the hashpw method with a random salt, like this:
|
|
||||||
* <p>
|
|
||||||
* <code>
|
|
||||||
* String pw_hash = BCrypt.hashpw(plain_password, BCrypt.gensalt()); <br>
|
|
||||||
* </code>
|
|
||||||
* <p>
|
|
||||||
* To check whether a plaintext password matches one that has been
|
|
||||||
* hashed previously, use the checkpw method:
|
|
||||||
* <p>
|
|
||||||
* <code>
|
|
||||||
* if (BCrypt.checkpw(candidate_password, stored_hash))<br>
|
|
||||||
* System.out.println("It matches");<br>
|
|
||||||
* else<br>
|
|
||||||
* System.out.println("It does not match");<br>
|
|
||||||
* </code>
|
|
||||||
* <p>
|
|
||||||
* The gensalt() method takes an optional parameter (log_rounds)
|
|
||||||
* that determines the computational complexity of the hashing:
|
|
||||||
* <p>
|
|
||||||
* <code>
|
|
||||||
* String strong_salt = BCrypt.gensalt(10)<br>
|
|
||||||
* String stronger_salt = BCrypt.gensalt(12)<br>
|
|
||||||
* </code>
|
|
||||||
* <p>
|
|
||||||
* The amount of work increases exponentially (2**log_rounds), so
|
* The amount of work increases exponentially (2**log_rounds), so
|
||||||
* each increment is twice as much work. The default log_rounds is
|
* each increment is twice as much work. The default log_rounds is
|
||||||
* 10, and the valid range is 4 to 30.
|
* 10, and the valid range is 4 to 30.
|
||||||
@@ -64,22 +36,18 @@ import java.security.SecureRandom;
|
|||||||
* @version 0.2
|
* @version 0.2
|
||||||
*/
|
*/
|
||||||
public class BCrypt {
|
public class BCrypt {
|
||||||
// BCrypt parameters
|
|
||||||
private static final int GENSALT_DEFAULT_LOG2_ROUNDS = 10;
|
|
||||||
private static final int BCRYPT_SALT_LEN = 16;
|
|
||||||
|
|
||||||
// Blowfish parameters
|
// Blowfish parameters
|
||||||
private static final int BLOWFISH_NUM_ROUNDS = 16;
|
private static final int BLOWFISH_NUM_ROUNDS = 16;
|
||||||
|
|
||||||
// Initial contents of key schedule
|
// Initial contents of key schedule
|
||||||
private static final int P_orig[] = {
|
private static final int[] P_orig = {
|
||||||
0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344,
|
0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344,
|
||||||
0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89,
|
0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89,
|
||||||
0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c,
|
0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c,
|
||||||
0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917,
|
0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917,
|
||||||
0x9216d5d9, 0x8979fb1b
|
0x9216d5d9, 0x8979fb1b
|
||||||
};
|
};
|
||||||
private static final int S_orig[] = {
|
private static final int[] S_orig = {
|
||||||
0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7,
|
0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7,
|
||||||
0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99,
|
0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99,
|
||||||
0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16,
|
0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16,
|
||||||
@@ -344,149 +312,9 @@ public class BCrypt {
|
|||||||
0x66697368, 0x53776174, 0x44796e61, 0x6d697465,
|
0x66697368, 0x53776174, 0x44796e61, 0x6d697465,
|
||||||
};
|
};
|
||||||
|
|
||||||
// bcrypt IV: "OrpheanBeholderScryDoubt". The C implementation calls
|
|
||||||
// this "ciphertext", but it is really plaintext or an IV. We keep
|
|
||||||
// the name to make code comparison easier.
|
|
||||||
static private final int bf_crypt_ciphertext[] = {
|
|
||||||
0x4f727068, 0x65616e42, 0x65686f6c,
|
|
||||||
0x64657253, 0x63727944, 0x6f756274
|
|
||||||
};
|
|
||||||
|
|
||||||
// Table for Base64 encoding
|
|
||||||
static private final char base64_code[] = {
|
|
||||||
'.', '/', 'A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J',
|
|
||||||
'K', 'L', 'M', 'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V',
|
|
||||||
'W', 'X', 'Y', 'Z', 'a', 'b', 'c', 'd', 'e', 'f', 'g', 'h',
|
|
||||||
'i', 'j', 'k', 'l', 'm', 'n', 'o', 'p', 'q', 'r', 's', 't',
|
|
||||||
'u', 'v', 'w', 'x', 'y', 'z', '0', '1', '2', '3', '4', '5',
|
|
||||||
'6', '7', '8', '9'
|
|
||||||
};
|
|
||||||
|
|
||||||
// Table for Base64 decoding
|
|
||||||
static private final byte index_64[] = {
|
|
||||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
|
||||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
|
||||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
|
||||||
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
|
||||||
-1, -1, -1, -1, -1, -1, 0, 1, 54, 55,
|
|
||||||
56, 57, 58, 59, 60, 61, 62, 63, -1, -1,
|
|
||||||
-1, -1, -1, -1, -1, 2, 3, 4, 5, 6,
|
|
||||||
7, 8, 9, 10, 11, 12, 13, 14, 15, 16,
|
|
||||||
17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27,
|
|
||||||
-1, -1, -1, -1, -1, -1, 28, 29, 30,
|
|
||||||
31, 32, 33, 34, 35, 36, 37, 38, 39, 40,
|
|
||||||
41, 42, 43, 44, 45, 46, 47, 48, 49, 50,
|
|
||||||
51, 52, 53, -1, -1, -1, -1, -1
|
|
||||||
};
|
|
||||||
|
|
||||||
// Expanded Blowfish key
|
// Expanded Blowfish key
|
||||||
private int P[];
|
private int[] P;
|
||||||
private int S[];
|
private int[] S;
|
||||||
|
|
||||||
/**
|
|
||||||
* Encode a byte array using bcrypt's slightly-modified base64
|
|
||||||
* encoding scheme. Note that this is *not* compatible with
|
|
||||||
* the standard MIME-base64 encoding.
|
|
||||||
*
|
|
||||||
* @param d the byte array to encode
|
|
||||||
* @param len the number of bytes to encode
|
|
||||||
* @return base64-encoded string
|
|
||||||
* @exception IllegalArgumentException if the length is invalid
|
|
||||||
*/
|
|
||||||
private static String encode_base64(byte d[], int len)
|
|
||||||
throws IllegalArgumentException {
|
|
||||||
int off = 0;
|
|
||||||
StringBuffer rs = new StringBuffer();
|
|
||||||
int c1, c2;
|
|
||||||
|
|
||||||
if (len <= 0 || len > d.length)
|
|
||||||
throw new IllegalArgumentException ("Invalid len");
|
|
||||||
|
|
||||||
while (off < len) {
|
|
||||||
c1 = d[off++] & 0xff;
|
|
||||||
rs.append(base64_code[(c1 >> 2) & 0x3f]);
|
|
||||||
c1 = (c1 & 0x03) << 4;
|
|
||||||
if (off >= len) {
|
|
||||||
rs.append(base64_code[c1 & 0x3f]);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
c2 = d[off++] & 0xff;
|
|
||||||
c1 |= (c2 >> 4) & 0x0f;
|
|
||||||
rs.append(base64_code[c1 & 0x3f]);
|
|
||||||
c1 = (c2 & 0x0f) << 2;
|
|
||||||
if (off >= len) {
|
|
||||||
rs.append(base64_code[c1 & 0x3f]);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
c2 = d[off++] & 0xff;
|
|
||||||
c1 |= (c2 >> 6) & 0x03;
|
|
||||||
rs.append(base64_code[c1 & 0x3f]);
|
|
||||||
rs.append(base64_code[c2 & 0x3f]);
|
|
||||||
}
|
|
||||||
return rs.toString();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Look up the 3 bits base64-encoded by the specified character,
|
|
||||||
* range-checking againt conversion table
|
|
||||||
* @param x the base64-encoded value
|
|
||||||
* @return the decoded value of x
|
|
||||||
*/
|
|
||||||
private static byte char64(char x) {
|
|
||||||
if ((int)x < 0 || (int)x > index_64.length)
|
|
||||||
return -1;
|
|
||||||
return index_64[(int)x];
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Decode a string encoded using bcrypt's base64 scheme to a
|
|
||||||
* byte array. Note that this is *not* compatible with
|
|
||||||
* the standard MIME-base64 encoding.
|
|
||||||
* @param s the string to decode
|
|
||||||
* @param maxolen the maximum number of bytes to decode
|
|
||||||
* @return an array containing the decoded bytes
|
|
||||||
* @throws IllegalArgumentException if maxolen is invalid
|
|
||||||
*/
|
|
||||||
private static byte[] decode_base64(String s, int maxolen)
|
|
||||||
throws IllegalArgumentException {
|
|
||||||
StringBuffer rs = new StringBuffer();
|
|
||||||
int off = 0, slen = s.length(), olen = 0;
|
|
||||||
byte ret[];
|
|
||||||
byte c1, c2, c3, c4, o;
|
|
||||||
|
|
||||||
if (maxolen <= 0)
|
|
||||||
throw new IllegalArgumentException ("Invalid maxolen");
|
|
||||||
|
|
||||||
while (off < slen - 1 && olen < maxolen) {
|
|
||||||
c1 = char64(s.charAt(off++));
|
|
||||||
c2 = char64(s.charAt(off++));
|
|
||||||
if (c1 == -1 || c2 == -1)
|
|
||||||
break;
|
|
||||||
o = (byte)(c1 << 2);
|
|
||||||
o |= (c2 & 0x30) >> 4;
|
|
||||||
rs.append((char)o);
|
|
||||||
if (++olen >= maxolen || off >= slen)
|
|
||||||
break;
|
|
||||||
c3 = char64(s.charAt(off++));
|
|
||||||
if (c3 == -1)
|
|
||||||
break;
|
|
||||||
o = (byte)((c2 & 0x0f) << 4);
|
|
||||||
o |= (c3 & 0x3c) >> 2;
|
|
||||||
rs.append((char)o);
|
|
||||||
if (++olen >= maxolen || off >= slen)
|
|
||||||
break;
|
|
||||||
c4 = char64(s.charAt(off++));
|
|
||||||
o = (byte)((c3 & 0x03) << 6);
|
|
||||||
o |= c4;
|
|
||||||
rs.append((char)o);
|
|
||||||
++olen;
|
|
||||||
}
|
|
||||||
|
|
||||||
ret = new byte[olen];
|
|
||||||
for (off = 0; off < olen; off++)
|
|
||||||
ret[off] = (byte)rs.charAt(off);
|
|
||||||
return ret;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Blowfish encipher a single 64-bit block encoded as
|
* Blowfish encipher a single 64-bit block encoded as
|
||||||
@@ -494,7 +322,7 @@ public class BCrypt {
|
|||||||
* @param lr an array containing the two 32-bit half blocks
|
* @param lr an array containing the two 32-bit half blocks
|
||||||
* @param off the position in the array of the blocks
|
* @param off the position in the array of the blocks
|
||||||
*/
|
*/
|
||||||
private final void encipher(int lr[], int off) {
|
private void encipher(int[] lr, int off) {
|
||||||
int i, n, l = lr[off], r = lr[off + 1];
|
int i, n, l = lr[off], r = lr[off + 1];
|
||||||
|
|
||||||
l ^= P[0];
|
l ^= P[0];
|
||||||
@@ -524,7 +352,7 @@ public class BCrypt {
|
|||||||
* current offset into data
|
* current offset into data
|
||||||
* @return the next word of material from data
|
* @return the next word of material from data
|
||||||
*/
|
*/
|
||||||
private static int streamtoword(byte data[], int offp[]) {
|
private static int streamtoword(byte[] data, int[] offp) {
|
||||||
int i;
|
int i;
|
||||||
int word = 0;
|
int word = 0;
|
||||||
int off = offp[0];
|
int off = offp[0];
|
||||||
@@ -542,18 +370,18 @@ public class BCrypt {
|
|||||||
* Initialise the Blowfish key schedule
|
* Initialise the Blowfish key schedule
|
||||||
*/
|
*/
|
||||||
private void init_key() {
|
private void init_key() {
|
||||||
P = (int[])P_orig.clone();
|
P = P_orig.clone();
|
||||||
S = (int[])S_orig.clone();
|
S = S_orig.clone();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Key the Blowfish cipher
|
* Key the Blowfish cipher
|
||||||
* @param key an array containing the key
|
* @param key an array containing the key
|
||||||
*/
|
*/
|
||||||
private void key(byte key[]) {
|
private void key(byte[] key) {
|
||||||
int i;
|
int i;
|
||||||
int koffp[] = { 0 };
|
int[] koffp = { 0 };
|
||||||
int lr[] = { 0, 0 };
|
int[] lr = { 0, 0 };
|
||||||
int plen = P.length, slen = S.length;
|
int plen = P.length, slen = S.length;
|
||||||
|
|
||||||
for (i = 0; i < plen; i++)
|
for (i = 0; i < plen; i++)
|
||||||
@@ -579,10 +407,10 @@ public class BCrypt {
|
|||||||
* @param data salt information
|
* @param data salt information
|
||||||
* @param key password information
|
* @param key password information
|
||||||
*/
|
*/
|
||||||
private void ekskey(byte data[], byte key[]) {
|
private void ekskey(byte[] data, byte[] key) {
|
||||||
int i;
|
int i;
|
||||||
int koffp[] = { 0 }, doffp[] = { 0 };
|
int[] koffp = { 0 }, doffp = { 0 };
|
||||||
int lr[] = { 0, 0 };
|
int[] lr = { 0, 0 };
|
||||||
int plen = P.length, slen = S.length;
|
int plen = P.length, slen = S.length;
|
||||||
|
|
||||||
for (i = 0; i < plen; i++)
|
for (i = 0; i < plen; i++)
|
||||||
@@ -687,183 +515,4 @@ public class BCrypt {
|
|||||||
throw new RuntimeException(e);
|
throw new RuntimeException(e);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Perform the central password hashing step in the
|
|
||||||
* bcrypt scheme
|
|
||||||
* @param password the password to hash
|
|
||||||
* @param salt the binary salt to hash with the password
|
|
||||||
* @param log_rounds the binary logarithm of the number
|
|
||||||
* of rounds of hashing to apply
|
|
||||||
* @param cdata the plaintext to encrypt
|
|
||||||
* @return an array containing the binary hashed password
|
|
||||||
*/
|
|
||||||
public byte[] crypt_raw(byte password[], byte salt[], int log_rounds,
|
|
||||||
int cdata[]) {
|
|
||||||
int rounds, i, j;
|
|
||||||
int clen = cdata.length;
|
|
||||||
byte ret[];
|
|
||||||
|
|
||||||
if (log_rounds < 4 || log_rounds > 30)
|
|
||||||
throw new IllegalArgumentException ("Bad number of rounds");
|
|
||||||
rounds = 1 << log_rounds;
|
|
||||||
if (salt.length != BCRYPT_SALT_LEN)
|
|
||||||
throw new IllegalArgumentException ("Bad salt length");
|
|
||||||
|
|
||||||
init_key();
|
|
||||||
ekskey(salt, password);
|
|
||||||
for (i = 0; i != rounds; i++) {
|
|
||||||
key(password);
|
|
||||||
key(salt);
|
|
||||||
}
|
|
||||||
|
|
||||||
for (i = 0; i < 64; i++) {
|
|
||||||
for (j = 0; j < (clen >> 1); j++)
|
|
||||||
encipher(cdata, j << 1);
|
|
||||||
}
|
|
||||||
|
|
||||||
ret = new byte[clen * 4];
|
|
||||||
for (i = 0, j = 0; i < clen; i++) {
|
|
||||||
ret[j++] = (byte)((cdata[i] >> 24) & 0xff);
|
|
||||||
ret[j++] = (byte)((cdata[i] >> 16) & 0xff);
|
|
||||||
ret[j++] = (byte)((cdata[i] >> 8) & 0xff);
|
|
||||||
ret[j++] = (byte)(cdata[i] & 0xff);
|
|
||||||
}
|
|
||||||
return ret;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Hash a password using the OpenBSD bcrypt scheme
|
|
||||||
* @param password the password to hash
|
|
||||||
* @param salt the salt to hash with (perhaps generated
|
|
||||||
* using BCrypt.gensalt)
|
|
||||||
* @return the hashed password
|
|
||||||
*/
|
|
||||||
public static String hashpw(String password, String salt) {
|
|
||||||
BCrypt B;
|
|
||||||
String real_salt;
|
|
||||||
byte passwordb[], saltb[], hashed[];
|
|
||||||
char minor = (char)0;
|
|
||||||
int rounds, off = 0;
|
|
||||||
StringBuffer rs = new StringBuffer();
|
|
||||||
|
|
||||||
if (salt.charAt(0) != '$' || salt.charAt(1) != '2')
|
|
||||||
throw new IllegalArgumentException ("Invalid salt version");
|
|
||||||
if (salt.charAt(2) == '$')
|
|
||||||
off = 3;
|
|
||||||
else {
|
|
||||||
minor = salt.charAt(2);
|
|
||||||
if (minor != 'a' || salt.charAt(3) != '$')
|
|
||||||
throw new IllegalArgumentException ("Invalid salt revision");
|
|
||||||
off = 4;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Extract number of rounds
|
|
||||||
if (salt.charAt(off + 2) > '$')
|
|
||||||
throw new IllegalArgumentException ("Missing salt rounds");
|
|
||||||
rounds = Integer.parseInt(salt.substring(off, off + 2));
|
|
||||||
|
|
||||||
real_salt = salt.substring(off + 3, off + 25);
|
|
||||||
try {
|
|
||||||
passwordb = (password + (minor >= 'a' ? "\000" : "")).getBytes("UTF-8");
|
|
||||||
} catch (UnsupportedEncodingException uee) {
|
|
||||||
throw new AssertionError("UTF-8 is not supported");
|
|
||||||
}
|
|
||||||
|
|
||||||
saltb = decode_base64(real_salt, BCRYPT_SALT_LEN);
|
|
||||||
|
|
||||||
B = new BCrypt();
|
|
||||||
hashed = B.crypt_raw(passwordb, saltb, rounds,
|
|
||||||
(int[])bf_crypt_ciphertext.clone());
|
|
||||||
|
|
||||||
rs.append("$2");
|
|
||||||
if (minor >= 'a')
|
|
||||||
rs.append(minor);
|
|
||||||
rs.append("$");
|
|
||||||
if (rounds < 10)
|
|
||||||
rs.append("0");
|
|
||||||
if (rounds > 30) {
|
|
||||||
throw new IllegalArgumentException(
|
|
||||||
"rounds exceeds maximum (30)");
|
|
||||||
}
|
|
||||||
rs.append(Integer.toString(rounds));
|
|
||||||
rs.append("$");
|
|
||||||
rs.append(encode_base64(saltb, saltb.length));
|
|
||||||
rs.append(encode_base64(hashed,
|
|
||||||
bf_crypt_ciphertext.length * 4 - 1));
|
|
||||||
return rs.toString();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Generate a salt for use with the BCrypt.hashpw() method
|
|
||||||
* @param log_rounds the log2 of the number of rounds of
|
|
||||||
* hashing to apply - the work factor therefore increases as
|
|
||||||
* 2**log_rounds.
|
|
||||||
* @param random an instance of SecureRandom to use
|
|
||||||
* @return an encoded salt value
|
|
||||||
*/
|
|
||||||
public static String gensalt(int log_rounds, SecureRandom random) {
|
|
||||||
StringBuffer rs = new StringBuffer();
|
|
||||||
byte rnd[] = new byte[BCRYPT_SALT_LEN];
|
|
||||||
|
|
||||||
random.nextBytes(rnd);
|
|
||||||
|
|
||||||
rs.append("$2a$");
|
|
||||||
if (log_rounds < 10)
|
|
||||||
rs.append("0");
|
|
||||||
if (log_rounds > 30) {
|
|
||||||
throw new IllegalArgumentException(
|
|
||||||
"log_rounds exceeds maximum (30)");
|
|
||||||
}
|
|
||||||
rs.append(Integer.toString(log_rounds));
|
|
||||||
rs.append("$");
|
|
||||||
rs.append(encode_base64(rnd, rnd.length));
|
|
||||||
return rs.toString();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Generate a salt for use with the BCrypt.hashpw() method
|
|
||||||
* @param log_rounds the log2 of the number of rounds of
|
|
||||||
* hashing to apply - the work factor therefore increases as
|
|
||||||
* 2**log_rounds.
|
|
||||||
* @return an encoded salt value
|
|
||||||
*/
|
|
||||||
public static String gensalt(int log_rounds) {
|
|
||||||
return gensalt(log_rounds, new SecureRandom());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Generate a salt for use with the BCrypt.hashpw() method,
|
|
||||||
* selecting a reasonable default for the number of hashing
|
|
||||||
* rounds to apply
|
|
||||||
* @return an encoded salt value
|
|
||||||
*/
|
|
||||||
public static String gensalt() {
|
|
||||||
return gensalt(GENSALT_DEFAULT_LOG2_ROUNDS);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Check that a plaintext password matches a previously hashed
|
|
||||||
* one
|
|
||||||
* @param plaintext the plaintext password to verify
|
|
||||||
* @param hashed the previously-hashed password
|
|
||||||
* @return true if the passwords match, false otherwise
|
|
||||||
*/
|
|
||||||
public static boolean checkpw(String plaintext, String hashed) {
|
|
||||||
byte hashed_bytes[];
|
|
||||||
byte try_bytes[];
|
|
||||||
try {
|
|
||||||
String try_pw = hashpw(plaintext, hashed);
|
|
||||||
hashed_bytes = hashed.getBytes("UTF-8");
|
|
||||||
try_bytes = try_pw.getBytes("UTF-8");
|
|
||||||
} catch (UnsupportedEncodingException uee) {
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
if (hashed_bytes.length != try_bytes.length)
|
|
||||||
return false;
|
|
||||||
byte ret = 0;
|
|
||||||
for (int i = 0; i < try_bytes.length; i++)
|
|
||||||
ret |= hashed_bytes[i] ^ try_bytes[i];
|
|
||||||
return ret == 0;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,918 +0,0 @@
|
|||||||
/* Ported from C to Java by Dmitry Skiba [sahn0], 23/02/08.
|
|
||||||
* Original: http://cds.xs4all.nl:8081/ecdh/
|
|
||||||
*/
|
|
||||||
/* Generic 64-bit integer implementation of Curve25519 ECDH
|
|
||||||
* Written by Matthijs van Duin, 200608242056
|
|
||||||
* Public domain.
|
|
||||||
*
|
|
||||||
* Based on work by Daniel J Bernstein, http://cr.yp.to/ecdh.html
|
|
||||||
*/
|
|
||||||
package djb;
|
|
||||||
|
|
||||||
public class Curve25519 {
|
|
||||||
|
|
||||||
/* key size */
|
|
||||||
public static final int KEY_SIZE = 32;
|
|
||||||
|
|
||||||
/* 0 */
|
|
||||||
public static final byte[] ZERO = {
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
|
||||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0
|
|
||||||
};
|
|
||||||
|
|
||||||
/* the prime 2^255-19 */
|
|
||||||
public static final byte[] PRIME = {
|
|
||||||
(byte)237, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)255,
|
|
||||||
(byte)255, (byte)255, (byte)255, (byte)127
|
|
||||||
};
|
|
||||||
|
|
||||||
/* group order (a prime near 2^252+2^124) */
|
|
||||||
public static final byte[] ORDER = {
|
|
||||||
(byte)237, (byte)211, (byte)245, (byte)92,
|
|
||||||
(byte)26, (byte)99, (byte)18, (byte)88,
|
|
||||||
(byte)214, (byte)156, (byte)247, (byte)162,
|
|
||||||
(byte)222, (byte)249, (byte)222, (byte)20,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)16
|
|
||||||
};
|
|
||||||
|
|
||||||
/********* KEY AGREEMENT *********/
|
|
||||||
|
|
||||||
/* Private key clamping
|
|
||||||
* k [out] your private key for key agreement
|
|
||||||
* k [in] 32 random bytes
|
|
||||||
*/
|
|
||||||
public static final void clamp(byte[] k) {
|
|
||||||
k[31] &= 0x7F;
|
|
||||||
k[31] |= 0x40;
|
|
||||||
k[ 0] &= 0xF8;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Key-pair generation
|
|
||||||
* P [out] your public key
|
|
||||||
* s [out] your private key for signing
|
|
||||||
* k [out] your private key for key agreement
|
|
||||||
* k [in] 32 random bytes
|
|
||||||
* s may be NULL if you don't care
|
|
||||||
*
|
|
||||||
* WARNING: if s is not NULL, this function has data-dependent timing */
|
|
||||||
public static final void keygen(byte[] P, byte[] s, byte[] k) {
|
|
||||||
clamp(k);
|
|
||||||
core(P, s, k, null);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Key agreement
|
|
||||||
* Z [out] shared secret (needs hashing before use)
|
|
||||||
* k [in] your private key for key agreement
|
|
||||||
* P [in] peer's public key
|
|
||||||
*/
|
|
||||||
public static final void curve(byte[] Z, byte[] k, byte[] P) {
|
|
||||||
core(Z, null, k, P);
|
|
||||||
}
|
|
||||||
|
|
||||||
/********* DIGITAL SIGNATURES *********/
|
|
||||||
|
|
||||||
/* deterministic EC-KCDSA
|
|
||||||
*
|
|
||||||
* s is the private key for signing
|
|
||||||
* P is the corresponding public key
|
|
||||||
* Z is the context data (signer public key or certificate, etc)
|
|
||||||
*
|
|
||||||
* signing:
|
|
||||||
*
|
|
||||||
* m = hash(Z, message)
|
|
||||||
* x = hash(m, s)
|
|
||||||
* keygen25519(Y, NULL, x);
|
|
||||||
* r = hash(Y);
|
|
||||||
* h = m XOR r
|
|
||||||
* sign25519(v, h, x, s);
|
|
||||||
*
|
|
||||||
* output (v,r) as the signature
|
|
||||||
*
|
|
||||||
* verification:
|
|
||||||
*
|
|
||||||
* m = hash(Z, message);
|
|
||||||
* h = m XOR r
|
|
||||||
* verify25519(Y, v, h, P)
|
|
||||||
*
|
|
||||||
* confirm r == hash(Y)
|
|
||||||
*
|
|
||||||
* It would seem to me that it would be simpler to have the signer directly do
|
|
||||||
* h = hash(m, Y) and send that to the recipient instead of r, who can verify
|
|
||||||
* the signature by checking h == hash(m, Y). If there are any problems with
|
|
||||||
* such a scheme, please let me know.
|
|
||||||
*
|
|
||||||
* Also, EC-KCDSA (like most DS algorithms) picks x random, which is a waste of
|
|
||||||
* perfectly good entropy, but does allow Y to be calculated in advance of (or
|
|
||||||
* parallel to) hashing the message.
|
|
||||||
*/
|
|
||||||
|
|
||||||
/* Signature generation primitive, calculates (x-h)s mod q
|
|
||||||
* v [out] signature value
|
|
||||||
* h [in] signature hash (of message, signature pub key, and context data)
|
|
||||||
* x [in] signature private key
|
|
||||||
* s [in] private key for signing
|
|
||||||
* returns true on success, false on failure (use different x or h)
|
|
||||||
*/
|
|
||||||
public static final boolean sign(byte[] v, byte[] h, byte[] x, byte[] s) {
|
|
||||||
// v = (x - h) s mod q
|
|
||||||
int w, i;
|
|
||||||
byte[] h1 = new byte[32], x1 = new byte[32];
|
|
||||||
byte[] tmp1 = new byte[64];
|
|
||||||
byte[] tmp2 = new byte[64];
|
|
||||||
|
|
||||||
// Don't clobber the arguments, be nice!
|
|
||||||
cpy32(h1, h);
|
|
||||||
cpy32(x1, x);
|
|
||||||
|
|
||||||
// Reduce modulo group order
|
|
||||||
byte[] tmp3=new byte[32];
|
|
||||||
divmod(tmp3, h1, 32, ORDER, 32);
|
|
||||||
divmod(tmp3, x1, 32, ORDER, 32);
|
|
||||||
|
|
||||||
// v = x1 - h1
|
|
||||||
// If v is negative, add the group order to it to become positive.
|
|
||||||
// If v was already positive we don't have to worry about overflow
|
|
||||||
// when adding the order because v < ORDER and 2*ORDER < 2^256
|
|
||||||
mula_small(v, x1, 0, h1, 32, -1);
|
|
||||||
mula_small(v, v , 0, ORDER, 32, 1);
|
|
||||||
|
|
||||||
// tmp1 = (x-h)*s mod q
|
|
||||||
mula32(tmp1, v, s, 32, 1);
|
|
||||||
divmod(tmp2, tmp1, 64, ORDER, 32);
|
|
||||||
|
|
||||||
for (w = 0, i = 0; i < 32; i++)
|
|
||||||
w |= v[i] = tmp1[i];
|
|
||||||
return w != 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Signature verification primitive, calculates Y = vP + hG
|
|
||||||
* Y [out] signature public key
|
|
||||||
* v [in] signature value
|
|
||||||
* h [in] signature hash
|
|
||||||
* P [in] public key
|
|
||||||
*/
|
|
||||||
public static final void verify(byte[] Y, byte[] v, byte[] h, byte[] P) {
|
|
||||||
/* Y = v abs(P) + h G */
|
|
||||||
byte[] d=new byte[32];
|
|
||||||
long10[]
|
|
||||||
p=new long10[]{new long10(),new long10()},
|
|
||||||
s=new long10[]{new long10(),new long10()},
|
|
||||||
yx=new long10[]{new long10(),new long10(),new long10()},
|
|
||||||
yz=new long10[]{new long10(),new long10(),new long10()},
|
|
||||||
t1=new long10[]{new long10(),new long10(),new long10()},
|
|
||||||
t2=new long10[]{new long10(),new long10(),new long10()};
|
|
||||||
|
|
||||||
int vi = 0, hi = 0, di = 0, nvh=0, i, j, k;
|
|
||||||
|
|
||||||
/* set p[0] to G and p[1] to P */
|
|
||||||
|
|
||||||
set(p[0], 9);
|
|
||||||
unpack(p[1], P);
|
|
||||||
|
|
||||||
/* set s[0] to P+G and s[1] to P-G */
|
|
||||||
|
|
||||||
/* s[0] = (Py^2 + Gy^2 - 2 Py Gy)/(Px - Gx)^2 - Px - Gx - 486662 */
|
|
||||||
/* s[1] = (Py^2 + Gy^2 + 2 Py Gy)/(Px - Gx)^2 - Px - Gx - 486662 */
|
|
||||||
|
|
||||||
x_to_y2(t1[0], t2[0], p[1]); /* t2[0] = Py^2 */
|
|
||||||
sqrt(t1[0], t2[0]); /* t1[0] = Py or -Py */
|
|
||||||
j = is_negative(t1[0]); /* ... check which */
|
|
||||||
t2[0]._0 += 39420360; /* t2[0] = Py^2 + Gy^2 */
|
|
||||||
mul(t2[1], BASE_2Y, t1[0]);/* t2[1] = 2 Py Gy or -2 Py Gy */
|
|
||||||
sub(t1[j], t2[0], t2[1]); /* t1[0] = Py^2 + Gy^2 - 2 Py Gy */
|
|
||||||
add(t1[1-j], t2[0], t2[1]);/* t1[1] = Py^2 + Gy^2 + 2 Py Gy */
|
|
||||||
cpy(t2[0], p[1]); /* t2[0] = Px */
|
|
||||||
t2[0]._0 -= 9; /* t2[0] = Px - Gx */
|
|
||||||
sqr(t2[1], t2[0]); /* t2[1] = (Px - Gx)^2 */
|
|
||||||
recip(t2[0], t2[1], 0); /* t2[0] = 1/(Px - Gx)^2 */
|
|
||||||
mul(s[0], t1[0], t2[0]); /* s[0] = t1[0]/(Px - Gx)^2 */
|
|
||||||
sub(s[0], s[0], p[1]); /* s[0] = t1[0]/(Px - Gx)^2 - Px */
|
|
||||||
s[0]._0 -= 9 + 486662; /* s[0] = X(P+G) */
|
|
||||||
mul(s[1], t1[1], t2[0]); /* s[1] = t1[1]/(Px - Gx)^2 */
|
|
||||||
sub(s[1], s[1], p[1]); /* s[1] = t1[1]/(Px - Gx)^2 - Px */
|
|
||||||
s[1]._0 -= 9 + 486662; /* s[1] = X(P-G) */
|
|
||||||
mul_small(s[0], s[0], 1); /* reduce s[0] */
|
|
||||||
mul_small(s[1], s[1], 1); /* reduce s[1] */
|
|
||||||
|
|
||||||
|
|
||||||
/* prepare the chain */
|
|
||||||
for (i = 0; i < 32; i++) {
|
|
||||||
vi = (vi >> 8) ^ (v[i] & 0xFF) ^ ((v[i] & 0xFF) << 1);
|
|
||||||
hi = (hi >> 8) ^ (h[i] & 0xFF) ^ ((h[i] & 0xFF) << 1);
|
|
||||||
nvh = ~(vi ^ hi);
|
|
||||||
di = (nvh & (di & 0x80) >> 7) ^ vi;
|
|
||||||
di ^= nvh & (di & 0x01) << 1;
|
|
||||||
di ^= nvh & (di & 0x02) << 1;
|
|
||||||
di ^= nvh & (di & 0x04) << 1;
|
|
||||||
di ^= nvh & (di & 0x08) << 1;
|
|
||||||
di ^= nvh & (di & 0x10) << 1;
|
|
||||||
di ^= nvh & (di & 0x20) << 1;
|
|
||||||
di ^= nvh & (di & 0x40) << 1;
|
|
||||||
d[i] = (byte)di;
|
|
||||||
}
|
|
||||||
|
|
||||||
di = ((nvh & (di & 0x80) << 1) ^ vi) >> 8;
|
|
||||||
|
|
||||||
/* initialize state */
|
|
||||||
set(yx[0], 1);
|
|
||||||
cpy(yx[1], p[di]);
|
|
||||||
cpy(yx[2], s[0]);
|
|
||||||
set(yz[0], 0);
|
|
||||||
set(yz[1], 1);
|
|
||||||
set(yz[2], 1);
|
|
||||||
|
|
||||||
/* y[0] is (even)P + (even)G
|
|
||||||
* y[1] is (even)P + (odd)G if current d-bit is 0
|
|
||||||
* y[1] is (odd)P + (even)G if current d-bit is 1
|
|
||||||
* y[2] is (odd)P + (odd)G
|
|
||||||
*/
|
|
||||||
|
|
||||||
vi = 0;
|
|
||||||
hi = 0;
|
|
||||||
|
|
||||||
/* and go for it! */
|
|
||||||
for (i = 32; i--!=0; ) {
|
|
||||||
vi = (vi << 8) | (v[i] & 0xFF);
|
|
||||||
hi = (hi << 8) | (h[i] & 0xFF);
|
|
||||||
di = (di << 8) | (d[i] & 0xFF);
|
|
||||||
|
|
||||||
for (j = 8; j--!=0; ) {
|
|
||||||
mont_prep(t1[0], t2[0], yx[0], yz[0]);
|
|
||||||
mont_prep(t1[1], t2[1], yx[1], yz[1]);
|
|
||||||
mont_prep(t1[2], t2[2], yx[2], yz[2]);
|
|
||||||
|
|
||||||
k = ((vi ^ vi >> 1) >> j & 1)
|
|
||||||
+ ((hi ^ hi >> 1) >> j & 1);
|
|
||||||
mont_dbl(yx[2], yz[2], t1[k], t2[k], yx[0], yz[0]);
|
|
||||||
|
|
||||||
k = (di >> j & 2) ^ ((di >> j & 1) << 1);
|
|
||||||
mont_add(t1[1], t2[1], t1[k], t2[k], yx[1], yz[1],
|
|
||||||
p[di >> j & 1]);
|
|
||||||
|
|
||||||
mont_add(t1[2], t2[2], t1[0], t2[0], yx[2], yz[2],
|
|
||||||
s[((vi ^ hi) >> j & 2) >> 1]);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
k = (vi & 1) + (hi & 1);
|
|
||||||
recip(t1[0], yz[k], 0);
|
|
||||||
mul(t1[1], yx[k], t1[0]);
|
|
||||||
|
|
||||||
pack(t1[1], Y);
|
|
||||||
}
|
|
||||||
|
|
||||||
///////////////////////////////////////////////////////////////////////////
|
|
||||||
|
|
||||||
/* sahn0:
|
|
||||||
* Using this class instead of long[10] to avoid bounds checks. */
|
|
||||||
private static final class long10 {
|
|
||||||
public long10() {}
|
|
||||||
public long10(
|
|
||||||
long _0, long _1, long _2, long _3, long _4,
|
|
||||||
long _5, long _6, long _7, long _8, long _9)
|
|
||||||
{
|
|
||||||
this._0=_0; this._1=_1; this._2=_2;
|
|
||||||
this._3=_3; this._4=_4; this._5=_5;
|
|
||||||
this._6=_6; this._7=_7; this._8=_8;
|
|
||||||
this._9=_9;
|
|
||||||
}
|
|
||||||
public long _0,_1,_2,_3,_4,_5,_6,_7,_8,_9;
|
|
||||||
}
|
|
||||||
|
|
||||||
/********************* radix 2^8 math *********************/
|
|
||||||
|
|
||||||
private static final void cpy32(byte[] d, byte[] s) {
|
|
||||||
int i;
|
|
||||||
for (i = 0; i < 32; i++)
|
|
||||||
d[i] = s[i];
|
|
||||||
}
|
|
||||||
|
|
||||||
/* p[m..n+m-1] = q[m..n+m-1] + z * x */
|
|
||||||
/* n is the size of x */
|
|
||||||
/* n+m is the size of p and q */
|
|
||||||
private static final int mula_small(byte[] p,byte[] q,int m,byte[] x,int n,int z) {
|
|
||||||
int v=0;
|
|
||||||
for (int i=0;i<n;++i) {
|
|
||||||
v+=(q[i+m] & 0xFF)+z*(x[i] & 0xFF);
|
|
||||||
p[i+m]=(byte)v;
|
|
||||||
v>>=8;
|
|
||||||
}
|
|
||||||
return v;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* p += x * y * z where z is a small integer
|
|
||||||
* x is size 32, y is size t, p is size 32+t
|
|
||||||
* y is allowed to overlap with p+32 if you don't care about the upper half */
|
|
||||||
private static final int mula32(byte[] p, byte[] x, byte[] y, int t, int z) {
|
|
||||||
final int n = 31;
|
|
||||||
int w = 0;
|
|
||||||
int i = 0;
|
|
||||||
for (; i < t; i++) {
|
|
||||||
int zy = z * (y[i] & 0xFF);
|
|
||||||
w += mula_small(p, p, i, x, n, zy) +
|
|
||||||
(p[i+n] & 0xFF) + zy * (x[n] & 0xFF);
|
|
||||||
p[i+n] = (byte)w;
|
|
||||||
w >>= 8;
|
|
||||||
}
|
|
||||||
p[i+n] = (byte)(w + (p[i+n] & 0xFF));
|
|
||||||
return w >> 8;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* divide r (size n) by d (size t), returning quotient q and remainder r
|
|
||||||
* quotient is size n-t+1, remainder is size t
|
|
||||||
* requires t > 0 && d[t-1] != 0
|
|
||||||
* requires that r[-1] and d[-1] are valid memory locations
|
|
||||||
* q may overlap with r+t */
|
|
||||||
private static final void divmod(byte[] q, byte[] r, int n, byte[] d, int t) {
|
|
||||||
int rn = 0;
|
|
||||||
int dt = ((d[t-1] & 0xFF) << 8);
|
|
||||||
if (t>1) {
|
|
||||||
dt |= (d[t-2] & 0xFF);
|
|
||||||
}
|
|
||||||
while (n-- >= t) {
|
|
||||||
int z = (rn << 16) | ((r[n] & 0xFF) << 8);
|
|
||||||
if (n>0) {
|
|
||||||
z |= (r[n-1] & 0xFF);
|
|
||||||
}
|
|
||||||
z/=dt;
|
|
||||||
rn += mula_small(r,r, n-t+1, d, t, -z);
|
|
||||||
q[n-t+1] = (byte)((z + rn) & 0xFF); /* rn is 0 or -1 (underflow) */
|
|
||||||
mula_small(r,r, n-t+1, d, t, -rn);
|
|
||||||
rn = (r[n] & 0xFF);
|
|
||||||
r[n] = 0;
|
|
||||||
}
|
|
||||||
r[t-1] = (byte)rn;
|
|
||||||
}
|
|
||||||
|
|
||||||
private static final int numsize(byte[] x,int n) {
|
|
||||||
while (n--!=0 && x[n]==0)
|
|
||||||
;
|
|
||||||
return n+1;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Returns x if a contains the gcd, y if b.
|
|
||||||
* Also, the returned buffer contains the inverse of a mod b,
|
|
||||||
* as 32-byte signed.
|
|
||||||
* x and y must have 64 bytes space for temporary use.
|
|
||||||
* requires that a[-1] and b[-1] are valid memory locations */
|
|
||||||
private static final byte[] egcd32(byte[] x,byte[] y,byte[] a,byte[] b) {
|
|
||||||
int an, bn = 32, qn, i;
|
|
||||||
for (i = 0; i < 32; i++)
|
|
||||||
x[i] = y[i] = 0;
|
|
||||||
x[0] = 1;
|
|
||||||
an = numsize(a, 32);
|
|
||||||
if (an==0)
|
|
||||||
return y; /* division by zero */
|
|
||||||
byte[] temp=new byte[32];
|
|
||||||
while (true) {
|
|
||||||
qn = bn - an + 1;
|
|
||||||
divmod(temp, b, bn, a, an);
|
|
||||||
bn = numsize(b, bn);
|
|
||||||
if (bn==0)
|
|
||||||
return x;
|
|
||||||
mula32(y, x, temp, qn, -1);
|
|
||||||
|
|
||||||
qn = an - bn + 1;
|
|
||||||
divmod(temp, a, an, b, bn);
|
|
||||||
an = numsize(a, an);
|
|
||||||
if (an==0)
|
|
||||||
return y;
|
|
||||||
mula32(x, y, temp, qn, -1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/********************* radix 2^25.5 GF(2^255-19) math *********************/
|
|
||||||
|
|
||||||
private static final int P25=33554431; /* (1 << 25) - 1 */
|
|
||||||
private static final int P26=67108863; /* (1 << 26) - 1 */
|
|
||||||
|
|
||||||
/* Convert to internal format from little-endian byte format */
|
|
||||||
private static final void unpack(long10 x,byte[] m) {
|
|
||||||
x._0 = ((m[0] & 0xFF)) | ((m[1] & 0xFF))<<8 |
|
|
||||||
(m[2] & 0xFF)<<16 | ((m[3] & 0xFF)& 3)<<24;
|
|
||||||
x._1 = ((m[3] & 0xFF)&~ 3)>>2 | (m[4] & 0xFF)<<6 |
|
|
||||||
(m[5] & 0xFF)<<14 | ((m[6] & 0xFF)& 7)<<22;
|
|
||||||
x._2 = ((m[6] & 0xFF)&~ 7)>>3 | (m[7] & 0xFF)<<5 |
|
|
||||||
(m[8] & 0xFF)<<13 | ((m[9] & 0xFF)&31)<<21;
|
|
||||||
x._3 = ((m[9] & 0xFF)&~31)>>5 | (m[10] & 0xFF)<<3 |
|
|
||||||
(m[11] & 0xFF)<<11 | ((m[12] & 0xFF)&63)<<19;
|
|
||||||
x._4 = ((m[12] & 0xFF)&~63)>>6 | (m[13] & 0xFF)<<2 |
|
|
||||||
(m[14] & 0xFF)<<10 | (m[15] & 0xFF) <<18;
|
|
||||||
x._5 = (m[16] & 0xFF) | (m[17] & 0xFF)<<8 |
|
|
||||||
(m[18] & 0xFF)<<16 | ((m[19] & 0xFF)& 1)<<24;
|
|
||||||
x._6 = ((m[19] & 0xFF)&~ 1)>>1 | (m[20] & 0xFF)<<7 |
|
|
||||||
(m[21] & 0xFF)<<15 | ((m[22] & 0xFF)& 7)<<23;
|
|
||||||
x._7 = ((m[22] & 0xFF)&~ 7)>>3 | (m[23] & 0xFF)<<5 |
|
|
||||||
(m[24] & 0xFF)<<13 | ((m[25] & 0xFF)&15)<<21;
|
|
||||||
x._8 = ((m[25] & 0xFF)&~15)>>4 | (m[26] & 0xFF)<<4 |
|
|
||||||
(m[27] & 0xFF)<<12 | ((m[28] & 0xFF)&63)<<20;
|
|
||||||
x._9 = ((m[28] & 0xFF)&~63)>>6 | (m[29] & 0xFF)<<2 |
|
|
||||||
(m[30] & 0xFF)<<10 | (m[31] & 0xFF) <<18;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Check if reduced-form input >= 2^255-19 */
|
|
||||||
private static final boolean is_overflow(long10 x) {
|
|
||||||
return (
|
|
||||||
((x._0 > P26-19)) &&
|
|
||||||
((x._1 & x._3 & x._5 & x._7 & x._9) == P25) &&
|
|
||||||
((x._2 & x._4 & x._6 & x._8) == P26)
|
|
||||||
) || (x._9 > P25);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Convert from internal format to little-endian byte format. The
|
|
||||||
* number must be in a reduced form which is output by the following ops:
|
|
||||||
* unpack, mul, sqr
|
|
||||||
* set -- if input in range 0 .. P25
|
|
||||||
* If you're unsure if the number is reduced, first multiply it by 1. */
|
|
||||||
private static final void pack(long10 x,byte[] m) {
|
|
||||||
int ld = 0, ud = 0;
|
|
||||||
long t;
|
|
||||||
ld = (is_overflow(x)?1:0) - ((x._9 < 0)?1:0);
|
|
||||||
ud = ld * -(P25+1);
|
|
||||||
ld *= 19;
|
|
||||||
t = ld + x._0 + (x._1 << 26);
|
|
||||||
m[ 0] = (byte)t;
|
|
||||||
m[ 1] = (byte)(t >> 8);
|
|
||||||
m[ 2] = (byte)(t >> 16);
|
|
||||||
m[ 3] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + (x._2 << 19);
|
|
||||||
m[ 4] = (byte)t;
|
|
||||||
m[ 5] = (byte)(t >> 8);
|
|
||||||
m[ 6] = (byte)(t >> 16);
|
|
||||||
m[ 7] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + (x._3 << 13);
|
|
||||||
m[ 8] = (byte)t;
|
|
||||||
m[ 9] = (byte)(t >> 8);
|
|
||||||
m[10] = (byte)(t >> 16);
|
|
||||||
m[11] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + (x._4 << 6);
|
|
||||||
m[12] = (byte)t;
|
|
||||||
m[13] = (byte)(t >> 8);
|
|
||||||
m[14] = (byte)(t >> 16);
|
|
||||||
m[15] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + x._5 + (x._6 << 25);
|
|
||||||
m[16] = (byte)t;
|
|
||||||
m[17] = (byte)(t >> 8);
|
|
||||||
m[18] = (byte)(t >> 16);
|
|
||||||
m[19] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + (x._7 << 19);
|
|
||||||
m[20] = (byte)t;
|
|
||||||
m[21] = (byte)(t >> 8);
|
|
||||||
m[22] = (byte)(t >> 16);
|
|
||||||
m[23] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + (x._8 << 12);
|
|
||||||
m[24] = (byte)t;
|
|
||||||
m[25] = (byte)(t >> 8);
|
|
||||||
m[26] = (byte)(t >> 16);
|
|
||||||
m[27] = (byte)(t >> 24);
|
|
||||||
t = (t >> 32) + ((x._9 + ud) << 6);
|
|
||||||
m[28] = (byte)t;
|
|
||||||
m[29] = (byte)(t >> 8);
|
|
||||||
m[30] = (byte)(t >> 16);
|
|
||||||
m[31] = (byte)(t >> 24);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Copy a number */
|
|
||||||
private static final void cpy(long10 out, long10 in) {
|
|
||||||
out._0=in._0; out._1=in._1;
|
|
||||||
out._2=in._2; out._3=in._3;
|
|
||||||
out._4=in._4; out._5=in._5;
|
|
||||||
out._6=in._6; out._7=in._7;
|
|
||||||
out._8=in._8; out._9=in._9;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Set a number to value, which must be in range -185861411 .. 185861411 */
|
|
||||||
private static final void set(long10 out, int in) {
|
|
||||||
out._0=in; out._1=0;
|
|
||||||
out._2=0; out._3=0;
|
|
||||||
out._4=0; out._5=0;
|
|
||||||
out._6=0; out._7=0;
|
|
||||||
out._8=0; out._9=0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Add/subtract two numbers. The inputs must be in reduced form, and the
|
|
||||||
* output isn't, so to do another addition or subtraction on the output,
|
|
||||||
* first multiply it by one to reduce it. */
|
|
||||||
private static final void add(long10 xy, long10 x, long10 y) {
|
|
||||||
xy._0 = x._0 + y._0; xy._1 = x._1 + y._1;
|
|
||||||
xy._2 = x._2 + y._2; xy._3 = x._3 + y._3;
|
|
||||||
xy._4 = x._4 + y._4; xy._5 = x._5 + y._5;
|
|
||||||
xy._6 = x._6 + y._6; xy._7 = x._7 + y._7;
|
|
||||||
xy._8 = x._8 + y._8; xy._9 = x._9 + y._9;
|
|
||||||
}
|
|
||||||
private static final void sub(long10 xy, long10 x, long10 y) {
|
|
||||||
xy._0 = x._0 - y._0; xy._1 = x._1 - y._1;
|
|
||||||
xy._2 = x._2 - y._2; xy._3 = x._3 - y._3;
|
|
||||||
xy._4 = x._4 - y._4; xy._5 = x._5 - y._5;
|
|
||||||
xy._6 = x._6 - y._6; xy._7 = x._7 - y._7;
|
|
||||||
xy._8 = x._8 - y._8; xy._9 = x._9 - y._9;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Multiply a number by a small integer in range -185861411 .. 185861411.
|
|
||||||
* The output is in reduced form, the input x need not be. x and xy may point
|
|
||||||
* to the same buffer. */
|
|
||||||
private static final long10 mul_small(long10 xy, long10 x, long y) {
|
|
||||||
long t;
|
|
||||||
t = (x._8*y);
|
|
||||||
xy._8 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x._9*y);
|
|
||||||
xy._9 = (t & ((1 << 25) - 1));
|
|
||||||
t = 19 * (t >> 25) + (x._0*y);
|
|
||||||
xy._0 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x._1*y);
|
|
||||||
xy._1 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x._2*y);
|
|
||||||
xy._2 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x._3*y);
|
|
||||||
xy._3 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x._4*y);
|
|
||||||
xy._4 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x._5*y);
|
|
||||||
xy._5 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x._6*y);
|
|
||||||
xy._6 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x._7*y);
|
|
||||||
xy._7 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + xy._8;
|
|
||||||
xy._8 = (t & ((1 << 26) - 1));
|
|
||||||
xy._9 += (t >> 26);
|
|
||||||
return xy;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Multiply two numbers. The output is in reduced form, the inputs need not
|
|
||||||
* be. */
|
|
||||||
private static final long10 mul(long10 xy, long10 x, long10 y) {
|
|
||||||
/* sahn0:
|
|
||||||
* Using local variables to avoid class access.
|
|
||||||
* This seem to improve performance a bit...
|
|
||||||
*/
|
|
||||||
long
|
|
||||||
x_0=x._0,x_1=x._1,x_2=x._2,x_3=x._3,x_4=x._4,
|
|
||||||
x_5=x._5,x_6=x._6,x_7=x._7,x_8=x._8,x_9=x._9;
|
|
||||||
long
|
|
||||||
y_0=y._0,y_1=y._1,y_2=y._2,y_3=y._3,y_4=y._4,
|
|
||||||
y_5=y._5,y_6=y._6,y_7=y._7,y_8=y._8,y_9=y._9;
|
|
||||||
long t;
|
|
||||||
t = (x_0*y_8) + (x_2*y_6) + (x_4*y_4) + (x_6*y_2) +
|
|
||||||
(x_8*y_0) + 2 * ((x_1*y_7) + (x_3*y_5) +
|
|
||||||
(x_5*y_3) + (x_7*y_1)) + 38 *
|
|
||||||
(x_9*y_9);
|
|
||||||
xy._8 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x_0*y_9) + (x_1*y_8) + (x_2*y_7) +
|
|
||||||
(x_3*y_6) + (x_4*y_5) + (x_5*y_4) +
|
|
||||||
(x_6*y_3) + (x_7*y_2) + (x_8*y_1) +
|
|
||||||
(x_9*y_0);
|
|
||||||
xy._9 = (t & ((1 << 25) - 1));
|
|
||||||
t = (x_0*y_0) + 19 * ((t >> 25) + (x_2*y_8) + (x_4*y_6)
|
|
||||||
+ (x_6*y_4) + (x_8*y_2)) + 38 *
|
|
||||||
((x_1*y_9) + (x_3*y_7) + (x_5*y_5) +
|
|
||||||
(x_7*y_3) + (x_9*y_1));
|
|
||||||
xy._0 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x_0*y_1) + (x_1*y_0) + 19 * ((x_2*y_9)
|
|
||||||
+ (x_3*y_8) + (x_4*y_7) + (x_5*y_6) +
|
|
||||||
(x_6*y_5) + (x_7*y_4) + (x_8*y_3) +
|
|
||||||
(x_9*y_2));
|
|
||||||
xy._1 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x_0*y_2) + (x_2*y_0) + 19 * ((x_4*y_8)
|
|
||||||
+ (x_6*y_6) + (x_8*y_4)) + 2 * (x_1*y_1)
|
|
||||||
+ 38 * ((x_3*y_9) + (x_5*y_7) +
|
|
||||||
(x_7*y_5) + (x_9*y_3));
|
|
||||||
xy._2 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x_0*y_3) + (x_1*y_2) + (x_2*y_1) +
|
|
||||||
(x_3*y_0) + 19 * ((x_4*y_9) + (x_5*y_8) +
|
|
||||||
(x_6*y_7) + (x_7*y_6) +
|
|
||||||
(x_8*y_5) + (x_9*y_4));
|
|
||||||
xy._3 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x_0*y_4) + (x_2*y_2) + (x_4*y_0) + 19 *
|
|
||||||
((x_6*y_8) + (x_8*y_6)) + 2 * ((x_1*y_3) +
|
|
||||||
(x_3*y_1)) + 38 *
|
|
||||||
((x_5*y_9) + (x_7*y_7) + (x_9*y_5));
|
|
||||||
xy._4 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x_0*y_5) + (x_1*y_4) + (x_2*y_3) +
|
|
||||||
(x_3*y_2) + (x_4*y_1) + (x_5*y_0) + 19 *
|
|
||||||
((x_6*y_9) + (x_7*y_8) + (x_8*y_7) +
|
|
||||||
(x_9*y_6));
|
|
||||||
xy._5 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x_0*y_6) + (x_2*y_4) + (x_4*y_2) +
|
|
||||||
(x_6*y_0) + 19 * (x_8*y_8) + 2 * ((x_1*y_5) +
|
|
||||||
(x_3*y_3) + (x_5*y_1)) + 38 *
|
|
||||||
((x_7*y_9) + (x_9*y_7));
|
|
||||||
xy._6 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + (x_0*y_7) + (x_1*y_6) + (x_2*y_5) +
|
|
||||||
(x_3*y_4) + (x_4*y_3) + (x_5*y_2) +
|
|
||||||
(x_6*y_1) + (x_7*y_0) + 19 * ((x_8*y_9) +
|
|
||||||
(x_9*y_8));
|
|
||||||
xy._7 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + xy._8;
|
|
||||||
xy._8 = (t & ((1 << 26) - 1));
|
|
||||||
xy._9 += (t >> 26);
|
|
||||||
return xy;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Square a number. Optimization of mul25519(x2, x, x) */
|
|
||||||
private static final long10 sqr(long10 x2, long10 x) {
|
|
||||||
long
|
|
||||||
x_0=x._0,x_1=x._1,x_2=x._2,x_3=x._3,x_4=x._4,
|
|
||||||
x_5=x._5,x_6=x._6,x_7=x._7,x_8=x._8,x_9=x._9;
|
|
||||||
long t;
|
|
||||||
t = (x_4*x_4) + 2 * ((x_0*x_8) + (x_2*x_6)) + 38 *
|
|
||||||
(x_9*x_9) + 4 * ((x_1*x_7) + (x_3*x_5));
|
|
||||||
x2._8 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + 2 * ((x_0*x_9) + (x_1*x_8) + (x_2*x_7) +
|
|
||||||
(x_3*x_6) + (x_4*x_5));
|
|
||||||
x2._9 = (t & ((1 << 25) - 1));
|
|
||||||
t = 19 * (t >> 25) + (x_0*x_0) + 38 * ((x_2*x_8) +
|
|
||||||
(x_4*x_6) + (x_5*x_5)) + 76 * ((x_1*x_9)
|
|
||||||
+ (x_3*x_7));
|
|
||||||
x2._0 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + 2 * (x_0*x_1) + 38 * ((x_2*x_9) +
|
|
||||||
(x_3*x_8) + (x_4*x_7) + (x_5*x_6));
|
|
||||||
x2._1 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + 19 * (x_6*x_6) + 2 * ((x_0*x_2) +
|
|
||||||
(x_1*x_1)) + 38 * (x_4*x_8) + 76 *
|
|
||||||
((x_3*x_9) + (x_5*x_7));
|
|
||||||
x2._2 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + 2 * ((x_0*x_3) + (x_1*x_2)) + 38 *
|
|
||||||
((x_4*x_9) + (x_5*x_8) + (x_6*x_7));
|
|
||||||
x2._3 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + (x_2*x_2) + 2 * (x_0*x_4) + 38 *
|
|
||||||
((x_6*x_8) + (x_7*x_7)) + 4 * (x_1*x_3) + 76 *
|
|
||||||
(x_5*x_9);
|
|
||||||
x2._4 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + 2 * ((x_0*x_5) + (x_1*x_4) + (x_2*x_3))
|
|
||||||
+ 38 * ((x_6*x_9) + (x_7*x_8));
|
|
||||||
x2._5 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + 19 * (x_8*x_8) + 2 * ((x_0*x_6) +
|
|
||||||
(x_2*x_4) + (x_3*x_3)) + 4 * (x_1*x_5) +
|
|
||||||
76 * (x_7*x_9);
|
|
||||||
x2._6 = (t & ((1 << 26) - 1));
|
|
||||||
t = (t >> 26) + 2 * ((x_0*x_7) + (x_1*x_6) + (x_2*x_5) +
|
|
||||||
(x_3*x_4)) + 38 * (x_8*x_9);
|
|
||||||
x2._7 = (t & ((1 << 25) - 1));
|
|
||||||
t = (t >> 25) + x2._8;
|
|
||||||
x2._8 = (t & ((1 << 26) - 1));
|
|
||||||
x2._9 += (t >> 26);
|
|
||||||
return x2;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Calculates a reciprocal. The output is in reduced form, the inputs need not
|
|
||||||
* be. Simply calculates y = x^(p-2) so it's not too fast. */
|
|
||||||
/* When sqrtassist is true, it instead calculates y = x^((p-5)/8) */
|
|
||||||
private static final void recip(long10 y, long10 x, int sqrtassist) {
|
|
||||||
long10
|
|
||||||
t0=new long10(),
|
|
||||||
t1=new long10(),
|
|
||||||
t2=new long10(),
|
|
||||||
t3=new long10(),
|
|
||||||
t4=new long10();
|
|
||||||
int i;
|
|
||||||
/* the chain for x^(2^255-21) is straight from djb's implementation */
|
|
||||||
sqr(t1, x); /* 2 == 2 * 1 */
|
|
||||||
sqr(t2, t1); /* 4 == 2 * 2 */
|
|
||||||
sqr(t0, t2); /* 8 == 2 * 4 */
|
|
||||||
mul(t2, t0, x); /* 9 == 8 + 1 */
|
|
||||||
mul(t0, t2, t1); /* 11 == 9 + 2 */
|
|
||||||
sqr(t1, t0); /* 22 == 2 * 11 */
|
|
||||||
mul(t3, t1, t2); /* 31 == 22 + 9
|
|
||||||
== 2^5 - 2^0 */
|
|
||||||
sqr(t1, t3); /* 2^6 - 2^1 */
|
|
||||||
sqr(t2, t1); /* 2^7 - 2^2 */
|
|
||||||
sqr(t1, t2); /* 2^8 - 2^3 */
|
|
||||||
sqr(t2, t1); /* 2^9 - 2^4 */
|
|
||||||
sqr(t1, t2); /* 2^10 - 2^5 */
|
|
||||||
mul(t2, t1, t3); /* 2^10 - 2^0 */
|
|
||||||
sqr(t1, t2); /* 2^11 - 2^1 */
|
|
||||||
sqr(t3, t1); /* 2^12 - 2^2 */
|
|
||||||
for (i = 1; i < 5; i++) {
|
|
||||||
sqr(t1, t3);
|
|
||||||
sqr(t3, t1);
|
|
||||||
} /* t3 */ /* 2^20 - 2^10 */
|
|
||||||
mul(t1, t3, t2); /* 2^20 - 2^0 */
|
|
||||||
sqr(t3, t1); /* 2^21 - 2^1 */
|
|
||||||
sqr(t4, t3); /* 2^22 - 2^2 */
|
|
||||||
for (i = 1; i < 10; i++) {
|
|
||||||
sqr(t3, t4);
|
|
||||||
sqr(t4, t3);
|
|
||||||
} /* t4 */ /* 2^40 - 2^20 */
|
|
||||||
mul(t3, t4, t1); /* 2^40 - 2^0 */
|
|
||||||
for (i = 0; i < 5; i++) {
|
|
||||||
sqr(t1, t3);
|
|
||||||
sqr(t3, t1);
|
|
||||||
} /* t3 */ /* 2^50 - 2^10 */
|
|
||||||
mul(t1, t3, t2); /* 2^50 - 2^0 */
|
|
||||||
sqr(t2, t1); /* 2^51 - 2^1 */
|
|
||||||
sqr(t3, t2); /* 2^52 - 2^2 */
|
|
||||||
for (i = 1; i < 25; i++) {
|
|
||||||
sqr(t2, t3);
|
|
||||||
sqr(t3, t2);
|
|
||||||
} /* t3 */ /* 2^100 - 2^50 */
|
|
||||||
mul(t2, t3, t1); /* 2^100 - 2^0 */
|
|
||||||
sqr(t3, t2); /* 2^101 - 2^1 */
|
|
||||||
sqr(t4, t3); /* 2^102 - 2^2 */
|
|
||||||
for (i = 1; i < 50; i++) {
|
|
||||||
sqr(t3, t4);
|
|
||||||
sqr(t4, t3);
|
|
||||||
} /* t4 */ /* 2^200 - 2^100 */
|
|
||||||
mul(t3, t4, t2); /* 2^200 - 2^0 */
|
|
||||||
for (i = 0; i < 25; i++) {
|
|
||||||
sqr(t4, t3);
|
|
||||||
sqr(t3, t4);
|
|
||||||
} /* t3 */ /* 2^250 - 2^50 */
|
|
||||||
mul(t2, t3, t1); /* 2^250 - 2^0 */
|
|
||||||
sqr(t1, t2); /* 2^251 - 2^1 */
|
|
||||||
sqr(t2, t1); /* 2^252 - 2^2 */
|
|
||||||
if (sqrtassist!=0) {
|
|
||||||
mul(y, x, t2); /* 2^252 - 3 */
|
|
||||||
} else {
|
|
||||||
sqr(t1, t2); /* 2^253 - 2^3 */
|
|
||||||
sqr(t2, t1); /* 2^254 - 2^4 */
|
|
||||||
sqr(t1, t2); /* 2^255 - 2^5 */
|
|
||||||
mul(y, t1, t0); /* 2^255 - 21 */
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/* checks if x is "negative", requires reduced input */
|
|
||||||
private static final int is_negative(long10 x) {
|
|
||||||
return (int)(((is_overflow(x) || (x._9 < 0))?1:0) ^ (x._0 & 1));
|
|
||||||
}
|
|
||||||
|
|
||||||
/* a square root */
|
|
||||||
private static final void sqrt(long10 x, long10 u) {
|
|
||||||
long10 v=new long10(), t1=new long10(), t2=new long10();
|
|
||||||
add(t1, u, u); /* t1 = 2u */
|
|
||||||
recip(v, t1, 1); /* v = (2u)^((p-5)/8) */
|
|
||||||
sqr(x, v); /* x = v^2 */
|
|
||||||
mul(t2, t1, x); /* t2 = 2uv^2 */
|
|
||||||
t2._0--; /* t2 = 2uv^2-1 */
|
|
||||||
mul(t1, v, t2); /* t1 = v(2uv^2-1) */
|
|
||||||
mul(x, u, t1); /* x = uv(2uv^2-1) */
|
|
||||||
}
|
|
||||||
|
|
||||||
/********************* Elliptic curve *********************/
|
|
||||||
|
|
||||||
/* y^2 = x^3 + 486662 x^2 + x over GF(2^255-19) */
|
|
||||||
|
|
||||||
/* t1 = ax + az
|
|
||||||
* t2 = ax - az */
|
|
||||||
private static final void mont_prep(long10 t1, long10 t2, long10 ax, long10 az) {
|
|
||||||
add(t1, ax, az);
|
|
||||||
sub(t2, ax, az);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* A = P + Q where
|
|
||||||
* X(A) = ax/az
|
|
||||||
* X(P) = (t1+t2)/(t1-t2)
|
|
||||||
* X(Q) = (t3+t4)/(t3-t4)
|
|
||||||
* X(P-Q) = dx
|
|
||||||
* clobbers t1 and t2, preserves t3 and t4 */
|
|
||||||
private static final void mont_add(long10 t1, long10 t2, long10 t3, long10 t4,long10 ax, long10 az, long10 dx) {
|
|
||||||
mul(ax, t2, t3);
|
|
||||||
mul(az, t1, t4);
|
|
||||||
add(t1, ax, az);
|
|
||||||
sub(t2, ax, az);
|
|
||||||
sqr(ax, t1);
|
|
||||||
sqr(t1, t2);
|
|
||||||
mul(az, t1, dx);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* B = 2 * Q where
|
|
||||||
* X(B) = bx/bz
|
|
||||||
* X(Q) = (t3+t4)/(t3-t4)
|
|
||||||
* clobbers t1 and t2, preserves t3 and t4 */
|
|
||||||
private static final void mont_dbl(long10 t1, long10 t2, long10 t3, long10 t4,long10 bx, long10 bz) {
|
|
||||||
sqr(t1, t3);
|
|
||||||
sqr(t2, t4);
|
|
||||||
mul(bx, t1, t2);
|
|
||||||
sub(t2, t1, t2);
|
|
||||||
mul_small(bz, t2, 121665);
|
|
||||||
add(t1, t1, bz);
|
|
||||||
mul(bz, t1, t2);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Y^2 = X^3 + 486662 X^2 + X
|
|
||||||
* t is a temporary */
|
|
||||||
private static final void x_to_y2(long10 t, long10 y2, long10 x) {
|
|
||||||
sqr(t, x);
|
|
||||||
mul_small(y2, x, 486662);
|
|
||||||
add(t, t, y2);
|
|
||||||
t._0++;
|
|
||||||
mul(y2, t, x);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* P = kG and s = sign(P)/k */
|
|
||||||
private static final void core(byte[] Px, byte[] s, byte[] k, byte[] Gx) {
|
|
||||||
long10
|
|
||||||
dx=new long10(),
|
|
||||||
t1=new long10(),
|
|
||||||
t2=new long10(),
|
|
||||||
t3=new long10(),
|
|
||||||
t4=new long10();
|
|
||||||
long10[]
|
|
||||||
x=new long10[]{new long10(),new long10()},
|
|
||||||
z=new long10[]{new long10(),new long10()};
|
|
||||||
int i, j;
|
|
||||||
|
|
||||||
/* unpack the base */
|
|
||||||
if (Gx!=null)
|
|
||||||
unpack(dx, Gx);
|
|
||||||
else
|
|
||||||
set(dx, 9);
|
|
||||||
|
|
||||||
/* 0G = point-at-infinity */
|
|
||||||
set(x[0], 1);
|
|
||||||
set(z[0], 0);
|
|
||||||
|
|
||||||
/* 1G = G */
|
|
||||||
cpy(x[1], dx);
|
|
||||||
set(z[1], 1);
|
|
||||||
|
|
||||||
for (i = 32; i--!=0; ) {
|
|
||||||
if (i==0) {
|
|
||||||
i=0;
|
|
||||||
}
|
|
||||||
for (j = 8; j--!=0; ) {
|
|
||||||
/* swap arguments depending on bit */
|
|
||||||
int bit1 = (k[i] & 0xFF) >> j & 1;
|
|
||||||
int bit0 = ~(k[i] & 0xFF) >> j & 1;
|
|
||||||
long10 ax = x[bit0];
|
|
||||||
long10 az = z[bit0];
|
|
||||||
long10 bx = x[bit1];
|
|
||||||
long10 bz = z[bit1];
|
|
||||||
|
|
||||||
/* a' = a + b */
|
|
||||||
/* b' = 2 b */
|
|
||||||
mont_prep(t1, t2, ax, az);
|
|
||||||
mont_prep(t3, t4, bx, bz);
|
|
||||||
mont_add(t1, t2, t3, t4, ax, az, dx);
|
|
||||||
mont_dbl(t1, t2, t3, t4, bx, bz);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
recip(t1, z[0], 0);
|
|
||||||
mul(dx, x[0], t1);
|
|
||||||
pack(dx, Px);
|
|
||||||
|
|
||||||
/* calculate s such that s abs(P) = G .. assumes G is std base point */
|
|
||||||
if (s!=null) {
|
|
||||||
x_to_y2(t2, t1, dx); /* t1 = Py^2 */
|
|
||||||
recip(t3, z[1], 0); /* where Q=P+G ... */
|
|
||||||
mul(t2, x[1], t3); /* t2 = Qx */
|
|
||||||
add(t2, t2, dx); /* t2 = Qx + Px */
|
|
||||||
t2._0 += 9 + 486662; /* t2 = Qx + Px + Gx + 486662 */
|
|
||||||
dx._0 -= 9; /* dx = Px - Gx */
|
|
||||||
sqr(t3, dx); /* t3 = (Px - Gx)^2 */
|
|
||||||
mul(dx, t2, t3); /* dx = t2 (Px - Gx)^2 */
|
|
||||||
sub(dx, dx, t1); /* dx = t2 (Px - Gx)^2 - Py^2 */
|
|
||||||
dx._0 -= 39420360; /* dx = t2 (Px - Gx)^2 - Py^2 - Gy^2 */
|
|
||||||
mul(t1, dx, BASE_R2Y); /* t1 = -Py */
|
|
||||||
if (is_negative(t1)!=0) /* sign is 1, so just copy */
|
|
||||||
cpy32(s, k);
|
|
||||||
else /* sign is -1, so negate */
|
|
||||||
mula_small(s, ORDER_TIMES_8, 0, k, 32, -1);
|
|
||||||
|
|
||||||
/* reduce s mod q
|
|
||||||
* (is this needed? do it just in case, it's fast anyway) */
|
|
||||||
//divmod((dstptr) t1, s, 32, order25519, 32);
|
|
||||||
|
|
||||||
/* take reciprocal of s mod q */
|
|
||||||
byte[] temp1=new byte[32];
|
|
||||||
byte[] temp2=new byte[64];
|
|
||||||
byte[] temp3=new byte[64];
|
|
||||||
cpy32(temp1, ORDER);
|
|
||||||
cpy32(s, egcd32(temp2, temp3, s, temp1));
|
|
||||||
if ((s[31] & 0x80)!=0)
|
|
||||||
mula_small(s, s, 0, ORDER, 32, 1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/* smallest multiple of the order that's >= 2^255 */
|
|
||||||
private static final byte[] ORDER_TIMES_8 = {
|
|
||||||
(byte)104, (byte)159, (byte)174, (byte)231,
|
|
||||||
(byte)210, (byte)24, (byte)147, (byte)192,
|
|
||||||
(byte)178, (byte)230, (byte)188, (byte)23,
|
|
||||||
(byte)245, (byte)206, (byte)247, (byte)166,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)0,
|
|
||||||
(byte)0, (byte)0, (byte)0, (byte)128
|
|
||||||
};
|
|
||||||
|
|
||||||
/* constants 2Gy and 1/(2Gy) */
|
|
||||||
private static final long10 BASE_2Y = new long10(
|
|
||||||
39999547, 18689728, 59995525, 1648697, 57546132,
|
|
||||||
24010086, 19059592, 5425144, 63499247, 16420658
|
|
||||||
);
|
|
||||||
private static final long10 BASE_R2Y = new long10(
|
|
||||||
5744, 8160848, 4790893, 13779497, 35730846,
|
|
||||||
12541209, 49101323, 30047407, 40071253, 6226132
|
|
||||||
);
|
|
||||||
}
|
|
||||||
@@ -104,7 +104,8 @@ public class Promise<V, T extends Throwable> {
|
|||||||
lock.lock();
|
lock.lock();
|
||||||
try {
|
try {
|
||||||
pendingEx = null;
|
pendingEx = null;
|
||||||
deliver(null);
|
log.debug("Clearing <<{}>>", name);
|
||||||
|
val = null;
|
||||||
} finally {
|
} finally {
|
||||||
lock.unlock();
|
lock.unlock();
|
||||||
}
|
}
|
||||||
@@ -136,7 +137,7 @@ public class Promise<V, T extends Throwable> {
|
|||||||
throws T {
|
throws T {
|
||||||
final V value = tryRetrieve(timeout, unit);
|
final V value = tryRetrieve(timeout, unit);
|
||||||
if (value == null)
|
if (value == null)
|
||||||
throw chainer.chain(new TimeoutException("Timeout expired"));
|
throw chainer.chain(new TimeoutException("Timeout expired: " + timeout + " " + unit));
|
||||||
else
|
else
|
||||||
return value;
|
return value;
|
||||||
}
|
}
|
||||||
@@ -176,6 +177,7 @@ public class Promise<V, T extends Throwable> {
|
|||||||
}
|
}
|
||||||
return val;
|
return val;
|
||||||
} catch (InterruptedException ie) {
|
} catch (InterruptedException ie) {
|
||||||
|
Thread.currentThread().interrupt();
|
||||||
throw chainer.chain(ie);
|
throw chainer.chain(ie);
|
||||||
} finally {
|
} finally {
|
||||||
lock.unlock();
|
lock.unlock();
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ final class Heartbeater
|
|||||||
extends KeepAlive {
|
extends KeepAlive {
|
||||||
|
|
||||||
Heartbeater(ConnectionImpl conn) {
|
Heartbeater(ConnectionImpl conn) {
|
||||||
super(conn, "heartbeater");
|
super(conn, "sshj-Heartbeater");
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
|
|||||||
@@ -20,6 +20,8 @@ import net.schmizz.sshj.connection.ConnectionImpl;
|
|||||||
import net.schmizz.sshj.transport.TransportException;
|
import net.schmizz.sshj.transport.TransportException;
|
||||||
import org.slf4j.Logger;
|
import org.slf4j.Logger;
|
||||||
|
|
||||||
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
public abstract class KeepAlive extends Thread {
|
public abstract class KeepAlive extends Thread {
|
||||||
protected final Logger log;
|
protected final Logger log;
|
||||||
protected final ConnectionImpl conn;
|
protected final ConnectionImpl conn;
|
||||||
@@ -33,40 +35,49 @@ public abstract class KeepAlive extends Thread {
|
|||||||
setDaemon(true);
|
setDaemon(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* KeepAlive enabled based on KeepAlive interval
|
||||||
|
*
|
||||||
|
* @return Enabled when KeepInterval is greater than 0
|
||||||
|
*/
|
||||||
|
public boolean isEnabled() {
|
||||||
|
return keepAliveInterval > 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get KeepAlive interval in seconds
|
||||||
|
*
|
||||||
|
* @return KeepAlive interval in seconds defaults to 0
|
||||||
|
*/
|
||||||
public synchronized int getKeepAliveInterval() {
|
public synchronized int getKeepAliveInterval() {
|
||||||
return keepAliveInterval;
|
return keepAliveInterval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set KeepAlive interval in seconds
|
||||||
|
*
|
||||||
|
* @param keepAliveInterval KeepAlive interval in seconds
|
||||||
|
*/
|
||||||
public synchronized void setKeepAliveInterval(int keepAliveInterval) {
|
public synchronized void setKeepAliveInterval(int keepAliveInterval) {
|
||||||
this.keepAliveInterval = keepAliveInterval;
|
this.keepAliveInterval = keepAliveInterval;
|
||||||
if (keepAliveInterval > 0 && getState() == State.NEW) {
|
|
||||||
start();
|
|
||||||
}
|
|
||||||
notify();
|
|
||||||
}
|
|
||||||
|
|
||||||
synchronized protected int getPositiveInterval()
|
|
||||||
throws InterruptedException {
|
|
||||||
while (keepAliveInterval <= 0) {
|
|
||||||
wait();
|
|
||||||
}
|
|
||||||
return keepAliveInterval;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void run() {
|
public void run() {
|
||||||
log.debug("Starting {}, sending keep-alive every {} seconds", getClass().getSimpleName(), keepAliveInterval);
|
log.debug("{} Started with interval [{} seconds]", getClass().getSimpleName(), keepAliveInterval);
|
||||||
try {
|
try {
|
||||||
while (!isInterrupted()) {
|
while (!isInterrupted()) {
|
||||||
final int hi = getPositiveInterval();
|
final int interval = getKeepAliveInterval();
|
||||||
if (conn.getTransport().isRunning()) {
|
if (conn.getTransport().isRunning()) {
|
||||||
log.debug("Sending keep-alive since {} seconds elapsed", hi);
|
log.debug("{} Sending after interval [{} seconds]", getClass().getSimpleName(), interval);
|
||||||
doKeepAlive();
|
doKeepAlive();
|
||||||
}
|
}
|
||||||
Thread.sleep(hi * 1000);
|
TimeUnit.SECONDS.sleep(interval);
|
||||||
}
|
}
|
||||||
} catch (InterruptedException e) {
|
} catch (InterruptedException e) {
|
||||||
// Interrupt signal may be catched when sleeping.
|
// this is almost certainly a planned interruption, but even so, no harm in setting the interrupt flag
|
||||||
|
Thread.currentThread().interrupt();
|
||||||
|
log.trace("{} Interrupted while sleeping", getClass().getSimpleName());
|
||||||
} catch (Exception e) {
|
} catch (Exception e) {
|
||||||
// If we weren't interrupted, kill the transport, then this exception was unexpected.
|
// If we weren't interrupted, kill the transport, then this exception was unexpected.
|
||||||
// Else we're in shutdown-mode already, so don't forcibly kill the transport.
|
// Else we're in shutdown-mode already, so don't forcibly kill the transport.
|
||||||
@@ -74,9 +85,7 @@ public abstract class KeepAlive extends Thread {
|
|||||||
conn.getTransport().die(e);
|
conn.getTransport().die(e);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
log.debug("{} Stopped", getClass().getSimpleName());
|
||||||
log.debug("Stopping {}", getClass().getSimpleName());
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
protected abstract void doKeepAlive() throws TransportException, ConnectionException;
|
protected abstract void doKeepAlive() throws TransportException, ConnectionException;
|
||||||
|
|||||||
@@ -37,7 +37,7 @@ public class KeepAliveRunner extends KeepAlive {
|
|||||||
new LinkedList<Promise<SSHPacket, ConnectionException>>();
|
new LinkedList<Promise<SSHPacket, ConnectionException>>();
|
||||||
|
|
||||||
KeepAliveRunner(ConnectionImpl conn) {
|
KeepAliveRunner(ConnectionImpl conn) {
|
||||||
super(conn, "keep-alive");
|
super(conn, "sshj-KeepAliveRunner");
|
||||||
}
|
}
|
||||||
|
|
||||||
synchronized public int getMaxAliveCount() {
|
synchronized public int getMaxAliveCount() {
|
||||||
|
|||||||
@@ -19,8 +19,6 @@ import com.hierynomus.sshj.key.KeyAlgorithm;
|
|||||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||||
import net.schmizz.sshj.common.Factory;
|
import net.schmizz.sshj.common.Factory;
|
||||||
import net.schmizz.sshj.common.SecurityUtils;
|
import net.schmizz.sshj.common.SecurityUtils;
|
||||||
import net.schmizz.sshj.transport.random.JCERandom;
|
|
||||||
import net.schmizz.sshj.transport.random.SingletonRandomFactory;
|
|
||||||
|
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
|
|
||||||
@@ -34,7 +32,6 @@ public class AndroidConfig
|
|||||||
SecurityUtils.registerSecurityProvider("org.spongycastle.jce.provider.BouncyCastleProvider");
|
SecurityUtils.registerSecurityProvider("org.spongycastle.jce.provider.BouncyCastleProvider");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected void initKeyAlgorithms() {
|
protected void initKeyAlgorithms() {
|
||||||
setKeyAlgorithms(Arrays.<Factory.Named<KeyAlgorithm>>asList(
|
setKeyAlgorithms(Arrays.<Factory.Named<KeyAlgorithm>>asList(
|
||||||
@@ -43,10 +40,4 @@ public class AndroidConfig
|
|||||||
KeyAlgorithms.SSHDSA()
|
KeyAlgorithms.SSHDSA()
|
||||||
));
|
));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
|
||||||
protected void initRandomFactory(boolean ignored) {
|
|
||||||
setRandomFactory(new SingletonRandomFactory(new JCERandom.Factory()));
|
|
||||||
}
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -200,4 +200,8 @@ public interface Config {
|
|||||||
* See {@link #isVerifyHostKeyCertificates()}.
|
* See {@link #isVerifyHostKeyCertificates()}.
|
||||||
*/
|
*/
|
||||||
void setVerifyHostKeyCertificates(boolean value);
|
void setVerifyHostKeyCertificates(boolean value);
|
||||||
|
|
||||||
|
int getMaxCircularBufferSize();
|
||||||
|
|
||||||
|
void setMaxCircularBufferSize(int maxCircularBufferSize);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -26,6 +26,7 @@ import net.schmizz.sshj.transport.mac.MAC;
|
|||||||
import net.schmizz.sshj.transport.random.Random;
|
import net.schmizz.sshj.transport.random.Random;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
import net.schmizz.sshj.userauth.keyprovider.FileKeyProvider;
|
||||||
|
|
||||||
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -48,6 +49,8 @@ public class ConfigImpl
|
|||||||
private boolean waitForServerIdentBeforeSendingClientIdent = false;
|
private boolean waitForServerIdentBeforeSendingClientIdent = false;
|
||||||
private LoggerFactory loggerFactory;
|
private LoggerFactory loggerFactory;
|
||||||
private boolean verifyHostKeyCertificates = true;
|
private boolean verifyHostKeyCertificates = true;
|
||||||
|
// HF-982: default to 16MB buffers.
|
||||||
|
private int maxCircularBufferSize = 16 * 1024 * 1024;
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public List<Factory.Named<Cipher>> getCipherFactories() {
|
public List<Factory.Named<Cipher>> getCipherFactories() {
|
||||||
@@ -174,6 +177,16 @@ public class ConfigImpl
|
|||||||
return loggerFactory;
|
return loggerFactory;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int getMaxCircularBufferSize() {
|
||||||
|
return maxCircularBufferSize;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void setMaxCircularBufferSize(int maxCircularBufferSize) {
|
||||||
|
this.maxCircularBufferSize = maxCircularBufferSize;
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void setLoggerFactory(LoggerFactory loggerFactory) {
|
public void setLoggerFactory(LoggerFactory loggerFactory) {
|
||||||
this.loggerFactory = loggerFactory;
|
this.loggerFactory = loggerFactory;
|
||||||
@@ -188,4 +201,30 @@ public class ConfigImpl
|
|||||||
public void setVerifyHostKeyCertificates(boolean value) {
|
public void setVerifyHostKeyCertificates(boolean value) {
|
||||||
verifyHostKeyCertificates = value;
|
verifyHostKeyCertificates = value;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Modern servers neglect the key algorithm ssh-rsa. OpenSSH 8.8 even dropped its support by default in favour
|
||||||
|
* of rsa-sha2-*. However, there are legacy servers like Apache SSHD that don't support the newer replacements
|
||||||
|
* for ssh-rsa.
|
||||||
|
*
|
||||||
|
* If ssh-rsa factory is in {@link #getKeyAlgorithms()}, this methods makes ssh-rsa key algorithm more preferred
|
||||||
|
* than any of rsa-sha2-*. Otherwise, nothing happens.
|
||||||
|
*/
|
||||||
|
public void prioritizeSshRsaKeyAlgorithm() {
|
||||||
|
List<Factory.Named<KeyAlgorithm>> keyAlgorithms = getKeyAlgorithms();
|
||||||
|
for (int sshRsaIndex = 0; sshRsaIndex < keyAlgorithms.size(); ++ sshRsaIndex) {
|
||||||
|
if ("ssh-rsa".equals(keyAlgorithms.get(sshRsaIndex).getName())) {
|
||||||
|
for (int i = 0; i < sshRsaIndex; ++i) {
|
||||||
|
final String algo = keyAlgorithms.get(i).getName();
|
||||||
|
if ("rsa-sha2-256".equals(algo) || "rsa-sha2-512".equals(algo)) {
|
||||||
|
keyAlgorithms = new ArrayList<>(keyAlgorithms);
|
||||||
|
keyAlgorithms.add(i, keyAlgorithms.remove(sshRsaIndex));
|
||||||
|
setKeyAlgorithms(keyAlgorithms);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -29,23 +29,24 @@ import com.hierynomus.sshj.userauth.keyprovider.OpenSSHKeyV1KeyFile;
|
|||||||
import net.schmizz.keepalive.KeepAliveProvider;
|
import net.schmizz.keepalive.KeepAliveProvider;
|
||||||
import net.schmizz.sshj.common.Factory;
|
import net.schmizz.sshj.common.Factory;
|
||||||
import net.schmizz.sshj.common.LoggerFactory;
|
import net.schmizz.sshj.common.LoggerFactory;
|
||||||
import net.schmizz.sshj.common.SecurityUtils;
|
|
||||||
import net.schmizz.sshj.transport.cipher.Cipher;
|
import net.schmizz.sshj.transport.cipher.Cipher;
|
||||||
import net.schmizz.sshj.transport.compression.NoneCompression;
|
import net.schmizz.sshj.transport.compression.NoneCompression;
|
||||||
import net.schmizz.sshj.transport.kex.Curve25519SHA256;
|
import net.schmizz.sshj.transport.kex.Curve25519SHA256;
|
||||||
import net.schmizz.sshj.transport.kex.DHGexSHA1;
|
import net.schmizz.sshj.transport.kex.DHGexSHA1;
|
||||||
import net.schmizz.sshj.transport.kex.DHGexSHA256;
|
import net.schmizz.sshj.transport.kex.DHGexSHA256;
|
||||||
import net.schmizz.sshj.transport.kex.ECDHNistP;
|
import net.schmizz.sshj.transport.kex.ECDHNistP;
|
||||||
import net.schmizz.sshj.transport.random.BouncyCastleRandom;
|
|
||||||
import net.schmizz.sshj.transport.random.JCERandom;
|
import net.schmizz.sshj.transport.random.JCERandom;
|
||||||
import net.schmizz.sshj.transport.random.SingletonRandomFactory;
|
import net.schmizz.sshj.transport.random.SingletonRandomFactory;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.OpenSSHKeyFile;
|
import net.schmizz.sshj.userauth.keyprovider.OpenSSHKeyFile;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.PKCS5KeyFile;
|
|
||||||
import net.schmizz.sshj.userauth.keyprovider.PKCS8KeyFile;
|
import net.schmizz.sshj.userauth.keyprovider.PKCS8KeyFile;
|
||||||
import net.schmizz.sshj.userauth.keyprovider.PuTTYKeyFile;
|
import net.schmizz.sshj.userauth.keyprovider.PuTTYKeyFile;
|
||||||
import org.slf4j.Logger;
|
import org.slf4j.Logger;
|
||||||
|
|
||||||
import java.util.*;
|
import java.util.Arrays;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.LinkedList;
|
||||||
|
import java.util.ListIterator;
|
||||||
|
import java.util.Properties;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A {@link net.schmizz.sshj.Config} that is initialized as follows. Items marked with an asterisk are added to the config only if
|
* A {@link net.schmizz.sshj.Config} that is initialized as follows. Items marked with an asterisk are added to the config only if
|
||||||
@@ -64,8 +65,6 @@ import java.util.*;
|
|||||||
* <li>{@link net.schmizz.sshj.ConfigImpl#setVersion Client version}: {@code "NET_3_0"}</li>
|
* <li>{@link net.schmizz.sshj.ConfigImpl#setVersion Client version}: {@code "NET_3_0"}</li>
|
||||||
* </ul>
|
* </ul>
|
||||||
* <p/>
|
* <p/>
|
||||||
* [1] It is worth noting that Sun's JRE does not have the unlimited cryptography extension enabled by default. This
|
|
||||||
* prevents using ciphers with strength greater than 128.
|
|
||||||
*/
|
*/
|
||||||
public class DefaultConfig
|
public class DefaultConfig
|
||||||
extends ConfigImpl {
|
extends ConfigImpl {
|
||||||
@@ -75,11 +74,10 @@ public class DefaultConfig
|
|||||||
public DefaultConfig() {
|
public DefaultConfig() {
|
||||||
setLoggerFactory(LoggerFactory.DEFAULT);
|
setLoggerFactory(LoggerFactory.DEFAULT);
|
||||||
setVersion(readVersionFromProperties());
|
setVersion(readVersionFromProperties());
|
||||||
final boolean bouncyCastleRegistered = SecurityUtils.isBouncyCastleRegistered();
|
initKeyExchangeFactories();
|
||||||
initKeyExchangeFactories(bouncyCastleRegistered);
|
|
||||||
initKeyAlgorithms();
|
initKeyAlgorithms();
|
||||||
initRandomFactory(bouncyCastleRegistered);
|
initRandomFactory();
|
||||||
initFileKeyProviderFactories(bouncyCastleRegistered);
|
initFileKeyProviderFactories();
|
||||||
initCipherFactories();
|
initCipherFactories();
|
||||||
initCompressionFactories();
|
initCompressionFactories();
|
||||||
initMACFactories();
|
initMACFactories();
|
||||||
@@ -104,35 +102,32 @@ public class DefaultConfig
|
|||||||
log = loggerFactory.getLogger(getClass());
|
log = loggerFactory.getLogger(getClass());
|
||||||
}
|
}
|
||||||
|
|
||||||
protected void initKeyExchangeFactories(boolean bouncyCastleRegistered) {
|
protected void initKeyExchangeFactories() {
|
||||||
if (bouncyCastleRegistered) {
|
setKeyExchangeFactories(
|
||||||
setKeyExchangeFactories(
|
new Curve25519SHA256.Factory(),
|
||||||
new Curve25519SHA256.Factory(),
|
new Curve25519SHA256.FactoryLibSsh(),
|
||||||
new Curve25519SHA256.FactoryLibSsh(),
|
new DHGexSHA256.Factory(),
|
||||||
new DHGexSHA256.Factory(),
|
new ECDHNistP.Factory521(),
|
||||||
new ECDHNistP.Factory521(),
|
new ECDHNistP.Factory384(),
|
||||||
new ECDHNistP.Factory384(),
|
new ECDHNistP.Factory256(),
|
||||||
new ECDHNistP.Factory256(),
|
new DHGexSHA1.Factory(),
|
||||||
new DHGexSHA1.Factory(),
|
DHGroups.Group1SHA1(),
|
||||||
DHGroups.Group1SHA1(),
|
DHGroups.Group14SHA1(),
|
||||||
DHGroups.Group14SHA1(),
|
DHGroups.Group14SHA256(),
|
||||||
DHGroups.Group14SHA256(),
|
DHGroups.Group15SHA512(),
|
||||||
DHGroups.Group15SHA512(),
|
DHGroups.Group16SHA512(),
|
||||||
DHGroups.Group16SHA512(),
|
DHGroups.Group17SHA512(),
|
||||||
DHGroups.Group17SHA512(),
|
DHGroups.Group18SHA512(),
|
||||||
DHGroups.Group18SHA512(),
|
ExtendedDHGroups.Group14SHA256AtSSH(),
|
||||||
ExtendedDHGroups.Group14SHA256AtSSH(),
|
ExtendedDHGroups.Group15SHA256(),
|
||||||
ExtendedDHGroups.Group15SHA256(),
|
ExtendedDHGroups.Group15SHA256AtSSH(),
|
||||||
ExtendedDHGroups.Group15SHA256AtSSH(),
|
ExtendedDHGroups.Group15SHA384AtSSH(),
|
||||||
ExtendedDHGroups.Group15SHA384AtSSH(),
|
ExtendedDHGroups.Group16SHA256(),
|
||||||
ExtendedDHGroups.Group16SHA256(),
|
ExtendedDHGroups.Group16SHA384AtSSH(),
|
||||||
ExtendedDHGroups.Group16SHA384AtSSH(),
|
ExtendedDHGroups.Group16SHA512AtSSH(),
|
||||||
ExtendedDHGroups.Group16SHA512AtSSH(),
|
ExtendedDHGroups.Group18SHA512AtSSH(),
|
||||||
ExtendedDHGroups.Group18SHA512AtSSH(),
|
new ExtInfoClientFactory()
|
||||||
new ExtInfoClientFactory());
|
);
|
||||||
} else {
|
|
||||||
setKeyExchangeFactories(DHGroups.Group1SHA1(), new DHGexSHA1.Factory());
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
protected void initKeyAlgorithms() {
|
protected void initKeyAlgorithms() {
|
||||||
@@ -153,22 +148,19 @@ public class DefaultConfig
|
|||||||
KeyAlgorithms.SSHDSA()));
|
KeyAlgorithms.SSHDSA()));
|
||||||
}
|
}
|
||||||
|
|
||||||
protected void initRandomFactory(boolean bouncyCastleRegistered) {
|
protected void initRandomFactory() {
|
||||||
setRandomFactory(new SingletonRandomFactory(new JCERandom.Factory()));
|
setRandomFactory(new SingletonRandomFactory(new JCERandom.Factory()));
|
||||||
}
|
}
|
||||||
|
|
||||||
protected void initFileKeyProviderFactories(boolean bouncyCastleRegistered) {
|
protected void initFileKeyProviderFactories() {
|
||||||
if (bouncyCastleRegistered) {
|
setFileKeyProviderFactories(
|
||||||
setFileKeyProviderFactories(
|
new OpenSSHKeyV1KeyFile.Factory(),
|
||||||
new OpenSSHKeyV1KeyFile.Factory(),
|
new PKCS8KeyFile.Factory(),
|
||||||
new PKCS8KeyFile.Factory(),
|
new OpenSSHKeyFile.Factory(),
|
||||||
new PKCS5KeyFile.Factory(),
|
new PuTTYKeyFile.Factory()
|
||||||
new OpenSSHKeyFile.Factory(),
|
);
|
||||||
new PuTTYKeyFile.Factory());
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
protected void initCipherFactories() {
|
protected void initCipherFactories() {
|
||||||
List<Factory.Named<Cipher>> avail = new LinkedList<Factory.Named<Cipher>>(Arrays.<Factory.Named<Cipher>>asList(
|
List<Factory.Named<Cipher>> avail = new LinkedList<Factory.Named<Cipher>>(Arrays.<Factory.Named<Cipher>>asList(
|
||||||
ChachaPolyCiphers.CHACHA_POLY_OPENSSH(),
|
ChachaPolyCiphers.CHACHA_POLY_OPENSSH(),
|
||||||
@@ -206,27 +198,22 @@ public class DefaultConfig
|
|||||||
StreamCiphers.Arcfour256())
|
StreamCiphers.Arcfour256())
|
||||||
);
|
);
|
||||||
|
|
||||||
boolean warn = false;
|
final ListIterator<Factory.Named<Cipher>> factories = avail.listIterator();
|
||||||
// Ref. https://issues.apache.org/jira/browse/SSHD-24
|
while (factories.hasNext()) {
|
||||||
// "AES256 and AES192 requires unlimited cryptography extension"
|
final Factory.Named<Cipher> factory = factories.next();
|
||||||
for (Iterator<Factory.Named<Cipher>> i = avail.iterator(); i.hasNext(); ) {
|
|
||||||
final Factory.Named<Cipher> f = i.next();
|
|
||||||
try {
|
try {
|
||||||
final Cipher c = f.create();
|
final Cipher cipher = factory.create();
|
||||||
final byte[] key = new byte[c.getBlockSize()];
|
final byte[] key = new byte[cipher.getBlockSize()];
|
||||||
final byte[] iv = new byte[c.getIVSize()];
|
final byte[] iv = new byte[cipher.getIVSize()];
|
||||||
c.init(Cipher.Mode.Encrypt, key, iv);
|
cipher.init(Cipher.Mode.Encrypt, key, iv);
|
||||||
} catch (Exception e) {
|
} catch (Exception e) {
|
||||||
warn = true;
|
log.info("Cipher [{}] disabled: {}", factory.getName(), e.getCause().getMessage());
|
||||||
log.warn(e.getCause().getMessage());
|
factories.remove();
|
||||||
i.remove();
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (warn)
|
|
||||||
log.warn("Disabling high-strength ciphers: cipher strengths apparently limited by JCE policy");
|
|
||||||
|
|
||||||
setCipherFactories(avail);
|
setCipherFactories(avail);
|
||||||
log.debug("Available cipher factories: {}", avail);
|
log.debug("Available Ciphers {}", avail);
|
||||||
}
|
}
|
||||||
|
|
||||||
protected void initMACFactories() {
|
protected void initMACFactories() {
|
||||||
|
|||||||
@@ -0,0 +1,28 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package net.schmizz.sshj;
|
||||||
|
|
||||||
|
import net.schmizz.sshj.common.SecurityUtils;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SSHJ Configuration that uses the default Security Provider configuration from java.security and disables Bouncy Castle registration
|
||||||
|
*/
|
||||||
|
public class DefaultSecurityProviderConfig extends DefaultConfig {
|
||||||
|
static {
|
||||||
|
// Disable Bouncy Castle Provider registration prior to invoking constructors
|
||||||
|
SecurityUtils.setRegisterBouncyCastle(false);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -15,6 +15,8 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj;
|
package net.schmizz.sshj;
|
||||||
|
|
||||||
|
import net.schmizz.keepalive.KeepAlive;
|
||||||
|
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||||
import net.schmizz.sshj.common.*;
|
import net.schmizz.sshj.common.*;
|
||||||
import net.schmizz.sshj.connection.Connection;
|
import net.schmizz.sshj.connection.Connection;
|
||||||
import net.schmizz.sshj.connection.ConnectionException;
|
import net.schmizz.sshj.connection.ConnectionException;
|
||||||
@@ -26,7 +28,6 @@ import net.schmizz.sshj.connection.channel.forwarded.RemotePortForwarder.Forward
|
|||||||
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder;
|
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder;
|
||||||
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder.X11Channel;
|
import net.schmizz.sshj.connection.channel.forwarded.X11Forwarder.X11Channel;
|
||||||
import net.schmizz.sshj.sftp.SFTPClient;
|
import net.schmizz.sshj.sftp.SFTPClient;
|
||||||
import net.schmizz.sshj.sftp.SFTPEngine;
|
|
||||||
import net.schmizz.sshj.sftp.StatefulSFTPClient;
|
import net.schmizz.sshj.sftp.StatefulSFTPClient;
|
||||||
import net.schmizz.sshj.transport.Transport;
|
import net.schmizz.sshj.transport.Transport;
|
||||||
import net.schmizz.sshj.transport.TransportException;
|
import net.schmizz.sshj.transport.TransportException;
|
||||||
@@ -55,6 +56,7 @@ import javax.security.auth.login.LoginContext;
|
|||||||
import java.io.Closeable;
|
import java.io.Closeable;
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.InetSocketAddress;
|
||||||
import java.net.ServerSocket;
|
import java.net.ServerSocket;
|
||||||
import java.nio.charset.Charset;
|
import java.nio.charset.Charset;
|
||||||
import java.security.KeyPair;
|
import java.security.KeyPair;
|
||||||
@@ -424,6 +426,7 @@ public class SSHClient
|
|||||||
@Override
|
@Override
|
||||||
public void disconnect()
|
public void disconnect()
|
||||||
throws IOException {
|
throws IOException {
|
||||||
|
conn.getKeepAlive().interrupt();
|
||||||
for (LocalPortForwarder forwarder : forwarders) {
|
for (LocalPortForwarder forwarder : forwarders) {
|
||||||
try {
|
try {
|
||||||
forwarder.close();
|
forwarder.close();
|
||||||
@@ -441,6 +444,16 @@ public class SSHClient
|
|||||||
return conn;
|
return conn;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get Remote Socket Address from Transport
|
||||||
|
*
|
||||||
|
* @return Remote Socket Address or null when not connected
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public InetSocketAddress getRemoteSocketAddress() {
|
||||||
|
return trans.getRemoteSocketAddress();
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the character set used to communicate with the remote machine for certain strings (like paths).
|
* Returns the character set used to communicate with the remote machine for certain strings (like paths).
|
||||||
*
|
*
|
||||||
@@ -537,7 +550,7 @@ public class SSHClient
|
|||||||
* Creates a {@link KeyProvider} instance from given location on the file system. Currently the following private key files are supported:
|
* Creates a {@link KeyProvider} instance from given location on the file system. Currently the following private key files are supported:
|
||||||
* <ul>
|
* <ul>
|
||||||
* <li>PKCS8 (OpenSSH uses this format)</li>
|
* <li>PKCS8 (OpenSSH uses this format)</li>
|
||||||
* <li>PKCS5</li>
|
* <li>PEM-encoded PKCS1</li>
|
||||||
* <li>Putty keyfile</li>
|
* <li>Putty keyfile</li>
|
||||||
* <li>openssh-key-v1 (New OpenSSH keyfile format)</li>
|
* <li>openssh-key-v1 (New OpenSSH keyfile format)</li>
|
||||||
* </ul>
|
* </ul>
|
||||||
@@ -719,7 +732,7 @@ public class SSHClient
|
|||||||
throws IOException {
|
throws IOException {
|
||||||
checkConnected();
|
checkConnected();
|
||||||
checkAuthenticated();
|
checkAuthenticated();
|
||||||
return new SFTPClient(new SFTPEngine(this).init());
|
return new SFTPClient(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -728,11 +741,11 @@ public class SSHClient
|
|||||||
*
|
*
|
||||||
* @throws IOException if there is an error starting the {@code sftp} subsystem
|
* @throws IOException if there is an error starting the {@code sftp} subsystem
|
||||||
*/
|
*/
|
||||||
public SFTPClient newStatefulSFTPClient()
|
public StatefulSFTPClient newStatefulSFTPClient()
|
||||||
throws IOException {
|
throws IOException {
|
||||||
checkConnected();
|
checkConnected();
|
||||||
checkAuthenticated();
|
checkAuthenticated();
|
||||||
return new StatefulSFTPClient(new SFTPEngine(this).init());
|
return new StatefulSFTPClient(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -792,6 +805,11 @@ public class SSHClient
|
|||||||
super.onConnect();
|
super.onConnect();
|
||||||
trans.init(getRemoteHostname(), getRemotePort(), getInputStream(), getOutputStream());
|
trans.init(getRemoteHostname(), getRemotePort(), getInputStream(), getOutputStream());
|
||||||
doKex();
|
doKex();
|
||||||
|
final KeepAlive keepAliveThread = conn.getKeepAlive();
|
||||||
|
if (keepAliveThread.isEnabled()) {
|
||||||
|
ThreadNameProvider.setThreadName(conn.getKeepAlive(), trans);
|
||||||
|
keepAliveThread.start();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -15,8 +15,6 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj;
|
package net.schmizz.sshj;
|
||||||
|
|
||||||
import com.hierynomus.sshj.backport.JavaVersion;
|
|
||||||
import com.hierynomus.sshj.backport.Jdk7HttpProxySocket;
|
|
||||||
import net.schmizz.sshj.connection.channel.Channel;
|
import net.schmizz.sshj.connection.channel.Channel;
|
||||||
import net.schmizz.sshj.connection.channel.direct.DirectConnection;
|
import net.schmizz.sshj.connection.channel.direct.DirectConnection;
|
||||||
|
|
||||||
@@ -26,7 +24,6 @@ import java.io.InputStream;
|
|||||||
import java.io.OutputStream;
|
import java.io.OutputStream;
|
||||||
import java.net.InetAddress;
|
import java.net.InetAddress;
|
||||||
import java.net.InetSocketAddress;
|
import java.net.InetSocketAddress;
|
||||||
import java.net.Proxy;
|
|
||||||
import java.net.Socket;
|
import java.net.Socket;
|
||||||
|
|
||||||
public abstract class SocketClient {
|
public abstract class SocketClient {
|
||||||
@@ -57,73 +54,6 @@ public abstract class SocketClient {
|
|||||||
return new InetSocketAddress(hostname, port);
|
return new InetSocketAddress(hostname, port);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Connect to a host via a proxy.
|
|
||||||
* @param hostname The host name to connect to.
|
|
||||||
* @param proxy The proxy to connect via.
|
|
||||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
|
||||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public void connect(String hostname, Proxy proxy) throws IOException {
|
|
||||||
connect(hostname, defaultPort, proxy);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Connect to a host via a proxy.
|
|
||||||
* @param hostname The host name to connect to.
|
|
||||||
* @param port The port to connect to.
|
|
||||||
* @param proxy The proxy to connect via.
|
|
||||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
|
||||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public void connect(String hostname, int port, Proxy proxy) throws IOException {
|
|
||||||
this.hostname = hostname;
|
|
||||||
this.port = port;
|
|
||||||
if (JavaVersion.isJava7OrEarlier() && proxy.type() == Proxy.Type.HTTP) {
|
|
||||||
// Java7 and earlier have no support for HTTP Connect proxies, return our custom socket.
|
|
||||||
socket = new Jdk7HttpProxySocket(proxy);
|
|
||||||
} else {
|
|
||||||
socket = new Socket(proxy);
|
|
||||||
}
|
|
||||||
socket.connect(makeInetSocketAddress(hostname, port), connectTimeout);
|
|
||||||
onConnect();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Connect to a host via a proxy.
|
|
||||||
* @param host The host address to connect to.
|
|
||||||
* @param proxy The proxy to connect via.
|
|
||||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
|
||||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public void connect(InetAddress host, Proxy proxy) throws IOException {
|
|
||||||
connect(host, defaultPort, proxy);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Connect to a host via a proxy.
|
|
||||||
* @param host The host address to connect to.
|
|
||||||
* @param port The port to connect to.
|
|
||||||
* @param proxy The proxy to connect via.
|
|
||||||
* @deprecated This method will be removed after v0.12.0. If you want to connect via a proxy, you can do this by injecting a {@link javax.net.SocketFactory}
|
|
||||||
* into the SocketClient. The SocketFactory should create sockets using the {@link java.net.Socket#Socket(java.net.Proxy)} constructor.
|
|
||||||
*/
|
|
||||||
@Deprecated
|
|
||||||
public void connect(InetAddress host, int port, Proxy proxy) throws IOException {
|
|
||||||
this.port = port;
|
|
||||||
if (JavaVersion.isJava7OrEarlier() && proxy.type() == Proxy.Type.HTTP) {
|
|
||||||
// Java7 and earlier have no support for HTTP Connect proxies, return our custom socket.
|
|
||||||
socket = new Jdk7HttpProxySocket(proxy);
|
|
||||||
} else {
|
|
||||||
socket = new Socket(proxy);
|
|
||||||
}
|
|
||||||
socket.connect(new InetSocketAddress(host, port), connectTimeout);
|
|
||||||
onConnect();
|
|
||||||
}
|
|
||||||
|
|
||||||
public void connect(String hostname) throws IOException {
|
public void connect(String hostname) throws IOException {
|
||||||
connect(hostname, defaultPort);
|
connect(hostname, defaultPort);
|
||||||
}
|
}
|
||||||
@@ -135,7 +65,9 @@ public abstract class SocketClient {
|
|||||||
this.hostname = hostname;
|
this.hostname = hostname;
|
||||||
this.port = port;
|
this.port = port;
|
||||||
socket = socketFactory.createSocket();
|
socket = socketFactory.createSocket();
|
||||||
socket.connect(makeInetSocketAddress(hostname, port), connectTimeout);
|
if (! socket.isConnected()) {
|
||||||
|
socket.connect(makeInetSocketAddress(hostname, port), connectTimeout);
|
||||||
|
}
|
||||||
onConnect();
|
onConnect();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -174,7 +106,9 @@ public abstract class SocketClient {
|
|||||||
public void connect(InetAddress host, int port) throws IOException {
|
public void connect(InetAddress host, int port) throws IOException {
|
||||||
this.port = port;
|
this.port = port;
|
||||||
socket = socketFactory.createSocket();
|
socket = socketFactory.createSocket();
|
||||||
socket.connect(new InetSocketAddress(host, port), connectTimeout);
|
if (! socket.isConnected()) {
|
||||||
|
socket.connect(new InetSocketAddress(host, port), connectTimeout);
|
||||||
|
}
|
||||||
onConnect();
|
onConnect();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
47
src/main/java/net/schmizz/sshj/common/Base64Decoder.java
Normal file
47
src/main/java/net/schmizz/sshj/common/Base64Decoder.java
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package net.schmizz.sshj.common;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Base64;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* <p>Wraps {@link java.util.Base64.Decoder} in order to wrap unchecked {@code IllegalArgumentException} thrown by
|
||||||
|
* the default Java Base64 decoder here and there.</p>
|
||||||
|
*
|
||||||
|
* <p>Please use this class instead of {@link java.util.Base64.Decoder}.</p>
|
||||||
|
*/
|
||||||
|
public class Base64Decoder {
|
||||||
|
private Base64Decoder() {
|
||||||
|
}
|
||||||
|
|
||||||
|
public static byte[] decode(byte[] source) throws Base64DecodingException {
|
||||||
|
try {
|
||||||
|
return Base64.getDecoder().decode(source);
|
||||||
|
} catch (IllegalArgumentException err) {
|
||||||
|
throw new Base64DecodingException(err);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static byte[] decode(String src) throws Base64DecodingException {
|
||||||
|
try {
|
||||||
|
return Base64.getDecoder().decode(src);
|
||||||
|
} catch (IllegalArgumentException err) {
|
||||||
|
throw new Base64DecodingException(err);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,28 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package net.schmizz.sshj.common;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A checked wrapper for all {@link IllegalArgumentException}, thrown by {@link java.util.Base64.Decoder}.
|
||||||
|
*
|
||||||
|
* @see Base64Decoder
|
||||||
|
*/
|
||||||
|
public class Base64DecodingException extends Exception {
|
||||||
|
public Base64DecodingException(IllegalArgumentException cause) {
|
||||||
|
super("Failed to decode base64: " + cause.getMessage(), cause);
|
||||||
|
}
|
||||||
|
}
|
||||||
194
src/main/java/net/schmizz/sshj/common/CircularBuffer.java
Normal file
194
src/main/java/net/schmizz/sshj/common/CircularBuffer.java
Normal file
@@ -0,0 +1,194 @@
|
|||||||
|
/*
|
||||||
|
* Copyright (C)2009 - SSHJ Contributors
|
||||||
|
*
|
||||||
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
* you may not use this file except in compliance with the License.
|
||||||
|
* You may obtain a copy of the License at
|
||||||
|
*
|
||||||
|
* http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
*
|
||||||
|
* Unless required by applicable law or agreed to in writing, software
|
||||||
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
* See the License for the specific language governing permissions and
|
||||||
|
* limitations under the License.
|
||||||
|
*/
|
||||||
|
package net.schmizz.sshj.common;
|
||||||
|
|
||||||
|
public class CircularBuffer<T extends CircularBuffer<T>> {
|
||||||
|
|
||||||
|
public static class CircularBufferException
|
||||||
|
extends SSHException {
|
||||||
|
|
||||||
|
public CircularBufferException(String message) {
|
||||||
|
super(message);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static final class PlainCircularBuffer
|
||||||
|
extends CircularBuffer<PlainCircularBuffer> {
|
||||||
|
|
||||||
|
public PlainCircularBuffer(int size, int maxSize) {
|
||||||
|
super(size, maxSize);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Maximum size of the internal array (one plus the maximum capacity of the buffer).
|
||||||
|
*/
|
||||||
|
private final int maxSize;
|
||||||
|
/**
|
||||||
|
* Internal array for the data. All bytes minus one can be used to avoid empty vs full ambiguity when rpos == wpos.
|
||||||
|
*/
|
||||||
|
private byte[] data;
|
||||||
|
/**
|
||||||
|
* Next read position. Wraps around the end of the internal array. When it reaches wpos, the buffer becomes empty.
|
||||||
|
* Can take the value data.length, which is equivalent to 0.
|
||||||
|
*/
|
||||||
|
private int rpos;
|
||||||
|
/**
|
||||||
|
* Next write position. Wraps around the end of the internal array. If it is equal to rpos, then the buffer is
|
||||||
|
* empty; the code does not allow wpos to reach rpos from the left. This implies that the buffer can store up to
|
||||||
|
* data.length - 1 bytes. Can take the value data.length, which is equivalent to 0.
|
||||||
|
*/
|
||||||
|
private int wpos;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Determines the size to which to grow the internal array.
|
||||||
|
*/
|
||||||
|
private int getNextSize(int currentSize) {
|
||||||
|
// Use next power of 2.
|
||||||
|
int nextSize = 1;
|
||||||
|
while (nextSize < currentSize) {
|
||||||
|
nextSize <<= 1;
|
||||||
|
if (nextSize <= 0) {
|
||||||
|
return maxSize;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return Math.min(nextSize, maxSize); // limit to max size
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new circular buffer of the given size. The capacity of the buffer is one less than the size/
|
||||||
|
*/
|
||||||
|
public CircularBuffer(int size, int maxSize) {
|
||||||
|
this.maxSize = maxSize;
|
||||||
|
if (size > maxSize) {
|
||||||
|
throw new IllegalArgumentException(
|
||||||
|
String.format("Initial requested size %d larger than maximum size %d", size, maxSize));
|
||||||
|
}
|
||||||
|
int initialSize = getNextSize(size);
|
||||||
|
this.data = new byte[initialSize];
|
||||||
|
this.rpos = 0;
|
||||||
|
this.wpos = 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Data available in the buffer for reading.
|
||||||
|
*/
|
||||||
|
public int available() {
|
||||||
|
int available = wpos - rpos;
|
||||||
|
return available >= 0 ? available : available + data.length; // adjust if wpos is left of rpos
|
||||||
|
}
|
||||||
|
|
||||||
|
private void ensureAvailable(int a)
|
||||||
|
throws CircularBufferException {
|
||||||
|
if (available() < a) {
|
||||||
|
throw new CircularBufferException("Underflow");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns how many more bytes this buffer can receive.
|
||||||
|
*/
|
||||||
|
public int maxPossibleRemainingCapacity() {
|
||||||
|
// Remaining capacity is one less than remaining space to ensure that wpos does not reach rpos from the left.
|
||||||
|
int remaining = rpos - wpos - 1;
|
||||||
|
if (remaining < 0) {
|
||||||
|
remaining += data.length; // adjust if rpos is left of wpos
|
||||||
|
}
|
||||||
|
// Add the maximum amount the internal array can grow.
|
||||||
|
return remaining + maxSize - data.length;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If the internal array does not have room for "capacity" more bytes, resizes the array to make that room.
|
||||||
|
*/
|
||||||
|
void ensureCapacity(int capacity) throws CircularBufferException {
|
||||||
|
int available = available();
|
||||||
|
int remaining = data.length - available;
|
||||||
|
// If capacity fits exactly in the remaining space, expand it; otherwise, wpos would reach rpos from the left.
|
||||||
|
if (remaining <= capacity) {
|
||||||
|
int neededSize = available + capacity + 1;
|
||||||
|
int nextSize = getNextSize(neededSize);
|
||||||
|
if (nextSize < neededSize) {
|
||||||
|
throw new CircularBufferException("Attempted overflow");
|
||||||
|
}
|
||||||
|
byte[] tmp = new byte[nextSize];
|
||||||
|
// Copy data to the beginning of the new array.
|
||||||
|
if (wpos >= rpos) {
|
||||||
|
System.arraycopy(data, rpos, tmp, 0, available);
|
||||||
|
wpos -= rpos; // wpos must be relative to the new rpos, which will be 0
|
||||||
|
} else {
|
||||||
|
int tail = data.length - rpos;
|
||||||
|
System.arraycopy(data, rpos, tmp, 0, tail); // segment right of rpos
|
||||||
|
System.arraycopy(data, 0, tmp, tail, wpos); // segment left of wpos
|
||||||
|
wpos += tail; // wpos must be relative to the new rpos, which will be 0
|
||||||
|
}
|
||||||
|
rpos = 0;
|
||||||
|
data = tmp;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reads data from this buffer into the provided array.
|
||||||
|
*/
|
||||||
|
public void readRawBytes(byte[] destination, int offset, int length) throws CircularBufferException {
|
||||||
|
ensureAvailable(length);
|
||||||
|
|
||||||
|
int rposNext = rpos + length;
|
||||||
|
if (rposNext <= data.length) {
|
||||||
|
System.arraycopy(data, rpos, destination, offset, length);
|
||||||
|
} else {
|
||||||
|
int tail = data.length - rpos;
|
||||||
|
System.arraycopy(data, rpos, destination, offset, tail); // segment right of rpos
|
||||||
|
rposNext = length - tail; // rpos wraps around the end of the buffer
|
||||||
|
System.arraycopy(data, 0, destination, offset + tail, rposNext); // remainder
|
||||||
|
}
|
||||||
|
// This can make rpos equal data.length, which has the same effect as wpos being 0.
|
||||||
|
rpos = rposNext;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Writes data to this buffer from the provided array.
|
||||||
|
*/
|
||||||
|
@SuppressWarnings("unchecked")
|
||||||
|
public T putRawBytes(byte[] source, int offset, int length) throws CircularBufferException {
|
||||||
|
ensureCapacity(length);
|
||||||
|
|
||||||
|
int wposNext = wpos + length;
|
||||||
|
if (wposNext <= data.length) {
|
||||||
|
System.arraycopy(source, offset, data, wpos, length);
|
||||||
|
} else {
|
||||||
|
int tail = data.length - wpos;
|
||||||
|
System.arraycopy(source, offset, data, wpos, tail); // segment right of wpos
|
||||||
|
wposNext = length - tail; // wpos wraps around the end of the buffer
|
||||||
|
System.arraycopy(source, offset + tail, data, 0, wposNext); // remainder
|
||||||
|
}
|
||||||
|
// This can make wpos equal data.length, which has the same effect as wpos being 0.
|
||||||
|
wpos = wposNext;
|
||||||
|
|
||||||
|
return (T) this;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Used only for testing.
|
||||||
|
int length() {
|
||||||
|
return data.length;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return "CircularBuffer [rpos=" + rpos + ", wpos=" + wpos + ", size=" + data.length + "]";
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
@@ -57,9 +57,6 @@ class ECDSAVariationsAdapter {
|
|||||||
|
|
||||||
static PublicKey readPubKeyFromBuffer(Buffer<?> buf, String variation) throws GeneralSecurityException {
|
static PublicKey readPubKeyFromBuffer(Buffer<?> buf, String variation) throws GeneralSecurityException {
|
||||||
String algorithm = BASE_ALGORITHM_NAME + variation;
|
String algorithm = BASE_ALGORITHM_NAME + variation;
|
||||||
if (!SecurityUtils.isBouncyCastleRegistered()) {
|
|
||||||
throw new GeneralSecurityException("BouncyCastle is required to read a key of type " + algorithm);
|
|
||||||
}
|
|
||||||
try {
|
try {
|
||||||
// final String algo = buf.readString(); it has been already read
|
// final String algo = buf.readString(); it has been already read
|
||||||
final String curveName = buf.readString();
|
final String curveName = buf.readString();
|
||||||
|
|||||||
@@ -259,6 +259,11 @@ public class SecurityUtils {
|
|||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configure whether to register the Bouncy Castle Security Provider. Must be called prior to other methods
|
||||||
|
*
|
||||||
|
* @param registerBouncyCastle Enable or disable Bouncy Castle Provider registration on subsequent method invocation
|
||||||
|
*/
|
||||||
public static synchronized void setRegisterBouncyCastle(boolean registerBouncyCastle) {
|
public static synchronized void setRegisterBouncyCastle(boolean registerBouncyCastle) {
|
||||||
SecurityUtils.registerBouncyCastle = registerBouncyCastle;
|
SecurityUtils.registerBouncyCastle = registerBouncyCastle;
|
||||||
registrationDone = false;
|
registrationDone = false;
|
||||||
|
|||||||
@@ -145,8 +145,14 @@ public class StreamCopier {
|
|||||||
final double sizeKiB = count / 1024.0;
|
final double sizeKiB = count / 1024.0;
|
||||||
log.debug(String.format("%1$,.1f KiB transferred in %2$,.1f seconds (%3$,.2f KiB/s)", sizeKiB, timeSeconds, (sizeKiB / timeSeconds)));
|
log.debug(String.format("%1$,.1f KiB transferred in %2$,.1f seconds (%3$,.2f KiB/s)", sizeKiB, timeSeconds, (sizeKiB / timeSeconds)));
|
||||||
|
|
||||||
if (length != -1 && read == -1)
|
// Did we encounter EOF?
|
||||||
throw new IOException("Encountered EOF, could not transfer " + length + " bytes");
|
if (read == -1) {
|
||||||
|
// If InputStream was closed we should also close OutputStream
|
||||||
|
out.close();
|
||||||
|
|
||||||
|
if (length != -1)
|
||||||
|
throw new IOException("Encountered EOF, could not transfer " + length + " bytes");
|
||||||
|
}
|
||||||
|
|
||||||
return count;
|
return count;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -164,8 +164,7 @@ public abstract class AbstractChannel
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void handle(Message msg, SSHPacket buf)
|
public void handle(Message msg, SSHPacket buf) throws SSHException {
|
||||||
throws ConnectionException, TransportException {
|
|
||||||
switch (msg) {
|
switch (msg) {
|
||||||
|
|
||||||
case CHANNEL_DATA:
|
case CHANNEL_DATA:
|
||||||
@@ -304,6 +303,25 @@ public abstract class AbstractChannel
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Prevent CHANNEL_CLOSE to be sent between isOpen and a Transport.write call in the runnable, otherwise
|
||||||
|
// a disconnect with a "packet referred to nonexistent channel" message can occur.
|
||||||
|
//
|
||||||
|
// This particularly happens when the transport.Reader thread passes an eof from the server to the
|
||||||
|
// ChannelInputStream, the reading library-user thread returns, and closes the channel at the same time as the
|
||||||
|
// transport.Reader thread receives the subsequent CHANNEL_CLOSE from the server.
|
||||||
|
boolean whileOpen(TransportRunnable runnable) throws TransportException, ConnectionException {
|
||||||
|
openCloseLock.lock();
|
||||||
|
try {
|
||||||
|
if (isOpen()) {
|
||||||
|
runnable.run();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
openCloseLock.unlock();
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
private void gotChannelRequest(SSHPacket buf)
|
private void gotChannelRequest(SSHPacket buf)
|
||||||
throws ConnectionException, TransportException {
|
throws ConnectionException, TransportException {
|
||||||
final String reqType;
|
final String reqType;
|
||||||
@@ -335,7 +353,7 @@ public abstract class AbstractChannel
|
|||||||
}
|
}
|
||||||
|
|
||||||
protected void gotExtendedData(SSHPacket buf)
|
protected void gotExtendedData(SSHPacket buf)
|
||||||
throws ConnectionException, TransportException {
|
throws SSHException {
|
||||||
throw new ConnectionException(DisconnectReason.PROTOCOL_ERROR,
|
throw new ConnectionException(DisconnectReason.PROTOCOL_ERROR,
|
||||||
"Extended data not supported on " + type + " channel");
|
"Extended data not supported on " + type + " channel");
|
||||||
}
|
}
|
||||||
@@ -356,7 +374,7 @@ public abstract class AbstractChannel
|
|||||||
}
|
}
|
||||||
|
|
||||||
protected void receiveInto(ChannelInputStream stream, SSHPacket buf)
|
protected void receiveInto(ChannelInputStream stream, SSHPacket buf)
|
||||||
throws ConnectionException, TransportException {
|
throws SSHException {
|
||||||
final int len;
|
final int len;
|
||||||
try {
|
try {
|
||||||
len = buf.readUInt32AsInt();
|
len = buf.readUInt32AsInt();
|
||||||
@@ -427,5 +445,8 @@ public abstract class AbstractChannel
|
|||||||
+ rwin + " >";
|
+ rwin + " >";
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public interface TransportRunnable {
|
||||||
|
void run() throws TransportException, ConnectionException;
|
||||||
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -38,7 +38,7 @@ public final class ChannelInputStream
|
|||||||
private final Channel chan;
|
private final Channel chan;
|
||||||
private final Transport trans;
|
private final Transport trans;
|
||||||
private final Window.Local win;
|
private final Window.Local win;
|
||||||
private final Buffer.PlainBuffer buf;
|
private final CircularBuffer.PlainCircularBuffer buf;
|
||||||
private final byte[] b = new byte[1];
|
private final byte[] b = new byte[1];
|
||||||
|
|
||||||
private boolean eof;
|
private boolean eof;
|
||||||
@@ -46,10 +46,11 @@ public final class ChannelInputStream
|
|||||||
|
|
||||||
public ChannelInputStream(Channel chan, Transport trans, Window.Local win) {
|
public ChannelInputStream(Channel chan, Transport trans, Window.Local win) {
|
||||||
this.chan = chan;
|
this.chan = chan;
|
||||||
log = chan.getLoggerFactory().getLogger(getClass());
|
this.log = chan.getLoggerFactory().getLogger(getClass());
|
||||||
this.trans = trans;
|
this.trans = trans;
|
||||||
this.win = win;
|
this.win = win;
|
||||||
buf = new Buffer.PlainBuffer(chan.getLocalMaxPacketSize());
|
this.buf = new CircularBuffer.PlainCircularBuffer(
|
||||||
|
chan.getLocalMaxPacketSize(), trans.getConfig().getMaxCircularBufferSize());
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -105,6 +106,7 @@ public final class ChannelInputStream
|
|||||||
try {
|
try {
|
||||||
buf.wait();
|
buf.wait();
|
||||||
} catch (InterruptedException e) {
|
} catch (InterruptedException e) {
|
||||||
|
Thread.currentThread().interrupt();
|
||||||
throw (IOException) new InterruptedIOException().initCause(e);
|
throw (IOException) new InterruptedIOException().initCause(e);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -112,48 +114,44 @@ public final class ChannelInputStream
|
|||||||
len = buf.available();
|
len = buf.available();
|
||||||
}
|
}
|
||||||
buf.readRawBytes(b, off, len);
|
buf.readRawBytes(b, off, len);
|
||||||
if (buf.rpos() > win.getMaxPacketSize() && buf.available() == 0) {
|
|
||||||
buf.clear();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!chan.getAutoExpand()) {
|
if (!chan.getAutoExpand()) {
|
||||||
checkWindow();
|
checkWindow();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
return len;
|
return len;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void receive(byte[] data, int offset, int len)
|
public void receive(byte[] data, int offset, int len) throws SSHException {
|
||||||
throws ConnectionException, TransportException {
|
|
||||||
if (eof) {
|
if (eof) {
|
||||||
throw new ConnectionException("Getting data on EOF'ed stream");
|
throw new ConnectionException("Getting data on EOF'ed stream");
|
||||||
}
|
}
|
||||||
synchronized (buf) {
|
synchronized (buf) {
|
||||||
buf.putRawBytes(data, offset, len);
|
buf.putRawBytes(data, offset, len);
|
||||||
buf.notifyAll();
|
buf.notifyAll();
|
||||||
}
|
// Potential fix for #203 (window consumed below 0).
|
||||||
// Potential fix for #203 (window consumed below 0).
|
// This seems to be a race condition if we receive more data, while we're already sending a SSH_MSG_CHANNEL_WINDOW_ADJUST
|
||||||
// This seems to be a race condition if we receive more data, while we're already sending a SSH_MSG_CHANNEL_WINDOW_ADJUST
|
// And the window has not expanded yet.
|
||||||
// And the window has not expanded yet.
|
|
||||||
synchronized (win) {
|
|
||||||
win.consume(len);
|
win.consume(len);
|
||||||
}
|
if (chan.getAutoExpand()) {
|
||||||
if (chan.getAutoExpand()) {
|
checkWindow();
|
||||||
checkWindow();
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private void checkWindow()
|
private void checkWindow() throws TransportException {
|
||||||
throws TransportException {
|
/*
|
||||||
synchronized (win) {
|
* Window must fit in remaining buffer capacity. We already expect win.size() amount of data to arrive. The
|
||||||
final long adjustment = win.neededAdjustment();
|
* difference between that and the remaining capacity is the maximum adjustment we can make to the window.
|
||||||
if (adjustment > 0) {
|
*/
|
||||||
log.debug("Sending SSH_MSG_CHANNEL_WINDOW_ADJUST to #{} for {} bytes", chan.getRecipient(), adjustment);
|
final long maxAdjustment = buf.maxPossibleRemainingCapacity() - win.getSize();
|
||||||
trans.write(new SSHPacket(Message.CHANNEL_WINDOW_ADJUST)
|
final long adjustment = Math.min(win.neededAdjustment(), maxAdjustment);
|
||||||
.putUInt32FromInt(chan.getRecipient()).putUInt32(adjustment));
|
if (adjustment > 0) {
|
||||||
win.expand(adjustment);
|
log.debug("Sending SSH_MSG_CHANNEL_WINDOW_ADJUST to #{} for {} bytes", chan.getRecipient(), adjustment);
|
||||||
}
|
trans.write(new SSHPacket(Message.CHANNEL_WINDOW_ADJUST)
|
||||||
|
.putUInt32FromInt(chan.getRecipient()).putUInt32(adjustment));
|
||||||
|
win.expand(adjustment);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -30,7 +30,7 @@ import java.util.concurrent.atomic.AtomicBoolean;
|
|||||||
*/
|
*/
|
||||||
public final class ChannelOutputStream extends OutputStream implements ErrorNotifiable {
|
public final class ChannelOutputStream extends OutputStream implements ErrorNotifiable {
|
||||||
|
|
||||||
private final Channel chan;
|
private final AbstractChannel chan;
|
||||||
private final Transport trans;
|
private final Transport trans;
|
||||||
private final Window.Remote win;
|
private final Window.Remote win;
|
||||||
|
|
||||||
@@ -47,6 +47,12 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
|
|
||||||
private final SSHPacket packet = new SSHPacket(Message.CHANNEL_DATA);
|
private final SSHPacket packet = new SSHPacket(Message.CHANNEL_DATA);
|
||||||
private final Buffer.PlainBuffer leftOvers = new Buffer.PlainBuffer();
|
private final Buffer.PlainBuffer leftOvers = new Buffer.PlainBuffer();
|
||||||
|
private final AbstractChannel.TransportRunnable packetWriteRunnable = new AbstractChannel.TransportRunnable() {
|
||||||
|
@Override
|
||||||
|
public void run() throws TransportException {
|
||||||
|
trans.write(packet);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
DataBuffer() {
|
DataBuffer() {
|
||||||
headerOffset = packet.rpos();
|
headerOffset = packet.rpos();
|
||||||
@@ -99,8 +105,9 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
if (leftOverBytes > 0) {
|
if (leftOverBytes > 0) {
|
||||||
leftOvers.putRawBytes(packet.array(), packet.wpos(), leftOverBytes);
|
leftOvers.putRawBytes(packet.array(), packet.wpos(), leftOverBytes);
|
||||||
}
|
}
|
||||||
|
if (!chan.whileOpen(packetWriteRunnable)) {
|
||||||
trans.write(packet);
|
throwStreamClosed();
|
||||||
|
}
|
||||||
win.consume(writeNow);
|
win.consume(writeNow);
|
||||||
|
|
||||||
packet.rpos(headerOffset);
|
packet.rpos(headerOffset);
|
||||||
@@ -119,7 +126,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
public ChannelOutputStream(Channel chan, Transport trans, Window.Remote win) {
|
public ChannelOutputStream(AbstractChannel chan, Transport trans, Window.Remote win) {
|
||||||
this.chan = chan;
|
this.chan = chan;
|
||||||
this.trans = trans;
|
this.trans = trans;
|
||||||
this.win = win;
|
this.win = win;
|
||||||
@@ -157,7 +164,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
if (error != null) {
|
if (error != null) {
|
||||||
throw error;
|
throw error;
|
||||||
} else {
|
} else {
|
||||||
throw new ConnectionException("Stream closed");
|
throwStreamClosed();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -165,9 +172,14 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
@Override
|
@Override
|
||||||
public synchronized void close() throws IOException {
|
public synchronized void close() throws IOException {
|
||||||
// Not closed yet, and underlying channel is open to flush the data to.
|
// Not closed yet, and underlying channel is open to flush the data to.
|
||||||
if (!closed.getAndSet(true) && chan.isOpen()) {
|
if (!closed.getAndSet(true)) {
|
||||||
buffer.flush(false);
|
chan.whileOpen(new AbstractChannel.TransportRunnable() {
|
||||||
trans.write(new SSHPacket(Message.CHANNEL_EOF).putUInt32(chan.getRecipient()));
|
@Override
|
||||||
|
public void run() throws TransportException, ConnectionException {
|
||||||
|
buffer.flush(false);
|
||||||
|
trans.write(new SSHPacket(Message.CHANNEL_EOF).putUInt32(chan.getRecipient()));
|
||||||
|
}
|
||||||
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -188,4 +200,7 @@ public final class ChannelOutputStream extends OutputStream implements ErrorNoti
|
|||||||
return "< ChannelOutputStream for Channel #" + chan.getID() + " >";
|
return "< ChannelOutputStream for Channel #" + chan.getID() + " >";
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private static void throwStreamClosed() throws ConnectionException {
|
||||||
|
throw new ConnectionException("Stream closed");
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -22,8 +22,6 @@ import java.io.IOException;
|
|||||||
import java.net.Socket;
|
import java.net.Socket;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
import static com.hierynomus.sshj.backport.Sockets.asCloseable;
|
|
||||||
|
|
||||||
public class SocketStreamCopyMonitor
|
public class SocketStreamCopyMonitor
|
||||||
extends Thread {
|
extends Thread {
|
||||||
|
|
||||||
@@ -43,7 +41,7 @@ public class SocketStreamCopyMonitor
|
|||||||
await(y);
|
await(y);
|
||||||
} catch (IOException ignored) {
|
} catch (IOException ignored) {
|
||||||
} finally {
|
} finally {
|
||||||
IOUtils.closeQuietly(channel, asCloseable(socket));
|
IOUtils.closeQuietly(channel, socket);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -93,6 +93,7 @@ public abstract class Window {
|
|||||||
throw new ConnectionException("Timeout when trying to expand the window size");
|
throw new ConnectionException("Timeout when trying to expand the window size");
|
||||||
}
|
}
|
||||||
} catch (InterruptedException ie) {
|
} catch (InterruptedException ie) {
|
||||||
|
Thread.currentThread().interrupt();
|
||||||
throw new ConnectionException(ie);
|
throw new ConnectionException(ie);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -29,8 +29,6 @@ import java.net.Socket;
|
|||||||
import java.net.SocketException;
|
import java.net.SocketException;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
import static com.hierynomus.sshj.backport.Sockets.asCloseable;
|
|
||||||
|
|
||||||
public class LocalPortForwarder {
|
public class LocalPortForwarder {
|
||||||
|
|
||||||
public static class ForwardedChannel
|
public static class ForwardedChannel
|
||||||
@@ -78,7 +76,7 @@ public class LocalPortForwarder {
|
|||||||
chan.open();
|
chan.open();
|
||||||
chan.start();
|
chan.start();
|
||||||
} catch (IOException e) {
|
} catch (IOException e) {
|
||||||
IOUtils.closeQuietly(chan, asCloseable(socket));
|
IOUtils.closeQuietly(chan, socket);
|
||||||
throw e;
|
throw e;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -210,7 +210,7 @@ public class SessionChannel
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected void gotExtendedData(SSHPacket buf)
|
protected void gotExtendedData(SSHPacket buf)
|
||||||
throws ConnectionException, TransportException {
|
throws SSHException {
|
||||||
try {
|
try {
|
||||||
final int dataTypeCode = buf.readUInt32AsInt();
|
final int dataTypeCode = buf.readUInt32AsInt();
|
||||||
if (dataTypeCode == 1)
|
if (dataTypeCode == 1)
|
||||||
@@ -225,7 +225,9 @@ public class SessionChannel
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void notifyError(SSHException error) {
|
public void notifyError(SSHException error) {
|
||||||
err.notifyError(error);
|
if (err != null) {
|
||||||
|
err.notifyError(error);
|
||||||
|
}
|
||||||
super.notifyError(error);
|
super.notifyError(error);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -15,10 +15,11 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.connection.channel.direct;
|
package net.schmizz.sshj.connection.channel.direct;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.common.RemoteAddressProvider;
|
||||||
import net.schmizz.sshj.common.SSHException;
|
import net.schmizz.sshj.common.SSHException;
|
||||||
|
|
||||||
/** A factory interface for creating SSH {@link Session session channels}. */
|
/** A factory interface for creating SSH {@link Session session channels}. */
|
||||||
public interface SessionFactory {
|
public interface SessionFactory extends RemoteAddressProvider {
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Opens a {@code session} channel. The returned {@link Session} instance allows {@link Session#exec(String)
|
* Opens a {@code session} channel. The returned {@link Session} instance allows {@link Session#exec(String)
|
||||||
@@ -27,7 +28,7 @@ public interface SessionFactory {
|
|||||||
*
|
*
|
||||||
* @return the opened {@code session} channel
|
* @return the opened {@code session} channel
|
||||||
*
|
*
|
||||||
* @throws SSHException
|
* @throws SSHException Thrown on session initialization failures
|
||||||
* @see Session
|
* @see Session
|
||||||
*/
|
*/
|
||||||
Session startSession()
|
Session startSession()
|
||||||
|
|||||||
@@ -142,6 +142,10 @@ public class RemotePortForwarder
|
|||||||
// Listen on all IPv4
|
// Listen on all IPv4
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
if ("0.0.0.0".equals(address) && "0:0:0:0:0:0:0:0".equals(channelForward.address)) {
|
||||||
|
// Handle IPv4 requests on IPv6 channel forward
|
||||||
|
return true;
|
||||||
|
}
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -41,7 +41,7 @@ public class PacketReader extends Thread {
|
|||||||
this.engine = engine;
|
this.engine = engine;
|
||||||
log = engine.getLoggerFactory().getLogger(getClass());
|
log = engine.getLoggerFactory().getLogger(getClass());
|
||||||
this.in = engine.getSubsystem().getInputStream();
|
this.in = engine.getSubsystem().getInputStream();
|
||||||
setName("sftp reader");
|
setName("sshj-PacketReader");
|
||||||
setDaemon(true);
|
setDaemon(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -15,6 +15,7 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.sftp;
|
package net.schmizz.sshj.sftp;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.sftp.RemoteResourceSelector;
|
||||||
import net.schmizz.sshj.sftp.Response.StatusCode;
|
import net.schmizz.sshj.sftp.Response.StatusCode;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -22,6 +23,8 @@ import java.util.LinkedList;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
|
import static com.hierynomus.sshj.sftp.RemoteResourceFilterConverter.selectorFrom;
|
||||||
|
|
||||||
public class RemoteDirectory
|
public class RemoteDirectory
|
||||||
extends RemoteResource {
|
extends RemoteResource {
|
||||||
|
|
||||||
@@ -31,37 +34,55 @@ public class RemoteDirectory
|
|||||||
|
|
||||||
public List<RemoteResourceInfo> scan(RemoteResourceFilter filter)
|
public List<RemoteResourceInfo> scan(RemoteResourceFilter filter)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
List<RemoteResourceInfo> rri = new LinkedList<RemoteResourceInfo>();
|
return scan(selectorFrom(filter));
|
||||||
// TODO: Remove GOTO!
|
}
|
||||||
loop:
|
|
||||||
for (; ; ) {
|
|
||||||
final Response res = requester.request(newRequest(PacketType.READDIR))
|
|
||||||
.retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
|
||||||
switch (res.getType()) {
|
|
||||||
|
|
||||||
|
public List<RemoteResourceInfo> scan(RemoteResourceSelector selector)
|
||||||
|
throws IOException {
|
||||||
|
if (selector == null) {
|
||||||
|
selector = RemoteResourceSelector.ALL;
|
||||||
|
}
|
||||||
|
|
||||||
|
List<RemoteResourceInfo> remoteResourceInfos = new LinkedList<>();
|
||||||
|
|
||||||
|
while (true) {
|
||||||
|
final Response response = requester.request(newRequest(PacketType.READDIR))
|
||||||
|
.retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||||
|
|
||||||
|
switch (response.getType()) {
|
||||||
case NAME:
|
case NAME:
|
||||||
final int count = res.readUInt32AsInt();
|
final int count = response.readUInt32AsInt();
|
||||||
for (int i = 0; i < count; i++) {
|
for (int i = 0; i < count; i++) {
|
||||||
final String name = res.readString(requester.sub.getRemoteCharset());
|
final String name = response.readString(requester.sub.getRemoteCharset());
|
||||||
res.readString(); // long name - IGNORED - shdve never been in the protocol
|
response.readString(); // long name - IGNORED - shdve never been in the protocol
|
||||||
final FileAttributes attrs = res.readFileAttributes();
|
final FileAttributes attrs = response.readFileAttributes();
|
||||||
final PathComponents comps = requester.getPathHelper().getComponents(path, name);
|
final PathComponents comps = requester.getPathHelper().getComponents(path, name);
|
||||||
final RemoteResourceInfo inf = new RemoteResourceInfo(comps, attrs);
|
final RemoteResourceInfo inf = new RemoteResourceInfo(comps, attrs);
|
||||||
if (!(".".equals(name) || "..".equals(name)) && (filter == null || filter.accept(inf))) {
|
|
||||||
rri.add(inf);
|
if (".".equals(name) || "..".equals(name)) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
final RemoteResourceSelector.Result selectionResult = selector.select(inf);
|
||||||
|
switch (selectionResult) {
|
||||||
|
case ACCEPT:
|
||||||
|
remoteResourceInfos.add(inf);
|
||||||
|
break;
|
||||||
|
case CONTINUE:
|
||||||
|
continue;
|
||||||
|
case BREAK:
|
||||||
|
return remoteResourceInfos;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case STATUS:
|
case STATUS:
|
||||||
res.ensureStatusIs(StatusCode.EOF);
|
response.ensureStatusIs(StatusCode.EOF);
|
||||||
break loop;
|
return remoteResourceInfos;
|
||||||
|
|
||||||
default:
|
default:
|
||||||
throw new SFTPException("Unexpected packet: " + res.getType());
|
throw new SFTPException("Unexpected packet: " + response.getType());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return rri;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,6 +23,8 @@ import java.io.ByteArrayInputStream;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.io.OutputStream;
|
import java.io.OutputStream;
|
||||||
|
import java.util.ArrayDeque;
|
||||||
|
import java.util.Deque;
|
||||||
import java.util.LinkedList;
|
import java.util.LinkedList;
|
||||||
import java.util.Queue;
|
import java.util.Queue;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
@@ -220,49 +222,104 @@ public class RemoteFile
|
|||||||
|
|
||||||
public class ReadAheadRemoteFileInputStream
|
public class ReadAheadRemoteFileInputStream
|
||||||
extends InputStream {
|
extends InputStream {
|
||||||
|
private class UnconfirmedRead {
|
||||||
|
private final long offset;
|
||||||
|
private final Promise<Response, SFTPException> promise;
|
||||||
|
private final int length;
|
||||||
|
|
||||||
|
private UnconfirmedRead(long offset, int length, Promise<Response, SFTPException> promise) {
|
||||||
|
this.offset = offset;
|
||||||
|
this.length = length;
|
||||||
|
this.promise = promise;
|
||||||
|
}
|
||||||
|
|
||||||
|
UnconfirmedRead(long offset, int length) throws IOException {
|
||||||
|
this(offset, length, RemoteFile.this.asyncRead(offset, length));
|
||||||
|
}
|
||||||
|
|
||||||
|
public long getOffset() {
|
||||||
|
return offset;
|
||||||
|
}
|
||||||
|
|
||||||
|
public Promise<Response, SFTPException> getPromise() {
|
||||||
|
return promise;
|
||||||
|
}
|
||||||
|
|
||||||
|
public int getLength() {
|
||||||
|
return length;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
private final byte[] b = new byte[1];
|
private final byte[] b = new byte[1];
|
||||||
|
|
||||||
private final int maxUnconfirmedReads;
|
private final int maxUnconfirmedReads;
|
||||||
private final Queue<Promise<Response, SFTPException>> unconfirmedReads = new LinkedList<Promise<Response, SFTPException>>();
|
private final long readAheadLimit;
|
||||||
private final Queue<Long> unconfirmedReadOffsets = new LinkedList<Long>();
|
private final Deque<UnconfirmedRead> unconfirmedReads = new ArrayDeque<>();
|
||||||
|
|
||||||
private long requestOffset;
|
private long currentOffset;
|
||||||
private long responseOffset;
|
private int maxReadLength = Integer.MAX_VALUE;
|
||||||
private boolean eof;
|
private boolean eof;
|
||||||
|
|
||||||
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads) {
|
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads) {
|
||||||
assert 0 <= maxUnconfirmedReads;
|
this(maxUnconfirmedReads, 0L);
|
||||||
|
}
|
||||||
this.maxUnconfirmedReads = maxUnconfirmedReads;
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param maxUnconfirmedReads Maximum number of unconfirmed requests to send
|
||||||
|
* @param fileOffset Initial offset in file to read from
|
||||||
|
*/
|
||||||
|
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads, long fileOffset) {
|
||||||
|
this(maxUnconfirmedReads, fileOffset, -1L);
|
||||||
}
|
}
|
||||||
|
|
||||||
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads, long fileOffset) {
|
/**
|
||||||
|
*
|
||||||
|
* @param maxUnconfirmedReads Maximum number of unconfirmed requests to send
|
||||||
|
* @param fileOffset Initial offset in file to read from
|
||||||
|
* @param readAheadLimit Read ahead is disabled after this limit has been reached
|
||||||
|
*/
|
||||||
|
public ReadAheadRemoteFileInputStream(int maxUnconfirmedReads, long fileOffset, long readAheadLimit) {
|
||||||
assert 0 <= maxUnconfirmedReads;
|
assert 0 <= maxUnconfirmedReads;
|
||||||
assert 0 <= fileOffset;
|
assert 0 <= fileOffset;
|
||||||
|
|
||||||
this.maxUnconfirmedReads = maxUnconfirmedReads;
|
this.maxUnconfirmedReads = maxUnconfirmedReads;
|
||||||
this.requestOffset = this.responseOffset = fileOffset;
|
this.currentOffset = fileOffset;
|
||||||
|
this.readAheadLimit = readAheadLimit > 0 ? fileOffset + readAheadLimit : Long.MAX_VALUE;
|
||||||
}
|
}
|
||||||
|
|
||||||
private ByteArrayInputStream pending = new ByteArrayInputStream(new byte[0]);
|
private ByteArrayInputStream pending = new ByteArrayInputStream(new byte[0]);
|
||||||
|
|
||||||
private boolean retrieveUnconfirmedRead(boolean blocking) throws IOException {
|
private boolean retrieveUnconfirmedRead(boolean blocking) throws IOException {
|
||||||
if (unconfirmedReads.size() <= 0) {
|
final UnconfirmedRead unconfirmedRead = unconfirmedReads.peek();
|
||||||
|
if (unconfirmedRead == null || !blocking && !unconfirmedRead.getPromise().isDelivered()) {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
unconfirmedReads.remove(unconfirmedRead);
|
||||||
|
|
||||||
if (!blocking && !unconfirmedReads.peek().isDelivered()) {
|
final Response res = unconfirmedRead.promise.retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
unconfirmedReadOffsets.remove();
|
|
||||||
final Response res = unconfirmedReads.remove().retrieve(requester.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
|
||||||
switch (res.getType()) {
|
switch (res.getType()) {
|
||||||
case DATA:
|
case DATA:
|
||||||
int recvLen = res.readUInt32AsInt();
|
int recvLen = res.readUInt32AsInt();
|
||||||
responseOffset += recvLen;
|
if (unconfirmedRead.offset == currentOffset) {
|
||||||
pending = new ByteArrayInputStream(res.array(), res.rpos(), recvLen);
|
currentOffset += recvLen;
|
||||||
|
pending = new ByteArrayInputStream(res.array(), res.rpos(), recvLen);
|
||||||
|
|
||||||
|
if (recvLen < unconfirmedRead.length) {
|
||||||
|
// The server returned a packet smaller than the client had requested.
|
||||||
|
// It can be caused by at least one of the following:
|
||||||
|
// * The file has been read fully. Then, few futile read requests can be sent during
|
||||||
|
// the next read(), but the file will be downloaded correctly anyway.
|
||||||
|
// * The server shapes the request length. Then, the read window will be adjusted,
|
||||||
|
// and all further read-ahead requests won't be shaped.
|
||||||
|
// * The file on the server is not a regular file, it is something like fifo.
|
||||||
|
// Then, the window will shrink, and the client will start reading the file slower than it
|
||||||
|
// hypothetically can. It must be a rare case, and it is not worth implementing a sort of
|
||||||
|
// congestion control algorithm here.
|
||||||
|
maxReadLength = recvLen;
|
||||||
|
unconfirmedReads.clear();
|
||||||
|
}
|
||||||
|
}
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case STATUS:
|
case STATUS:
|
||||||
@@ -290,40 +347,31 @@ public class RemoteFile
|
|||||||
// we also need to go here for len <= 0, because pending may be at
|
// we also need to go here for len <= 0, because pending may be at
|
||||||
// EOF in which case it would return -1 instead of 0
|
// EOF in which case it would return -1 instead of 0
|
||||||
|
|
||||||
|
long requestOffset;
|
||||||
|
if (unconfirmedReads.isEmpty()) {
|
||||||
|
requestOffset = currentOffset;
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
final UnconfirmedRead lastRequest = unconfirmedReads.getLast();
|
||||||
|
requestOffset = lastRequest.offset + lastRequest.length;
|
||||||
|
}
|
||||||
while (unconfirmedReads.size() <= maxUnconfirmedReads) {
|
while (unconfirmedReads.size() <= maxUnconfirmedReads) {
|
||||||
// Send read requests as long as there is no EOF and we have not reached the maximum parallelism
|
// Send read requests as long as there is no EOF and we have not reached the maximum parallelism
|
||||||
int reqLen = Math.max(1024, len); // don't be shy!
|
int reqLen = Math.min(Math.max(1024, len), maxReadLength);
|
||||||
unconfirmedReads.add(RemoteFile.this.asyncRead(requestOffset, reqLen));
|
if (readAheadLimit > requestOffset) {
|
||||||
unconfirmedReadOffsets.add(requestOffset);
|
long remaining = readAheadLimit - requestOffset;
|
||||||
|
if (reqLen > remaining) {
|
||||||
|
reqLen = (int) remaining;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
unconfirmedReads.add(new UnconfirmedRead(requestOffset, reqLen));
|
||||||
requestOffset += reqLen;
|
requestOffset += reqLen;
|
||||||
|
if (requestOffset >= readAheadLimit) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
long nextOffset = unconfirmedReadOffsets.peek();
|
if (!retrieveUnconfirmedRead(true /*blocking*/)) {
|
||||||
if (responseOffset != nextOffset) {
|
|
||||||
|
|
||||||
// the server could not give us all the data we needed, so
|
|
||||||
// we try to fill the gap synchronously
|
|
||||||
|
|
||||||
assert responseOffset < nextOffset;
|
|
||||||
assert 0 < (nextOffset - responseOffset);
|
|
||||||
assert (nextOffset - responseOffset) <= Integer.MAX_VALUE;
|
|
||||||
|
|
||||||
byte[] buf = new byte[(int) (nextOffset - responseOffset)];
|
|
||||||
int recvLen = RemoteFile.this.read(responseOffset, buf, 0, buf.length);
|
|
||||||
|
|
||||||
if (recvLen < 0) {
|
|
||||||
eof = true;
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
if (0 == recvLen) {
|
|
||||||
// avoid infinite loops
|
|
||||||
throw new SFTPException("Unexpected response size (0), bailing out");
|
|
||||||
}
|
|
||||||
|
|
||||||
responseOffset += recvLen;
|
|
||||||
pending = new ByteArrayInputStream(buf, 0, recvLen);
|
|
||||||
} else if (!retrieveUnconfirmedRead(true /*blocking*/)) {
|
|
||||||
|
|
||||||
// this may happen if we change prefetch strategy
|
// this may happen if we change prefetch strategy
|
||||||
// currently, we should never get here...
|
// currently, we should never get here...
|
||||||
|
|||||||
@@ -15,6 +15,8 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.sftp;
|
package net.schmizz.sshj.sftp;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.sftp.RemoteResourceSelector;
|
||||||
|
import net.schmizz.sshj.connection.channel.direct.SessionFactory;
|
||||||
import net.schmizz.sshj.xfer.FilePermission;
|
import net.schmizz.sshj.xfer.FilePermission;
|
||||||
import net.schmizz.sshj.xfer.LocalDestFile;
|
import net.schmizz.sshj.xfer.LocalDestFile;
|
||||||
import net.schmizz.sshj.xfer.LocalSourceFile;
|
import net.schmizz.sshj.xfer.LocalSourceFile;
|
||||||
@@ -24,6 +26,8 @@ import java.io.Closeable;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.*;
|
import java.util.*;
|
||||||
|
|
||||||
|
import static com.hierynomus.sshj.sftp.RemoteResourceFilterConverter.selectorFrom;
|
||||||
|
|
||||||
public class SFTPClient
|
public class SFTPClient
|
||||||
implements Closeable {
|
implements Closeable {
|
||||||
|
|
||||||
@@ -39,6 +43,13 @@ public class SFTPClient
|
|||||||
this.xfer = new SFTPFileTransfer(engine);
|
this.xfer = new SFTPFileTransfer(engine);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public SFTPClient(SessionFactory sessionFactory) throws IOException {
|
||||||
|
this.engine = new SFTPEngine(sessionFactory);
|
||||||
|
this.engine.init();
|
||||||
|
log = engine.getLoggerFactory().getLogger(getClass());
|
||||||
|
this.xfer = new SFTPFileTransfer(engine);
|
||||||
|
}
|
||||||
|
|
||||||
public SFTPEngine getSFTPEngine() {
|
public SFTPEngine getSFTPEngine() {
|
||||||
return engine;
|
return engine;
|
||||||
}
|
}
|
||||||
@@ -49,16 +60,18 @@ public class SFTPClient
|
|||||||
|
|
||||||
public List<RemoteResourceInfo> ls(String path)
|
public List<RemoteResourceInfo> ls(String path)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
return ls(path, null);
|
return ls(path, RemoteResourceSelector.ALL);
|
||||||
}
|
}
|
||||||
|
|
||||||
public List<RemoteResourceInfo> ls(String path, RemoteResourceFilter filter)
|
public List<RemoteResourceInfo> ls(String path, RemoteResourceFilter filter)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final RemoteDirectory dir = engine.openDir(path);
|
return ls(path, selectorFrom(filter));
|
||||||
try {
|
}
|
||||||
return dir.scan(filter);
|
|
||||||
} finally {
|
public List<RemoteResourceInfo> ls(String path, RemoteResourceSelector selector)
|
||||||
dir.close();
|
throws IOException {
|
||||||
|
try (RemoteDirectory dir = engine.openDir(path)) {
|
||||||
|
return dir.scan(selector == null ? RemoteResourceSelector.ALL : selector);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -233,21 +246,41 @@ public class SFTPClient
|
|||||||
xfer.download(source, dest);
|
xfer.download(source, dest);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public void get(String source, String dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
xfer.download(source, dest, byteOffset);
|
||||||
|
}
|
||||||
|
|
||||||
public void put(String source, String dest)
|
public void put(String source, String dest)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
xfer.upload(source, dest);
|
xfer.upload(source, dest);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public void put(String source, String dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
xfer.upload(source, dest, byteOffset);
|
||||||
|
}
|
||||||
|
|
||||||
public void get(String source, LocalDestFile dest)
|
public void get(String source, LocalDestFile dest)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
xfer.download(source, dest);
|
xfer.download(source, dest);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public void get(String source, LocalDestFile dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
xfer.download(source, dest, byteOffset);
|
||||||
|
}
|
||||||
|
|
||||||
public void put(LocalSourceFile source, String dest)
|
public void put(LocalSourceFile source, String dest)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
xfer.upload(source, dest);
|
xfer.upload(source, dest);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public void put(LocalSourceFile source, String dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
xfer.upload(source, dest, byteOffset);
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void close()
|
public void close()
|
||||||
throws IOException {
|
throws IOException {
|
||||||
|
|||||||
@@ -15,6 +15,7 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.sftp;
|
package net.schmizz.sshj.sftp;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||||
import net.schmizz.concurrent.Promise;
|
import net.schmizz.concurrent.Promise;
|
||||||
import net.schmizz.sshj.common.IOUtils;
|
import net.schmizz.sshj.common.IOUtils;
|
||||||
import net.schmizz.sshj.common.LoggerFactory;
|
import net.schmizz.sshj.common.LoggerFactory;
|
||||||
@@ -47,6 +48,7 @@ public class SFTPEngine
|
|||||||
|
|
||||||
protected final PathHelper pathHelper;
|
protected final PathHelper pathHelper;
|
||||||
|
|
||||||
|
private final Session session;
|
||||||
protected final Session.Subsystem sub;
|
protected final Session.Subsystem sub;
|
||||||
protected final PacketReader reader;
|
protected final PacketReader reader;
|
||||||
protected final OutputStream out;
|
protected final OutputStream out;
|
||||||
@@ -62,12 +64,13 @@ public class SFTPEngine
|
|||||||
|
|
||||||
public SFTPEngine(SessionFactory ssh, String pathSep)
|
public SFTPEngine(SessionFactory ssh, String pathSep)
|
||||||
throws SSHException {
|
throws SSHException {
|
||||||
Session session = ssh.startSession();
|
session = ssh.startSession();
|
||||||
loggerFactory = session.getLoggerFactory();
|
loggerFactory = session.getLoggerFactory();
|
||||||
log = loggerFactory.getLogger(getClass());
|
log = loggerFactory.getLogger(getClass());
|
||||||
sub = session.startSubsystem("sftp");
|
sub = session.startSubsystem("sftp");
|
||||||
out = sub.getOutputStream();
|
out = sub.getOutputStream();
|
||||||
reader = new PacketReader(this);
|
reader = new PacketReader(this);
|
||||||
|
ThreadNameProvider.setThreadName(reader, ssh);
|
||||||
pathHelper = new PathHelper(new PathHelper.Canonicalizer() {
|
pathHelper = new PathHelper(new PathHelper.Canonicalizer() {
|
||||||
@Override
|
@Override
|
||||||
public String canonicalize(String path)
|
public String canonicalize(String path)
|
||||||
@@ -79,7 +82,23 @@ public class SFTPEngine
|
|||||||
|
|
||||||
public SFTPEngine init()
|
public SFTPEngine init()
|
||||||
throws IOException {
|
throws IOException {
|
||||||
transmit(new SFTPPacket<Request>(PacketType.INIT).putUInt32(MAX_SUPPORTED_VERSION));
|
return init(MAX_SUPPORTED_VERSION);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Introduced for internal use by testcases.
|
||||||
|
* @param requestedVersion
|
||||||
|
* @throws IOException
|
||||||
|
*/
|
||||||
|
protected SFTPEngine init(int requestedVersion)
|
||||||
|
throws IOException {
|
||||||
|
if (requestedVersion > MAX_SUPPORTED_VERSION)
|
||||||
|
throw new SFTPException("You requested an unsupported protocol version: " + requestedVersion + " (requested) > " + MAX_SUPPORTED_VERSION + " (supported)");
|
||||||
|
|
||||||
|
if (requestedVersion < MAX_SUPPORTED_VERSION)
|
||||||
|
log.debug("Client version {} is smaller than MAX_SUPPORTED_VERSION {}", requestedVersion, MAX_SUPPORTED_VERSION);
|
||||||
|
|
||||||
|
transmit(new SFTPPacket<Request>(PacketType.INIT).putUInt32(requestedVersion));
|
||||||
|
|
||||||
final SFTPPacket<Response> response = reader.readPacket();
|
final SFTPPacket<Response> response = reader.readPacket();
|
||||||
|
|
||||||
@@ -89,7 +108,7 @@ public class SFTPEngine
|
|||||||
|
|
||||||
operativeVersion = response.readUInt32AsInt();
|
operativeVersion = response.readUInt32AsInt();
|
||||||
log.debug("Server version {}", operativeVersion);
|
log.debug("Server version {}", operativeVersion);
|
||||||
if (MAX_SUPPORTED_VERSION < operativeVersion)
|
if (requestedVersion < operativeVersion)
|
||||||
throw new SFTPException("Server reported incompatible protocol version: " + operativeVersion);
|
throw new SFTPException("Server reported incompatible protocol version: " + operativeVersion);
|
||||||
|
|
||||||
while (response.available() > 0)
|
while (response.available() > 0)
|
||||||
@@ -232,17 +251,79 @@ public class SFTPEngine
|
|||||||
|
|
||||||
public void rename(String oldPath, String newPath, Set<RenameFlags> flags)
|
public void rename(String oldPath, String newPath, Set<RenameFlags> flags)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
if (operativeVersion < 1)
|
if (operativeVersion < 1) {
|
||||||
throw new SFTPException("RENAME is not supported in SFTPv" + operativeVersion);
|
throw new SFTPException("RENAME is not supported in SFTPv" + operativeVersion);
|
||||||
|
|
||||||
long renameFlagMask = 0L;
|
|
||||||
for (RenameFlags flag : flags) {
|
|
||||||
renameFlagMask = renameFlagMask | flag.longValue();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
doRequest(
|
// request variables to be determined
|
||||||
newRequest(PacketType.RENAME).putString(oldPath, sub.getRemoteCharset()).putString(newPath, sub.getRemoteCharset()).putUInt32(renameFlagMask)
|
PacketType type = PacketType.RENAME; // Default
|
||||||
).ensureStatusPacketIsOK();
|
long renameFlagMask = 0L;
|
||||||
|
String serverExtension = null;
|
||||||
|
|
||||||
|
if (!flags.isEmpty()) {
|
||||||
|
// SFTP Version 5 introduced rename flags according to Section 6.5 of the specification
|
||||||
|
if (operativeVersion >= 5) {
|
||||||
|
for (RenameFlags flag : flags) {
|
||||||
|
renameFlagMask = renameFlagMask | flag.longValue();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
// Try to find a fallback solution if flags are not supported by the server.
|
||||||
|
|
||||||
|
// "posix-rename@openssh.com" provides ATOMIC and OVERWRITE behaviour.
|
||||||
|
// From the SFTP-spec, Section 6.5:
|
||||||
|
// "If SSH_FXP_RENAME_OVERWRITE is specified, the server MAY perform an atomic rename even if it is
|
||||||
|
// not requested."
|
||||||
|
// So, if overwrite is allowed we can always use the posix-rename as a fallback.
|
||||||
|
else if (flags.contains(RenameFlags.OVERWRITE) &&
|
||||||
|
supportsServerExtension("posix-rename","openssh.com")) {
|
||||||
|
|
||||||
|
type = PacketType.EXTENDED;
|
||||||
|
serverExtension = "posix-rename@openssh.com";
|
||||||
|
}
|
||||||
|
|
||||||
|
// Because the OVERWRITE flag changes the behaviour in a possibly unintended way, it has to be
|
||||||
|
// explicitly requested for the above fallback to be applicable.
|
||||||
|
// Tell this to the developer if ATOMIC is requested without OVERWRITE.
|
||||||
|
else if (flags.contains(RenameFlags.ATOMIC) &&
|
||||||
|
!flags.contains(RenameFlags.OVERWRITE) &&
|
||||||
|
!flags.contains(RenameFlags.NATIVE) && // see next case below
|
||||||
|
supportsServerExtension("posix-rename","openssh.com")) {
|
||||||
|
throw new SFTPException("RENAME-FLAGS are not supported in SFTPv" + operativeVersion + " but " +
|
||||||
|
"the \"posix-rename@openssh.com\" extension could be used as fallback if OVERWRITE " +
|
||||||
|
"behaviour is acceptable (needs to be activated via RenameFlags.OVERWRITE).");
|
||||||
|
}
|
||||||
|
|
||||||
|
// From the SFTP-spec, Section 6.5:
|
||||||
|
// "If flags includes SSH_FXP_RENAME_NATIVE, the server is free to do the rename operation in whatever
|
||||||
|
// fashion it deems appropriate. Other flag values are considered hints as to desired behavior, but not
|
||||||
|
// requirements."
|
||||||
|
else if (flags.contains(RenameFlags.NATIVE)) {
|
||||||
|
log.debug("Flags are not supported but NATIVE-flag allows to ignore other requested flags: " +
|
||||||
|
flags.toString());
|
||||||
|
}
|
||||||
|
|
||||||
|
// finally: let the user know that the server does not support what was asked
|
||||||
|
else {
|
||||||
|
throw new SFTPException("RENAME-FLAGS are not supported in SFTPv" + operativeVersion + " and no " +
|
||||||
|
"supported server extension could be found to achieve a similar result.");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// build and send request
|
||||||
|
final Request request = newRequest(type);
|
||||||
|
|
||||||
|
if (serverExtension != null) {
|
||||||
|
request.putString(serverExtension);
|
||||||
|
}
|
||||||
|
|
||||||
|
request.putString(oldPath, sub.getRemoteCharset())
|
||||||
|
.putString(newPath, sub.getRemoteCharset());
|
||||||
|
|
||||||
|
if (renameFlagMask != 0L) {
|
||||||
|
request.putUInt32(renameFlagMask);
|
||||||
|
}
|
||||||
|
|
||||||
|
doRequest(request).ensureStatusPacketIsOK();
|
||||||
}
|
}
|
||||||
|
|
||||||
public String canonicalize(String path)
|
public String canonicalize(String path)
|
||||||
@@ -266,6 +347,7 @@ public class SFTPEngine
|
|||||||
throws IOException {
|
throws IOException {
|
||||||
sub.close();
|
sub.close();
|
||||||
reader.interrupt();
|
reader.interrupt();
|
||||||
|
session.close();
|
||||||
}
|
}
|
||||||
|
|
||||||
protected LoggerFactory getLoggerFactory() {
|
protected LoggerFactory getLoggerFactory() {
|
||||||
|
|||||||
@@ -50,25 +50,47 @@ public class SFTPFileTransfer
|
|||||||
@Override
|
@Override
|
||||||
public void upload(String source, String dest)
|
public void upload(String source, String dest)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
upload(new FileSystemFile(source), dest);
|
upload(source, dest, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void upload(String source, String dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
upload(new FileSystemFile(source), dest, byteOffset);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void download(String source, String dest)
|
public void download(String source, String dest)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
download(source, new FileSystemFile(dest));
|
download(source, dest, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void download(String source, String dest, long byteOffset)
|
||||||
|
throws IOException {
|
||||||
|
download(source, new FileSystemFile(dest), byteOffset);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void upload(LocalSourceFile localFile, String remotePath) throws IOException {
|
public void upload(LocalSourceFile localFile, String remotePath) throws IOException {
|
||||||
new Uploader(localFile, remotePath).upload(getTransferListener());
|
upload(localFile, remotePath, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void upload(LocalSourceFile localFile, String remotePath, long byteOffset) throws IOException {
|
||||||
|
new Uploader(localFile, remotePath).upload(getTransferListener(), byteOffset);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void download(String source, LocalDestFile dest) throws IOException {
|
public void download(String source, LocalDestFile dest) throws IOException {
|
||||||
|
download(source, dest, 0);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public void download(String source, LocalDestFile dest, long byteOffset) throws IOException {
|
||||||
final PathComponents pathComponents = engine.getPathHelper().getComponents(source);
|
final PathComponents pathComponents = engine.getPathHelper().getComponents(source);
|
||||||
final FileAttributes attributes = engine.stat(source);
|
final FileAttributes attributes = engine.stat(source);
|
||||||
new Downloader().download(getTransferListener(), new RemoteResourceInfo(pathComponents, attributes), dest);
|
new Downloader().download(getTransferListener(), new RemoteResourceInfo(pathComponents, attributes), dest, byteOffset);
|
||||||
}
|
}
|
||||||
|
|
||||||
public void setUploadFilter(LocalFileFilter uploadFilter) {
|
public void setUploadFilter(LocalFileFilter uploadFilter) {
|
||||||
@@ -92,7 +114,8 @@ public class SFTPFileTransfer
|
|||||||
@SuppressWarnings("PMD.MissingBreakInSwitch")
|
@SuppressWarnings("PMD.MissingBreakInSwitch")
|
||||||
private void download(final TransferListener listener,
|
private void download(final TransferListener listener,
|
||||||
final RemoteResourceInfo remote,
|
final RemoteResourceInfo remote,
|
||||||
final LocalDestFile local) throws IOException {
|
final LocalDestFile local,
|
||||||
|
final long byteOffset) throws IOException {
|
||||||
final LocalDestFile adjustedFile;
|
final LocalDestFile adjustedFile;
|
||||||
switch (remote.getAttributes().getType()) {
|
switch (remote.getAttributes().getType()) {
|
||||||
case DIRECTORY:
|
case DIRECTORY:
|
||||||
@@ -101,8 +124,9 @@ public class SFTPFileTransfer
|
|||||||
case UNKNOWN:
|
case UNKNOWN:
|
||||||
log.warn("Server did not supply information about the type of file at `{}` " +
|
log.warn("Server did not supply information about the type of file at `{}` " +
|
||||||
"-- assuming it is a regular file!", remote.getPath());
|
"-- assuming it is a regular file!", remote.getPath());
|
||||||
|
// fall through
|
||||||
case REGULAR:
|
case REGULAR:
|
||||||
adjustedFile = downloadFile(listener.file(remote.getName(), remote.getAttributes().getSize()), remote, local);
|
adjustedFile = downloadFile(listener.file(remote.getName(), remote.getAttributes().getSize()), remote, local, byteOffset);
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
throw new IOException(remote + " is not a regular file or directory");
|
throw new IOException(remote + " is not a regular file or directory");
|
||||||
@@ -119,7 +143,7 @@ public class SFTPFileTransfer
|
|||||||
final RemoteDirectory rd = engine.openDir(remote.getPath());
|
final RemoteDirectory rd = engine.openDir(remote.getPath());
|
||||||
try {
|
try {
|
||||||
for (RemoteResourceInfo rri : rd.scan(getDownloadFilter()))
|
for (RemoteResourceInfo rri : rd.scan(getDownloadFilter()))
|
||||||
download(listener, rri, adjusted.getChild(rri.getName()));
|
download(listener, rri, adjusted.getChild(rri.getName()), 0); // not supporting individual byte offsets for these files
|
||||||
} finally {
|
} finally {
|
||||||
rd.close();
|
rd.close();
|
||||||
}
|
}
|
||||||
@@ -128,13 +152,15 @@ public class SFTPFileTransfer
|
|||||||
|
|
||||||
private LocalDestFile downloadFile(final StreamCopier.Listener listener,
|
private LocalDestFile downloadFile(final StreamCopier.Listener listener,
|
||||||
final RemoteResourceInfo remote,
|
final RemoteResourceInfo remote,
|
||||||
final LocalDestFile local)
|
final LocalDestFile local,
|
||||||
|
final long byteOffset)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final LocalDestFile adjusted = local.getTargetFile(remote.getName());
|
final LocalDestFile adjusted = local.getTargetFile(remote.getName());
|
||||||
final RemoteFile rf = engine.open(remote.getPath());
|
final RemoteFile rf = engine.open(remote.getPath());
|
||||||
try {
|
try {
|
||||||
final RemoteFile.ReadAheadRemoteFileInputStream rfis = rf.new ReadAheadRemoteFileInputStream(16);
|
log.debug("Attempting to download {} with offset={}", remote.getPath(), byteOffset);
|
||||||
final OutputStream os = adjusted.getOutputStream();
|
final RemoteFile.ReadAheadRemoteFileInputStream rfis = rf.new ReadAheadRemoteFileInputStream(16, byteOffset);
|
||||||
|
final OutputStream os = adjusted.getOutputStream(byteOffset != 0);
|
||||||
try {
|
try {
|
||||||
new StreamCopier(rfis, os, engine.getLoggerFactory())
|
new StreamCopier(rfis, os, engine.getLoggerFactory())
|
||||||
.bufSize(engine.getSubsystem().getLocalMaxPacketSize())
|
.bufSize(engine.getSubsystem().getLocalMaxPacketSize())
|
||||||
@@ -173,17 +199,17 @@ public class SFTPFileTransfer
|
|||||||
this.remote = remote;
|
this.remote = remote;
|
||||||
}
|
}
|
||||||
|
|
||||||
private void upload(final TransferListener listener) throws IOException {
|
private void upload(final TransferListener listener, long byteOffset) throws IOException {
|
||||||
if (source.isDirectory()) {
|
if (source.isDirectory()) {
|
||||||
makeDirIfNotExists(remote); // Ensure that the directory exists
|
makeDirIfNotExists(remote); // Ensure that the directory exists
|
||||||
uploadDir(listener.directory(source.getName()), source, remote);
|
uploadDir(listener.directory(source.getName()), source, remote);
|
||||||
setAttributes(source, remote);
|
setAttributes(source, remote);
|
||||||
} else if (source.isFile() && isDirectory(remote)) {
|
} else if (source.isFile() && isDirectory(remote)) {
|
||||||
String adjustedRemote = engine.getPathHelper().adjustForParent(this.remote, source.getName());
|
String adjustedRemote = engine.getPathHelper().adjustForParent(this.remote, source.getName());
|
||||||
uploadFile(listener.file(source.getName(), source.getLength()), source, adjustedRemote);
|
uploadFile(listener.file(source.getName(), source.getLength()), source, adjustedRemote, byteOffset);
|
||||||
setAttributes(source, adjustedRemote);
|
setAttributes(source, adjustedRemote);
|
||||||
} else if (source.isFile()) {
|
} else if (source.isFile()) {
|
||||||
uploadFile(listener.file(source.getName(), source.getLength()), source, remote);
|
uploadFile(listener.file(source.getName(), source.getLength()), source, remote, byteOffset);
|
||||||
setAttributes(source, remote);
|
setAttributes(source, remote);
|
||||||
} else {
|
} else {
|
||||||
throw new IOException(source + " is not a file or directory");
|
throw new IOException(source + " is not a file or directory");
|
||||||
@@ -192,13 +218,14 @@ public class SFTPFileTransfer
|
|||||||
|
|
||||||
private void upload(final TransferListener listener,
|
private void upload(final TransferListener listener,
|
||||||
final LocalSourceFile local,
|
final LocalSourceFile local,
|
||||||
final String remote)
|
final String remote,
|
||||||
|
final long byteOffset)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final String adjustedPath;
|
final String adjustedPath;
|
||||||
if (local.isDirectory()) {
|
if (local.isDirectory()) {
|
||||||
adjustedPath = uploadDir(listener.directory(local.getName()), local, remote);
|
adjustedPath = uploadDir(listener.directory(local.getName()), local, remote);
|
||||||
} else if (local.isFile()) {
|
} else if (local.isFile()) {
|
||||||
adjustedPath = uploadFile(listener.file(local.getName(), local.getLength()), local, remote);
|
adjustedPath = uploadFile(listener.file(local.getName(), local.getLength()), local, remote, byteOffset);
|
||||||
} else {
|
} else {
|
||||||
throw new IOException(local + " is not a file or directory");
|
throw new IOException(local + " is not a file or directory");
|
||||||
}
|
}
|
||||||
@@ -217,22 +244,34 @@ public class SFTPFileTransfer
|
|||||||
throws IOException {
|
throws IOException {
|
||||||
makeDirIfNotExists(remote);
|
makeDirIfNotExists(remote);
|
||||||
for (LocalSourceFile f : local.getChildren(getUploadFilter()))
|
for (LocalSourceFile f : local.getChildren(getUploadFilter()))
|
||||||
upload(listener, f, engine.getPathHelper().adjustForParent(remote, f.getName()));
|
upload(listener, f, engine.getPathHelper().adjustForParent(remote, f.getName()), 0); // not supporting individual byte offsets for these files
|
||||||
return remote;
|
return remote;
|
||||||
}
|
}
|
||||||
|
|
||||||
private String uploadFile(final StreamCopier.Listener listener,
|
private String uploadFile(final StreamCopier.Listener listener,
|
||||||
final LocalSourceFile local,
|
final LocalSourceFile local,
|
||||||
final String remote)
|
final String remote,
|
||||||
|
final long byteOffset)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final String adjusted = prepareFile(local, remote);
|
final String adjusted = prepareFile(local, remote, byteOffset);
|
||||||
RemoteFile rf = null;
|
RemoteFile rf = null;
|
||||||
InputStream fis = null;
|
InputStream fis = null;
|
||||||
RemoteFile.RemoteFileOutputStream rfos = null;
|
RemoteFile.RemoteFileOutputStream rfos = null;
|
||||||
|
EnumSet<OpenMode> modes;
|
||||||
try {
|
try {
|
||||||
rf = engine.open(adjusted, EnumSet.of(OpenMode.WRITE, OpenMode.CREAT, OpenMode.TRUNC));
|
if (byteOffset == 0) {
|
||||||
|
// Starting at the beginning, overwrite/create
|
||||||
|
modes = EnumSet.of(OpenMode.WRITE, OpenMode.CREAT, OpenMode.TRUNC);
|
||||||
|
} else {
|
||||||
|
// Starting at some offset, append
|
||||||
|
modes = EnumSet.of(OpenMode.WRITE, OpenMode.APPEND);
|
||||||
|
}
|
||||||
|
|
||||||
|
log.debug("Attempting to upload {} with offset={}", local.getName(), byteOffset);
|
||||||
|
rf = engine.open(adjusted, modes);
|
||||||
fis = local.getInputStream();
|
fis = local.getInputStream();
|
||||||
rfos = rf.new RemoteFileOutputStream(0, 16);
|
fis.skip(byteOffset);
|
||||||
|
rfos = rf.new RemoteFileOutputStream(byteOffset, 16);
|
||||||
new StreamCopier(fis, rfos, engine.getLoggerFactory())
|
new StreamCopier(fis, rfos, engine.getLoggerFactory())
|
||||||
.bufSize(engine.getSubsystem().getRemoteMaxPacketSize() - rf.getOutgoingPacketOverhead())
|
.bufSize(engine.getSubsystem().getRemoteMaxPacketSize() - rf.getOutgoingPacketOverhead())
|
||||||
.keepFlushing(false)
|
.keepFlushing(false)
|
||||||
@@ -294,7 +333,7 @@ public class SFTPFileTransfer
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private String prepareFile(final LocalSourceFile local, final String remote)
|
private String prepareFile(final LocalSourceFile local, final String remote, final long byteOffset)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final FileAttributes attrs;
|
final FileAttributes attrs;
|
||||||
try {
|
try {
|
||||||
@@ -309,7 +348,7 @@ public class SFTPFileTransfer
|
|||||||
if (attrs.getMode().getType() == FileMode.Type.DIRECTORY) {
|
if (attrs.getMode().getType() == FileMode.Type.DIRECTORY) {
|
||||||
throw new IOException("Trying to upload file " + local.getName() + " to path " + remote + " but that is a directory");
|
throw new IOException("Trying to upload file " + local.getName() + " to path " + remote + " but that is a directory");
|
||||||
} else {
|
} else {
|
||||||
log.debug("probeFile: {} is a {} file that will be replaced", remote, attrs.getMode().getType());
|
log.debug("probeFile: {} is a {} file that will be {}", remote, attrs.getMode().getType(), byteOffset > 0 ? "resumed" : "replaced");
|
||||||
return remote;
|
return remote;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,6 +15,8 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.sftp;
|
package net.schmizz.sshj.sftp;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.sftp.RemoteResourceSelector;
|
||||||
|
import net.schmizz.sshj.connection.channel.direct.SessionFactory;
|
||||||
import net.schmizz.sshj.xfer.LocalDestFile;
|
import net.schmizz.sshj.xfer.LocalDestFile;
|
||||||
import net.schmizz.sshj.xfer.LocalSourceFile;
|
import net.schmizz.sshj.xfer.LocalSourceFile;
|
||||||
|
|
||||||
@@ -22,6 +24,8 @@ import java.io.IOException;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
|
import static com.hierynomus.sshj.sftp.RemoteResourceFilterConverter.selectorFrom;
|
||||||
|
|
||||||
public class StatefulSFTPClient
|
public class StatefulSFTPClient
|
||||||
extends SFTPClient {
|
extends SFTPClient {
|
||||||
|
|
||||||
@@ -34,6 +38,12 @@ public class StatefulSFTPClient
|
|||||||
log.debug("Start dir = {}", cwd);
|
log.debug("Start dir = {}", cwd);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public StatefulSFTPClient(SessionFactory sessionFactory) throws IOException {
|
||||||
|
super(sessionFactory);
|
||||||
|
this.cwd = getSFTPEngine().canonicalize(".");
|
||||||
|
log.debug("Start dir = {}", cwd);
|
||||||
|
}
|
||||||
|
|
||||||
private synchronized String cwdify(String path) {
|
private synchronized String cwdify(String path) {
|
||||||
return engine.getPathHelper().adjustForParent(cwd, path);
|
return engine.getPathHelper().adjustForParent(cwd, path);
|
||||||
}
|
}
|
||||||
@@ -50,7 +60,7 @@ public class StatefulSFTPClient
|
|||||||
|
|
||||||
public synchronized List<RemoteResourceInfo> ls()
|
public synchronized List<RemoteResourceInfo> ls()
|
||||||
throws IOException {
|
throws IOException {
|
||||||
return ls(cwd, null);
|
return ls(cwd, RemoteResourceSelector.ALL);
|
||||||
}
|
}
|
||||||
|
|
||||||
public synchronized List<RemoteResourceInfo> ls(RemoteResourceFilter filter)
|
public synchronized List<RemoteResourceInfo> ls(RemoteResourceFilter filter)
|
||||||
@@ -63,20 +73,21 @@ public class StatefulSFTPClient
|
|||||||
return super.canonicalize(cwd);
|
return super.canonicalize(cwd);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
|
||||||
public List<RemoteResourceInfo> ls(String path)
|
public List<RemoteResourceInfo> ls(String path)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
return ls(path, null);
|
return ls(path, RemoteResourceSelector.ALL);
|
||||||
|
}
|
||||||
|
|
||||||
|
public List<RemoteResourceInfo> ls(String path, RemoteResourceFilter filter)
|
||||||
|
throws IOException {
|
||||||
|
return ls(path, selectorFrom(filter));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public List<RemoteResourceInfo> ls(String path, RemoteResourceFilter filter)
|
public List<RemoteResourceInfo> ls(String path, RemoteResourceSelector selector)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
final RemoteDirectory dir = getSFTPEngine().openDir(cwdify(path));
|
try (RemoteDirectory dir = getSFTPEngine().openDir(cwdify(path))) {
|
||||||
try {
|
return dir.scan(selector == null ? RemoteResourceSelector.ALL : selector);
|
||||||
return dir.scan(filter);
|
|
||||||
} finally {
|
|
||||||
dir.close();
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -51,6 +51,14 @@ abstract class Converter {
|
|||||||
return seq;
|
return seq;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
void resetSequenceNumber() {
|
||||||
|
seq = -1;
|
||||||
|
}
|
||||||
|
|
||||||
|
boolean isSequenceNumberAtMax() {
|
||||||
|
return seq == 0xffffffffL;
|
||||||
|
}
|
||||||
|
|
||||||
void setAlgorithms(Cipher cipher, MAC mac, Compression compression) {
|
void setAlgorithms(Cipher cipher, MAC mac, Compression compression) {
|
||||||
this.cipher = cipher;
|
this.cipher = cipher;
|
||||||
this.mac = mac;
|
this.mac = mac;
|
||||||
|
|||||||
@@ -60,6 +60,10 @@ final class KeyExchanger
|
|||||||
|
|
||||||
private final AtomicBoolean kexOngoing = new AtomicBoolean();
|
private final AtomicBoolean kexOngoing = new AtomicBoolean();
|
||||||
|
|
||||||
|
private final AtomicBoolean initialKex = new AtomicBoolean(true);
|
||||||
|
|
||||||
|
private final AtomicBoolean strictKex = new AtomicBoolean();
|
||||||
|
|
||||||
/** What we are expecting from the next packet */
|
/** What we are expecting from the next packet */
|
||||||
private Expected expected = Expected.KEXINIT;
|
private Expected expected = Expected.KEXINIT;
|
||||||
|
|
||||||
@@ -123,6 +127,14 @@ final class KeyExchanger
|
|||||||
return kexOngoing.get();
|
return kexOngoing.get();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
boolean isStrictKex() {
|
||||||
|
return strictKex.get();
|
||||||
|
}
|
||||||
|
|
||||||
|
boolean isInitialKex() {
|
||||||
|
return initialKex.get();
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Starts key exchange by sending a {@code SSH_MSG_KEXINIT} packet. Key exchange needs to be done once mandatorily
|
* Starts key exchange by sending a {@code SSH_MSG_KEXINIT} packet. Key exchange needs to be done once mandatorily
|
||||||
* after initializing the {@link Transport} for it to be usable and may be initiated at any later point e.g. if
|
* after initializing the {@link Transport} for it to be usable and may be initiated at any later point e.g. if
|
||||||
@@ -136,13 +148,25 @@ final class KeyExchanger
|
|||||||
void startKex(boolean waitForDone)
|
void startKex(boolean waitForDone)
|
||||||
throws TransportException {
|
throws TransportException {
|
||||||
if (!kexOngoing.getAndSet(true)) {
|
if (!kexOngoing.getAndSet(true)) {
|
||||||
done.clear();
|
if (isKeyExchangeAllowed()) {
|
||||||
sendKexInit();
|
log.debug("Initiating key exchange");
|
||||||
|
done.clear();
|
||||||
|
sendKexInit();
|
||||||
|
} else {
|
||||||
|
kexOngoing.set(false);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
if (waitForDone)
|
if (waitForDone)
|
||||||
waitForDone();
|
waitForDone();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Key exchange can be initiated exactly once while connecting or later after authentication when re-keying.
|
||||||
|
*/
|
||||||
|
private boolean isKeyExchangeAllowed() {
|
||||||
|
return !isKexDone() || transport.isAuthenticated();
|
||||||
|
}
|
||||||
|
|
||||||
void waitForDone()
|
void waitForDone()
|
||||||
throws TransportException {
|
throws TransportException {
|
||||||
done.await(transport.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
done.await(transport.getTimeoutMs(), TimeUnit.MILLISECONDS);
|
||||||
@@ -171,7 +195,7 @@ final class KeyExchanger
|
|||||||
throws TransportException {
|
throws TransportException {
|
||||||
log.debug("Sending SSH_MSG_KEXINIT");
|
log.debug("Sending SSH_MSG_KEXINIT");
|
||||||
List<String> knownHostAlgs = findKnownHostAlgs(transport.getRemoteHost(), transport.getRemotePort());
|
List<String> knownHostAlgs = findKnownHostAlgs(transport.getRemoteHost(), transport.getRemotePort());
|
||||||
clientProposal = new Proposal(transport.getConfig(), knownHostAlgs);
|
clientProposal = new Proposal(transport.getConfig(), knownHostAlgs, initialKex.get());
|
||||||
transport.write(clientProposal.getPacket());
|
transport.write(clientProposal.getPacket());
|
||||||
kexInitSent.set();
|
kexInitSent.set();
|
||||||
}
|
}
|
||||||
@@ -190,6 +214,9 @@ final class KeyExchanger
|
|||||||
throws TransportException {
|
throws TransportException {
|
||||||
log.debug("Sending SSH_MSG_NEWKEYS");
|
log.debug("Sending SSH_MSG_NEWKEYS");
|
||||||
transport.write(new SSHPacket(Message.NEWKEYS));
|
transport.write(new SSHPacket(Message.NEWKEYS));
|
||||||
|
if (strictKex.get()) {
|
||||||
|
transport.getEncoder().resetSequenceNumber();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -222,6 +249,10 @@ final class KeyExchanger
|
|||||||
|
|
||||||
private void setKexDone() {
|
private void setKexDone() {
|
||||||
kexOngoing.set(false);
|
kexOngoing.set(false);
|
||||||
|
initialKex.set(false);
|
||||||
|
if (strictKex.get()) {
|
||||||
|
transport.getDecoder().resetSequenceNumber();
|
||||||
|
}
|
||||||
kexInitSent.clear();
|
kexInitSent.clear();
|
||||||
done.set();
|
done.set();
|
||||||
}
|
}
|
||||||
@@ -230,6 +261,7 @@ final class KeyExchanger
|
|||||||
throws TransportException {
|
throws TransportException {
|
||||||
buf.rpos(buf.rpos() - 1);
|
buf.rpos(buf.rpos() - 1);
|
||||||
final Proposal serverProposal = new Proposal(buf);
|
final Proposal serverProposal = new Proposal(buf);
|
||||||
|
gotStrictKexInfo(serverProposal);
|
||||||
negotiatedAlgs = clientProposal.negotiate(serverProposal);
|
negotiatedAlgs = clientProposal.negotiate(serverProposal);
|
||||||
log.debug("Negotiated algorithms: {}", negotiatedAlgs);
|
log.debug("Negotiated algorithms: {}", negotiatedAlgs);
|
||||||
for(AlgorithmsVerifier v: algorithmVerifiers) {
|
for(AlgorithmsVerifier v: algorithmVerifiers) {
|
||||||
@@ -243,7 +275,6 @@ final class KeyExchanger
|
|||||||
negotiatedAlgs.getKeyExchangeAlgorithm());
|
negotiatedAlgs.getKeyExchangeAlgorithm());
|
||||||
transport.setHostKeyAlgorithm(Factory.Named.Util.create(transport.getConfig().getKeyAlgorithms(),
|
transport.setHostKeyAlgorithm(Factory.Named.Util.create(transport.getConfig().getKeyAlgorithms(),
|
||||||
negotiatedAlgs.getSignatureAlgorithm()));
|
negotiatedAlgs.getSignatureAlgorithm()));
|
||||||
transport.setRSASHA2Support(negotiatedAlgs.getRSASHA2Support());
|
|
||||||
|
|
||||||
try {
|
try {
|
||||||
kex.init(transport,
|
kex.init(transport,
|
||||||
@@ -254,6 +285,18 @@ final class KeyExchanger
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private void gotStrictKexInfo(Proposal serverProposal) throws TransportException {
|
||||||
|
if (initialKex.get() && serverProposal.isStrictKeyExchangeSupportedByServer()) {
|
||||||
|
strictKex.set(true);
|
||||||
|
log.debug("Enabling strict key exchange extension");
|
||||||
|
if (transport.getDecoder().getSequenceNumber() != 0) {
|
||||||
|
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||||
|
"SSH_MSG_KEXINIT was not first package during strict key exchange"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Private method used while putting new keys into use that will resize the key used to initialize the cipher to the
|
* Private method used while putting new keys into use that will resize the key used to initialize the cipher to the
|
||||||
* needed length.
|
* needed length.
|
||||||
|
|||||||
@@ -26,10 +26,8 @@ public final class NegotiatedAlgorithms {
|
|||||||
private final String c2sComp;
|
private final String c2sComp;
|
||||||
private final String s2cComp;
|
private final String s2cComp;
|
||||||
|
|
||||||
private final boolean rsaSHA2Support;
|
|
||||||
|
|
||||||
NegotiatedAlgorithms(String kex, String sig, String c2sCipher, String s2cCipher, String c2sMAC, String s2cMAC,
|
NegotiatedAlgorithms(String kex, String sig, String c2sCipher, String s2cCipher, String c2sMAC, String s2cMAC,
|
||||||
String c2sComp, String s2cComp, boolean rsaSHA2Support) {
|
String c2sComp, String s2cComp) {
|
||||||
this.kex = kex;
|
this.kex = kex;
|
||||||
this.sig = sig;
|
this.sig = sig;
|
||||||
this.c2sCipher = c2sCipher;
|
this.c2sCipher = c2sCipher;
|
||||||
@@ -38,7 +36,6 @@ public final class NegotiatedAlgorithms {
|
|||||||
this.s2cMAC = s2cMAC;
|
this.s2cMAC = s2cMAC;
|
||||||
this.c2sComp = c2sComp;
|
this.c2sComp = c2sComp;
|
||||||
this.s2cComp = s2cComp;
|
this.s2cComp = s2cComp;
|
||||||
this.rsaSHA2Support = rsaSHA2Support;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
public String getKeyExchangeAlgorithm() {
|
public String getKeyExchangeAlgorithm() {
|
||||||
@@ -73,10 +70,6 @@ public final class NegotiatedAlgorithms {
|
|||||||
return s2cComp;
|
return s2cComp;
|
||||||
}
|
}
|
||||||
|
|
||||||
public boolean getRSASHA2Support() {
|
|
||||||
return rsaSHA2Support;
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public String toString() {
|
public String toString() {
|
||||||
return ("[ " +
|
return ("[ " +
|
||||||
@@ -88,7 +81,6 @@ public final class NegotiatedAlgorithms {
|
|||||||
"s2cMAC=" + s2cMAC + "; " +
|
"s2cMAC=" + s2cMAC + "; " +
|
||||||
"c2sComp=" + c2sComp + "; " +
|
"c2sComp=" + c2sComp + "; " +
|
||||||
"s2cComp=" + s2cComp + "; " +
|
"s2cComp=" + s2cComp + "; " +
|
||||||
"rsaSHA2Support=" + rsaSHA2Support +
|
|
||||||
" ]");
|
" ]");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -15,7 +15,6 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.transport;
|
package net.schmizz.sshj.transport;
|
||||||
|
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
|
||||||
import net.schmizz.sshj.Config;
|
import net.schmizz.sshj.Config;
|
||||||
import net.schmizz.sshj.common.Buffer;
|
import net.schmizz.sshj.common.Buffer;
|
||||||
import net.schmizz.sshj.common.Factory;
|
import net.schmizz.sshj.common.Factory;
|
||||||
@@ -38,8 +37,11 @@ class Proposal {
|
|||||||
private final List<String> s2cComp;
|
private final List<String> s2cComp;
|
||||||
private final SSHPacket packet;
|
private final SSHPacket packet;
|
||||||
|
|
||||||
public Proposal(Config config, List<String> knownHostAlgs) {
|
public Proposal(Config config, List<String> knownHostAlgs, boolean initialKex) {
|
||||||
kex = Factory.Named.Util.getNames(config.getKeyExchangeFactories());
|
kex = Factory.Named.Util.getNames(config.getKeyExchangeFactories());
|
||||||
|
if (initialKex) {
|
||||||
|
kex.add("kex-strict-c-v00@openssh.com");
|
||||||
|
}
|
||||||
sig = filterKnownHostKeyAlgorithms(Factory.Named.Util.getNames(config.getKeyAlgorithms()), knownHostAlgs);
|
sig = filterKnownHostKeyAlgorithms(Factory.Named.Util.getNames(config.getKeyAlgorithms()), knownHostAlgs);
|
||||||
c2sCipher = s2cCipher = Factory.Named.Util.getNames(config.getCipherFactories());
|
c2sCipher = s2cCipher = Factory.Named.Util.getNames(config.getCipherFactories());
|
||||||
c2sMAC = s2cMAC = Factory.Named.Util.getNames(config.getMACFactories());
|
c2sMAC = s2cMAC = Factory.Named.Util.getNames(config.getMACFactories());
|
||||||
@@ -92,6 +94,10 @@ class Proposal {
|
|||||||
return kex;
|
return kex;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public boolean isStrictKeyExchangeSupportedByServer() {
|
||||||
|
return kex.contains("kex-strict-s-v00@openssh.com");
|
||||||
|
}
|
||||||
|
|
||||||
public List<String> getHostKeyAlgorithms() {
|
public List<String> getHostKeyAlgorithms() {
|
||||||
return sig;
|
return sig;
|
||||||
}
|
}
|
||||||
@@ -140,8 +146,8 @@ class Proposal {
|
|||||||
firstMatch("Client2ServerCompressionAlgorithms", this.getClient2ServerCompressionAlgorithms(),
|
firstMatch("Client2ServerCompressionAlgorithms", this.getClient2ServerCompressionAlgorithms(),
|
||||||
other.getClient2ServerCompressionAlgorithms()),
|
other.getClient2ServerCompressionAlgorithms()),
|
||||||
firstMatch("Server2ClientCompressionAlgorithms", this.getServer2ClientCompressionAlgorithms(),
|
firstMatch("Server2ClientCompressionAlgorithms", this.getServer2ClientCompressionAlgorithms(),
|
||||||
other.getServer2ClientCompressionAlgorithms()),
|
other.getServer2ClientCompressionAlgorithms())
|
||||||
other.getHostKeyAlgorithms().containsAll(KeyAlgorithms.SSH_RSA_SHA2_ALGORITHMS));
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
private List<String> filterKnownHostKeyAlgorithms(List<String> configuredKeyAlgorithms, List<String> knownHostKeyAlgorithms) {
|
private List<String> filterKnownHostKeyAlgorithms(List<String> configuredKeyAlgorithms, List<String> knownHostKeyAlgorithms) {
|
||||||
|
|||||||
@@ -29,7 +29,7 @@ public final class Reader
|
|||||||
public Reader(TransportImpl trans) {
|
public Reader(TransportImpl trans) {
|
||||||
this.trans = trans;
|
this.trans = trans;
|
||||||
log = trans.getConfig().getLoggerFactory().getLogger(getClass());
|
log = trans.getConfig().getLoggerFactory().getLogger(getClass());
|
||||||
setName("reader");
|
setName("sshj-Reader");
|
||||||
setDaemon(true);
|
setDaemon(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -15,6 +15,7 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.transport;
|
package net.schmizz.sshj.transport;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.common.RemoteAddressProvider;
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithm;
|
import com.hierynomus.sshj.key.KeyAlgorithm;
|
||||||
import net.schmizz.sshj.Config;
|
import net.schmizz.sshj.Config;
|
||||||
import net.schmizz.sshj.Service;
|
import net.schmizz.sshj.Service;
|
||||||
@@ -27,11 +28,12 @@ import net.schmizz.sshj.transport.verification.HostKeyVerifier;
|
|||||||
|
|
||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.io.OutputStream;
|
import java.io.OutputStream;
|
||||||
|
import java.util.List;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
|
|
||||||
/** Transport layer of the SSH protocol. */
|
/** Transport layer of the SSH protocol. */
|
||||||
public interface Transport
|
public interface Transport
|
||||||
extends SSHPacketHandler {
|
extends SSHPacketHandler, RemoteAddressProvider {
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the host information and the streams to be used by this transport. Identification information is exchanged
|
* Sets the host information and the streams to be used by this transport. Identification information is exchanged
|
||||||
@@ -208,7 +210,7 @@ public interface Transport
|
|||||||
/**
|
/**
|
||||||
* Specify a {@code listener} that will be notified upon disconnection.
|
* Specify a {@code listener} that will be notified upon disconnection.
|
||||||
*
|
*
|
||||||
* @param listener
|
* @param listener Disconnect Listener to be configured
|
||||||
*/
|
*/
|
||||||
void setDisconnectListener(DisconnectListener listener);
|
void setDisconnectListener(DisconnectListener listener);
|
||||||
|
|
||||||
@@ -223,5 +225,5 @@ public interface Transport
|
|||||||
void die(Exception e);
|
void die(Exception e);
|
||||||
|
|
||||||
KeyAlgorithm getHostKeyAlgorithm();
|
KeyAlgorithm getHostKeyAlgorithm();
|
||||||
KeyAlgorithm getClientKeyAlgorithm(KeyType keyType) throws TransportException;
|
List<KeyAlgorithm> getClientKeyAlgorithms(KeyType keyType) throws TransportException;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,6 +15,7 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.transport;
|
package net.schmizz.sshj.transport;
|
||||||
|
|
||||||
|
import com.hierynomus.sshj.common.ThreadNameProvider;
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithm;
|
import com.hierynomus.sshj.key.KeyAlgorithm;
|
||||||
import com.hierynomus.sshj.key.KeyAlgorithms;
|
import com.hierynomus.sshj.key.KeyAlgorithms;
|
||||||
import com.hierynomus.sshj.transport.IdentificationStringParser;
|
import com.hierynomus.sshj.transport.IdentificationStringParser;
|
||||||
@@ -22,7 +23,6 @@ import net.schmizz.concurrent.ErrorDeliveryUtil;
|
|||||||
import net.schmizz.concurrent.Event;
|
import net.schmizz.concurrent.Event;
|
||||||
import net.schmizz.sshj.AbstractService;
|
import net.schmizz.sshj.AbstractService;
|
||||||
import net.schmizz.sshj.Config;
|
import net.schmizz.sshj.Config;
|
||||||
import net.schmizz.sshj.SSHClient;
|
|
||||||
import net.schmizz.sshj.Service;
|
import net.schmizz.sshj.Service;
|
||||||
import net.schmizz.sshj.common.*;
|
import net.schmizz.sshj.common.*;
|
||||||
import net.schmizz.sshj.transport.verification.AlgorithmsVerifier;
|
import net.schmizz.sshj.transport.verification.AlgorithmsVerifier;
|
||||||
@@ -32,6 +32,8 @@ import org.slf4j.Logger;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.io.OutputStream;
|
import java.io.OutputStream;
|
||||||
|
import java.net.InetSocketAddress;
|
||||||
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.concurrent.TimeUnit;
|
import java.util.concurrent.TimeUnit;
|
||||||
import java.util.concurrent.locks.ReentrantLock;
|
import java.util.concurrent.locks.ReentrantLock;
|
||||||
@@ -86,8 +88,6 @@ public final class TransportImpl
|
|||||||
|
|
||||||
private KeyAlgorithm hostKeyAlgorithm;
|
private KeyAlgorithm hostKeyAlgorithm;
|
||||||
|
|
||||||
private boolean rsaSHA2Support;
|
|
||||||
|
|
||||||
private final Event<TransportException> serviceAccept;
|
private final Event<TransportException> serviceAccept;
|
||||||
|
|
||||||
private final Event<TransportException> close;
|
private final Event<TransportException> close;
|
||||||
@@ -130,8 +130,8 @@ public final class TransportImpl
|
|||||||
public TransportImpl(Config config) {
|
public TransportImpl(Config config) {
|
||||||
this.config = config;
|
this.config = config;
|
||||||
this.loggerFactory = config.getLoggerFactory();
|
this.loggerFactory = config.getLoggerFactory();
|
||||||
this.serviceAccept = new Event<TransportException>("service accept", TransportException.chainer, loggerFactory);
|
this.serviceAccept = new Event<>("service accept", TransportException.chainer, loggerFactory);
|
||||||
this.close = new Event<TransportException>("transport close", TransportException.chainer, loggerFactory);
|
this.close = new Event<>("transport close", TransportException.chainer, loggerFactory);
|
||||||
this.nullService = new NullService(this);
|
this.nullService = new NullService(this);
|
||||||
this.service = nullService;
|
this.service = nullService;
|
||||||
this.log = loggerFactory.getLogger(getClass());
|
this.log = loggerFactory.getLogger(getClass());
|
||||||
@@ -165,9 +165,20 @@ public final class TransportImpl
|
|||||||
throw new TransportException(e);
|
throw new TransportException(e);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
ThreadNameProvider.setThreadName(reader, this);
|
||||||
reader.start();
|
reader.start();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get Remote Socket Address using Connection Information
|
||||||
|
*
|
||||||
|
* @return Remote Socket Address or null when not connected
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public InetSocketAddress getRemoteSocketAddress() {
|
||||||
|
return connInfo == null ? null : new InetSocketAddress(getRemoteHost(), getRemotePort());
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* TransportImpl implements its own default DisconnectListener.
|
* TransportImpl implements its own default DisconnectListener.
|
||||||
*/
|
*/
|
||||||
@@ -211,7 +222,7 @@ public final class TransportImpl
|
|||||||
*
|
*
|
||||||
* @param buffer The buffer to read from.
|
* @param buffer The buffer to read from.
|
||||||
* @return empty string if full ident string has not yet been received
|
* @return empty string if full ident string has not yet been received
|
||||||
* @throws IOException
|
* @throws IOException Thrown when protocol version is not supported
|
||||||
*/
|
*/
|
||||||
private String readIdentification(Buffer.PlainBuffer buffer)
|
private String readIdentification(Buffer.PlainBuffer buffer)
|
||||||
throws IOException {
|
throws IOException {
|
||||||
@@ -409,13 +420,13 @@ public final class TransportImpl
|
|||||||
try {
|
try {
|
||||||
|
|
||||||
if (kexer.isKexOngoing()) {
|
if (kexer.isKexOngoing()) {
|
||||||
// Only transport layer packets (1 to 49) allowed except SERVICE_REQUEST
|
// Only transport layer packets (1 to 49) allowed except SERVICE_REQUEST and IGNORE
|
||||||
final Message m = Message.fromByte(payload.array()[payload.rpos()]);
|
final Message m = Message.fromByte(payload.array()[payload.rpos()]);
|
||||||
if (!m.in(1, 49) || m == Message.SERVICE_REQUEST) {
|
if (!m.in(1, 49) || m == Message.SERVICE_REQUEST || m == Message.IGNORE) {
|
||||||
assert m != Message.KEXINIT;
|
assert m != Message.KEXINIT;
|
||||||
kexer.waitForDone();
|
kexer.waitForDone();
|
||||||
}
|
}
|
||||||
} else if (encoder.getSequenceNumber() == 0) // We get here every 2**32th packet
|
} else if (encoder.isSequenceNumberAtMax()) // We get here every 2**32th packet
|
||||||
kexer.startKex(true);
|
kexer.startKex(true);
|
||||||
|
|
||||||
final long seq = encoder.encode(payload);
|
final long seq = encoder.encode(payload);
|
||||||
@@ -468,9 +479,20 @@ public final class TransportImpl
|
|||||||
|
|
||||||
log.trace("Received packet {}", msg);
|
log.trace("Received packet {}", msg);
|
||||||
|
|
||||||
|
if (kexer.isInitialKex()) {
|
||||||
|
if (decoder.isSequenceNumberAtMax()) {
|
||||||
|
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||||
|
"Sequence number of decoder is about to wrap during initial key exchange");
|
||||||
|
}
|
||||||
|
if (kexer.isStrictKex() && !isKexerPacket(msg) && msg != Message.DISCONNECT) {
|
||||||
|
throw new TransportException(DisconnectReason.KEY_EXCHANGE_FAILED,
|
||||||
|
"Unexpected packet type during initial strict key exchange");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
if (msg.geq(50)) { // not a transport layer packet
|
if (msg.geq(50)) { // not a transport layer packet
|
||||||
service.handle(msg, buf);
|
service.handle(msg, buf);
|
||||||
} else if (msg.in(20, 21) || msg.in(30, 49)) { // kex packet
|
} else if (isKexerPacket(msg)) {
|
||||||
kexer.handle(msg, buf);
|
kexer.handle(msg, buf);
|
||||||
} else {
|
} else {
|
||||||
switch (msg) {
|
switch (msg) {
|
||||||
@@ -502,6 +524,10 @@ public final class TransportImpl
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private static boolean isKexerPacket(Message msg) {
|
||||||
|
return msg.in(20, 21) || msg.in(30, 49);
|
||||||
|
}
|
||||||
|
|
||||||
private void gotDebug(SSHPacket buf)
|
private void gotDebug(SSHPacket buf)
|
||||||
throws TransportException {
|
throws TransportException {
|
||||||
try {
|
try {
|
||||||
@@ -544,7 +570,7 @@ public final class TransportImpl
|
|||||||
* Got an SSH_MSG_UNIMPLEMENTED, so lets see where we're at and act accordingly.
|
* Got an SSH_MSG_UNIMPLEMENTED, so lets see where we're at and act accordingly.
|
||||||
*
|
*
|
||||||
* @param packet The 'unimplemented' packet received
|
* @param packet The 'unimplemented' packet received
|
||||||
* @throws TransportException
|
* @throws TransportException Thrown when key exchange is ongoing
|
||||||
*/
|
*/
|
||||||
private void gotUnimplemented(SSHPacket packet)
|
private void gotUnimplemented(SSHPacket packet)
|
||||||
throws SSHException {
|
throws SSHException {
|
||||||
@@ -626,21 +652,19 @@ public final class TransportImpl
|
|||||||
return this.hostKeyAlgorithm;
|
return this.hostKeyAlgorithm;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void setRSASHA2Support(boolean rsaSHA2Support) {
|
|
||||||
this.rsaSHA2Support = rsaSHA2Support;
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public KeyAlgorithm getClientKeyAlgorithm(KeyType keyType) throws TransportException {
|
public List<KeyAlgorithm> getClientKeyAlgorithms(KeyType keyType) throws TransportException {
|
||||||
if (keyType != KeyType.RSA || !rsaSHA2Support) {
|
|
||||||
return Factory.Named.Util.create(getConfig().getKeyAlgorithms(), keyType.toString());
|
|
||||||
}
|
|
||||||
|
|
||||||
List<Factory.Named<KeyAlgorithm>> factories = getConfig().getKeyAlgorithms();
|
List<Factory.Named<KeyAlgorithm>> factories = getConfig().getKeyAlgorithms();
|
||||||
|
List<KeyAlgorithm> available = new ArrayList<>();
|
||||||
if (factories != null)
|
if (factories != null)
|
||||||
for (Factory.Named<KeyAlgorithm> f : factories)
|
for (Factory.Named<KeyAlgorithm> f : factories)
|
||||||
if (f.getName().equals("ssh-rsa") || KeyAlgorithms.SSH_RSA_SHA2_ALGORITHMS.contains(f.getName()))
|
if (
|
||||||
return f.create();
|
f instanceof KeyAlgorithms.Factory && ((KeyAlgorithms.Factory) f).getKeyType().equals(keyType)
|
||||||
throw new TransportException("Cannot find an available KeyAlgorithm for type " + keyType);
|
|| !(f instanceof KeyAlgorithms.Factory) && f.getName().equals(keyType.toString())
|
||||||
|
)
|
||||||
|
available.add(f.create());
|
||||||
|
if (available.isEmpty())
|
||||||
|
throw new TransportException("Cannot find an available KeyAlgorithm for type " + keyType);
|
||||||
|
return available;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,18 +15,15 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.transport.compression;
|
package net.schmizz.sshj.transport.compression;
|
||||||
|
|
||||||
import com.jcraft.jzlib.Deflater;
|
import java.util.zip.DataFormatException;
|
||||||
import com.jcraft.jzlib.GZIPException;
|
import java.util.zip.Deflater;
|
||||||
import com.jcraft.jzlib.Inflater;
|
import java.util.zip.Inflater;
|
||||||
import com.jcraft.jzlib.JZlib;
|
|
||||||
import net.schmizz.sshj.common.Buffer;
|
import net.schmizz.sshj.common.Buffer;
|
||||||
import net.schmizz.sshj.common.DisconnectReason;
|
import net.schmizz.sshj.common.DisconnectReason;
|
||||||
import net.schmizz.sshj.common.SSHRuntimeException;
|
|
||||||
import net.schmizz.sshj.transport.TransportException;
|
import net.schmizz.sshj.transport.TransportException;
|
||||||
|
|
||||||
/** ZLib based Compression. */
|
public class ZlibCompression implements Compression {
|
||||||
public class ZlibCompression
|
|
||||||
implements Compression {
|
|
||||||
|
|
||||||
/** Named factory for the ZLib Compression. */
|
/** Named factory for the ZLib Compression. */
|
||||||
public static class Factory
|
public static class Factory
|
||||||
@@ -52,19 +49,15 @@ public class ZlibCompression
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void init(Mode mode) {
|
public void init(Mode mode) {
|
||||||
try {
|
switch (mode) {
|
||||||
switch (mode) {
|
case DEFLATE:
|
||||||
case DEFLATE:
|
deflater = new Deflater(Deflater.DEFAULT_COMPRESSION);
|
||||||
deflater = new Deflater(JZlib.Z_DEFAULT_COMPRESSION);
|
break;
|
||||||
break;
|
case INFLATE:
|
||||||
case INFLATE:
|
inflater = new Inflater();
|
||||||
inflater = new Inflater();
|
break;
|
||||||
break;
|
default:
|
||||||
default:
|
assert false;
|
||||||
assert false;
|
|
||||||
}
|
|
||||||
} catch (GZIPException gze) {
|
|
||||||
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -75,43 +68,32 @@ public class ZlibCompression
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void compress(Buffer buffer) {
|
public void compress(Buffer buffer) {
|
||||||
deflater.setNextIn(buffer.array());
|
deflater.setInput(buffer.array(), buffer.rpos(), buffer.available());
|
||||||
deflater.setNextInIndex(buffer.rpos());
|
|
||||||
deflater.setAvailIn(buffer.available());
|
|
||||||
buffer.wpos(buffer.rpos());
|
buffer.wpos(buffer.rpos());
|
||||||
do {
|
while (true) {
|
||||||
deflater.setNextOut(tempBuf);
|
final int len = deflater.deflate(tempBuf, 0, BUF_SIZE, Deflater.SYNC_FLUSH);
|
||||||
deflater.setNextOutIndex(0);
|
if(len > 0) {
|
||||||
deflater.setAvailOut(BUF_SIZE);
|
buffer.putRawBytes(tempBuf, 0, len);
|
||||||
final int status = deflater.deflate(JZlib.Z_PARTIAL_FLUSH);
|
|
||||||
if (status == JZlib.Z_OK) {
|
|
||||||
buffer.putRawBytes(tempBuf, 0, BUF_SIZE - deflater.getAvailOut());
|
|
||||||
} else {
|
} else {
|
||||||
throw new SSHRuntimeException("compress: deflate returned " + status);
|
return;
|
||||||
}
|
}
|
||||||
} while (deflater.getAvailOut() == 0);
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public void uncompress(Buffer from, Buffer to)
|
public void uncompress(Buffer from, Buffer to)
|
||||||
throws TransportException {
|
throws TransportException {
|
||||||
inflater.setNextIn(from.array());
|
inflater.setInput(from.array(), from.rpos(), from.available());
|
||||||
inflater.setNextInIndex(from.rpos());
|
|
||||||
inflater.setAvailIn(from.available());
|
|
||||||
while (true) {
|
while (true) {
|
||||||
inflater.setNextOut(tempBuf);
|
try {
|
||||||
inflater.setNextOutIndex(0);
|
int len = inflater.inflate(tempBuf, 0, BUF_SIZE);
|
||||||
inflater.setAvailOut(BUF_SIZE);
|
if(len > 0) {
|
||||||
final int status = inflater.inflate(JZlib.Z_PARTIAL_FLUSH);
|
to.putRawBytes(tempBuf, 0, len);
|
||||||
switch (status) {
|
} else {
|
||||||
case JZlib.Z_OK:
|
|
||||||
to.putRawBytes(tempBuf, 0, BUF_SIZE - inflater.getAvailOut());
|
|
||||||
break;
|
|
||||||
case JZlib.Z_BUF_ERROR:
|
|
||||||
return;
|
return;
|
||||||
default:
|
}
|
||||||
throw new TransportException(DisconnectReason.COMPRESSION_ERROR, "uncompress: inflate returned " + status);
|
} catch (DataFormatException e) {
|
||||||
|
throw new TransportException(DisconnectReason.COMPRESSION_ERROR, "uncompress: inflate returned " + e.getMessage());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -15,50 +15,91 @@
|
|||||||
*/
|
*/
|
||||||
package net.schmizz.sshj.transport.kex;
|
package net.schmizz.sshj.transport.kex;
|
||||||
|
|
||||||
import com.hierynomus.sshj.common.KeyAlgorithm;
|
|
||||||
import net.schmizz.sshj.common.Factory;
|
import net.schmizz.sshj.common.Factory;
|
||||||
|
import net.schmizz.sshj.common.SecurityUtils;
|
||||||
import net.schmizz.sshj.transport.random.Random;
|
import net.schmizz.sshj.transport.random.Random;
|
||||||
import org.bouncycastle.asn1.x9.X9ECParameters;
|
|
||||||
import org.bouncycastle.crypto.ec.CustomNamedCurves;
|
|
||||||
import org.bouncycastle.jce.spec.ECParameterSpec;
|
|
||||||
|
|
||||||
import java.math.BigInteger;
|
import java.math.BigInteger;
|
||||||
import java.security.GeneralSecurityException;
|
import java.security.GeneralSecurityException;
|
||||||
|
import java.security.KeyFactory;
|
||||||
|
import java.security.KeyPair;
|
||||||
|
import java.security.PublicKey;
|
||||||
import java.security.spec.AlgorithmParameterSpec;
|
import java.security.spec.AlgorithmParameterSpec;
|
||||||
import java.util.Arrays;
|
import java.security.spec.KeySpec;
|
||||||
|
import java.security.spec.X509EncodedKeySpec;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Key Exchange Method using Curve25519 as defined in RFC 8731
|
||||||
|
*/
|
||||||
public class Curve25519DH extends DHBase {
|
public class Curve25519DH extends DHBase {
|
||||||
|
|
||||||
private byte[] secretKey;
|
private static final String ALGORITHM = "X25519";
|
||||||
|
|
||||||
|
private static final int KEY_LENGTH = 32;
|
||||||
|
|
||||||
|
private int encodedKeyLength;
|
||||||
|
|
||||||
|
private int algorithmIdLength;
|
||||||
|
|
||||||
|
// Algorithm Identifier is set on Key Agreement Initialization
|
||||||
|
private byte[] algorithmId = new byte[KEY_LENGTH];
|
||||||
|
|
||||||
public Curve25519DH() {
|
public Curve25519DH() {
|
||||||
super(KeyAlgorithm.ECDSA, "ECDH");
|
super(ALGORITHM, ALGORITHM);
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
void computeK(byte[] f) throws GeneralSecurityException {
|
|
||||||
byte[] k = new byte[32];
|
|
||||||
djb.Curve25519.curve(k, secretKey, f);
|
|
||||||
setK(new BigInteger(1, k));
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public void init(AlgorithmParameterSpec params, Factory<Random> randomFactory) throws GeneralSecurityException {
|
|
||||||
Random random = randomFactory.create();
|
|
||||||
byte[] secretBytes = new byte[32];
|
|
||||||
random.fill(secretBytes);
|
|
||||||
byte[] publicBytes = new byte[32];
|
|
||||||
djb.Curve25519.keygen(publicBytes, null, secretBytes);
|
|
||||||
this.secretKey = Arrays.copyOf(secretBytes, secretBytes.length);
|
|
||||||
setE(publicBytes);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* TODO want to figure out why BouncyCastle does not work.
|
* Compute Shared Secret Key using Diffie-Hellman Curve25519 known as X25519
|
||||||
* @return The initialized curve25519 parameter spec
|
*
|
||||||
|
* @param peerPublicKey Peer public key bytes
|
||||||
|
* @throws GeneralSecurityException Thrown on key agreement failures
|
||||||
*/
|
*/
|
||||||
public static AlgorithmParameterSpec getCurve25519Params() {
|
@Override
|
||||||
X9ECParameters ecP = CustomNamedCurves.getByName("curve25519");
|
void computeK(final byte[] peerPublicKey) throws GeneralSecurityException {
|
||||||
return new ECParameterSpec(ecP.getCurve(), ecP.getG(), ecP.getN(), ecP.getH(), ecP.getSeed());
|
final KeyFactory keyFactory = SecurityUtils.getKeyFactory(ALGORITHM);
|
||||||
|
final KeySpec peerPublicKeySpec = getPeerPublicKeySpec(peerPublicKey);
|
||||||
|
final PublicKey generatedPeerPublicKey = keyFactory.generatePublic(peerPublicKeySpec);
|
||||||
|
|
||||||
|
agreement.doPhase(generatedPeerPublicKey, true);
|
||||||
|
final byte[] sharedSecretKey = agreement.generateSecret();
|
||||||
|
final BigInteger sharedSecretNumber = new BigInteger(BigInteger.ONE.signum(), sharedSecretKey);
|
||||||
|
setK(sharedSecretNumber);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Initialize Key Agreement with generated Public and Private Key Pair
|
||||||
|
*
|
||||||
|
* @param params Parameters not used
|
||||||
|
* @param randomFactory Random Factory not used
|
||||||
|
* @throws GeneralSecurityException Thrown on key agreement initialization failures
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public void init(final AlgorithmParameterSpec params, final Factory<Random> randomFactory) throws GeneralSecurityException {
|
||||||
|
final KeyPair keyPair = generator.generateKeyPair();
|
||||||
|
agreement.init(keyPair.getPrivate());
|
||||||
|
setPublicKey(keyPair.getPublic());
|
||||||
|
}
|
||||||
|
|
||||||
|
private void setPublicKey(final PublicKey publicKey) {
|
||||||
|
final byte[] encoded = publicKey.getEncoded();
|
||||||
|
|
||||||
|
// Set key and algorithm identifier lengths based on initialized Public Key
|
||||||
|
encodedKeyLength = encoded.length;
|
||||||
|
algorithmIdLength = encodedKeyLength - KEY_LENGTH;
|
||||||
|
algorithmId = new byte[algorithmIdLength];
|
||||||
|
|
||||||
|
// Encoded public key consists of the algorithm identifier and public key
|
||||||
|
final byte[] publicKeyEncoded = new byte[KEY_LENGTH];
|
||||||
|
System.arraycopy(encoded, algorithmIdLength, publicKeyEncoded, 0, KEY_LENGTH);
|
||||||
|
setE(publicKeyEncoded);
|
||||||
|
|
||||||
|
// Save Algorithm Identifier byte array
|
||||||
|
System.arraycopy(encoded, 0, algorithmId, 0, algorithmIdLength);
|
||||||
|
}
|
||||||
|
|
||||||
|
private KeySpec getPeerPublicKeySpec(final byte[] peerPublicKey) {
|
||||||
|
final byte[] encodedKeySpec = new byte[encodedKeyLength];
|
||||||
|
System.arraycopy(algorithmId, 0, encodedKeySpec, 0, algorithmIdLength);
|
||||||
|
System.arraycopy(peerPublicKey, 0, encodedKeySpec, algorithmIdLength, KEY_LENGTH);
|
||||||
|
return new X509EncodedKeySpec(encodedKeySpec);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user